Compare commits

..

8 Commits

Author SHA1 Message Date
Jim Han
8a647c1d8e Update config.yaml 2021-03-20 18:22:06 +08:00
Jim Han
ea3be76fd5 Add links 2021-03-16 19:25:42 +08:00
秋のかえで
7abb02ab44 Chore: add issues config (#344) 2021-03-07 14:09:59 +08:00
JimhHan
18574aca47 Fix: grammar
Co-Authored-By: R3pl4c3r <30682790+R3pl4c3r@users.noreply.github.com>
2021-03-07 12:56:52 +08:00
JimhHan
769bed9dbc Update issue templates
Co-Authored-By: 惜别 <realsekibetu@gmail.com>
Co-Authored-By: R3pl4c3r <30682790+R3pl4c3r@users.noreply.github.com>
2021-03-07 12:51:54 +08:00
JimhHan
1233bd5031 Chore: issue templates
Co-Authored-By: 惜别 <realsekibetu@gmail.com>
2021-03-06 22:01:06 +08:00
JimhHan
039c8e63e7 Add: Issue templates 2021-03-06 21:06:58 +08:00
Jim Han
29db059a87 Create: Bug report(zh-CN) template 2021-03-06 16:34:05 +08:00
588 changed files with 9669 additions and 28091 deletions

92
.github/ISSUE_TEMPLATE/bug-en.md vendored Normal file
View File

@@ -0,0 +1,92 @@
---
name: Bug Report
about: Create a bug report of Xray.
title: '[Bug] <bug you are reporting>'
labels: ''
assignees: ''
---
<!-- Thanks for your reporting.
1. Please make sure you are submitting a bug of Xray-Core instead of acquiring usage or bug in third-party programs. If you are not sure, please contact us in our official Telegram group.
2. Bug: **An error, flaw or fault in a program ** that causes it to produce an incorrect or unexpected result. (Reference: Wikipedia)
3. Please check existing Issues and Discussions first and read the documentation in detail. Duplicated issues will be closed.
4. Please don't report issue like "I can't use a feature". It's probably your own mistake.
5. You should fully complete the following contents or this issue may not be handled.
6. Please *make sure* the content you are submitting does not contain your private information.
-->
**Describe the bug**
<!-- A clear and concise description of what the bug is. -->
**To Reproduce**
<!-- Steps to reproduce the bug: -->
1.
2.
3.
4.
**Expected behavior**
<!-- A clear and concise description of what you expected to happen. -->
**Client Log**
<details>
```
Please paste your client log here:
```
</details>
**Server Log**
<details>
```
Please paste your server log here:
```
</details>
**Client config**
<details>
```json
Please paste your client config file here:
```
</details>
**Server Config**
<details>
```json
Please paste your server config file here:
```
</details>
**Client Information**
- OS: [e.g. Windows 10]
- Xray version [e.g. 1.3.1]
- Xray installing approach[e.g. Xray-install]
**Server Information**
- OS: [e.g. Windows 10]
- Xray version [e.g. 1.3.1]
- Xray installing approach[e.g. Xray-install]
**Additional Information**
<!-- Add any other information about the problem here. -->

91
.github/ISSUE_TEMPLATE/bug-zh-CN.md vendored Normal file
View File

@@ -0,0 +1,91 @@
---
name: Bug 反馈
about: 这是 Xray 的一个 bug。
title: '[Bug] 你发现的bug'
labels: ''
assignees: ''
---
<!-- 感谢您的反馈!
1. 请先确认您提交的是 Xray-Core 的 Bug而非使用咨询抑或是第三方程序的 Bug。如果您不确定请在 Telegram 群中反馈。
2. Bug软件运行中因为 **程序本身有错误** 而造成的功能不正常。(Reference: Wikipedia)
3. 请先查询已有的 Issues 与 Discussions ,并且详细阅读文档的相关内容。如果您提出的是已知的问题,此 issue 将有可能被关闭。
4. 请不要轻易提出类似“不能使用某功能”的问题。这往往是你自己的问题。
5. 您需要完整地完成下列内容,否则此 issue 可能不会被处理。
6. *务必* 确保不包含任何个人隐私信息。
-->
**问题描述**
<!-- 请清晰简洁地描述此问题。-->
**复现方式**
<!-- 复现此步骤的过程: -->
1.
2.
3.
4.
**预期行为**
<!-- 请清晰简洁地描述您期望的的行为。-->
**客户端日志**
<details>
```
请删除此行,并在此处粘贴客户端日志
```
</details>
**服务端日志**
<details>
```
请删除此行,并在此处粘贴服务端日志
```
</details>
**客户端配置**
<details>
```json
请删除此行,并在此处粘贴客户端配置
```
</details>
**服务端配置**
<details>
```json
请删除此行,并在此处粘贴服务端日志
```
</details>
**客户端环境**
- 系统与版本: [如 Windows 10]
- Xray 版本 [如 1.3.1]
- Xray 安装方式:[如 Xray-install]
**服务端环境**
- 系统与版本: [如 Windows 10]
- Xray 版本 [如 1.3.1]
- Xray 安装方式:[如 Xray-install]
**附加信息**
<!-- 如果您有额外的信息,请在此处说明。-->

9
.github/ISSUE_TEMPLATE/config.yaml vendored Normal file
View File

@@ -0,0 +1,9 @@
contact_links:
- name: 加入 Telegram 群组 / Join Telegram Group
url: https://t.me/projectXray
- name: 官方文档 / Official Document
url: https://xtls.github.io/
- name: 安装脚本 / Installing Script
url: https://github.com/XTLS/Xray-install
- name: 示例配置 / Example Config
url: https://github.com/XTLS/Xray-examples

32
.github/ISSUE_TEMPLATE/feature-en.md vendored Normal file
View File

@@ -0,0 +1,32 @@
---
name: Feature Request
about: Suggest an idea for Xray
title: '[Feature] your idea'
labels: ''
assignees: ''
---
<!-- Thanks for your support!
1. Please confirm that you are submitting a feature request.
2. We do not recommend any inexperienced users to request a new feature.
3. Please check existing Issues and Discussions first and read the documentation in detail. Duplicated issues will be closed
4. To be clear: none of developers is obliged to meet your needs. In particular, features that do not make any sense.
5. You should fully complete the following contents.
-->
**What's your idea**
<!-- A clear and concise description of your idea. -->
**Is it related to an issue?**
<!-- Please specify here if yes. -->
**What's your solution?**
<!-- Describe the solution you'd like. -->
1.
2.
3.
4.
**Is there any additional information?**
<!-- Add any other information here. -->

32
.github/ISSUE_TEMPLATE/feature-zh-CN.md vendored Normal file
View File

@@ -0,0 +1,32 @@
---
name: 功能请求
about: 希望 Xray 添加一个新功能。
title: '[Feature] 你的想法'
labels: ''
assignees: ''
---
<!-- 感谢您的反馈!
1. 请先确认您提交的是功能请求。
2. 我们不建议缺少经验的用户提出功能请求。
3. 请先查询已有的 Issues 与 Discussions ,并且详细阅读文档的相关内容。重复的 issue 将有可能被关闭。
4. 需要向您明确一点:任何开发者均没有义务满足您的需求。特别是不合理或没有意义的功能。
5. 您需要完整地完成下列内容,否则此 issue 可能不会被处理。
-->
**您的想法是什么?**
<!-- 请清晰简洁地描述您预期中的功能。-->
**是否与已知的 issue 相关?**
<!-- 如果是,请在此注明 -->
**您认为应如何实现此功能?**
<!-- 请清晰简洁地描述如何实现此功能。-->
1.
2.
3.
4.
**有没有额外的信息?**
<!-- 如果您有额外的信息,请在此处说明。-->

17
.github/ISSUE_TEMPLATE/question-en.md vendored Normal file
View File

@@ -0,0 +1,17 @@
---
name: Question
about: Question of Xray.
title: ''
labels: ''
assignees: ''
---
<!-- Thanks for your support
1. Issue is **NOT** a proper place to ask a question, otherwise your issue may be closed.
2. Please check existing Issues, Discussions and documentation in detail first. You may find the answers you want before you ask the question.
3. If it is still not resolved, please give feedback in the our official Telegram group or Discussions.
4. Wherever you ask a question, please *make sure* the content does not contain your private information.
5. We highly recommend you to read https://github.com/tvvocold/How-To-Ask-Questions-The-Smart-Way.
-->

View File

@@ -0,0 +1,17 @@
---
name: 使用疑问
about: 使用 Xray 时的疑问。
title: ''
labels: ''
assignees: ''
---
<!-- 感谢您的支持!
1. Issue **不是**用来提问的, 否则将可能会被 close。
2. 请先查询已有的 issue、discussion ,并且详细阅读文档的相关内容。那里可能有您需要的答案。
3. 如果仍未解决,请在官方 Telegram 群中或 Discussion 区反馈。
4. 无论在何处提问,请 *务必确保* 其不包含任何个人隐私信息。
5. 我们强烈推荐您阅读 https://github.com/tvvocold/How-To-Ask-Questions-The-Smart-Way。
-->

View File

@@ -2,6 +2,7 @@
"android-arm64": { "friendlyName": "android-arm64-v8a" },
"darwin-amd64": { "friendlyName": "macos-64" },
"darwin-arm64": { "friendlyName": "macos-arm64-v8a" },
"dragonfly-amd64": { "friendlyName": "dragonfly-64" },
"freebsd-386": { "friendlyName": "freebsd-32" },
"freebsd-amd64": { "friendlyName": "freebsd-64" },
"freebsd-arm64": { "friendlyName": "freebsd-arm64-v8a" },
@@ -21,7 +22,6 @@
"linux-ppc64le": { "friendlyName": "linux-ppc64le" },
"linux-ppc64": { "friendlyName": "linux-ppc64" },
"linux-riscv64": { "friendlyName": "linux-riscv64" },
"linux-loong64": { "friendlyName": "linux-loong64" },
"linux-s390x": { "friendlyName": "linux-s390x" },
"openbsd-386": { "friendlyName": "openbsd-32" },
"openbsd-amd64": { "friendlyName": "openbsd-64" },
@@ -29,6 +29,5 @@
"openbsd-arm7": { "friendlyName": "openbsd-arm32-v7a" },
"windows-386": { "friendlyName": "windows-32" },
"windows-amd64": { "friendlyName": "windows-64" },
"windows-arm64": { "friendlyName": "windows-arm64-v8a" },
"windows-arm7": { "friendlyName": "windows-arm32-v7a" }
}

View File

@@ -1,15 +0,0 @@
# To get started with Dependabot version updates, you'll need to specify which
# package ecosystems to update and where the package manifests are located.
# Please see the documentation for all configuration options:
# https://help.github.com/github/administering-a-repository/configuration-options-for-dependency-updates
version: 2
updates:
- package-ecosystem: "gomod"
directory: "/" # Location of package manifests
schedule:
interval: "daily"
- package-ecosystem: "github-actions"
directory: "/"
schedule:
interval: "daily"

View File

@@ -1,22 +0,0 @@
# syntax=docker/dockerfile:1
FROM --platform=$BUILDPLATFORM golang:alpine AS build
WORKDIR /src
COPY . .
ARG TARGETOS TARGETARCH
RUN GOOS=$TARGETOS GOARCH=$TARGETARCH CGO_ENABLED=0 go build -o xray -trimpath -ldflags "-s -w -buildid=" ./main
FROM --platform=${TARGETPLATFORM} alpine:latest
WORKDIR /root
COPY .github/docker/files/config.json /etc/xray/config.json
COPY --from=build /src/xray /usr/bin/xray
RUN set -ex \
&& apk add --no-cache tzdata ca-certificates \
&& mkdir -p /var/log/xray /usr/share/xray \
&& chmod +x /usr/bin/xray \
&& wget -O /usr/share/xray/geosite.dat https://github.com/Loyalsoldier/v2ray-rules-dat/releases/latest/download/geosite.dat \
&& wget -O /usr/share/xray/geoip.dat https://github.com/Loyalsoldier/v2ray-rules-dat/releases/latest/download/geoip.dat
VOLUME /etc/xray
ENV TZ=Asia/Shanghai
ENTRYPOINT [ "/usr/bin/xray" ]
CMD [ "-config", "/etc/xray/config.json" ]

View File

@@ -1,18 +0,0 @@
{
"inbounds": [{
"port": 9000,
"protocol": "vmess",
"settings": {
"clients": [
{
"id": "1eb6e917-774b-4a84-aff6-b058577c60a5",
"level": 1
}
]
}
}],
"outbounds": [{
"protocol": "freedom",
"settings": {}
}]
}

View File

@@ -1,45 +0,0 @@
name: Build docker image
on:
push:
branches:
- main
jobs:
build-image:
runs-on: ubuntu-latest
permissions:
packages: write
steps:
- uses: actions/checkout@v4
- name: Docker metadata
id: meta
uses: docker/metadata-action@v5
with:
images: ghcr.io/${{ github.repository_owner }}/xray-core
flavor: latest=true
tags: |
type=ref,event=branch
type=ref,event=pr
type=semver,pattern={{version}}
- name: Login to GitHub Container Registry
uses: docker/login-action@v3
with:
registry: ghcr.io
username: ${{ github.repository_owner }}
password: ${{ secrets.GITHUB_TOKEN }}
- # Add support for more platforms with QEMU (optional)
# https://github.com/docker/setup-qemu-action
name: Set up QEMU
uses: docker/setup-qemu-action@v3
- name: Set up Docker Buildx
uses: docker/setup-buildx-action@v3
- name: Build and push
uses: docker/build-push-action@v5
with:
context: .
platforms: linux/amd64,linux/arm64
file: .github/docker/Dockerfile
push: true
tags: ${{ steps.meta.outputs.tags }}
labels: ${{ steps.meta.outputs.labels }}

View File

@@ -20,60 +20,16 @@ on:
- "go.sum"
- ".github/workflows/*.yml"
jobs:
prepare:
runs-on: ubuntu-latest
steps:
- name: Restore Cache
uses: actions/cache/restore@v3
with:
path: resources
key: xray-geodat-
- name: Update Geodat
id: update
uses: nick-fields/retry@v2
with:
timeout_minutes: 60
retry_wait_seconds: 60
max_attempts: 60
command: |
[ -d 'resources' ] || mkdir resources
LIST=('geoip geoip geoip' 'domain-list-community dlc geosite')
for i in "${LIST[@]}"
do
INFO=($(echo $i | awk 'BEGIN{FS=" ";OFS=" "} {print $1,$2,$3}'))
FILE_NAME="${INFO[2]}.dat"
echo -e "Verifying HASH key..."
HASH="$(curl -sL "https://raw.githubusercontent.com/v2fly/${INFO[0]}/release/${INFO[1]}.dat.sha256sum" | awk -F ' ' '{print $1}')"
if [ -s "./resources/${FILE_NAME}" ] && [ "$(sha256sum "./resources/${FILE_NAME}" | awk -F ' ' '{print $1}')" == "${HASH}" ]; then
continue
else
echo -e "Downloading https://raw.githubusercontent.com/v2fly/${INFO[0]}/release/${INFO[1]}.dat..."
curl -L "https://raw.githubusercontent.com/v2fly/${INFO[0]}/release/${INFO[1]}.dat" -o ./resources/${FILE_NAME}
echo -e "Verifying HASH key..."
[ "$(sha256sum "./resources/${FILE_NAME}" | awk -F ' ' '{print $1}')" == "${HASH}" ] || { echo -e "The HASH key of ${FILE_NAME} does not match cloud one."; exit 1; }
echo "unhit=true" >> $GITHUB_OUTPUT
fi
done
- name: Save Cache
uses: actions/cache/save@v3
if: ${{ steps.update.outputs.unhit }}
with:
path: resources
key: xray-geodat-${{ github.sha }}-${{ github.run_number }}
build:
needs: prepare
permissions:
contents: write
strategy:
matrix:
# Include amd64 on all platforms.
goos: [windows, freebsd, openbsd, linux, darwin]
goos: [windows, freebsd, openbsd, linux, dragonfly, darwin]
goarch: [amd64, 386]
exclude:
# Exclude i386 on darwin
# Exclude i386 on darwin and dragonfly.
- goarch: 386
goos: dragonfly
- goarch: 386
goos: darwin
include:
@@ -96,21 +52,17 @@ jobs:
- goos: android
goarch: arm64
# END Android ARM 8
# Windows ARM
- goos: windows
goarch: arm64
# Windows ARM 7
- goos: windows
goarch: arm
goarm: 7
# BEGIN Other architectures
# BEGIN riscv64 & ARM64 & LOONG64
# BEGIN riscv64 & ARM64
- goos: linux
goarch: arm64
- goos: linux
goarch: riscv64
- goos: linux
goarch: loong64
# END riscv64 & ARM64 & LOONG64
# END riscv64 & ARM64
# BEGIN MIPS
- goos: linux
goarch: mips64
@@ -156,49 +108,75 @@ jobs:
CGO_ENABLED: 0
steps:
- name: Checkout codebase
uses: actions/checkout@v4
uses: actions/checkout@v2
- name: Show workflow information
id: get_filename
run: |
export _NAME=$(jq ".[\"$GOOS-$GOARCH$GOARM$GOMIPS\"].friendlyName" -r < .github/build/friendly-filenames.json)
echo "GOOS: $GOOS, GOARCH: $GOARCH, GOARM: $GOARM, GOMIPS: $GOMIPS, RELEASE_NAME: $_NAME"
echo "::set-output name=ASSET_NAME::$_NAME"
echo "ASSET_NAME=$_NAME" >> $GITHUB_ENV
- name: Set up Go
uses: actions/setup-go@v5
uses: actions/setup-go@v2
with:
go-version: '1.21'
check-latest: true
go-version: ^1.16
- name: Get project dependencies
run: go mod download
- name: Replace Custom to Commit ID
if: github.event_name != 'release'
run: |
ID=$(git rev-parse --short ${{ github.sha }})
if [ "${{ github.event_name }}" == 'pull_request' ]
then
ID=$(git rev-parse --short ${{ github.event.pull_request.head.sha }})
fi
sed -i '/build/ s/Custom/'$ID'/' ./core/core.go
- name: Build Xray
run: |
mkdir -p build_assets
make
find . -maxdepth 1 -type f -regex '.*\(wxray\|xray\|xray_softfloat\)\(\|.exe\)' -exec mv {} ./build_assets/ \;
- name: Restore Cache
uses: actions/cache/restore@v3
with:
path: resources
key: xray-geodat-
- name: Copy README.md & LICENSE
go build -v -o build_assets/xray -trimpath -ldflags "-s -w -buildid=" ./main
- name: Build Mips softfloat Xray
if: matrix.goarch == 'mips' || matrix.goarch == 'mipsle'
run: |
GOMIPS=softfloat go build -v -o build_assets/xray_softfloat -trimpath -ldflags "-s -w -buildid=" ./main
- name: Rename Windows Xray
if: matrix.goos == 'windows'
run: |
cd ./build_assets || exit 1
mv xray xray.exe
- name: Prepare to release
run: |
mv -f resources/* build_assets
cp ${GITHUB_WORKSPACE}/README.md ./build_assets/README.md
cp ${GITHUB_WORKSPACE}/LICENSE ./build_assets/LICENSE
LIST=('geoip geoip geoip' 'domain-list-community dlc geosite')
for i in "${LIST[@]}"
do
INFO=($(echo $i | awk 'BEGIN{FS=" ";OFS=" "} {print $1,$2,$3}'))
LASTEST_TAG="$(curl -sL "https://api.github.com/repos/v2fly/${INFO[0]}/releases" | jq -r ".[0].tag_name" || echo "latest")"
FILE_NAME="${INFO[2]}.dat"
echo -e "Downloading ${FILE_NAME}..."
curl -L "https://github.com/v2fly/${INFO[0]}/releases/download/${LASTEST_TAG}/${INFO[1]}.dat" -o ./build_assets/${FILE_NAME}
echo -e "Verifying HASH key..."
HASH="$(curl -sL "https://github.com/v2fly/${INFO[0]}/releases/download/${LASTEST_TAG}/${INFO[1]}.dat.sha256sum" | awk -F ' ' '{print $1}')"
[ "$(sha256sum "./build_assets/${FILE_NAME}" | awk -F ' ' '{print $1}')" == "${HASH}" ] || { echo -e "The HASH key of ${FILE_NAME} does not match cloud one."; exit 1; }
done
- name: Create ZIP archive
shell: bash
run: |
pushd build_assets || exit 1
touch -mt $(date +%Y01010000) *
zip -9vr ../Xray-${{ env.ASSET_NAME }}.zip .
zip -9vr ../Xray-$ASSET_NAME.zip .
popd || exit 1
FILE=./Xray-${{ env.ASSET_NAME }}.zip
FILE=./Xray-$ASSET_NAME.zip
DGST=$FILE.dgst
for METHOD in {"md5","sha1","sha256","sha512"}
do
@@ -207,20 +185,20 @@ jobs:
- name: Change the name
run: |
mv build_assets Xray-${{ env.ASSET_NAME }}
mv build_assets Xray-$ASSET_NAME
- name: Upload files to Artifacts
uses: actions/upload-artifact@v4
uses: actions/upload-artifact@v2
with:
name: Xray-${{ env.ASSET_NAME }}
name: Xray-${{ steps.get_filename.outputs.ASSET_NAME }}
path: |
./Xray-${{ env.ASSET_NAME }}/*
./Xray-${{ steps.get_filename.outputs.ASSET_NAME }}/*
- name: Upload binaries to release
uses: svenstaro/upload-release-action@v2
if: github.event_name == 'release'
with:
repo_token: ${{ secrets.GITHUB_TOKEN }}
file: ./Xray-${{ env.ASSET_NAME }}.zip*
file: ./Xray-${{ steps.get_filename.outputs.ASSET_NAME }}.zip*
tag: ${{ github.ref }}
file_glob: true

View File

@@ -19,8 +19,6 @@ on:
jobs:
test:
permissions:
contents: read
runs-on: ${{ matrix.os }}
strategy:
fail-fast: false
@@ -28,17 +26,23 @@ jobs:
os: [windows-latest, ubuntu-latest, macos-latest]
steps:
- name: Set up Go
uses: actions/setup-go@v5
uses: actions/setup-go@v2
with:
go-version: '1.21'
check-latest: true
go-version: ^1.16
- name: Checkout codebase
uses: actions/checkout@v4
- name: Restore Cache
uses: actions/cache/restore@v3
with:
path: resources
key: xray-geodat-
enableCrossOsArchive: true
uses: actions/checkout@v2
- name: Prepare geo*dat
if: ${{ matrix.os != 'windows-latest' }}
run: |
mkdir resources
wget -O ./resources/geoip.dat https://github.com/v2fly/geoip/releases/latest/download/geoip.dat
wget -O ./resources/geosite.dat https://github.com/v2fly/domain-list-community/releases/latest/download/dlc.dat
- name: Prepare geo*dat for Windows
if: ${{ matrix.os == 'windows-latest' }}
run: |
mkdir resources
Invoke-WebRequest -Uri "https://github.com/v2fly/geoip/releases/latest/download/geoip.dat" -OutFile "./resources/geoip.dat"
Invoke-WebRequest -Uri "https://github.com/v2fly/domain-list-community/releases/latest/download/dlc.dat" -OutFile "./resources/geosite.dat"
- name: Test
run: go test -timeout 1h -v ./...

30
.gitignore vendored
View File

@@ -1,30 +0,0 @@
# Binaries for programs and plugins
*.exe
*.exe~
*.dll
*.so
*.dylib
# Test binary, built with `go test -c`
*.test
# Output of the go coverage tool, specifically when used with LiteIDE
*.out
# Dependency directories (remove the comment below to include it)
# vendor/
*.DS_Store
.idea
*.zip
*.tar.gz
xray
xray_softfloat
mockgen
vprotogen
!infra/vprotogen/
errorgen
!common/errors/errorgen/
*.dat
.vscode
/build_assets

View File

@@ -1,128 +0,0 @@
# Contributor Covenant Code of Conduct
## Our Pledge
We as members, contributors, and leaders pledge to make participation in our
community a harassment-free experience for everyone, regardless of age, body
size, visible or invisible disability, ethnicity, sex characteristics, gender
identity and expression, level of experience, education, socio-economic status,
nationality, personal appearance, race, religion, or sexual identity
and orientation.
We pledge to act and interact in ways that contribute to an open, welcoming,
diverse, inclusive, and healthy community.
## Our Standards
Examples of behavior that contributes to a positive environment for our
community include:
* Demonstrating empathy and kindness toward other people
* Being respectful of differing opinions, viewpoints, and experiences
* Giving and gracefully accepting constructive feedback
* Accepting responsibility and apologizing to those affected by our mistakes,
and learning from the experience
* Focusing on what is best not just for us as individuals, but for the
overall community
Examples of unacceptable behavior include:
* The use of sexualized language or imagery, and sexual attention or
advances of any kind
* Trolling, insulting or derogatory comments, and personal or political attacks
* Public or private harassment
* Publishing others' private information, such as a physical or email
address, without their explicit permission
* Other conduct which could reasonably be considered inappropriate in a
professional setting
## Enforcement Responsibilities
Community leaders are responsible for clarifying and enforcing our standards of
acceptable behavior and will take appropriate and fair corrective action in
response to any behavior that they deem inappropriate, threatening, offensive,
or harmful.
Community leaders have the right and responsibility to remove, edit, or reject
comments, commits, code, wiki edits, issues, and other contributions that are
not aligned to this Code of Conduct, and will communicate reasons for moderation
decisions when appropriate.
## Scope
This Code of Conduct applies within all community spaces, and also applies when
an individual is officially representing the community in public spaces.
Examples of representing our community include using an official e-mail address,
posting via an official social media account, or acting as an appointed
representative at an online or offline event.
## Enforcement
Instances of abusive, harassing, or otherwise unacceptable behavior may be
reported to the community leaders responsible for enforcement at
https://t.me/projectXtls.
All complaints will be reviewed and investigated promptly and fairly.
All community leaders are obligated to respect the privacy and security of the
reporter of any incident.
## Enforcement Guidelines
Community leaders will follow these Community Impact Guidelines in determining
the consequences for any action they deem in violation of this Code of Conduct:
### 1. Correction
**Community Impact**: Use of inappropriate language or other behavior deemed
unprofessional or unwelcome in the community.
**Consequence**: A private, written warning from community leaders, providing
clarity around the nature of the violation and an explanation of why the
behavior was inappropriate. A public apology may be requested.
### 2. Warning
**Community Impact**: A violation through a single incident or series
of actions.
**Consequence**: A warning with consequences for continued behavior. No
interaction with the people involved, including unsolicited interaction with
those enforcing the Code of Conduct, for a specified period of time. This
includes avoiding interactions in community spaces as well as external channels
like social media. Violating these terms may lead to a temporary or
permanent ban.
### 3. Temporary Ban
**Community Impact**: A serious violation of community standards, including
sustained inappropriate behavior.
**Consequence**: A temporary ban from any sort of interaction or public
communication with the community for a specified period of time. No public or
private interaction with the people involved, including unsolicited interaction
with those enforcing the Code of Conduct, is allowed during this period.
Violating these terms may lead to a permanent ban.
### 4. Permanent Ban
**Community Impact**: Demonstrating a pattern of violation of community
standards, including sustained inappropriate behavior, harassment of an
individual, or aggression toward or disparagement of classes of individuals.
**Consequence**: A permanent ban from any sort of public interaction within
the community.
## Attribution
This Code of Conduct is adapted from the [Contributor Covenant][homepage],
version 2.0, available at
https://www.contributor-covenant.org/version/2/0/code_of_conduct.html.
Community Impact Guidelines were inspired by [Mozilla's code of conduct
enforcement ladder](https://github.com/mozilla/diversity).
[homepage]: https://www.contributor-covenant.org
For answers to common questions about this code of conduct, see the FAQ at
https://www.contributor-covenant.org/faq. Translations are available at
https://www.contributor-covenant.org/translations.

View File

@@ -1,29 +0,0 @@
NAME = xray
VERSION=$(shell git describe --always --dirty)
LDFLAGS = -X github.com/xtls/xray-core/core.build=$(VERSION) -s -w -buildid=
PARAMS = -trimpath -ldflags "$(LDFLAGS)" -v
MAIN = ./main
PREFIX ?= $(shell go env GOPATH)
ifeq ($(GOOS),windows)
OUTPUT = $(NAME).exe
ADDITION = go build -o w$(NAME).exe -trimpath -ldflags "-H windowsgui $(LDFLAGS)" -v $(MAIN)
else
OUTPUT = $(NAME)
endif
ifeq ($(shell echo "$(GOARCH)" | grep -Pq "(mips|mipsle)" && echo true),true) #
ADDITION = GOMIPS=softfloat go build -o $(NAME)_softfloat -trimpath -ldflags "$(LDFLAGS)" -v $(MAIN)
endif
.PHONY: clean
build:
go build -o $(OUTPUT) $(PARAMS) $(MAIN)
$(ADDITION)
install:
go build -o $(PREFIX)/bin/$(OUTPUT) $(PARAMS) $(MAIN)
clean:
go clean -v -i $(PWD)
rm -f xray xray.exe wxray.exe xray_softfloat

186
README.md
View File

@@ -1,16 +1,81 @@
# Project X
[Project X](https://github.com/XTLS) originates from XTLS protocol, providing a set of network tools such as [Xray-core](https://github.com/XTLS/Xray-core) and [REALITY](https://github.com/XTLS/REALITY).
[README](https://github.com/XTLS/Xray-core#readme) is open, so feel free to submit your project [here](https://github.com/XTLS/Xray-core/pulls).
[Project X](https://github.com/XTLS) originates from XTLS protocol, provides a set of network tools such as [Xray-core](https://github.com/XTLS/Xray-core) and [Xray-flutter](https://github.com/XTLS/Xray-flutter).
## License
[Mozilla Public License Version 2.0](https://github.com/XTLS/Xray-core/blob/main/LICENSE)
## Documentation
## Installation
[Project X Official Website](https://xtls.github.io)
- Linux Script
- [Xray-install](https://github.com/XTLS/Xray-install)
- [Xray-script](https://github.com/kirin10000/Xray-script)
- Docker
- [teddysun/xray](https://hub.docker.com/r/teddysun/xray)
- Xray-docker
- One Click
- [ProxySU](https://github.com/proxysu/ProxySU)
- [v2ray-agent](https://github.com/mack-a/v2ray-agent)
- [Xray-yes](https://github.com/jiuqi9997/Xray-yes)
- [Xray_onekey](https://github.com/wulabing/Xray_onekey)
- Magisk
- [Xray4Magisk](https://github.com/CerteKim/Xray4Magisk)
- [Xray_For_Magisk](https://github.com/E7KMbb/Xray_For_Magisk)
- Homebrew
- [Repository 0](https://github.com/N4FA/homebrew-xray)
- [Repository 1](https://github.com/xiruizhao/homebrew-xray)
## Usage
[Xray-examples](https://github.com/XTLS/Xray-examples) / [VLESS-TCP-XTLS-WHATEVER](https://github.com/XTLS/Xray-examples/tree/main/VLESS-TCP-XTLS-WHATEVER)
## GUI Clients
- OpenWrt
- [PassWall](https://github.com/xiaorouji/openwrt-passwall)
- [Hello World](https://github.com/jerrykuku/luci-app-vssr)
- [ShadowSocksR Plus+](https://github.com/fw876/helloworld)
- [luci-app-xray](https://github.com/yichya/luci-app-xray) ([openwrt-xray](https://github.com/yichya/openwrt-xray))
- Windows
- [v2rayN](https://github.com/2dust/v2rayN)
- [Qv2ray](https://github.com/Qv2ray/Qv2ray)
- [Netch (NetFilter & TUN/TAP)](https://github.com/NetchX/Netch)
- Android
- [v2rayNG](https://github.com/2dust/v2rayNG)
- [Kitsunebi](https://github.com/rurirei/Kitsunebi/tree/release_xtls)
- iOS / Mac
- [Shadowrocket](https://apps.apple.com/app/shadowrocket/id932747118)
## Credits
This repo relies on the following third-party projects:
- Special thanks:
- [v2fly/v2ray-core](https://github.com/v2fly/v2ray-core)
- In production:
- [gorilla/websocket](https://github.com/gorilla/websocket)
- [lucas-clemente/quic-go](https://github.com/lucas-clemente/quic-go)
- [pires/go-proxyproto](https://github.com/pires/go-proxyproto)
- [seiflotfy/cuckoofilter](https://github.com/seiflotfy/cuckoofilter)
- [google/starlark-go](https://github.com/google/starlark-go)
- For testing only:
- [miekg/dns](https://github.com/miekg/dns)
- [h12w/socks](https://github.com/h12w/socks)
## Compilation
### Windows
```
go build -o xray.exe -trimpath -ldflags "-s -w -buildid=" ./main
```
### Linux / macOS
```
go build -o xray -trimpath -ldflags "-s -w -buildid=" ./main
```
## Telegram
@@ -18,117 +83,6 @@
[Project X Channel](https://t.me/projectXtls)
## Installation
- Linux Script
- [XTLS/Xray-install](https://github.com/XTLS/Xray-install)
- Docker
- Official: [ghcr.io/xtls/xray-core](https://ghcr.io/xtls/xray-core)
- [iamybj/docker-xray](https://hub.docker.com/r/iamybj/docker-xray)
- [teddysun/xray](https://hub.docker.com/r/teddysun/xray)
- Web Panel
- [X-UI-English](https://github.com/NidukaAkalanka/x-ui-english), [3X-UI](https://github.com/MHSanaei/3x-ui), [X-UI](https://github.com/alireza0/x-ui), [X-UI](https://github.com/diditra/x-ui)
- [Xray-UI](https://github.com/qist/xray-ui), [X-UI](https://github.com/sing-web/x-ui)
- [Hiddify](https://github.com/hiddify/hiddify-config)
- [Marzban](https://github.com/Gozargah/Marzban)
- [Libertea](https://github.com/VZiChoushaDui/Libertea)
- One Click
- [Xray-REALITY](https://github.com/zxcvos/Xray-script), [xray-reality](https://github.com/sajjaddg/xray-reality), [reality-ezpz](https://github.com/aleskxyz/reality-ezpz)
- [Xray-script](https://github.com/kirin10000/Xray-script), [Xray_bash_onekey](https://github.com/hello-yunshu/Xray_bash_onekey), [XTool](https://github.com/LordPenguin666/XTool)
- [v2ray-agent](https://github.com/mack-a/v2ray-agent), [Xray_onekey](https://github.com/wulabing/Xray_onekey), [ProxySU](https://github.com/proxysu/ProxySU)
- Magisk
- [Xray4Magisk](https://github.com/Asterisk4Magisk/Xray4Magisk)
- [Xray_For_Magisk](https://github.com/E7KMbb/Xray_For_Magisk)
- Homebrew
- `brew install xray`
## Usage
- Example
- [VLESS-XTLS-uTLS-REALITY](https://github.com/XTLS/REALITY#readme)
- [VLESS-TCP-XTLS-Vision](https://github.com/XTLS/Xray-examples/tree/main/VLESS-TCP-XTLS-Vision)
- [All-in-One-fallbacks-Nginx](https://github.com/XTLS/Xray-examples/tree/main/All-in-One-fallbacks-Nginx)
- Xray-examples
- [XTLS/Xray-examples](https://github.com/XTLS/Xray-examples)
- [chika0801/Xray-examples](https://github.com/chika0801/Xray-examples)
- [lxhao61/integrated-examples](https://github.com/lxhao61/integrated-examples)
- Tutorial
- [XTLS Vision](https://github.com/chika0801/Xray-install)
- [REALITY (English)](https://cscot.pages.dev/2023/03/02/Xray-REALITY-tutorial/)
- [XTLS-Iran-Reality (English)](https://github.com/SasukeFreestyle/XTLS-Iran-Reality)
- [Xray REALITY with 'steal oneself' (English)](https://computerscot.github.io/vless-xtls-utls-reality-steal-oneself.html)
- [Xray with WireGuard inbound (English)](https://g800.pages.dev/wireguard)
## GUI Clients
- OpenWrt
- [PassWall](https://github.com/xiaorouji/openwrt-passwall), [PassWall 2](https://github.com/xiaorouji/openwrt-passwall2)
- [ShadowSocksR Plus+](https://github.com/fw876/helloworld)
- [luci-app-xray](https://github.com/yichya/luci-app-xray) ([openwrt-xray](https://github.com/yichya/openwrt-xray))
- Windows
- [v2rayN](https://github.com/2dust/v2rayN)
- [NekoRay](https://github.com/Matsuridayo/nekoray)
- [Furious](https://github.com/LorenEteval/Furious)
- [HiddifyN](https://github.com/hiddify/HiddifyN)
- [Invisible Man - Xray](https://github.com/InvisibleManVPN/InvisibleMan-XRayClient)
- Android
- [v2rayNG](https://github.com/2dust/v2rayNG)
- [HiddifyNG](https://github.com/hiddify/HiddifyNG)
- [X-flutter](https://github.com/XTLS/X-flutter)
- iOS & macOS arm64
- [Mango](https://github.com/arror/Mango)
- [FoXray](https://apps.apple.com/app/foxray/id6448898396)
- [Streisand](https://apps.apple.com/app/streisand/id6450534064)
- macOS arm64 & x64
- [V2rayU](https://github.com/yanue/V2rayU)
- [V2RayXS](https://github.com/tzmax/V2RayXS)
- [Furious](https://github.com/LorenEteval/Furious)
- [FoXray](https://apps.apple.com/app/foxray/id6448898396)
- Linux
- [v2rayA](https://github.com/v2rayA/v2rayA)
- [NekoRay](https://github.com/Matsuridayo/nekoray)
- [Furious](https://github.com/LorenEteval/Furious)
## Others that support VLESS, XTLS, REALITY, XUDP, PLUX...
- iOS & macOS arm64
- [Shadowrocket](https://apps.apple.com/app/shadowrocket/id932747118)
- Xray Tools
- [xray-knife](https://github.com/lilendian0x00/xray-knife)
- Xray Wrapper
- [XTLS/libXray](https://github.com/XTLS/libXray)
- [xtlsapi](https://github.com/hiddify/xtlsapi)
- [AndroidLibXrayLite](https://github.com/2dust/AndroidLibXrayLite)
- [XrayKit](https://github.com/arror/XrayKit)
- [Xray-core-python](https://github.com/LorenEteval/Xray-core-python)
- [XrayR](https://github.com/XrayR-project/XrayR)
- [XrayR-release](https://github.com/XrayR-project/XrayR-release)
- [XrayR-V2Board](https://github.com/missuo/XrayR-V2Board)
- [Clash.Meta](https://github.com/MetaCubeX/Clash.Meta)
- [Clash Verge](https://github.com/zzzgydi/clash-verge)
- [clashN](https://github.com/2dust/clashN)
- [Clash Meta for Android](https://github.com/MetaCubeX/ClashMetaForAndroid)
- [meta_for_ios](https://t.me/meta_for_ios)
- [sing-box](https://github.com/SagerNet/sing-box)
- [installReality](https://github.com/BoxXt/installReality)
- [sbox-reality](https://github.com/Misaka-blog/sbox-reality)
- [sing-box-for-ios](https://github.com/SagerNet/sing-box-for-ios)
## Contributing
[Code of Conduct](https://github.com/XTLS/Xray-core/blob/main/CODE_OF_CONDUCT.md)
## Credits
- [Xray-core v1.0.0](https://github.com/XTLS/Xray-core/releases/tag/v1.0.0) was forked from [v2fly-core 9a03cc5](https://github.com/v2fly/v2ray-core/commit/9a03cc5c98d04cc28320fcee26dbc236b3291256), and we have made & accumulated a huge number of enhancements over time, check [the release notes for each version](https://github.com/XTLS/Xray-core/releases).
- For third-party projects used in [Xray-core](https://github.com/XTLS/Xray-core), check your local or [the latest go.mod](https://github.com/XTLS/Xray-core/blob/main/go.mod).
## Compilation
```bash
make
```
## Stargazers over time
[![Stargazers over time](https://starchart.cc/XTLS/Xray-core.svg)](https://starchart.cc/XTLS/Xray-core)

View File

@@ -7,11 +7,12 @@ import (
"net"
"sync"
"google.golang.org/grpc"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/signal/done"
core "github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/outbound"
"google.golang.org/grpc"
)
// Commander is a Xray feature that provides gRPC methods to external clients.

View File

@@ -1,12 +1,13 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// protoc-gen-go v1.25.0
// protoc v3.14.0
// source: app/commander/config.proto
package commander
import (
proto "github.com/golang/protobuf/proto"
serial "github.com/xtls/xray-core/common/serial"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
@@ -21,6 +22,10 @@ const (
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// This is a compile-time assertion that a sufficiently up-to-date version
// of the legacy proto package is being used.
const _ = proto.ProtoPackageIsVersion4
// Config is the settings for Commander.
type Config struct {
state protoimpl.MessageState

View File

@@ -37,7 +37,7 @@ func (l *OutboundListener) Accept() (net.Conn, error) {
}
}
// Close implements net.Listener.
// Close implement net.Listener.
func (l *OutboundListener) Close() error {
common.Must(l.done.Close())
L:

View File

@@ -1,12 +1,13 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// protoc-gen-go v1.25.0
// protoc v3.14.0
// source: app/dispatcher/config.proto
package dispatcher
import (
proto "github.com/golang/protobuf/proto"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
@@ -20,6 +21,10 @@ const (
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// This is a compile-time assertion that a sufficiently up-to-date version
// of the legacy proto package is being used.
const _ = proto.ProtoPackageIsVersion4
type SessionConfig struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache

View File

@@ -15,7 +15,6 @@ import (
"github.com/xtls/xray-core/common/protocol"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/features/outbound"
"github.com/xtls/xray-core/features/policy"
"github.com/xtls/xray-core/features/routing"
@@ -25,7 +24,9 @@ import (
"github.com/xtls/xray-core/transport/pipe"
)
var errSniffingTimeout = newError("timeout on sniffing")
var (
errSniffingTimeout = newError("timeout on sniffing")
)
type cachedReader struct {
sync.Mutex
@@ -92,18 +93,13 @@ type DefaultDispatcher struct {
router routing.Router
policy policy.Manager
stats stats.Manager
dns dns.Client
fdns dns.FakeDNSEngine
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
d := new(DefaultDispatcher)
if err := core.RequireFeatures(ctx, func(om outbound.Manager, router routing.Router, pm policy.Manager, sm stats.Manager, dc dns.Client) error {
core.RequireFeatures(ctx, func(fdns dns.FakeDNSEngine) {
d.fdns = fdns
})
return d.Init(config.(*Config), om, router, pm, sm, dc)
if err := core.RequireFeatures(ctx, func(om outbound.Manager, router routing.Router, pm policy.Manager, sm stats.Manager) error {
return d.Init(config.(*Config), om, router, pm, sm)
}); err != nil {
return nil, err
}
@@ -112,12 +108,11 @@ func init() {
}
// Init initializes DefaultDispatcher.
func (d *DefaultDispatcher) Init(config *Config, om outbound.Manager, router routing.Router, pm policy.Manager, sm stats.Manager, dns dns.Client) error {
func (d *DefaultDispatcher) Init(config *Config, om outbound.Manager, router routing.Router, pm policy.Manager, sm stats.Manager) error {
d.ohm = om
d.router = router
d.policy = pm
d.stats = sm
d.dns = dns
return nil
}
@@ -180,34 +175,19 @@ func (d *DefaultDispatcher) getLink(ctx context.Context) (*transport.Link, *tran
return inboundLink, outboundLink
}
func (d *DefaultDispatcher) shouldOverride(ctx context.Context, result SniffResult, request session.SniffingRequest, destination net.Destination) bool {
func shouldOverride(result SniffResult, request session.SniffingRequest) bool {
domain := result.Domain()
if domain == "" {
return false
}
for _, d := range request.ExcludeForDomain {
if strings.ToLower(domain) == d {
if domain == d {
return false
}
}
protocolString := result.Protocol()
if resComp, ok := result.(SnifferResultComposite); ok {
protocolString = resComp.ProtocolForDomainResult()
}
protocol := result.Protocol()
for _, p := range request.OverrideDestinationForProtocol {
if strings.HasPrefix(protocolString, p) || strings.HasPrefix(p, protocolString) {
if strings.HasPrefix(protocol, p) {
return true
}
if fkr0, ok := d.fdns.(dns.FakeDNSEngineRev0); ok && protocolString != "bittorrent" && p == "fakedns" &&
destination.Address.Family().IsIP() && fkr0.IsIPInIPPool(destination.Address) {
newError("Using sniffer ", protocolString, " since the fake DNS missed").WriteToLog(session.ExportIDToError(ctx))
return true
}
if resultSubset, ok := result.(SnifferIsProtoSubsetOf); ok {
if resultSubset.IsProtoSubsetOf(p) {
return true
}
}
}
return false
@@ -218,21 +198,19 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
if !destination.IsValid() {
panic("Dispatcher: Invalid destination.")
}
ob := session.OutboundFromContext(ctx)
if ob == nil {
ob = &session.Outbound{}
ctx = session.ContextWithOutbound(ctx, ob)
ob := &session.Outbound{
Target: destination,
}
ob.OriginalTarget = destination
ob.Target = destination
ctx = session.ContextWithOutbound(ctx, ob)
inbound, outbound := d.getLink(ctx)
content := session.ContentFromContext(ctx)
if content == nil {
content = new(session.Content)
ctx = session.ContextWithContent(ctx, content)
}
sniffingRequest := content.SniffingRequest
inbound, outbound := d.getLink(ctx)
if !sniffingRequest.Enabled {
if destination.Network != net.Network_TCP || !sniffingRequest.Enabled {
go d.routedDispatch(ctx, outbound, destination)
} else {
go func() {
@@ -240,27 +218,15 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
reader: outbound.Reader.(*pipe.Reader),
}
outbound.Reader = cReader
result, err := sniffer(ctx, cReader, sniffingRequest.MetadataOnly, destination.Network)
result, err := sniffer(ctx, cReader)
if err == nil {
content.Protocol = result.Protocol()
}
if err == nil && d.shouldOverride(ctx, result, sniffingRequest, destination) {
if err == nil && shouldOverride(result, sniffingRequest) {
domain := result.Domain()
newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
destination.Address = net.ParseAddress(domain)
protocol := result.Protocol()
if resComp, ok := result.(SnifferResultComposite); ok {
protocol = resComp.ProtocolForDomainResult()
}
isFakeIP := false
if fkr0, ok := d.fdns.(dns.FakeDNSEngineRev0); ok && ob.Target.Address.Family().IsIP() && fkr0.IsIPInIPPool(ob.Target.Address) {
isFakeIP = true
}
if sniffingRequest.RouteOnly && protocol != "fakedns" && protocol != "fakedns+others" && !isFakeIP {
ob.RouteTarget = destination
} else {
ob.Target = destination
}
ob.Target = destination
}
d.routedDispatch(ctx, outbound, destination)
}()
@@ -268,142 +234,52 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
return inbound, nil
}
// DispatchLink implements routing.Dispatcher.
func (d *DefaultDispatcher) DispatchLink(ctx context.Context, destination net.Destination, outbound *transport.Link) error {
if !destination.IsValid() {
return newError("Dispatcher: Invalid destination.")
}
ob := session.OutboundFromContext(ctx)
if ob == nil {
ob = &session.Outbound{}
ctx = session.ContextWithOutbound(ctx, ob)
}
ob.OriginalTarget = destination
ob.Target = destination
content := session.ContentFromContext(ctx)
if content == nil {
content = new(session.Content)
ctx = session.ContextWithContent(ctx, content)
}
sniffingRequest := content.SniffingRequest
if !sniffingRequest.Enabled {
d.routedDispatch(ctx, outbound, destination)
} else {
cReader := &cachedReader{
reader: outbound.Reader.(*pipe.Reader),
}
outbound.Reader = cReader
result, err := sniffer(ctx, cReader, sniffingRequest.MetadataOnly, destination.Network)
if err == nil {
content.Protocol = result.Protocol()
}
if err == nil && d.shouldOverride(ctx, result, sniffingRequest, destination) {
domain := result.Domain()
newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
destination.Address = net.ParseAddress(domain)
protocol := result.Protocol()
if resComp, ok := result.(SnifferResultComposite); ok {
protocol = resComp.ProtocolForDomainResult()
}
isFakeIP := false
if fkr0, ok := d.fdns.(dns.FakeDNSEngineRev0); ok && ob.Target.Address.Family().IsIP() && fkr0.IsIPInIPPool(ob.Target.Address) {
isFakeIP = true
}
if sniffingRequest.RouteOnly && protocol != "fakedns" && protocol != "fakedns+others" && !isFakeIP {
ob.RouteTarget = destination
} else {
ob.Target = destination
}
}
d.routedDispatch(ctx, outbound, destination)
}
return nil
}
func sniffer(ctx context.Context, cReader *cachedReader, metadataOnly bool, network net.Network) (SniffResult, error) {
func sniffer(ctx context.Context, cReader *cachedReader) (SniffResult, error) {
payload := buf.New()
defer payload.Release()
sniffer := NewSniffer(ctx)
sniffer := NewSniffer()
totalAttempt := 0
for {
select {
case <-ctx.Done():
return nil, ctx.Err()
default:
totalAttempt++
if totalAttempt > 2 {
return nil, errSniffingTimeout
}
metaresult, metadataErr := sniffer.SniffMetadata(ctx)
if metadataOnly {
return metaresult, metadataErr
}
contentResult, contentErr := func() (SniffResult, error) {
totalAttempt := 0
for {
select {
case <-ctx.Done():
return nil, ctx.Err()
default:
totalAttempt++
if totalAttempt > 2 {
return nil, errSniffingTimeout
}
cReader.Cache(payload)
if !payload.IsEmpty() {
result, err := sniffer.Sniff(ctx, payload.Bytes(), network)
if err != common.ErrNoClue {
return result, err
}
}
if payload.IsFull() {
return nil, errUnknownContent
cReader.Cache(payload)
if !payload.IsEmpty() {
result, err := sniffer.Sniff(payload.Bytes())
if err != common.ErrNoClue {
return result, err
}
}
if payload.IsFull() {
return nil, errUnknownContent
}
}
}()
if contentErr != nil && metadataErr == nil {
return metaresult, nil
}
if contentErr == nil && metadataErr == nil {
return CompositeResult(metaresult, contentResult), nil
}
return contentResult, contentErr
}
func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.Link, destination net.Destination) {
ob := session.OutboundFromContext(ctx)
if hosts, ok := d.dns.(dns.HostsLookup); ok && destination.Address.Family().IsDomain() {
proxied := hosts.LookupHosts(ob.Target.String())
if proxied != nil {
ro := ob.RouteTarget == destination
destination.Address = *proxied
if ro {
ob.RouteTarget = destination
} else {
ob.Target = destination
}
}
}
var handler outbound.Handler
skipRoutePick := false
if content := session.ContentFromContext(ctx); content != nil {
skipRoutePick = content.SkipRoutePick
}
routingLink := routing_session.AsRoutingContext(ctx)
inTag := routingLink.GetInboundTag()
isPickRoute := 0
if forcedOutboundTag := session.GetForcedOutboundTagFromContext(ctx); forcedOutboundTag != "" {
ctx = session.SetForcedOutboundTagToContext(ctx, "")
if h := d.ohm.GetHandler(forcedOutboundTag); h != nil {
isPickRoute = 1
newError("taking platform initialized detour [", forcedOutboundTag, "] for [", destination, "]").WriteToLog(session.ExportIDToError(ctx))
handler = h
} else {
newError("non existing tag for platform initialized detour: ", forcedOutboundTag).AtError().WriteToLog(session.ExportIDToError(ctx))
common.Close(link.Writer)
common.Interrupt(link.Reader)
return
}
} else if d.router != nil {
isPickRoute := false
if d.router != nil && !skipRoutePick {
if route, err := d.router.PickRoute(routingLink); err == nil {
outTag := route.GetOutboundTag()
isPickRoute = true
if h := d.ohm.GetHandler(outTag); h != nil {
isPickRoute = 2
newError("taking detour [", outTag, "] for [", destination, "]").WriteToLog(session.ExportIDToError(ctx))
handler = h
} else {
@@ -427,14 +303,18 @@ func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.
if accessMessage := log.AccessMessageFromContext(ctx); accessMessage != nil {
if tag := handler.Tag(); tag != "" {
if inTag == "" {
accessMessage.Detour = tag
} else if isPickRoute == 1 {
accessMessage.Detour = inTag + " ==> " + tag
} else if isPickRoute == 2 {
accessMessage.Detour = inTag + " -> " + tag
if isPickRoute {
if inTag != "" {
accessMessage.Detour = inTag + " -> " + tag
} else {
accessMessage.Detour = tag
}
} else {
accessMessage.Detour = inTag + " >> " + tag
if inTag != "" {
accessMessage.Detour = inTag + " >> " + tag
} else {
accessMessage.Detour = tag
}
}
}
log.Record(accessMessage)

View File

@@ -1,119 +0,0 @@
package dispatcher
import (
"context"
"strings"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/dns"
)
// newFakeDNSSniffer Creates a Fake DNS metadata sniffer
func newFakeDNSSniffer(ctx context.Context) (protocolSnifferWithMetadata, error) {
var fakeDNSEngine dns.FakeDNSEngine
{
fakeDNSEngineFeat := core.MustFromContext(ctx).GetFeature((*dns.FakeDNSEngine)(nil))
if fakeDNSEngineFeat != nil {
fakeDNSEngine = fakeDNSEngineFeat.(dns.FakeDNSEngine)
}
}
if fakeDNSEngine == nil {
errNotInit := newError("FakeDNSEngine is not initialized, but such a sniffer is used").AtError()
return protocolSnifferWithMetadata{}, errNotInit
}
return protocolSnifferWithMetadata{protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
Target := session.OutboundFromContext(ctx).Target
if Target.Network == net.Network_TCP || Target.Network == net.Network_UDP {
domainFromFakeDNS := fakeDNSEngine.GetDomainFromFakeDNS(Target.Address)
if domainFromFakeDNS != "" {
newError("fake dns got domain: ", domainFromFakeDNS, " for ip: ", Target.Address.String()).WriteToLog(session.ExportIDToError(ctx))
return &fakeDNSSniffResult{domainName: domainFromFakeDNS}, nil
}
}
if ipAddressInRangeValueI := ctx.Value(ipAddressInRange); ipAddressInRangeValueI != nil {
ipAddressInRangeValue := ipAddressInRangeValueI.(*ipAddressInRangeOpt)
if fkr0, ok := fakeDNSEngine.(dns.FakeDNSEngineRev0); ok {
inPool := fkr0.IsIPInIPPool(Target.Address)
ipAddressInRangeValue.addressInRange = &inPool
}
}
return nil, common.ErrNoClue
}, metadataSniffer: true}, nil
}
type fakeDNSSniffResult struct {
domainName string
}
func (fakeDNSSniffResult) Protocol() string {
return "fakedns"
}
func (f fakeDNSSniffResult) Domain() string {
return f.domainName
}
type fakeDNSExtraOpts int
const ipAddressInRange fakeDNSExtraOpts = 1
type ipAddressInRangeOpt struct {
addressInRange *bool
}
type DNSThenOthersSniffResult struct {
domainName string
protocolOriginalName string
}
func (f DNSThenOthersSniffResult) IsProtoSubsetOf(protocolName string) bool {
return strings.HasPrefix(protocolName, f.protocolOriginalName)
}
func (DNSThenOthersSniffResult) Protocol() string {
return "fakedns+others"
}
func (f DNSThenOthersSniffResult) Domain() string {
return f.domainName
}
func newFakeDNSThenOthers(ctx context.Context, fakeDNSSniffer protocolSnifferWithMetadata, others []protocolSnifferWithMetadata) (
protocolSnifferWithMetadata, error,
) { // nolint: unparam
// ctx may be used in the future
_ = ctx
return protocolSnifferWithMetadata{
protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
ipAddressInRangeValue := &ipAddressInRangeOpt{}
ctx = context.WithValue(ctx, ipAddressInRange, ipAddressInRangeValue)
result, err := fakeDNSSniffer.protocolSniffer(ctx, bytes)
if err == nil {
return result, nil
}
if ipAddressInRangeValue.addressInRange != nil {
if *ipAddressInRangeValue.addressInRange {
for _, v := range others {
if v.metadataSniffer || bytes != nil {
if result, err := v.protocolSniffer(ctx, bytes); err == nil {
return DNSThenOthersSniffResult{domainName: result.Domain(), protocolOriginalName: result.Protocol()}, nil
}
}
}
return nil, common.ErrNoClue
}
newError("ip address not in fake dns range, return as is").AtDebug().WriteToLog()
return nil, common.ErrNoClue
}
newError("fake dns sniffer did not set address in range option, assume false.").AtWarning().WriteToLog()
return nil, common.ErrNoClue
},
metadataSniffer: false,
}, nil
}

View File

@@ -1,13 +1,9 @@
package dispatcher
import (
"context"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/protocol/bittorrent"
"github.com/xtls/xray-core/common/protocol/http"
"github.com/xtls/xray-core/common/protocol/quic"
"github.com/xtls/xray-core/common/protocol/tls"
)
@@ -16,54 +12,30 @@ type SniffResult interface {
Domain() string
}
type protocolSniffer func(context.Context, []byte) (SniffResult, error)
type protocolSnifferWithMetadata struct {
protocolSniffer protocolSniffer
// A Metadata sniffer will be invoked on connection establishment only, with nil body,
// for both TCP and UDP connections
// It will not be shown as a traffic type for routing unless there is no other successful sniffing.
metadataSniffer bool
network net.Network
}
type protocolSniffer func([]byte) (SniffResult, error)
type Sniffer struct {
sniffer []protocolSnifferWithMetadata
sniffer []protocolSniffer
}
func NewSniffer(ctx context.Context) *Sniffer {
ret := &Sniffer{
sniffer: []protocolSnifferWithMetadata{
{func(c context.Context, b []byte) (SniffResult, error) { return http.SniffHTTP(b) }, false, net.Network_TCP},
{func(c context.Context, b []byte) (SniffResult, error) { return tls.SniffTLS(b) }, false, net.Network_TCP},
{func(c context.Context, b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) }, false, net.Network_TCP},
{func(c context.Context, b []byte) (SniffResult, error) { return quic.SniffQUIC(b) }, false, net.Network_UDP},
{func(c context.Context, b []byte) (SniffResult, error) { return bittorrent.SniffUTP(b) }, false, net.Network_UDP},
func NewSniffer() *Sniffer {
return &Sniffer{
sniffer: []protocolSniffer{
func(b []byte) (SniffResult, error) { return http.SniffHTTP(b) },
func(b []byte) (SniffResult, error) { return tls.SniffTLS(b) },
func(b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) },
},
}
if sniffer, err := newFakeDNSSniffer(ctx); err == nil {
others := ret.sniffer
ret.sniffer = append(ret.sniffer, sniffer)
fakeDNSThenOthers, err := newFakeDNSThenOthers(ctx, sniffer, others)
if err == nil {
ret.sniffer = append([]protocolSnifferWithMetadata{fakeDNSThenOthers}, ret.sniffer...)
}
}
return ret
}
var errUnknownContent = newError("unknown content")
func (s *Sniffer) Sniff(c context.Context, payload []byte, network net.Network) (SniffResult, error) {
var pendingSniffer []protocolSnifferWithMetadata
for _, si := range s.sniffer {
s := si.protocolSniffer
if si.metadataSniffer || si.network != network {
continue
}
result, err := s(c, payload)
func (s *Sniffer) Sniff(payload []byte) (SniffResult, error) {
var pendingSniffer []protocolSniffer
for _, s := range s.sniffer {
result, err := s(payload)
if err == common.ErrNoClue {
pendingSniffer = append(pendingSniffer, si)
pendingSniffer = append(pendingSniffer, s)
continue
}
@@ -79,59 +51,3 @@ func (s *Sniffer) Sniff(c context.Context, payload []byte, network net.Network)
return nil, errUnknownContent
}
func (s *Sniffer) SniffMetadata(c context.Context) (SniffResult, error) {
var pendingSniffer []protocolSnifferWithMetadata
for _, si := range s.sniffer {
s := si.protocolSniffer
if !si.metadataSniffer {
pendingSniffer = append(pendingSniffer, si)
continue
}
result, err := s(c, nil)
if err == common.ErrNoClue {
pendingSniffer = append(pendingSniffer, si)
continue
}
if err == nil && result != nil {
return result, nil
}
}
if len(pendingSniffer) > 0 {
s.sniffer = pendingSniffer
return nil, common.ErrNoClue
}
return nil, errUnknownContent
}
func CompositeResult(domainResult SniffResult, protocolResult SniffResult) SniffResult {
return &compositeResult{domainResult: domainResult, protocolResult: protocolResult}
}
type compositeResult struct {
domainResult SniffResult
protocolResult SniffResult
}
func (c compositeResult) Protocol() string {
return c.protocolResult.Protocol()
}
func (c compositeResult) Domain() string {
return c.domainResult.Domain()
}
func (c compositeResult) ProtocolForDomainResult() string {
return c.domainResult.Protocol()
}
type SnifferResultComposite interface {
ProtocolForDomainResult() string
}
type SnifferIsProtoSubsetOf interface {
IsProtoSubsetOf(protocolName string) bool
}

View File

@@ -1,63 +0,0 @@
package dns
import (
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/strmatcher"
"github.com/xtls/xray-core/common/uuid"
)
var typeMap = map[DomainMatchingType]strmatcher.Type{
DomainMatchingType_Full: strmatcher.Full,
DomainMatchingType_Subdomain: strmatcher.Domain,
DomainMatchingType_Keyword: strmatcher.Substr,
DomainMatchingType_Regex: strmatcher.Regex,
}
// References:
// https://www.iana.org/assignments/special-use-domain-names/special-use-domain-names.xhtml
// https://unix.stackexchange.com/questions/92441/whats-the-difference-between-local-home-and-lan
var localTLDsAndDotlessDomains = []*NameServer_PriorityDomain{
{Type: DomainMatchingType_Regex, Domain: "^[^.]+$"}, // This will only match domains without any dot
{Type: DomainMatchingType_Subdomain, Domain: "local"},
{Type: DomainMatchingType_Subdomain, Domain: "localdomain"},
{Type: DomainMatchingType_Subdomain, Domain: "localhost"},
{Type: DomainMatchingType_Subdomain, Domain: "lan"},
{Type: DomainMatchingType_Subdomain, Domain: "home.arpa"},
{Type: DomainMatchingType_Subdomain, Domain: "example"},
{Type: DomainMatchingType_Subdomain, Domain: "invalid"},
{Type: DomainMatchingType_Subdomain, Domain: "test"},
}
var localTLDsAndDotlessDomainsRule = &NameServer_OriginalRule{
Rule: "geosite:private",
Size: uint32(len(localTLDsAndDotlessDomains)),
}
func toStrMatcher(t DomainMatchingType, domain string) (strmatcher.Matcher, error) {
strMType, f := typeMap[t]
if !f {
return nil, newError("unknown mapping type", t).AtWarning()
}
matcher, err := strMType.New(domain)
if err != nil {
return nil, newError("failed to create str matcher").Base(err)
}
return matcher, nil
}
func toNetIP(addrs []net.Address) ([]net.IP, error) {
ips := make([]net.IP, 0, len(addrs))
for _, addr := range addrs {
if addr.Family().IsIP() {
ips = append(ips, addr.IP())
} else {
return nil, newError("Failed to convert address", addr, "to Net IP.").AtWarning()
}
}
return ips, nil
}
func generateRandomTag() string {
id := uuid.New()
return "xray.system." + id.String()
}

View File

@@ -1,12 +1,13 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// protoc-gen-go v1.25.0
// protoc v3.14.0
// source: app/dns/config.proto
package dns
import (
proto "github.com/golang/protobuf/proto"
router "github.com/xtls/xray-core/app/router"
net "github.com/xtls/xray-core/common/net"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
@@ -22,6 +23,10 @@ const (
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// This is a compile-time assertion that a sufficiently up-to-date version
// of the legacy proto package is being used.
const _ = proto.ProtoPackageIsVersion4
type DomainMatchingType int32
const (
@@ -74,67 +79,15 @@ func (DomainMatchingType) EnumDescriptor() ([]byte, []int) {
return file_app_dns_config_proto_rawDescGZIP(), []int{0}
}
type QueryStrategy int32
const (
QueryStrategy_USE_IP QueryStrategy = 0
QueryStrategy_USE_IP4 QueryStrategy = 1
QueryStrategy_USE_IP6 QueryStrategy = 2
)
// Enum value maps for QueryStrategy.
var (
QueryStrategy_name = map[int32]string{
0: "USE_IP",
1: "USE_IP4",
2: "USE_IP6",
}
QueryStrategy_value = map[string]int32{
"USE_IP": 0,
"USE_IP4": 1,
"USE_IP6": 2,
}
)
func (x QueryStrategy) Enum() *QueryStrategy {
p := new(QueryStrategy)
*p = x
return p
}
func (x QueryStrategy) String() string {
return protoimpl.X.EnumStringOf(x.Descriptor(), protoreflect.EnumNumber(x))
}
func (QueryStrategy) Descriptor() protoreflect.EnumDescriptor {
return file_app_dns_config_proto_enumTypes[1].Descriptor()
}
func (QueryStrategy) Type() protoreflect.EnumType {
return &file_app_dns_config_proto_enumTypes[1]
}
func (x QueryStrategy) Number() protoreflect.EnumNumber {
return protoreflect.EnumNumber(x)
}
// Deprecated: Use QueryStrategy.Descriptor instead.
func (QueryStrategy) EnumDescriptor() ([]byte, []int) {
return file_app_dns_config_proto_rawDescGZIP(), []int{1}
}
type NameServer struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
Address *net.Endpoint `protobuf:"bytes,1,opt,name=address,proto3" json:"address,omitempty"`
ClientIp []byte `protobuf:"bytes,5,opt,name=client_ip,json=clientIp,proto3" json:"client_ip,omitempty"`
SkipFallback bool `protobuf:"varint,6,opt,name=skipFallback,proto3" json:"skipFallback,omitempty"`
PrioritizedDomain []*NameServer_PriorityDomain `protobuf:"bytes,2,rep,name=prioritized_domain,json=prioritizedDomain,proto3" json:"prioritized_domain,omitempty"`
Geoip []*router.GeoIP `protobuf:"bytes,3,rep,name=geoip,proto3" json:"geoip,omitempty"`
OriginalRules []*NameServer_OriginalRule `protobuf:"bytes,4,rep,name=original_rules,json=originalRules,proto3" json:"original_rules,omitempty"`
QueryStrategy QueryStrategy `protobuf:"varint,7,opt,name=query_strategy,json=queryStrategy,proto3,enum=xray.app.dns.QueryStrategy" json:"query_strategy,omitempty"`
}
func (x *NameServer) Reset() {
@@ -176,20 +129,6 @@ func (x *NameServer) GetAddress() *net.Endpoint {
return nil
}
func (x *NameServer) GetClientIp() []byte {
if x != nil {
return x.ClientIp
}
return nil
}
func (x *NameServer) GetSkipFallback() bool {
if x != nil {
return x.SkipFallback
}
return false
}
func (x *NameServer) GetPrioritizedDomain() []*NameServer_PriorityDomain {
if x != nil {
return x.PrioritizedDomain
@@ -211,13 +150,6 @@ func (x *NameServer) GetOriginalRules() []*NameServer_OriginalRule {
return nil
}
func (x *NameServer) GetQueryStrategy() QueryStrategy {
if x != nil {
return x.QueryStrategy
}
return QueryStrategy_USE_IP
}
type Config struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
@@ -227,14 +159,14 @@ type Config struct {
// the moment. A special value 'localhost' as a domain address can be set to
// use DNS on local system.
//
// Deprecated: Marked as deprecated in app/dns/config.proto.
// Deprecated: Do not use.
NameServers []*net.Endpoint `protobuf:"bytes,1,rep,name=NameServers,proto3" json:"NameServers,omitempty"`
// NameServer list used by this DNS client.
NameServer []*NameServer `protobuf:"bytes,5,rep,name=name_server,json=nameServer,proto3" json:"name_server,omitempty"`
// Static hosts. Domain to IP.
// Deprecated. Use static_hosts.
//
// Deprecated: Marked as deprecated in app/dns/config.proto.
// Deprecated: Do not use.
Hosts map[string]*net.IPOrDomain `protobuf:"bytes,2,rep,name=Hosts,proto3" json:"Hosts,omitempty" protobuf_key:"bytes,1,opt,name=key,proto3" protobuf_val:"bytes,2,opt,name=value,proto3"`
// Client IP for EDNS client subnet. Must be 4 bytes (IPv4) or 16 bytes
// (IPv6).
@@ -242,11 +174,6 @@ type Config struct {
StaticHosts []*Config_HostMapping `protobuf:"bytes,4,rep,name=static_hosts,json=staticHosts,proto3" json:"static_hosts,omitempty"`
// Tag is the inbound tag of DNS client.
Tag string `protobuf:"bytes,6,opt,name=tag,proto3" json:"tag,omitempty"`
// DisableCache disables DNS cache
DisableCache bool `protobuf:"varint,8,opt,name=disableCache,proto3" json:"disableCache,omitempty"`
QueryStrategy QueryStrategy `protobuf:"varint,9,opt,name=query_strategy,json=queryStrategy,proto3,enum=xray.app.dns.QueryStrategy" json:"query_strategy,omitempty"`
DisableFallback bool `protobuf:"varint,10,opt,name=disableFallback,proto3" json:"disableFallback,omitempty"`
DisableFallbackIfMatch bool `protobuf:"varint,11,opt,name=disableFallbackIfMatch,proto3" json:"disableFallbackIfMatch,omitempty"`
}
func (x *Config) Reset() {
@@ -281,7 +208,7 @@ func (*Config) Descriptor() ([]byte, []int) {
return file_app_dns_config_proto_rawDescGZIP(), []int{1}
}
// Deprecated: Marked as deprecated in app/dns/config.proto.
// Deprecated: Do not use.
func (x *Config) GetNameServers() []*net.Endpoint {
if x != nil {
return x.NameServers
@@ -296,7 +223,7 @@ func (x *Config) GetNameServer() []*NameServer {
return nil
}
// Deprecated: Marked as deprecated in app/dns/config.proto.
// Deprecated: Do not use.
func (x *Config) GetHosts() map[string]*net.IPOrDomain {
if x != nil {
return x.Hosts
@@ -325,34 +252,6 @@ func (x *Config) GetTag() string {
return ""
}
func (x *Config) GetDisableCache() bool {
if x != nil {
return x.DisableCache
}
return false
}
func (x *Config) GetQueryStrategy() QueryStrategy {
if x != nil {
return x.QueryStrategy
}
return QueryStrategy_USE_IP
}
func (x *Config) GetDisableFallback() bool {
if x != nil {
return x.DisableFallback
}
return false
}
func (x *Config) GetDisableFallbackIfMatch() bool {
if x != nil {
return x.DisableFallbackIfMatch
}
return false
}
type NameServer_PriorityDomain struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
@@ -472,7 +371,8 @@ type Config_HostMapping struct {
Domain string `protobuf:"bytes,2,opt,name=domain,proto3" json:"domain,omitempty"`
Ip [][]byte `protobuf:"bytes,3,rep,name=ip,proto3" json:"ip,omitempty"`
// ProxiedDomain indicates the mapped domain has the same IP address on this
// domain. Xray will use this domain for IP queries.
// domain. Xray will use this domain for IP queries. This field is only
// effective if ip is empty.
ProxiedDomain string `protobuf:"bytes,4,opt,name=proxied_domain,json=proxiedDomain,proto3" json:"proxied_domain,omitempty"`
}
@@ -546,102 +446,77 @@ var file_app_dns_config_proto_rawDesc = []byte{
0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2f, 0x6e, 0x65, 0x74, 0x2f, 0x64, 0x65, 0x73, 0x74, 0x69,
0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x1a, 0x17, 0x61, 0x70,
0x70, 0x2f, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2f, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e,
0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xb2, 0x04, 0x0a, 0x0a, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65,
0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xad, 0x03, 0x0a, 0x0a, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65,
0x72, 0x76, 0x65, 0x72, 0x12, 0x33, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18,
0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64, 0x70, 0x6f, 0x69, 0x6e, 0x74,
0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x1b, 0x0a, 0x09, 0x63, 0x6c, 0x69,
0x65, 0x6e, 0x74, 0x5f, 0x69, 0x70, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x08, 0x63, 0x6c,
0x69, 0x65, 0x6e, 0x74, 0x49, 0x70, 0x12, 0x22, 0x0a, 0x0c, 0x73, 0x6b, 0x69, 0x70, 0x46, 0x61,
0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x18, 0x06, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x73, 0x6b,
0x69, 0x70, 0x46, 0x61, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x12, 0x56, 0x0a, 0x12, 0x70, 0x72,
0x69, 0x6f, 0x72, 0x69, 0x74, 0x69, 0x7a, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x27, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x56, 0x0a, 0x12, 0x70, 0x72, 0x69,
0x6f, 0x72, 0x69, 0x74, 0x69, 0x7a, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18,
0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x27, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x2e,
0x50, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x79, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x11,
0x70, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x69, 0x7a, 0x65, 0x64, 0x44, 0x6f, 0x6d, 0x61, 0x69,
0x6e, 0x12, 0x2c, 0x0a, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b,
0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x12,
0x4c, 0x0a, 0x0e, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x5f, 0x72, 0x75, 0x6c, 0x65,
0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61,
0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65,
0x72, 0x2e, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x0d,
0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x73, 0x1a, 0x5e, 0x0a,
0x0e, 0x50, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x79, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x12,
0x34, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x20, 0x2e,
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x44, 0x6f, 0x6d,
0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x52,
0x04, 0x74, 0x79, 0x70, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18,
0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x1a, 0x36, 0x0a,
0x0c, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x12, 0x0a,
0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x72, 0x75, 0x6c,
0x65, 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52,
0x04, 0x73, 0x69, 0x7a, 0x65, 0x22, 0x9f, 0x04, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
0x12, 0x3f, 0x0a, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x18,
0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64, 0x70, 0x6f, 0x69, 0x6e, 0x74,
0x42, 0x02, 0x18, 0x01, 0x52, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72,
0x73, 0x12, 0x39, 0x0a, 0x0b, 0x6e, 0x61, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72,
0x18, 0x05, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72,
0x2e, 0x50, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x79, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52,
0x11, 0x70, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x69, 0x7a, 0x65, 0x64, 0x44, 0x6f, 0x6d, 0x61,
0x69, 0x6e, 0x12, 0x2c, 0x0a, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28,
0x0b, 0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75,
0x74, 0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70,
0x12, 0x4c, 0x0a, 0x0e, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x5f, 0x72, 0x75, 0x6c,
0x65, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76,
0x65, 0x72, 0x2e, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x52,
0x0d, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x73, 0x12, 0x42,
0x0a, 0x0e, 0x71, 0x75, 0x65, 0x72, 0x79, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
0x18, 0x07, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x53, 0x74, 0x72, 0x61, 0x74,
0x65, 0x67, 0x79, 0x52, 0x0d, 0x71, 0x75, 0x65, 0x72, 0x79, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65,
0x67, 0x79, 0x1a, 0x5e, 0x0a, 0x0e, 0x50, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x79, 0x44, 0x6f,
0x6d, 0x61, 0x69, 0x6e, 0x12, 0x34, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01,
0x28, 0x0e, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e,
0x73, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67,
0x54, 0x79, 0x70, 0x65, 0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x64, 0x6f,
0x6d, 0x61, 0x69, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61,
0x69, 0x6e, 0x1a, 0x36, 0x0a, 0x0c, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75,
0x6c, 0x65, 0x12, 0x12, 0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09,
0x52, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x02,
0x20, 0x01, 0x28, 0x0d, 0x52, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x22, 0xef, 0x05, 0x0a, 0x06, 0x43,
0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x3f, 0x0a, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72,
0x76, 0x65, 0x72, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61,
0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64,
0x70, 0x6f, 0x69, 0x6e, 0x74, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53,
0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x12, 0x39, 0x0a, 0x0b, 0x6e, 0x61, 0x6d, 0x65, 0x5f, 0x73,
0x65, 0x72, 0x76, 0x65, 0x72, 0x18, 0x05, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x18, 0x2e, 0x78, 0x72,
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53,
0x65, 0x72, 0x76, 0x65, 0x72, 0x52, 0x0a, 0x6e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65,
0x72, 0x12, 0x39, 0x0a, 0x05, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b,
0x32, 0x1f, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e,
0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x45, 0x6e, 0x74, 0x72,
0x79, 0x42, 0x02, 0x18, 0x01, 0x52, 0x05, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x12, 0x1b, 0x0a, 0x09,
0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x5f, 0x69, 0x70, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52,
0x08, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x49, 0x70, 0x12, 0x43, 0x0a, 0x0c, 0x73, 0x74, 0x61,
0x74, 0x69, 0x63, 0x5f, 0x68, 0x6f, 0x73, 0x74, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32,
0x20, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x43,
0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e, 0x48, 0x6f, 0x73, 0x74, 0x4d, 0x61, 0x70, 0x70, 0x69, 0x6e,
0x67, 0x52, 0x0b, 0x73, 0x74, 0x61, 0x74, 0x69, 0x63, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x12, 0x10,
0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67,
0x12, 0x22, 0x0a, 0x0c, 0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x43, 0x61, 0x63, 0x68, 0x65,
0x18, 0x08, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x43,
0x61, 0x63, 0x68, 0x65, 0x12, 0x42, 0x0a, 0x0e, 0x71, 0x75, 0x65, 0x72, 0x79, 0x5f, 0x73, 0x74,
0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x09, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x1b, 0x2e, 0x78,
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x51, 0x75, 0x65, 0x72,
0x79, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0d, 0x71, 0x75, 0x65, 0x72, 0x79,
0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x28, 0x0a, 0x0f, 0x64, 0x69, 0x73, 0x61,
0x62, 0x6c, 0x65, 0x46, 0x61, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x18, 0x0a, 0x20, 0x01, 0x28,
0x08, 0x52, 0x0f, 0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x46, 0x61, 0x6c, 0x6c, 0x62, 0x61,
0x63, 0x6b, 0x12, 0x36, 0x0a, 0x16, 0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x46, 0x61, 0x6c,
0x6c, 0x62, 0x61, 0x63, 0x6b, 0x49, 0x66, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x18, 0x0b, 0x20, 0x01,
0x28, 0x08, 0x52, 0x16, 0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x46, 0x61, 0x6c, 0x6c, 0x62,
0x61, 0x63, 0x6b, 0x49, 0x66, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x1a, 0x55, 0x0a, 0x0a, 0x48, 0x6f,
0x73, 0x74, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, 0x03, 0x6b, 0x65, 0x79, 0x18,
0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, 0x31, 0x0a, 0x05, 0x76, 0x61,
0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79,
0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72,
0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38,
0x01, 0x1a, 0x92, 0x01, 0x0a, 0x0b, 0x48, 0x6f, 0x73, 0x74, 0x4d, 0x61, 0x70, 0x70, 0x69, 0x6e,
0x67, 0x12, 0x34, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32,
0x20, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x44,
0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70,
0x65, 0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69,
0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x12,
0x0e, 0x0a, 0x02, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x70, 0x12,
0x25, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61, 0x69,
0x6e, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65, 0x64,
0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4a, 0x04, 0x08, 0x07, 0x10, 0x08, 0x2a, 0x45, 0x0a, 0x12,
0x52, 0x0a, 0x6e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x12, 0x39, 0x0a, 0x05,
0x48, 0x6f, 0x73, 0x74, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1f, 0x2e, 0x78, 0x72,
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69,
0x67, 0x2e, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x42, 0x02, 0x18, 0x01,
0x52, 0x05, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x12, 0x1b, 0x0a, 0x09, 0x63, 0x6c, 0x69, 0x65, 0x6e,
0x74, 0x5f, 0x69, 0x70, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x08, 0x63, 0x6c, 0x69, 0x65,
0x6e, 0x74, 0x49, 0x70, 0x12, 0x43, 0x0a, 0x0c, 0x73, 0x74, 0x61, 0x74, 0x69, 0x63, 0x5f, 0x68,
0x6f, 0x73, 0x74, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61,
0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
0x2e, 0x48, 0x6f, 0x73, 0x74, 0x4d, 0x61, 0x70, 0x70, 0x69, 0x6e, 0x67, 0x52, 0x0b, 0x73, 0x74,
0x61, 0x74, 0x69, 0x63, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67,
0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x1a, 0x55, 0x0a, 0x0a, 0x48,
0x6f, 0x73, 0x74, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, 0x03, 0x6b, 0x65, 0x79,
0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, 0x31, 0x0a, 0x05, 0x76,
0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61,
0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f,
0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02,
0x38, 0x01, 0x1a, 0x92, 0x01, 0x0a, 0x0b, 0x48, 0x6f, 0x73, 0x74, 0x4d, 0x61, 0x70, 0x70, 0x69,
0x6e, 0x67, 0x12, 0x34, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e,
0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e,
0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79,
0x70, 0x65, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x75, 0x6c, 0x6c, 0x10, 0x00, 0x12, 0x0d, 0x0a, 0x09,
0x53, 0x75, 0x62, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07, 0x4b,
0x65, 0x79, 0x77, 0x6f, 0x72, 0x64, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x52, 0x65, 0x67, 0x65,
0x78, 0x10, 0x03, 0x2a, 0x35, 0x0a, 0x0d, 0x51, 0x75, 0x65, 0x72, 0x79, 0x53, 0x74, 0x72, 0x61,
0x74, 0x65, 0x67, 0x79, 0x12, 0x0a, 0x0a, 0x06, 0x55, 0x53, 0x45, 0x5f, 0x49, 0x50, 0x10, 0x00,
0x12, 0x0b, 0x0a, 0x07, 0x55, 0x53, 0x45, 0x5f, 0x49, 0x50, 0x34, 0x10, 0x01, 0x12, 0x0b, 0x0a,
0x07, 0x55, 0x53, 0x45, 0x5f, 0x49, 0x50, 0x36, 0x10, 0x02, 0x42, 0x46, 0x0a, 0x10, 0x63, 0x6f,
0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x50, 0x01,
0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c,
0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f,
0x64, 0x6e, 0x73, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x44,
0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
0x70, 0x65, 0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61,
0x69, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
0x12, 0x0e, 0x0a, 0x02, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x70,
0x12, 0x25, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61,
0x69, 0x6e, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65,
0x64, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x2a, 0x45, 0x0a, 0x12, 0x44, 0x6f, 0x6d, 0x61, 0x69,
0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08, 0x0a,
0x04, 0x46, 0x75, 0x6c, 0x6c, 0x10, 0x00, 0x12, 0x0d, 0x0a, 0x09, 0x53, 0x75, 0x62, 0x64, 0x6f,
0x6d, 0x61, 0x69, 0x6e, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07, 0x4b, 0x65, 0x79, 0x77, 0x6f, 0x72,
0x64, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x52, 0x65, 0x67, 0x65, 0x78, 0x10, 0x03, 0x42, 0x46,
0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64,
0x6e, 0x73, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d,
0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f,
0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41,
0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
}
var (
@@ -656,40 +531,37 @@ func file_app_dns_config_proto_rawDescGZIP() []byte {
return file_app_dns_config_proto_rawDescData
}
var file_app_dns_config_proto_enumTypes = make([]protoimpl.EnumInfo, 2)
var file_app_dns_config_proto_enumTypes = make([]protoimpl.EnumInfo, 1)
var file_app_dns_config_proto_msgTypes = make([]protoimpl.MessageInfo, 6)
var file_app_dns_config_proto_goTypes = []interface{}{
(DomainMatchingType)(0), // 0: xray.app.dns.DomainMatchingType
(QueryStrategy)(0), // 1: xray.app.dns.QueryStrategy
(*NameServer)(nil), // 2: xray.app.dns.NameServer
(*Config)(nil), // 3: xray.app.dns.Config
(*NameServer_PriorityDomain)(nil), // 4: xray.app.dns.NameServer.PriorityDomain
(*NameServer_OriginalRule)(nil), // 5: xray.app.dns.NameServer.OriginalRule
nil, // 6: xray.app.dns.Config.HostsEntry
(*Config_HostMapping)(nil), // 7: xray.app.dns.Config.HostMapping
(*net.Endpoint)(nil), // 8: xray.common.net.Endpoint
(*router.GeoIP)(nil), // 9: xray.app.router.GeoIP
(*net.IPOrDomain)(nil), // 10: xray.common.net.IPOrDomain
(*NameServer)(nil), // 1: xray.app.dns.NameServer
(*Config)(nil), // 2: xray.app.dns.Config
(*NameServer_PriorityDomain)(nil), // 3: xray.app.dns.NameServer.PriorityDomain
(*NameServer_OriginalRule)(nil), // 4: xray.app.dns.NameServer.OriginalRule
nil, // 5: xray.app.dns.Config.HostsEntry
(*Config_HostMapping)(nil), // 6: xray.app.dns.Config.HostMapping
(*net.Endpoint)(nil), // 7: xray.common.net.Endpoint
(*router.GeoIP)(nil), // 8: xray.app.router.GeoIP
(*net.IPOrDomain)(nil), // 9: xray.common.net.IPOrDomain
}
var file_app_dns_config_proto_depIdxs = []int32{
8, // 0: xray.app.dns.NameServer.address:type_name -> xray.common.net.Endpoint
4, // 1: xray.app.dns.NameServer.prioritized_domain:type_name -> xray.app.dns.NameServer.PriorityDomain
9, // 2: xray.app.dns.NameServer.geoip:type_name -> xray.app.router.GeoIP
5, // 3: xray.app.dns.NameServer.original_rules:type_name -> xray.app.dns.NameServer.OriginalRule
1, // 4: xray.app.dns.NameServer.query_strategy:type_name -> xray.app.dns.QueryStrategy
8, // 5: xray.app.dns.Config.NameServers:type_name -> xray.common.net.Endpoint
2, // 6: xray.app.dns.Config.name_server:type_name -> xray.app.dns.NameServer
6, // 7: xray.app.dns.Config.Hosts:type_name -> xray.app.dns.Config.HostsEntry
7, // 8: xray.app.dns.Config.static_hosts:type_name -> xray.app.dns.Config.HostMapping
1, // 9: xray.app.dns.Config.query_strategy:type_name -> xray.app.dns.QueryStrategy
0, // 10: xray.app.dns.NameServer.PriorityDomain.type:type_name -> xray.app.dns.DomainMatchingType
10, // 11: xray.app.dns.Config.HostsEntry.value:type_name -> xray.common.net.IPOrDomain
0, // 12: xray.app.dns.Config.HostMapping.type:type_name -> xray.app.dns.DomainMatchingType
13, // [13:13] is the sub-list for method output_type
13, // [13:13] is the sub-list for method input_type
13, // [13:13] is the sub-list for extension type_name
13, // [13:13] is the sub-list for extension extendee
0, // [0:13] is the sub-list for field type_name
7, // 0: xray.app.dns.NameServer.address:type_name -> xray.common.net.Endpoint
3, // 1: xray.app.dns.NameServer.prioritized_domain:type_name -> xray.app.dns.NameServer.PriorityDomain
8, // 2: xray.app.dns.NameServer.geoip:type_name -> xray.app.router.GeoIP
4, // 3: xray.app.dns.NameServer.original_rules:type_name -> xray.app.dns.NameServer.OriginalRule
7, // 4: xray.app.dns.Config.NameServers:type_name -> xray.common.net.Endpoint
1, // 5: xray.app.dns.Config.name_server:type_name -> xray.app.dns.NameServer
5, // 6: xray.app.dns.Config.Hosts:type_name -> xray.app.dns.Config.HostsEntry
6, // 7: xray.app.dns.Config.static_hosts:type_name -> xray.app.dns.Config.HostMapping
0, // 8: xray.app.dns.NameServer.PriorityDomain.type:type_name -> xray.app.dns.DomainMatchingType
9, // 9: xray.app.dns.Config.HostsEntry.value:type_name -> xray.common.net.IPOrDomain
0, // 10: xray.app.dns.Config.HostMapping.type:type_name -> xray.app.dns.DomainMatchingType
11, // [11:11] is the sub-list for method output_type
11, // [11:11] is the sub-list for method input_type
11, // [11:11] is the sub-list for extension type_name
11, // [11:11] is the sub-list for extension extendee
0, // [0:11] is the sub-list for field type_name
}
func init() { file_app_dns_config_proto_init() }
@@ -764,7 +636,7 @@ func file_app_dns_config_proto_init() {
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: file_app_dns_config_proto_rawDesc,
NumEnums: 2,
NumEnums: 1,
NumMessages: 6,
NumExtensions: 0,
NumServices: 0,

View File

@@ -12,8 +12,6 @@ import "app/router/config.proto";
message NameServer {
xray.common.net.Endpoint address = 1;
bytes client_ip = 5;
bool skipFallback = 6;
message PriorityDomain {
DomainMatchingType type = 1;
@@ -28,7 +26,6 @@ message NameServer {
repeated PriorityDomain prioritized_domain = 2;
repeated xray.app.router.GeoIP geoip = 3;
repeated OriginalRule original_rules = 4;
QueryStrategy query_strategy = 7;
}
enum DomainMatchingType {
@@ -38,12 +35,6 @@ enum DomainMatchingType {
Regex = 3;
}
enum QueryStrategy {
USE_IP = 0;
USE_IP4 = 1;
USE_IP6 = 2;
}
message Config {
// Nameservers used by this DNS. Only traditional UDP servers are support at
// the moment. A special value 'localhost' as a domain address can be set to
@@ -68,7 +59,8 @@ message Config {
repeated bytes ip = 3;
// ProxiedDomain indicates the mapped domain has the same IP address on this
// domain. Xray will use this domain for IP queries.
// domain. Xray will use this domain for IP queries. This field is only
// effective if ip is empty.
string proxied_domain = 4;
}
@@ -76,14 +68,4 @@ message Config {
// Tag is the inbound tag of DNS client.
string tag = 6;
reserved 7;
// DisableCache disables DNS cache
bool disableCache = 8;
QueryStrategy query_strategy = 9;
bool disableFallback = 10;
bool disableFallbackIfMatch = 11;
}

View File

@@ -2,312 +2,3 @@
package dns
//go:generate go run github.com/xtls/xray-core/common/errors/errorgen
import (
"context"
"fmt"
"strings"
"sync"
"github.com/xtls/xray-core/app/router"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/common/strmatcher"
"github.com/xtls/xray-core/features"
"github.com/xtls/xray-core/features/dns"
)
// DNS is a DNS rely server.
type DNS struct {
sync.Mutex
tag string
disableCache bool
disableFallback bool
disableFallbackIfMatch bool
ipOption *dns.IPOption
hosts *StaticHosts
clients []*Client
ctx context.Context
domainMatcher strmatcher.IndexMatcher
matcherInfos []*DomainMatcherInfo
}
// DomainMatcherInfo contains information attached to index returned by Server.domainMatcher
type DomainMatcherInfo struct {
clientIdx uint16
domainRuleIdx uint16
}
// New creates a new DNS server with given configuration.
func New(ctx context.Context, config *Config) (*DNS, error) {
var tag string
if len(config.Tag) > 0 {
tag = config.Tag
} else {
tag = generateRandomTag()
}
var clientIP net.IP
switch len(config.ClientIp) {
case 0, net.IPv4len, net.IPv6len:
clientIP = net.IP(config.ClientIp)
default:
return nil, newError("unexpected client IP length ", len(config.ClientIp))
}
var ipOption *dns.IPOption
switch config.QueryStrategy {
case QueryStrategy_USE_IP:
ipOption = &dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
}
case QueryStrategy_USE_IP4:
ipOption = &dns.IPOption{
IPv4Enable: true,
IPv6Enable: false,
FakeEnable: false,
}
case QueryStrategy_USE_IP6:
ipOption = &dns.IPOption{
IPv4Enable: false,
IPv6Enable: true,
FakeEnable: false,
}
}
hosts, err := NewStaticHosts(config.StaticHosts, config.Hosts)
if err != nil {
return nil, newError("failed to create hosts").Base(err)
}
clients := []*Client{}
domainRuleCount := 0
for _, ns := range config.NameServer {
domainRuleCount += len(ns.PrioritizedDomain)
}
// MatcherInfos is ensured to cover the maximum index domainMatcher could return, where matcher's index starts from 1
matcherInfos := make([]*DomainMatcherInfo, domainRuleCount+1)
domainMatcher := &strmatcher.MatcherGroup{}
geoipContainer := router.GeoIPMatcherContainer{}
for _, endpoint := range config.NameServers {
features.PrintDeprecatedFeatureWarning("simple DNS server")
client, err := NewSimpleClient(ctx, endpoint, clientIP)
if err != nil {
return nil, newError("failed to create client").Base(err)
}
clients = append(clients, client)
}
for _, ns := range config.NameServer {
clientIdx := len(clients)
updateDomain := func(domainRule strmatcher.Matcher, originalRuleIdx int, matcherInfos []*DomainMatcherInfo) error {
midx := domainMatcher.Add(domainRule)
matcherInfos[midx] = &DomainMatcherInfo{
clientIdx: uint16(clientIdx),
domainRuleIdx: uint16(originalRuleIdx),
}
return nil
}
myClientIP := clientIP
switch len(ns.ClientIp) {
case net.IPv4len, net.IPv6len:
myClientIP = net.IP(ns.ClientIp)
}
client, err := NewClient(ctx, ns, myClientIP, geoipContainer, &matcherInfos, updateDomain)
if err != nil {
return nil, newError("failed to create client").Base(err)
}
clients = append(clients, client)
}
// If there is no DNS client in config, add a `localhost` DNS client
if len(clients) == 0 {
clients = append(clients, NewLocalDNSClient())
}
return &DNS{
tag: tag,
hosts: hosts,
ipOption: ipOption,
clients: clients,
ctx: ctx,
domainMatcher: domainMatcher,
matcherInfos: matcherInfos,
disableCache: config.DisableCache,
disableFallback: config.DisableFallback,
disableFallbackIfMatch: config.DisableFallbackIfMatch,
}, nil
}
// Type implements common.HasType.
func (*DNS) Type() interface{} {
return dns.ClientType()
}
// Start implements common.Runnable.
func (s *DNS) Start() error {
return nil
}
// Close implements common.Closable.
func (s *DNS) Close() error {
return nil
}
// IsOwnLink implements proxy.dns.ownLinkVerifier
func (s *DNS) IsOwnLink(ctx context.Context) bool {
inbound := session.InboundFromContext(ctx)
return inbound != nil && inbound.Tag == s.tag
}
// LookupIP implements dns.Client.
func (s *DNS) LookupIP(domain string, option dns.IPOption) ([]net.IP, error) {
if domain == "" {
return nil, newError("empty domain name")
}
option.IPv4Enable = option.IPv4Enable && s.ipOption.IPv4Enable
option.IPv6Enable = option.IPv6Enable && s.ipOption.IPv6Enable
if !option.IPv4Enable && !option.IPv6Enable {
return nil, dns.ErrEmptyResponse
}
// Normalize the FQDN form query
if strings.HasSuffix(domain, ".") {
domain = domain[:len(domain)-1]
}
// Static host lookup
switch addrs := s.hosts.Lookup(domain, option); {
case addrs == nil: // Domain not recorded in static host
break
case len(addrs) == 0: // Domain recorded, but no valid IP returned (e.g. IPv4 address with only IPv6 enabled)
return nil, dns.ErrEmptyResponse
case len(addrs) == 1 && addrs[0].Family().IsDomain(): // Domain replacement
newError("domain replaced: ", domain, " -> ", addrs[0].Domain()).WriteToLog()
domain = addrs[0].Domain()
default: // Successfully found ip records in static host
newError("returning ", len(addrs), " IP(s) for domain ", domain, " -> ", addrs).WriteToLog()
return toNetIP(addrs)
}
// Name servers lookup
errs := []error{}
ctx := session.ContextWithInbound(s.ctx, &session.Inbound{Tag: s.tag})
for _, client := range s.sortClients(domain) {
if !option.FakeEnable && strings.EqualFold(client.Name(), "FakeDNS") {
newError("skip DNS resolution for domain ", domain, " at server ", client.Name()).AtDebug().WriteToLog()
continue
}
ips, err := client.QueryIP(ctx, domain, option, s.disableCache)
if len(ips) > 0 {
return ips, nil
}
if err != nil {
newError("failed to lookup ip for domain ", domain, " at server ", client.Name()).Base(err).WriteToLog()
errs = append(errs, err)
}
// 5 for RcodeRefused in miekg/dns, hardcode to reduce binary size
if err != context.Canceled && err != context.DeadlineExceeded && err != errExpectedIPNonMatch && err != dns.ErrEmptyResponse && dns.RCodeFromError(err) != 5 {
return nil, err
}
}
return nil, newError("returning nil for domain ", domain).Base(errors.Combine(errs...))
}
// LookupHosts implements dns.HostsLookup.
func (s *DNS) LookupHosts(domain string) *net.Address {
domain = strings.TrimSuffix(domain, ".")
if domain == "" {
return nil
}
// Normalize the FQDN form query
addrs := s.hosts.Lookup(domain, *s.ipOption)
if len(addrs) > 0 {
newError("domain replaced: ", domain, " -> ", addrs[0].String()).AtInfo().WriteToLog()
return &addrs[0]
}
return nil
}
// GetIPOption implements ClientWithIPOption.
func (s *DNS) GetIPOption() *dns.IPOption {
return s.ipOption
}
// SetQueryOption implements ClientWithIPOption.
func (s *DNS) SetQueryOption(isIPv4Enable, isIPv6Enable bool) {
s.ipOption.IPv4Enable = isIPv4Enable
s.ipOption.IPv6Enable = isIPv6Enable
}
// SetFakeDNSOption implements ClientWithIPOption.
func (s *DNS) SetFakeDNSOption(isFakeEnable bool) {
s.ipOption.FakeEnable = isFakeEnable
}
func (s *DNS) sortClients(domain string) []*Client {
clients := make([]*Client, 0, len(s.clients))
clientUsed := make([]bool, len(s.clients))
clientNames := make([]string, 0, len(s.clients))
domainRules := []string{}
// Priority domain matching
hasMatch := false
for _, match := range s.domainMatcher.Match(domain) {
info := s.matcherInfos[match]
client := s.clients[info.clientIdx]
domainRule := client.domains[info.domainRuleIdx]
domainRules = append(domainRules, fmt.Sprintf("%s(DNS idx:%d)", domainRule, info.clientIdx))
if clientUsed[info.clientIdx] {
continue
}
clientUsed[info.clientIdx] = true
clients = append(clients, client)
clientNames = append(clientNames, client.Name())
hasMatch = true
}
if !(s.disableFallback || s.disableFallbackIfMatch && hasMatch) {
// Default round-robin query
for idx, client := range s.clients {
if clientUsed[idx] || client.skipFallback {
continue
}
clientUsed[idx] = true
clients = append(clients, client)
clientNames = append(clientNames, client.Name())
}
}
if len(domainRules) > 0 {
newError("domain ", domain, " matches following rules: ", domainRules).AtDebug().WriteToLog()
}
if len(clientNames) > 0 {
newError("domain ", domain, " will use DNS in order: ", clientNames).AtDebug().WriteToLog()
}
if len(clients) == 0 {
clients = append(clients, s.clients[0])
clientNames = append(clientNames, s.clients[0].Name())
newError("domain ", domain, " will use the first DNS: ", clientNames).AtDebug().WriteToLog()
}
return clients
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
return New(ctx, config.(*Config))
}))
}

View File

@@ -1,24 +1,19 @@
package dns
import (
"context"
"encoding/binary"
"strings"
"time"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/core"
dns_feature "github.com/xtls/xray-core/features/dns"
"golang.org/x/net/dns/dnsmessage"
)
// Fqdn normalizes domain make sure it ends with '.'
// Fqdn normalize domain make sure it ends with '.'
func Fqdn(domain string) string {
if len(domain) > 0 && strings.HasSuffix(domain, ".") {
if len(domain) > 0 && domain[len(domain)-1] == '.' {
return domain
}
return domain + "."
@@ -57,7 +52,9 @@ func isNewer(baseRec *IPRecord, newRec *IPRecord) bool {
return baseRec.Expire.Before(newRec.Expire)
}
var errRecordNotFound = errors.New("record not found")
var (
errRecordNotFound = errors.New("record not found")
)
type dnsRequest struct {
reqType dnsmessage.Type
@@ -115,7 +112,7 @@ func genEDNS0Options(clientIP net.IP) *dnsmessage.Resource {
return opt
}
func buildReqMsgs(domain string, option dns_feature.IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
func buildReqMsgs(domain string, option IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
qA := dnsmessage.Question{
Name: dnsmessage.MustNewName(domain),
Type: dnsmessage.TypeA,
@@ -166,7 +163,7 @@ func buildReqMsgs(domain string, option dns_feature.IPOption, reqIDGen func() ui
return reqs
}
// parseResponse parses DNS answers from the returned payload
// parseResponse parse DNS answers from the returned payload
func parseResponse(payload []byte) (*IPRecord, error) {
var parser dnsmessage.Parser
h, err := parser.Start(payload)
@@ -214,7 +211,7 @@ L:
case dnsmessage.TypeAAAA:
ans, err := parser.AAAAResource()
if err != nil {
newError("failed to parse AAAA record for domain: ", ah.Name).Base(err).WriteToLog()
newError("failed to parse A record for domain: ", ah.Name).Base(err).WriteToLog()
break L
}
ipRecord.IP = append(ipRecord.IP, net.IPAddress(ans.AAAA[:]))
@@ -229,19 +226,3 @@ L:
return ipRecord, nil
}
// toDnsContext create a new background context with parent inbound, session and dns log
func toDnsContext(ctx context.Context, addr string) context.Context {
dnsCtx := core.ToBackgroundDetachedContext(ctx)
if inbound := session.InboundFromContext(ctx); inbound != nil {
dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
}
dnsCtx = session.ContextWithContent(dnsCtx, session.ContentFromContext(ctx))
dnsCtx = log.ContextWithAccessMessage(dnsCtx, &log.AccessMessage{
From: "DNS",
To: addr,
Status: log.AccessAccepted,
Reason: "",
})
return dnsCtx
}

View File

@@ -9,7 +9,6 @@ import (
"github.com/miekg/dns"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
dns_feature "github.com/xtls/xray-core/features/dns"
"golang.org/x/net/dns/dnsmessage"
)
@@ -49,28 +48,20 @@ func Test_parseResponse(t *testing.T) {
want *IPRecord
wantErr bool
}{
{
"empty",
{"empty",
&IPRecord{0, []net.Address(nil), time.Time{}, dnsmessage.RCodeSuccess},
false,
},
{
"error",
{"error",
nil,
true,
},
{
"a record",
&IPRecord{
1,
[]net.Address{net.ParseAddress("8.8.8.8"), net.ParseAddress("8.8.4.4")},
time.Time{},
dnsmessage.RCodeSuccess,
},
{"a record",
&IPRecord{1, []net.Address{net.ParseAddress("8.8.8.8"), net.ParseAddress("8.8.4.4")},
time.Time{}, dnsmessage.RCodeSuccess},
false,
},
{
"aaaa record",
{"aaaa record",
&IPRecord{2, []net.Address{net.ParseAddress("2001::123:8888"), net.ParseAddress("2001::123:8844")}, time.Time{}, dnsmessage.RCodeSuccess},
false,
},
@@ -101,7 +92,7 @@ func Test_buildReqMsgs(t *testing.T) {
}
type args struct {
domain string
option dns_feature.IPOption
option IPOption
reqOpts *dnsmessage.Resource
}
tests := []struct {
@@ -109,26 +100,10 @@ func Test_buildReqMsgs(t *testing.T) {
args args
want int
}{
{"dual stack", args{"test.com", dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
}, nil}, 2},
{"ipv4 only", args{"test.com", dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: false,
FakeEnable: false,
}, nil}, 1},
{"ipv6 only", args{"test.com", dns_feature.IPOption{
IPv4Enable: false,
IPv6Enable: true,
FakeEnable: false,
}, nil}, 1},
{"none/error", args{"test.com", dns_feature.IPOption{
IPv4Enable: false,
IPv6Enable: false,
FakeEnable: false,
}, nil}, 0},
{"dual stack", args{"test.com", IPOption{true, true}, nil}, 2},
{"ipv4 only", args{"test.com", IPOption{true, false}, nil}, 1},
{"ipv6 only", args{"test.com", IPOption{false, true}, nil}, 1},
{"none/error", args{"test.com", IPOption{false, false}, nil}, 0},
}
for _, tt := range tests {
t.Run(tt.name, func(t *testing.T) {

View File

@@ -5,6 +5,7 @@ import (
"context"
"fmt"
"io"
"io/ioutil"
"net/http"
"net/url"
"sync"
@@ -12,7 +13,6 @@ import (
"time"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/net/cnc"
"github.com/xtls/xray-core/common/protocol/dns"
@@ -31,69 +31,30 @@ import (
type DoHNameServer struct {
dispatcher routing.Dispatcher
sync.RWMutex
ips map[string]*record
pub *pubsub.Service
cleanup *task.Periodic
reqID uint32
httpClient *http.Client
dohURL string
name string
queryStrategy QueryStrategy
ips map[string]record
pub *pubsub.Service
cleanup *task.Periodic
reqID uint32
clientIP net.IP
httpClient *http.Client
dohURL string
name string
}
// NewDoHNameServer creates DOH server object for remote resolving.
func NewDoHNameServer(url *url.URL, dispatcher routing.Dispatcher, queryStrategy QueryStrategy) (*DoHNameServer, error) {
// NewDoHNameServer creates DOH client object for remote resolving
func NewDoHNameServer(url *url.URL, dispatcher routing.Dispatcher, clientIP net.IP) (*DoHNameServer, error) {
newError("DNS: created Remote DOH client for ", url.String()).AtInfo().WriteToLog()
s := baseDOHNameServer(url, "DOH", queryStrategy)
s := baseDOHNameServer(url, "DOH", clientIP)
s.dispatcher = dispatcher
tr := &http.Transport{
MaxIdleConns: 30,
IdleConnTimeout: 90 * time.Second,
TLSHandshakeTimeout: 30 * time.Second,
ForceAttemptHTTP2: true,
DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
dest, err := net.ParseDestination(network + ":" + addr)
if err != nil {
return nil, err
}
link, err := s.dispatcher.Dispatch(toDnsContext(ctx, s.dohURL), dest)
select {
case <-ctx.Done():
return nil, ctx.Err()
default:
}
if err != nil {
return nil, err
}
cc := common.ChainedClosable{}
if cw, ok := link.Writer.(common.Closable); ok {
cc = append(cc, cw)
}
if cr, ok := link.Reader.(common.Closable); ok {
cc = append(cc, cr)
}
return cnc.NewConnection(
cnc.ConnectionInputMulti(link.Writer),
cnc.ConnectionOutputMulti(link.Reader),
cnc.ConnectionOnClose(cc),
), nil
},
}
s.httpClient = &http.Client{
Timeout: time.Second * 180,
Transport: tr,
}
return s, nil
}
// NewDoHLocalNameServer creates DOH client object for local resolving
func NewDoHLocalNameServer(url *url.URL, queryStrategy QueryStrategy) *DoHNameServer {
func NewDoHLocalNameServer(url *url.URL, clientIP net.IP) *DoHNameServer {
url.Scheme = "https"
s := baseDOHNameServer(url, "DOHL", queryStrategy)
s := baseDOHNameServer(url, "DOHL", clientIP)
tr := &http.Transport{
IdleConnTimeout: 90 * time.Second,
ForceAttemptHTTP2: true,
@@ -103,12 +64,6 @@ func NewDoHLocalNameServer(url *url.URL, queryStrategy QueryStrategy) *DoHNameSe
return nil, err
}
conn, err := internet.DialSystem(ctx, dest, nil)
log.Record(&log.AccessMessage{
From: "DNS",
To: s.dohURL,
Status: log.AccessAccepted,
Detour: "local",
})
if err != nil {
return nil, err
}
@@ -123,22 +78,23 @@ func NewDoHLocalNameServer(url *url.URL, queryStrategy QueryStrategy) *DoHNameSe
return s
}
func baseDOHNameServer(url *url.URL, prefix string, queryStrategy QueryStrategy) *DoHNameServer {
func baseDOHNameServer(url *url.URL, prefix string, clientIP net.IP) *DoHNameServer {
s := &DoHNameServer{
ips: make(map[string]*record),
pub: pubsub.NewService(),
name: prefix + "//" + url.Host,
dohURL: url.String(),
queryStrategy: queryStrategy,
ips: make(map[string]record),
clientIP: clientIP,
pub: pubsub.NewService(),
name: prefix + "//" + url.Host,
dohURL: url.String(),
}
s.cleanup = &task.Periodic{
Interval: time.Minute,
Execute: s.Cleanup,
}
return s
}
// Name implements Server.
// Name returns client name
func (s *DoHNameServer) Name() string {
return s.name
}
@@ -170,7 +126,7 @@ func (s *DoHNameServer) Cleanup() error {
}
if len(s.ips) == 0 {
s.ips = make(map[string]*record)
s.ips = make(map[string]record)
}
return nil
@@ -180,10 +136,7 @@ func (s *DoHNameServer) updateIP(req *dnsRequest, ipRec *IPRecord) {
elapsed := time.Since(req.start)
s.Lock()
rec, found := s.ips[req.domain]
if !found {
rec = &record{}
}
rec := s.ips[req.domain]
updated := false
switch req.reqType {
@@ -193,7 +146,7 @@ func (s *DoHNameServer) updateIP(req *dnsRequest, ipRec *IPRecord) {
updated = true
}
case dnsmessage.TypeAAAA:
addr := make([]net.Address, 0, len(ipRec.IP))
addr := make([]net.Address, 0)
for _, ip := range ipRec.IP {
if len(ip.IP()) == net.IPv6len {
addr = append(addr, ip)
@@ -224,7 +177,7 @@ func (s *DoHNameServer) newReqID() uint16 {
return uint16(atomic.AddUint32(&s.reqID, 1))
}
func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption) {
func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPOption) {
newError(s.name, " querying: ", domain).AtInfo().WriteToLog(session.ExportIDToError(ctx))
if s.name+"." == "DOH//"+domain {
@@ -232,7 +185,7 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, clientIP n
return
}
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(clientIP))
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
var deadline time.Time
if d, ok := ctx.Deadline(); ok {
@@ -245,7 +198,7 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, clientIP n
go func(r *dnsRequest) {
// generate new context for each req, using same context
// may cause reqs all aborted if any one encounter an error
dnsCtx := ctx
dnsCtx := context.Background()
// reserve internal dns server requested Inbound
if inbound := session.InboundFromContext(ctx); inbound != nil {
@@ -253,8 +206,8 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, clientIP n
}
dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
Protocol: "https",
SkipDNSResolve: true,
Protocol: "https",
//SkipRoutePick: true,
})
// forced to use mux for DOH
@@ -296,6 +249,41 @@ func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte,
hc := s.httpClient
// Dispatched connection will be closed (interrupted) after each request
// This makes DOH inefficient without a keep-alived connection
// See: core/app/proxyman/outbound/handler.go:113
// Using mux (https request wrapped in a stream layer) improves the situation.
// Recommend to use NewDoHLocalNameServer (DOHL:) if xray instance is running on
// a normal network eg. the server side of xray
if s.dispatcher != nil {
tr := &http.Transport{
MaxIdleConns: 30,
IdleConnTimeout: 90 * time.Second,
TLSHandshakeTimeout: 30 * time.Second,
ForceAttemptHTTP2: true,
DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
dest, err := net.ParseDestination(network + ":" + addr)
if err != nil {
return nil, err
}
link, err := s.dispatcher.Dispatch(ctx, dest)
if err != nil {
return nil, err
}
return cnc.NewConnection(
cnc.ConnectionInputMulti(link.Writer),
cnc.ConnectionOutputMulti(link.Reader),
), nil
},
}
hc = &http.Client{
Timeout: time.Second * 180,
Transport: tr,
}
}
resp, err := hc.Do(req.WithContext(ctx))
if err != nil {
return nil, err
@@ -303,14 +291,14 @@ func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte,
defer resp.Body.Close()
if resp.StatusCode != http.StatusOK {
io.Copy(io.Discard, resp.Body) // flush resp.Body so that the conn is reusable
io.Copy(ioutil.Discard, resp.Body) // flush resp.Body so that the conn is reusable
return nil, fmt.Errorf("DOH server returned code %d", resp.StatusCode)
}
return io.ReadAll(resp.Body)
return ioutil.ReadAll(resp.Body)
}
func (s *DoHNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.IP, error) {
s.RLock()
record, found := s.ips[domain]
s.RUnlock()
@@ -319,30 +307,30 @@ func (s *DoHNameServer) findIPsForDomain(domain string, option dns_feature.IPOpt
return nil, errRecordNotFound
}
var err4 error
var err6 error
var ips []net.Address
var ip6 []net.Address
if option.IPv4Enable {
ips, err4 = record.A.getIPs()
var lastErr error
if option.IPv6Enable && record.AAAA != nil && record.AAAA.RCode == dnsmessage.RCodeSuccess {
aaaa, err := record.AAAA.getIPs()
if err != nil {
lastErr = err
}
ips = append(ips, aaaa...)
}
if option.IPv6Enable {
ip6, err6 = record.AAAA.getIPs()
ips = append(ips, ip6...)
if option.IPv4Enable && record.A != nil && record.A.RCode == dnsmessage.RCodeSuccess {
a, err := record.A.getIPs()
if err != nil {
lastErr = err
}
ips = append(ips, a...)
}
if len(ips) > 0 {
return toNetIP(ips)
return toNetIP(ips), nil
}
if err4 != nil {
return nil, err4
}
if err6 != nil {
return nil, err6
if lastErr != nil {
return nil, lastErr
}
if (option.IPv4Enable && record.A != nil) || (option.IPv6Enable && record.AAAA != nil) {
@@ -352,23 +340,14 @@ func (s *DoHNameServer) findIPsForDomain(domain string, option dns_feature.IPOpt
return nil, errRecordNotFound
}
// QueryIP implements Server.
func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption, disableCache bool) ([]net.IP, error) { // nolint: dupl
// QueryIP is called from dns.Server->queryIPTimeout
func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
fqdn := Fqdn(domain)
option = ResolveIpOptionOverride(s.queryStrategy, option)
if !option.IPv4Enable && !option.IPv6Enable {
return nil, dns_feature.ErrEmptyResponse
}
if disableCache {
newError("DNS cache is disabled. Querying IP for ", domain, " at ", s.name).AtDebug().WriteToLog()
} else {
ips, err := s.findIPsForDomain(fqdn, option)
if err != errRecordNotFound {
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSCacheHit, Elapsed: 0, Error: err})
return ips, err
}
ips, err := s.findIPsForDomain(fqdn, option)
if err != errRecordNotFound {
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
return ips, err
}
// ipv4 and ipv6 belong to different subscription groups
@@ -397,13 +376,11 @@ func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, clientIP net
}
close(done)
}()
s.sendQuery(ctx, fqdn, clientIP, option)
start := time.Now()
s.sendQuery(ctx, fqdn, option)
for {
ips, err := s.findIPsForDomain(fqdn, option)
if err != errRecordNotFound {
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
return ips, err
}

View File

@@ -1,250 +0,0 @@
package fakedns
import (
"context"
"math"
"math/big"
gonet "net"
"sync"
"time"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/cache"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/features/dns"
)
type Holder struct {
domainToIP cache.Lru
ipRange *gonet.IPNet
mu *sync.Mutex
config *FakeDnsPool
}
func (fkdns *Holder) IsIPInIPPool(ip net.Address) bool {
if ip.Family().IsDomain() {
return false
}
return fkdns.ipRange.Contains(ip.IP())
}
func (fkdns *Holder) GetFakeIPForDomain3(domain string, ipv4, ipv6 bool) []net.Address {
isIPv6 := fkdns.ipRange.IP.To4() == nil
if (isIPv6 && ipv6) || (!isIPv6 && ipv4) {
return fkdns.GetFakeIPForDomain(domain)
}
return []net.Address{}
}
func (*Holder) Type() interface{} {
return (*dns.FakeDNSEngine)(nil)
}
func (fkdns *Holder) Start() error {
if fkdns.config != nil && fkdns.config.IpPool != "" && fkdns.config.LruSize != 0 {
return fkdns.initializeFromConfig()
}
return newError("invalid fakeDNS setting")
}
func (fkdns *Holder) Close() error {
fkdns.domainToIP = nil
fkdns.ipRange = nil
fkdns.mu = nil
return nil
}
func NewFakeDNSHolder() (*Holder, error) {
var fkdns *Holder
var err error
if fkdns, err = NewFakeDNSHolderConfigOnly(nil); err != nil {
return nil, newError("Unable to create Fake Dns Engine").Base(err).AtError()
}
err = fkdns.initialize(dns.FakeIPv4Pool, 65535)
if err != nil {
return nil, err
}
return fkdns, nil
}
func NewFakeDNSHolderConfigOnly(conf *FakeDnsPool) (*Holder, error) {
return &Holder{nil, nil, nil, conf}, nil
}
func (fkdns *Holder) initializeFromConfig() error {
return fkdns.initialize(fkdns.config.IpPool, int(fkdns.config.LruSize))
}
func (fkdns *Holder) initialize(ipPoolCidr string, lruSize int) error {
var ipRange *gonet.IPNet
var err error
if _, ipRange, err = gonet.ParseCIDR(ipPoolCidr); err != nil {
return newError("Unable to parse CIDR for Fake DNS IP assignment").Base(err).AtError()
}
ones, bits := ipRange.Mask.Size()
rooms := bits - ones
if math.Log2(float64(lruSize)) >= float64(rooms) {
return newError("LRU size is bigger than subnet size").AtError()
}
fkdns.domainToIP = cache.NewLru(lruSize)
fkdns.ipRange = ipRange
fkdns.mu = new(sync.Mutex)
return nil
}
// GetFakeIPForDomain checks and generates a fake IP for a domain name
func (fkdns *Holder) GetFakeIPForDomain(domain string) []net.Address {
fkdns.mu.Lock()
defer fkdns.mu.Unlock()
if v, ok := fkdns.domainToIP.Get(domain); ok {
return []net.Address{v.(net.Address)}
}
currentTimeMillis := uint64(time.Now().UnixNano() / 1e6)
ones, bits := fkdns.ipRange.Mask.Size()
rooms := bits - ones
if rooms < 64 {
currentTimeMillis %= (uint64(1) << rooms)
}
bigIntIP := big.NewInt(0).SetBytes(fkdns.ipRange.IP)
bigIntIP = bigIntIP.Add(bigIntIP, new(big.Int).SetUint64(currentTimeMillis))
var ip net.Address
for {
ip = net.IPAddress(bigIntIP.Bytes())
// if we run for a long time, we may go back to beginning and start seeing the IP in use
if _, ok := fkdns.domainToIP.PeekKeyFromValue(ip); !ok {
break
}
bigIntIP = bigIntIP.Add(bigIntIP, big.NewInt(1))
if !fkdns.ipRange.Contains(bigIntIP.Bytes()) {
bigIntIP = big.NewInt(0).SetBytes(fkdns.ipRange.IP)
}
}
fkdns.domainToIP.Put(domain, ip)
return []net.Address{ip}
}
// GetDomainFromFakeDNS checks if an IP is a fake IP and have corresponding domain name
func (fkdns *Holder) GetDomainFromFakeDNS(ip net.Address) string {
if !ip.Family().IsIP() || !fkdns.ipRange.Contains(ip.IP()) {
return ""
}
if k, ok := fkdns.domainToIP.GetKeyFromValue(ip); ok {
return k.(string)
}
newError("A fake ip request to ", ip, ", however there is no matching domain name in fake DNS").AtInfo().WriteToLog()
return ""
}
type HolderMulti struct {
holders []*Holder
config *FakeDnsPoolMulti
}
func (h *HolderMulti) IsIPInIPPool(ip net.Address) bool {
if ip.Family().IsDomain() {
return false
}
for _, v := range h.holders {
if v.IsIPInIPPool(ip) {
return true
}
}
return false
}
func (h *HolderMulti) GetFakeIPForDomain3(domain string, ipv4, ipv6 bool) []net.Address {
var ret []net.Address
for _, v := range h.holders {
ret = append(ret, v.GetFakeIPForDomain3(domain, ipv4, ipv6)...)
}
return ret
}
func (h *HolderMulti) GetFakeIPForDomain(domain string) []net.Address {
var ret []net.Address
for _, v := range h.holders {
ret = append(ret, v.GetFakeIPForDomain(domain)...)
}
return ret
}
func (h *HolderMulti) GetDomainFromFakeDNS(ip net.Address) string {
for _, v := range h.holders {
if domain := v.GetDomainFromFakeDNS(ip); domain != "" {
return domain
}
}
return ""
}
func (h *HolderMulti) Type() interface{} {
return (*dns.FakeDNSEngine)(nil)
}
func (h *HolderMulti) Start() error {
for _, v := range h.holders {
if v.config != nil && v.config.IpPool != "" && v.config.LruSize != 0 {
if err := v.Start(); err != nil {
return newError("Cannot start all fake dns pools").Base(err)
}
} else {
return newError("invalid fakeDNS setting")
}
}
return nil
}
func (h *HolderMulti) Close() error {
for _, v := range h.holders {
if err := v.Close(); err != nil {
return newError("Cannot close all fake dns pools").Base(err)
}
}
return nil
}
func (h *HolderMulti) createHolderGroups() error {
for _, v := range h.config.Pools {
holder, err := NewFakeDNSHolderConfigOnly(v)
if err != nil {
return err
}
h.holders = append(h.holders, holder)
}
return nil
}
func NewFakeDNSHolderMulti(conf *FakeDnsPoolMulti) (*HolderMulti, error) {
holderMulti := &HolderMulti{nil, conf}
if err := holderMulti.createHolderGroups(); err != nil {
return nil, err
}
return holderMulti, nil
}
func init() {
common.Must(common.RegisterConfig((*FakeDnsPool)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
var f *Holder
var err error
if f, err = NewFakeDNSHolderConfigOnly(config.(*FakeDnsPool)); err != nil {
return nil, err
}
return f, nil
}))
common.Must(common.RegisterConfig((*FakeDnsPoolMulti)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
var f *HolderMulti
var err error
if f, err = NewFakeDNSHolderMulti(config.(*FakeDnsPoolMulti)); err != nil {
return nil, err
}
return f, nil
}))
}

View File

@@ -1,224 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// source: app/dns/fakedns/fakedns.proto
package fakedns
import (
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
type FakeDnsPool struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
IpPool string `protobuf:"bytes,1,opt,name=ip_pool,json=ipPool,proto3" json:"ip_pool,omitempty"` //CIDR of IP pool used as fake DNS IP
LruSize int64 `protobuf:"varint,2,opt,name=lruSize,proto3" json:"lruSize,omitempty"` //Size of Pool for remembering relationship between domain name and IP address
}
func (x *FakeDnsPool) Reset() {
*x = FakeDnsPool{}
if protoimpl.UnsafeEnabled {
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
}
func (x *FakeDnsPool) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*FakeDnsPool) ProtoMessage() {}
func (x *FakeDnsPool) ProtoReflect() protoreflect.Message {
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
if protoimpl.UnsafeEnabled && x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use FakeDnsPool.ProtoReflect.Descriptor instead.
func (*FakeDnsPool) Descriptor() ([]byte, []int) {
return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{0}
}
func (x *FakeDnsPool) GetIpPool() string {
if x != nil {
return x.IpPool
}
return ""
}
func (x *FakeDnsPool) GetLruSize() int64 {
if x != nil {
return x.LruSize
}
return 0
}
type FakeDnsPoolMulti struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
Pools []*FakeDnsPool `protobuf:"bytes,1,rep,name=pools,proto3" json:"pools,omitempty"`
}
func (x *FakeDnsPoolMulti) Reset() {
*x = FakeDnsPoolMulti{}
if protoimpl.UnsafeEnabled {
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[1]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
}
func (x *FakeDnsPoolMulti) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*FakeDnsPoolMulti) ProtoMessage() {}
func (x *FakeDnsPoolMulti) ProtoReflect() protoreflect.Message {
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[1]
if protoimpl.UnsafeEnabled && x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use FakeDnsPoolMulti.ProtoReflect.Descriptor instead.
func (*FakeDnsPoolMulti) Descriptor() ([]byte, []int) {
return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{1}
}
func (x *FakeDnsPoolMulti) GetPools() []*FakeDnsPool {
if x != nil {
return x.Pools
}
return nil
}
var File_app_dns_fakedns_fakedns_proto protoreflect.FileDescriptor
var file_app_dns_fakedns_fakedns_proto_rawDesc = []byte{
0x0a, 0x1d, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e,
0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12,
0x14, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61,
0x6b, 0x65, 0x64, 0x6e, 0x73, 0x22, 0x40, 0x0a, 0x0b, 0x46, 0x61, 0x6b, 0x65, 0x44, 0x6e, 0x73,
0x50, 0x6f, 0x6f, 0x6c, 0x12, 0x17, 0x0a, 0x07, 0x69, 0x70, 0x5f, 0x70, 0x6f, 0x6f, 0x6c, 0x18,
0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x69, 0x70, 0x50, 0x6f, 0x6f, 0x6c, 0x12, 0x18, 0x0a,
0x07, 0x6c, 0x72, 0x75, 0x53, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x07,
0x6c, 0x72, 0x75, 0x53, 0x69, 0x7a, 0x65, 0x22, 0x4b, 0x0a, 0x10, 0x46, 0x61, 0x6b, 0x65, 0x44,
0x6e, 0x73, 0x50, 0x6f, 0x6f, 0x6c, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x12, 0x37, 0x0a, 0x05, 0x70,
0x6f, 0x6f, 0x6c, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61,
0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e,
0x73, 0x2e, 0x46, 0x61, 0x6b, 0x65, 0x44, 0x6e, 0x73, 0x50, 0x6f, 0x6f, 0x6c, 0x52, 0x05, 0x70,
0x6f, 0x6f, 0x6c, 0x73, 0x42, 0x5e, 0x0a, 0x18, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79,
0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73,
0x50, 0x01, 0x5a, 0x29, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78,
0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70,
0x70, 0x2f, 0x64, 0x6e, 0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73, 0xaa, 0x02, 0x14,
0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x2e, 0x46, 0x61, 0x6b,
0x65, 0x64, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
}
var (
file_app_dns_fakedns_fakedns_proto_rawDescOnce sync.Once
file_app_dns_fakedns_fakedns_proto_rawDescData = file_app_dns_fakedns_fakedns_proto_rawDesc
)
func file_app_dns_fakedns_fakedns_proto_rawDescGZIP() []byte {
file_app_dns_fakedns_fakedns_proto_rawDescOnce.Do(func() {
file_app_dns_fakedns_fakedns_proto_rawDescData = protoimpl.X.CompressGZIP(file_app_dns_fakedns_fakedns_proto_rawDescData)
})
return file_app_dns_fakedns_fakedns_proto_rawDescData
}
var file_app_dns_fakedns_fakedns_proto_msgTypes = make([]protoimpl.MessageInfo, 2)
var file_app_dns_fakedns_fakedns_proto_goTypes = []interface{}{
(*FakeDnsPool)(nil), // 0: xray.app.dns.fakedns.FakeDnsPool
(*FakeDnsPoolMulti)(nil), // 1: xray.app.dns.fakedns.FakeDnsPoolMulti
}
var file_app_dns_fakedns_fakedns_proto_depIdxs = []int32{
0, // 0: xray.app.dns.fakedns.FakeDnsPoolMulti.pools:type_name -> xray.app.dns.fakedns.FakeDnsPool
1, // [1:1] is the sub-list for method output_type
1, // [1:1] is the sub-list for method input_type
1, // [1:1] is the sub-list for extension type_name
1, // [1:1] is the sub-list for extension extendee
0, // [0:1] is the sub-list for field type_name
}
func init() { file_app_dns_fakedns_fakedns_proto_init() }
func file_app_dns_fakedns_fakedns_proto_init() {
if File_app_dns_fakedns_fakedns_proto != nil {
return
}
if !protoimpl.UnsafeEnabled {
file_app_dns_fakedns_fakedns_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
switch v := v.(*FakeDnsPool); i {
case 0:
return &v.state
case 1:
return &v.sizeCache
case 2:
return &v.unknownFields
default:
return nil
}
}
file_app_dns_fakedns_fakedns_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} {
switch v := v.(*FakeDnsPoolMulti); i {
case 0:
return &v.state
case 1:
return &v.sizeCache
case 2:
return &v.unknownFields
default:
return nil
}
}
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: file_app_dns_fakedns_fakedns_proto_rawDesc,
NumEnums: 0,
NumMessages: 2,
NumExtensions: 0,
NumServices: 0,
},
GoTypes: file_app_dns_fakedns_fakedns_proto_goTypes,
DependencyIndexes: file_app_dns_fakedns_fakedns_proto_depIdxs,
MessageInfos: file_app_dns_fakedns_fakedns_proto_msgTypes,
}.Build()
File_app_dns_fakedns_fakedns_proto = out.File
file_app_dns_fakedns_fakedns_proto_rawDesc = nil
file_app_dns_fakedns_fakedns_proto_goTypes = nil
file_app_dns_fakedns_fakedns_proto_depIdxs = nil
}

View File

@@ -1,16 +0,0 @@
syntax = "proto3";
package xray.app.dns.fakedns;
option csharp_namespace = "Xray.App.Dns.Fakedns";
option go_package = "github.com/xtls/xray-core/app/dns/fakedns";
option java_package = "com.xray.app.dns.fakedns";
option java_multiple_files = true;
message FakeDnsPool{
string ip_pool = 1; //CIDR of IP pool used as fake DNS IP
int64 lruSize = 2; //Size of Pool for remembering relationship between domain name and IP address
}
message FakeDnsPoolMulti{
repeated FakeDnsPool pools = 1;
}

View File

@@ -1,206 +0,0 @@
package fakedns
import (
gonet "net"
"strconv"
"testing"
"github.com/stretchr/testify/assert"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/uuid"
"github.com/xtls/xray-core/features/dns"
"golang.org/x/sync/errgroup"
)
var ipPrefix = "198.1"
func TestNewFakeDnsHolder(_ *testing.T) {
_, err := NewFakeDNSHolder()
common.Must(err)
}
func TestFakeDnsHolderCreateMapping(t *testing.T) {
fkdns, err := NewFakeDNSHolder()
common.Must(err)
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
}
func TestFakeDnsHolderCreateMappingMany(t *testing.T) {
fkdns, err := NewFakeDNSHolder()
common.Must(err)
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
assert.Equal(t, ipPrefix, addr2[0].IP().String()[0:len(ipPrefix)])
assert.NotEqual(t, addr[0].IP().String(), addr2[0].IP().String())
}
func TestFakeDnsHolderCreateMappingManyAndResolve(t *testing.T) {
fkdns, err := NewFakeDNSHolder()
common.Must(err)
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
{
result := fkdns.GetDomainFromFakeDNS(addr[0])
assert.Equal(t, "fakednstest.example.com", result)
}
{
result := fkdns.GetDomainFromFakeDNS(addr2[0])
assert.Equal(t, "fakednstest2.example.com", result)
}
}
func TestFakeDnsHolderCreateMappingManySingleDomain(t *testing.T) {
fkdns, err := NewFakeDNSHolder()
common.Must(err)
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
addr2 := fkdns.GetFakeIPForDomain("fakednstest.example.com")
assert.Equal(t, addr[0].IP().String(), addr2[0].IP().String())
}
func TestGetFakeIPForDomainConcurrently(t *testing.T) {
fkdns, err := NewFakeDNSHolder()
common.Must(err)
total := 200
addr := make([][]net.Address, total)
var errg errgroup.Group
for i := 0; i < total; i++ {
errg.Go(testGetFakeIP(i, addr, fkdns))
}
errg.Wait()
for i := 0; i < total; i++ {
for j := i + 1; j < total; j++ {
assert.NotEqual(t, addr[i][0].IP().String(), addr[j][0].IP().String())
}
}
}
func testGetFakeIP(index int, addr [][]net.Address, fkdns *Holder) func() error {
return func() error {
addr[index] = fkdns.GetFakeIPForDomain("fakednstest" + strconv.Itoa(index) + ".example.com")
return nil
}
}
func TestFakeDnsHolderCreateMappingAndRollOver(t *testing.T) {
fkdns, err := NewFakeDNSHolderConfigOnly(&FakeDnsPool{
IpPool: dns.FakeIPv4Pool,
LruSize: 256,
})
common.Must(err)
err = fkdns.Start()
common.Must(err)
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
for i := 0; i <= 8192; i++ {
{
result := fkdns.GetDomainFromFakeDNS(addr[0])
assert.Equal(t, "fakednstest.example.com", result)
}
{
result := fkdns.GetDomainFromFakeDNS(addr2[0])
assert.Equal(t, "fakednstest2.example.com", result)
}
{
uuid := uuid.New()
domain := uuid.String() + ".fakednstest.example.com"
tempAddr := fkdns.GetFakeIPForDomain(domain)
rsaddr := tempAddr[0].IP().String()
result := fkdns.GetDomainFromFakeDNS(net.ParseAddress(rsaddr))
assert.Equal(t, domain, result)
}
}
}
func TestFakeDNSMulti(t *testing.T) {
fakeMulti, err := NewFakeDNSHolderMulti(&FakeDnsPoolMulti{
Pools: []*FakeDnsPool{{
IpPool: "240.0.0.0/12",
LruSize: 256,
}, {
IpPool: "fddd:c5b4:ff5f:f4f0::/64",
LruSize: 256,
}},
},
)
common.Must(err)
err = fakeMulti.Start()
common.Must(err)
assert.Nil(t, err, "Should not throw error")
_ = fakeMulti
t.Run("checkInRange", func(t *testing.T) {
t.Run("ipv4", func(t *testing.T) {
inPool := fakeMulti.IsIPInIPPool(net.IPAddress([]byte{240, 0, 0, 5}))
assert.True(t, inPool)
})
t.Run("ipv6", func(t *testing.T) {
ip, err := gonet.ResolveIPAddr("ip", "fddd:c5b4:ff5f:f4f0::5")
assert.Nil(t, err)
inPool := fakeMulti.IsIPInIPPool(net.IPAddress(ip.IP))
assert.True(t, inPool)
})
t.Run("ipv4_inverse", func(t *testing.T) {
inPool := fakeMulti.IsIPInIPPool(net.IPAddress([]byte{241, 0, 0, 5}))
assert.False(t, inPool)
})
t.Run("ipv6_inverse", func(t *testing.T) {
ip, err := gonet.ResolveIPAddr("ip", "fcdd:c5b4:ff5f:f4f0::5")
assert.Nil(t, err)
inPool := fakeMulti.IsIPInIPPool(net.IPAddress(ip.IP))
assert.False(t, inPool)
})
})
t.Run("allocateTwoAddressForTwoPool", func(t *testing.T) {
address := fakeMulti.GetFakeIPForDomain("fakednstest.example.com")
assert.Len(t, address, 2, "should be 2 address one for each pool")
t.Run("eachOfThemShouldResolve:0", func(t *testing.T) {
domain := fakeMulti.GetDomainFromFakeDNS(address[0])
assert.Equal(t, "fakednstest.example.com", domain)
})
t.Run("eachOfThemShouldResolve:1", func(t *testing.T) {
domain := fakeMulti.GetDomainFromFakeDNS(address[1])
assert.Equal(t, "fakednstest.example.com", domain)
})
})
t.Run("understandIPTypeSelector", func(t *testing.T) {
t.Run("ipv4", func(t *testing.T) {
address := fakeMulti.GetFakeIPForDomain3("fakednstestipv4.example.com", true, false)
assert.Len(t, address, 1, "should be 1 address")
assert.True(t, address[0].Family().IsIPv4())
})
t.Run("ipv6", func(t *testing.T) {
address := fakeMulti.GetFakeIPForDomain3("fakednstestipv6.example.com", false, true)
assert.Len(t, address, 1, "should be 1 address")
assert.True(t, address[0].Family().IsIPv6())
})
t.Run("ipv46", func(t *testing.T) {
address := fakeMulti.GetFakeIPForDomain3("fakednstestipv46.example.com", true, true)
assert.Len(t, address, 2, "should be 2 address")
assert.True(t, address[0].Family().IsIPv4())
assert.True(t, address[1].Family().IsIPv6())
})
})
}

View File

@@ -5,7 +5,6 @@ import (
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/strmatcher"
"github.com/xtls/xray-core/features"
"github.com/xtls/xray-core/features/dns"
)
// StaticHosts represents static domain-ip mapping in DNS server.
@@ -14,6 +13,25 @@ type StaticHosts struct {
matchers *strmatcher.MatcherGroup
}
var typeMap = map[DomainMatchingType]strmatcher.Type{
DomainMatchingType_Full: strmatcher.Full,
DomainMatchingType_Subdomain: strmatcher.Domain,
DomainMatchingType_Keyword: strmatcher.Substr,
DomainMatchingType_Regex: strmatcher.Regex,
}
func toStrMatcher(t DomainMatchingType, domain string) (strmatcher.Matcher, error) {
strMType, f := typeMap[t]
if !f {
return nil, newError("unknown mapping type", t).AtWarning()
}
matcher, err := strMType.New(domain)
if err != nil {
return nil, newError("failed to create str matcher").Base(err)
}
return matcher, nil
}
// NewStaticHosts creates a new StaticHosts instance.
func NewStaticHosts(hosts []*Config_HostMapping, legacy map[string]*net.IPOrDomain) (*StaticHosts, error) {
g := new(strmatcher.MatcherGroup)
@@ -47,8 +65,6 @@ func NewStaticHosts(hosts []*Config_HostMapping, legacy map[string]*net.IPOrDoma
id := g.Add(matcher)
ips := make([]net.Address, 0, len(mapping.Ip)+1)
switch {
case len(mapping.ProxiedDomain) > 0:
ips = append(ips, net.DomainAddress(mapping.ProxiedDomain))
case len(mapping.Ip) > 0:
for _, ip := range mapping.Ip {
addr := net.IPAddress(ip)
@@ -57,53 +73,50 @@ func NewStaticHosts(hosts []*Config_HostMapping, legacy map[string]*net.IPOrDoma
}
ips = append(ips, addr)
}
case len(mapping.ProxiedDomain) > 0:
ips = append(ips, net.DomainAddress(mapping.ProxiedDomain))
default:
return nil, newError("neither IP address nor proxied domain specified for domain: ", mapping.Domain).AtWarning()
}
// Special handling for localhost IPv6. This is a dirty workaround as JSON config supports only single IP mapping.
if len(ips) == 1 && ips[0] == net.LocalHostIP {
ips = append(ips, net.LocalHostIPv6)
}
sh.ips[id] = ips
}
return sh, nil
}
func filterIP(ips []net.Address, option dns.IPOption) []net.Address {
func filterIP(ips []net.Address, option IPOption) []net.Address {
filtered := make([]net.Address, 0, len(ips))
for _, ip := range ips {
if (ip.Family().IsIPv4() && option.IPv4Enable) || (ip.Family().IsIPv6() && option.IPv6Enable) {
filtered = append(filtered, ip)
}
}
if len(filtered) == 0 {
return nil
}
return filtered
}
func (h *StaticHosts) lookupInternal(domain string) []net.Address {
var ips []net.Address
for _, id := range h.matchers.Match(domain) {
// LookupIP returns IP address for the given domain, if exists in this StaticHosts.
func (h *StaticHosts) LookupIP(domain string, option IPOption) []net.Address {
indices := h.matchers.Match(domain)
if len(indices) == 0 {
return nil
}
ips := []net.Address{}
for _, id := range indices {
ips = append(ips, h.ips[id]...)
}
return ips
}
func (h *StaticHosts) lookup(domain string, option dns.IPOption, maxDepth int) []net.Address {
switch addrs := h.lookupInternal(domain); {
case len(addrs) == 0: // Not recorded in static hosts, return nil
return nil
case len(addrs) == 1 && addrs[0].Family().IsDomain(): // Try to unwrap domain
newError("found replaced domain: ", domain, " -> ", addrs[0].Domain(), ". Try to unwrap it").AtDebug().WriteToLog()
if maxDepth > 0 {
unwrapped := h.lookup(addrs[0].Domain(), option, maxDepth-1)
if unwrapped != nil {
return unwrapped
}
}
return addrs
default: // IP record found, return a non-nil IP array
return filterIP(addrs, option)
if len(ips) == 1 && ips[0].Family().IsDomain() {
return ips
}
}
// Lookup returns IP addresses or proxied domain for the given domain, if exists in this StaticHosts.
func (h *StaticHosts) Lookup(domain string, option dns.IPOption) []net.Address {
return h.lookup(domain, option, 5)
return filterIP(ips, option)
}

View File

@@ -4,10 +4,10 @@ import (
"testing"
"github.com/google/go-cmp/cmp"
. "github.com/xtls/xray-core/app/dns"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/features/dns"
)
func TestStaticHosts(t *testing.T) {
@@ -19,20 +19,6 @@ func TestStaticHosts(t *testing.T) {
{1, 1, 1, 1},
},
},
{
Type: DomainMatchingType_Full,
Domain: "proxy.xray.com",
Ip: [][]byte{
{1, 2, 3, 4},
{0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1},
},
ProxiedDomain: "another-proxy.xray.com",
},
{
Type: DomainMatchingType_Full,
Domain: "proxy2.xray.com",
ProxiedDomain: "proxy.xray.com",
},
{
Type: DomainMatchingType_Subdomain,
Domain: "example.cn",
@@ -45,7 +31,6 @@ func TestStaticHosts(t *testing.T) {
Domain: "baidu.com",
Ip: [][]byte{
{127, 0, 0, 1},
{0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1},
},
},
}
@@ -54,7 +39,7 @@ func TestStaticHosts(t *testing.T) {
common.Must(err)
{
ips := hosts.Lookup("example.com", dns.IPOption{
ips := hosts.LookupIP("example.com", IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
@@ -67,33 +52,7 @@ func TestStaticHosts(t *testing.T) {
}
{
domain := hosts.Lookup("proxy.xray.com", dns.IPOption{
IPv4Enable: true,
IPv6Enable: false,
})
if len(domain) != 1 {
t.Error("expect 1 domain, but got ", len(domain))
}
if diff := cmp.Diff(domain[0].Domain(), "another-proxy.xray.com"); diff != "" {
t.Error(diff)
}
}
{
domain := hosts.Lookup("proxy2.xray.com", dns.IPOption{
IPv4Enable: true,
IPv6Enable: false,
})
if len(domain) != 1 {
t.Error("expect 1 domain, but got ", len(domain))
}
if diff := cmp.Diff(domain[0].Domain(), "another-proxy.xray.com"); diff != "" {
t.Error(diff)
}
}
{
ips := hosts.Lookup("www.example.cn", dns.IPOption{
ips := hosts.LookupIP("www.example.cn", IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
@@ -106,7 +65,7 @@ func TestStaticHosts(t *testing.T) {
}
{
ips := hosts.Lookup("baidu.com", dns.IPOption{
ips := hosts.LookupIP("baidu.com", IPOption{
IPv4Enable: false,
IPv6Enable: true,
})

View File

@@ -2,247 +2,53 @@ package dns
import (
"context"
"net/url"
"strings"
"time"
"github.com/xtls/xray-core/app/router"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/strmatcher"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/features/routing"
"github.com/xtls/xray-core/features/dns/localdns"
)
// Server is the interface for Name Server.
type Server interface {
// Name of the Client.
Name() string
// QueryIP sends IP queries to its configured server.
QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns.IPOption, disableCache bool) ([]net.IP, error)
// IPOption is an object for IP query options.
type IPOption struct {
IPv4Enable bool
IPv6Enable bool
}
// Client is the interface for DNS client.
type Client struct {
server Server
clientIP net.IP
skipFallback bool
domains []string
expectIPs []*router.GeoIPMatcher
type Client interface {
// Name of the Client.
Name() string
// QueryIP sends IP queries to its configured server.
QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error)
}
var errExpectedIPNonMatch = errors.New("expectIPs not match")
// NewServer creates a name server object according to the network destination url.
func NewServer(dest net.Destination, dispatcher routing.Dispatcher, queryStrategy QueryStrategy) (Server, error) {
if address := dest.Address; address.Family().IsDomain() {
u, err := url.Parse(address.Domain())
if err != nil {
return nil, err
}
switch {
case strings.EqualFold(u.String(), "localhost"):
return NewLocalNameServer(), nil
case strings.EqualFold(u.Scheme, "https"): // DOH Remote mode
return NewDoHNameServer(u, dispatcher, queryStrategy)
case strings.EqualFold(u.Scheme, "https+local"): // DOH Local mode
return NewDoHLocalNameServer(u, queryStrategy), nil
case strings.EqualFold(u.Scheme, "quic+local"): // DNS-over-QUIC Local mode
return NewQUICNameServer(u, queryStrategy)
case strings.EqualFold(u.Scheme, "tcp"): // DNS-over-TCP Remote mode
return NewTCPNameServer(u, dispatcher, queryStrategy)
case strings.EqualFold(u.Scheme, "tcp+local"): // DNS-over-TCP Local mode
return NewTCPLocalNameServer(u, queryStrategy)
case strings.EqualFold(u.String(), "fakedns"):
return NewFakeDNSServer(), nil
}
}
if dest.Network == net.Network_Unknown {
dest.Network = net.Network_UDP
}
if dest.Network == net.Network_UDP { // UDP classic DNS mode
return NewClassicNameServer(dest, dispatcher), nil
}
return nil, newError("No available name server could be created from ", dest).AtWarning()
type LocalNameServer struct {
client *localdns.Client
}
// NewClient creates a DNS client managing a name server with client IP, domain rules and expected IPs.
func NewClient(
ctx context.Context,
ns *NameServer,
clientIP net.IP,
container router.GeoIPMatcherContainer,
matcherInfos *[]*DomainMatcherInfo,
updateDomainRule func(strmatcher.Matcher, int, []*DomainMatcherInfo) error,
) (*Client, error) {
client := &Client{}
err := core.RequireFeatures(ctx, func(dispatcher routing.Dispatcher) error {
// Create a new server for each client for now
server, err := NewServer(ns.Address.AsDestination(), dispatcher, ns.GetQueryStrategy())
if err != nil {
return newError("failed to create nameserver").Base(err).AtWarning()
}
// Priotize local domains with specific TLDs or without any dot to local DNS
if _, isLocalDNS := server.(*LocalNameServer); isLocalDNS {
ns.PrioritizedDomain = append(ns.PrioritizedDomain, localTLDsAndDotlessDomains...)
ns.OriginalRules = append(ns.OriginalRules, localTLDsAndDotlessDomainsRule)
// The following lines is a solution to avoid core panicsrule index out of range when setting `localhost` DNS client in config.
// Because the `localhost` DNS client will apend len(localTLDsAndDotlessDomains) rules into matcherInfos to match `geosite:private` default rule.
// But `matcherInfos` has no enough length to add rules, which leads to core panics (rule index out of range).
// To avoid this, the length of `matcherInfos` must be equal to the expected, so manually append it with Golang default zero value first for later modification.
// Related issues:
// https://github.com/v2fly/v2ray-core/issues/529
// https://github.com/v2fly/v2ray-core/issues/719
for i := 0; i < len(localTLDsAndDotlessDomains); i++ {
*matcherInfos = append(*matcherInfos, &DomainMatcherInfo{
clientIdx: uint16(0),
domainRuleIdx: uint16(0),
})
}
}
// Establish domain rules
var rules []string
ruleCurr := 0
ruleIter := 0
for _, domain := range ns.PrioritizedDomain {
domainRule, err := toStrMatcher(domain.Type, domain.Domain)
if err != nil {
return newError("failed to create prioritized domain").Base(err).AtWarning()
}
originalRuleIdx := ruleCurr
if ruleCurr < len(ns.OriginalRules) {
rule := ns.OriginalRules[ruleCurr]
if ruleCurr >= len(rules) {
rules = append(rules, rule.Rule)
}
ruleIter++
if ruleIter >= int(rule.Size) {
ruleIter = 0
ruleCurr++
}
} else { // No original rule, generate one according to current domain matcher (majorly for compatibility with tests)
rules = append(rules, domainRule.String())
ruleCurr++
}
err = updateDomainRule(domainRule, originalRuleIdx, *matcherInfos)
if err != nil {
return newError("failed to create prioritized domain").Base(err).AtWarning()
}
}
// Establish expected IPs
var matchers []*router.GeoIPMatcher
for _, geoip := range ns.Geoip {
matcher, err := container.Add(geoip)
if err != nil {
return newError("failed to create ip matcher").Base(err).AtWarning()
}
matchers = append(matchers, matcher)
}
if len(clientIP) > 0 {
switch ns.Address.Address.GetAddress().(type) {
case *net.IPOrDomain_Domain:
newError("DNS: client ", ns.Address.Address.GetDomain(), " uses clientIP ", clientIP.String()).AtInfo().WriteToLog()
case *net.IPOrDomain_Ip:
newError("DNS: client ", ns.Address.Address.GetIp(), " uses clientIP ", clientIP.String()).AtInfo().WriteToLog()
}
}
client.server = server
client.clientIP = clientIP
client.skipFallback = ns.SkipFallback
client.domains = rules
client.expectIPs = matchers
return nil
})
return client, err
}
// NewSimpleClient creates a DNS client with a simple destination.
func NewSimpleClient(ctx context.Context, endpoint *net.Endpoint, clientIP net.IP) (*Client, error) {
client := &Client{}
err := core.RequireFeatures(ctx, func(dispatcher routing.Dispatcher) error {
server, err := NewServer(endpoint.AsDestination(), dispatcher, QueryStrategy_USE_IP)
if err != nil {
return newError("failed to create nameserver").Base(err).AtWarning()
}
client.server = server
client.clientIP = clientIP
return nil
})
if len(clientIP) > 0 {
switch endpoint.Address.GetAddress().(type) {
case *net.IPOrDomain_Domain:
newError("DNS: client ", endpoint.Address.GetDomain(), " uses clientIP ", clientIP.String()).AtInfo().WriteToLog()
case *net.IPOrDomain_Ip:
newError("DNS: client ", endpoint.Address.GetIp(), " uses clientIP ", clientIP.String()).AtInfo().WriteToLog()
}
func (s *LocalNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
if option.IPv4Enable && option.IPv6Enable {
return s.client.LookupIP(domain)
}
return client, err
if option.IPv4Enable {
return s.client.LookupIPv4(domain)
}
if option.IPv6Enable {
return s.client.LookupIPv6(domain)
}
return nil, newError("neither IPv4 nor IPv6 is enabled")
}
// Name returns the server name the client manages.
func (c *Client) Name() string {
return c.server.Name()
func (s *LocalNameServer) Name() string {
return "localhost"
}
// QueryIP sends DNS query to the name server with the client's IP.
func (c *Client) QueryIP(ctx context.Context, domain string, option dns.IPOption, disableCache bool) ([]net.IP, error) {
ctx, cancel := context.WithTimeout(ctx, 4*time.Second)
ips, err := c.server.QueryIP(ctx, domain, c.clientIP, option, disableCache)
cancel()
if err != nil {
return ips, err
}
return c.MatchExpectedIPs(domain, ips)
}
// MatchExpectedIPs matches queried domain IPs with expected IPs and returns matched ones.
func (c *Client) MatchExpectedIPs(domain string, ips []net.IP) ([]net.IP, error) {
if len(c.expectIPs) == 0 {
return ips, nil
}
newIps := []net.IP{}
for _, ip := range ips {
for _, matcher := range c.expectIPs {
if matcher.Match(ip) {
newIps = append(newIps, ip)
break
}
}
}
if len(newIps) == 0 {
return nil, errExpectedIPNonMatch
}
newError("domain ", domain, " expectIPs ", newIps, " matched at server ", c.Name()).AtDebug().WriteToLog()
return newIps, nil
}
func ResolveIpOptionOverride(queryStrategy QueryStrategy, ipOption dns.IPOption) dns.IPOption {
switch queryStrategy {
case QueryStrategy_USE_IP:
return ipOption
case QueryStrategy_USE_IP4:
return dns.IPOption{
IPv4Enable: ipOption.IPv4Enable,
IPv6Enable: false,
FakeEnable: false,
}
case QueryStrategy_USE_IP6:
return dns.IPOption{
IPv4Enable: false,
IPv6Enable: ipOption.IPv6Enable,
FakeEnable: false,
}
default:
return ipOption
func NewLocalNameServer() *LocalNameServer {
newError("DNS: created localhost client").AtInfo().WriteToLog()
return &LocalNameServer{
client: localdns.New(),
}
}

View File

@@ -1,105 +0,0 @@
package dns_test
import (
"context"
"net/url"
"testing"
"time"
"github.com/google/go-cmp/cmp"
. "github.com/xtls/xray-core/app/dns"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
dns_feature "github.com/xtls/xray-core/features/dns"
)
func TestDOHNameServer(t *testing.T) {
url, err := url.Parse("https+local://1.1.1.1/dns-query")
common.Must(err)
s := NewDoHLocalNameServer(url, QueryStrategy_USE_IP)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, false)
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
}
func TestDOHNameServerWithCache(t *testing.T) {
url, err := url.Parse("https+local://1.1.1.1/dns-query")
common.Must(err)
s := NewDoHLocalNameServer(url, QueryStrategy_USE_IP)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, false)
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips2, err := s.QueryIP(ctx2, "google.com", net.IP(nil), dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, true)
cancel()
common.Must(err)
if r := cmp.Diff(ips2, ips); r != "" {
t.Fatal(r)
}
}
func TestDOHNameServerWithIPv4Override(t *testing.T) {
url, err := url.Parse("https+local://1.1.1.1/dns-query")
common.Must(err)
s := NewDoHLocalNameServer(url, QueryStrategy_USE_IP4)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, false)
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
for _, ip := range ips {
if len(ip) != net.IPv4len {
t.Error("expect only IPv4 response from DNS query")
}
}
}
func TestDOHNameServerWithIPv6Override(t *testing.T) {
url, err := url.Parse("https+local://1.1.1.1/dns-query")
common.Must(err)
s := NewDoHLocalNameServer(url, QueryStrategy_USE_IP6)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, false)
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
for _, ip := range ips {
if len(ip) != net.IPv6len {
t.Error("expect only IPv6 response from DNS query")
}
}
}

View File

@@ -1,49 +0,0 @@
package dns
import (
"context"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/dns"
)
type FakeDNSServer struct {
fakeDNSEngine dns.FakeDNSEngine
}
func NewFakeDNSServer() *FakeDNSServer {
return &FakeDNSServer{}
}
func (FakeDNSServer) Name() string {
return "FakeDNS"
}
func (f *FakeDNSServer) QueryIP(ctx context.Context, domain string, _ net.IP, opt dns.IPOption, _ bool) ([]net.IP, error) {
if f.fakeDNSEngine == nil {
if err := core.RequireFeatures(ctx, func(fd dns.FakeDNSEngine) {
f.fakeDNSEngine = fd
}); err != nil {
return nil, newError("Unable to locate a fake DNS Engine").Base(err).AtError()
}
}
var ips []net.Address
if fkr0, ok := f.fakeDNSEngine.(dns.FakeDNSEngineRev0); ok {
ips = fkr0.GetFakeIPForDomain3(domain, opt.IPv4Enable, opt.IPv6Enable)
} else {
ips = f.fakeDNSEngine.GetFakeIPForDomain(domain)
}
netIP, err := toNetIP(ips)
if err != nil {
return nil, newError("Unable to convert IP to net ip").Base(err).AtError()
}
newError(f.Name(), " got answer: ", domain, " -> ", ips).AtInfo().WriteToLog()
if len(netIP) > 0 {
return netIP, nil
}
return nil, dns.ErrEmptyResponse
}

View File

@@ -1,54 +0,0 @@
package dns
import (
"context"
"strings"
"time"
"github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/features/dns/localdns"
)
// LocalNameServer is an wrapper over local DNS feature.
type LocalNameServer struct {
client *localdns.Client
}
const errEmptyResponse = "No address associated with hostname"
// QueryIP implements Server.
func (s *LocalNameServer) QueryIP(_ context.Context, domain string, _ net.IP, option dns.IPOption, _ bool) (ips []net.IP, err error) {
start := time.Now()
ips, err = s.client.LookupIP(domain, option)
if err != nil && strings.HasSuffix(err.Error(), errEmptyResponse) {
err = dns.ErrEmptyResponse
}
if len(ips) > 0 {
newError("Localhost got answer: ", domain, " -> ", ips).AtInfo().WriteToLog()
log.Record(&log.DNSLog{Server: s.Name(), Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
}
return
}
// Name implements Server.
func (s *LocalNameServer) Name() string {
return "localhost"
}
// NewLocalNameServer creates localdns server object for directly lookup in system DNS.
func NewLocalNameServer() *LocalNameServer {
newError("DNS: created localhost client").AtInfo().WriteToLog()
return &LocalNameServer{
client: localdns.New(),
}
}
// NewLocalDNSClient creates localdns client object for directly lookup in system DNS.
func NewLocalDNSClient() *Client {
return &Client{server: NewLocalNameServer()}
}

View File

@@ -1,405 +0,0 @@
package dns
import (
"context"
"net/url"
"sync"
"sync/atomic"
"time"
"github.com/quic-go/quic-go"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/buf"
"github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/protocol/dns"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/common/signal/pubsub"
"github.com/xtls/xray-core/common/task"
dns_feature "github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/transport/internet/tls"
"golang.org/x/net/dns/dnsmessage"
"golang.org/x/net/http2"
)
// NextProtoDQ - During connection establishment, DNS/QUIC support is indicated
// by selecting the ALPN token "dq" in the crypto handshake.
const NextProtoDQ = "doq-i00"
const handshakeTimeout = time.Second * 8
// QUICNameServer implemented DNS over QUIC
type QUICNameServer struct {
sync.RWMutex
ips map[string]*record
pub *pubsub.Service
cleanup *task.Periodic
reqID uint32
name string
destination *net.Destination
connection quic.Connection
queryStrategy QueryStrategy
}
// NewQUICNameServer creates DNS-over-QUIC client object for local resolving
func NewQUICNameServer(url *url.URL, queryStrategy QueryStrategy) (*QUICNameServer, error) {
newError("DNS: created Local DNS-over-QUIC client for ", url.String()).AtInfo().WriteToLog()
var err error
port := net.Port(784)
if url.Port() != "" {
port, err = net.PortFromString(url.Port())
if err != nil {
return nil, err
}
}
dest := net.UDPDestination(net.ParseAddress(url.Hostname()), port)
s := &QUICNameServer{
ips: make(map[string]*record),
pub: pubsub.NewService(),
name: url.String(),
destination: &dest,
queryStrategy: queryStrategy,
}
s.cleanup = &task.Periodic{
Interval: time.Minute,
Execute: s.Cleanup,
}
return s, nil
}
// Name returns client name
func (s *QUICNameServer) Name() string {
return s.name
}
// Cleanup clears expired items from cache
func (s *QUICNameServer) Cleanup() error {
now := time.Now()
s.Lock()
defer s.Unlock()
if len(s.ips) == 0 {
return newError("nothing to do. stopping...")
}
for domain, record := range s.ips {
if record.A != nil && record.A.Expire.Before(now) {
record.A = nil
}
if record.AAAA != nil && record.AAAA.Expire.Before(now) {
record.AAAA = nil
}
if record.A == nil && record.AAAA == nil {
newError(s.name, " cleanup ", domain).AtDebug().WriteToLog()
delete(s.ips, domain)
} else {
s.ips[domain] = record
}
}
if len(s.ips) == 0 {
s.ips = make(map[string]*record)
}
return nil
}
func (s *QUICNameServer) updateIP(req *dnsRequest, ipRec *IPRecord) {
elapsed := time.Since(req.start)
s.Lock()
rec, found := s.ips[req.domain]
if !found {
rec = &record{}
}
updated := false
switch req.reqType {
case dnsmessage.TypeA:
if isNewer(rec.A, ipRec) {
rec.A = ipRec
updated = true
}
case dnsmessage.TypeAAAA:
addr := make([]net.Address, 0)
for _, ip := range ipRec.IP {
if len(ip.IP()) == net.IPv6len {
addr = append(addr, ip)
}
}
ipRec.IP = addr
if isNewer(rec.AAAA, ipRec) {
rec.AAAA = ipRec
updated = true
}
}
newError(s.name, " got answer: ", req.domain, " ", req.reqType, " -> ", ipRec.IP, " ", elapsed).AtInfo().WriteToLog()
if updated {
s.ips[req.domain] = rec
}
switch req.reqType {
case dnsmessage.TypeA:
s.pub.Publish(req.domain+"4", nil)
case dnsmessage.TypeAAAA:
s.pub.Publish(req.domain+"6", nil)
}
s.Unlock()
common.Must(s.cleanup.Start())
}
func (s *QUICNameServer) newReqID() uint16 {
return uint16(atomic.AddUint32(&s.reqID, 1))
}
func (s *QUICNameServer) sendQuery(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption) {
newError(s.name, " querying: ", domain).AtInfo().WriteToLog(session.ExportIDToError(ctx))
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(clientIP))
var deadline time.Time
if d, ok := ctx.Deadline(); ok {
deadline = d
} else {
deadline = time.Now().Add(time.Second * 5)
}
for _, req := range reqs {
go func(r *dnsRequest) {
// generate new context for each req, using same context
// may cause reqs all aborted if any one encounter an error
dnsCtx := ctx
// reserve internal dns server requested Inbound
if inbound := session.InboundFromContext(ctx); inbound != nil {
dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
}
dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
Protocol: "quic",
SkipDNSResolve: true,
})
var cancel context.CancelFunc
dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
defer cancel()
b, err := dns.PackMessage(r.msg)
if err != nil {
newError("failed to pack dns query").Base(err).AtError().WriteToLog()
return
}
conn, err := s.openStream(dnsCtx)
if err != nil {
newError("failed to open quic connection").Base(err).AtError().WriteToLog()
return
}
_, err = conn.Write(b.Bytes())
if err != nil {
newError("failed to send query").Base(err).AtError().WriteToLog()
return
}
_ = conn.Close()
respBuf := buf.New()
defer respBuf.Release()
n, err := respBuf.ReadFrom(conn)
if err != nil && n == 0 {
newError("failed to read response").Base(err).AtError().WriteToLog()
return
}
rec, err := parseResponse(respBuf.Bytes())
if err != nil {
newError("failed to handle response").Base(err).AtError().WriteToLog()
return
}
s.updateIP(r, rec)
}(req)
}
}
func (s *QUICNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
s.RLock()
record, found := s.ips[domain]
s.RUnlock()
if !found {
return nil, errRecordNotFound
}
var err4 error
var err6 error
var ips []net.Address
var ip6 []net.Address
if option.IPv4Enable {
ips, err4 = record.A.getIPs()
}
if option.IPv6Enable {
ip6, err6 = record.AAAA.getIPs()
ips = append(ips, ip6...)
}
if len(ips) > 0 {
return toNetIP(ips)
}
if err4 != nil {
return nil, err4
}
if err6 != nil {
return nil, err6
}
if (option.IPv4Enable && record.A != nil) || (option.IPv6Enable && record.AAAA != nil) {
return nil, dns_feature.ErrEmptyResponse
}
return nil, errRecordNotFound
}
// QueryIP is called from dns.Server->queryIPTimeout
func (s *QUICNameServer) QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption, disableCache bool) ([]net.IP, error) {
fqdn := Fqdn(domain)
option = ResolveIpOptionOverride(s.queryStrategy, option)
if !option.IPv4Enable && !option.IPv6Enable {
return nil, dns_feature.ErrEmptyResponse
}
if disableCache {
newError("DNS cache is disabled. Querying IP for ", domain, " at ", s.name).AtDebug().WriteToLog()
} else {
ips, err := s.findIPsForDomain(fqdn, option)
if err != errRecordNotFound {
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSCacheHit, Elapsed: 0, Error: err})
return ips, err
}
}
// ipv4 and ipv6 belong to different subscription groups
var sub4, sub6 *pubsub.Subscriber
if option.IPv4Enable {
sub4 = s.pub.Subscribe(fqdn + "4")
defer sub4.Close()
}
if option.IPv6Enable {
sub6 = s.pub.Subscribe(fqdn + "6")
defer sub6.Close()
}
done := make(chan interface{})
go func() {
if sub4 != nil {
select {
case <-sub4.Wait():
case <-ctx.Done():
}
}
if sub6 != nil {
select {
case <-sub6.Wait():
case <-ctx.Done():
}
}
close(done)
}()
s.sendQuery(ctx, fqdn, clientIP, option)
start := time.Now()
for {
ips, err := s.findIPsForDomain(fqdn, option)
if err != errRecordNotFound {
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
return ips, err
}
select {
case <-ctx.Done():
return nil, ctx.Err()
case <-done:
}
}
}
func isActive(s quic.Connection) bool {
select {
case <-s.Context().Done():
return false
default:
return true
}
}
func (s *QUICNameServer) getConnection() (quic.Connection, error) {
var conn quic.Connection
s.RLock()
conn = s.connection
if conn != nil && isActive(conn) {
s.RUnlock()
return conn, nil
}
if conn != nil {
// we're recreating the connection, let's create a new one
_ = conn.CloseWithError(0, "")
}
s.RUnlock()
s.Lock()
defer s.Unlock()
var err error
conn, err = s.openConnection()
if err != nil {
// This does not look too nice, but QUIC (or maybe quic-go)
// doesn't seem stable enough.
// Maybe retransmissions aren't fully implemented in quic-go?
// Anyways, the simple solution is to make a second try when
// it fails to open the QUIC connection.
conn, err = s.openConnection()
if err != nil {
return nil, err
}
}
s.connection = conn
return conn, nil
}
func (s *QUICNameServer) openConnection() (quic.Connection, error) {
tlsConfig := tls.Config{}
quicConfig := &quic.Config{
HandshakeIdleTimeout: handshakeTimeout,
}
tlsConfig.ServerName = s.destination.Address.String()
conn, err := quic.DialAddr(context.Background(), s.destination.NetAddr(), tlsConfig.GetTLSConfig(tls.WithNextProto("http/1.1", http2.NextProtoTLS, NextProtoDQ)), quicConfig)
log.Record(&log.AccessMessage{
From: "DNS",
To: s.destination,
Status: log.AccessAccepted,
Detour: "local",
})
if err != nil {
return nil, err
}
return conn, nil
}
func (s *QUICNameServer) openStream(ctx context.Context) (quic.Stream, error) {
conn, err := s.getConnection()
if err != nil {
return nil, err
}
// open a new stream
return conn.OpenStreamSync(ctx)
}

View File

@@ -1,88 +0,0 @@
package dns_test
import (
"context"
"net/url"
"testing"
"time"
"github.com/google/go-cmp/cmp"
. "github.com/xtls/xray-core/app/dns"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/features/dns"
)
func TestQUICNameServer(t *testing.T) {
url, err := url.Parse("quic://dns.adguard.com")
common.Must(err)
s, err := NewQUICNameServer(url, QueryStrategy_USE_IP)
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, false)
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips2, err := s.QueryIP(ctx2, "google.com", net.IP(nil), dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, true)
cancel()
common.Must(err)
if r := cmp.Diff(ips2, ips); r != "" {
t.Fatal(r)
}
}
func TestQUICNameServerWithIPv4Override(t *testing.T) {
url, err := url.Parse("quic://dns.adguard.com")
common.Must(err)
s, err := NewQUICNameServer(url, QueryStrategy_USE_IP4)
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, false)
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
for _, ip := range ips {
if len(ip) != net.IPv4len {
t.Error("expect only IPv4 response from DNS query")
}
}
}
func TestQUICNameServerWithIPv6Override(t *testing.T) {
url, err := url.Parse("quic://dns.adguard.com")
common.Must(err)
s, err := NewQUICNameServer(url, QueryStrategy_USE_IP6)
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, false)
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
for _, ip := range ips {
if len(ip) != net.IPv6len {
t.Error("expect only IPv6 response from DNS query")
}
}
}

View File

@@ -1,374 +0,0 @@
package dns
import (
"bytes"
"context"
"encoding/binary"
"net/url"
"sync"
"sync/atomic"
"time"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/buf"
"github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/net/cnc"
"github.com/xtls/xray-core/common/protocol/dns"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/common/signal/pubsub"
"github.com/xtls/xray-core/common/task"
dns_feature "github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/features/routing"
"github.com/xtls/xray-core/transport/internet"
"golang.org/x/net/dns/dnsmessage"
)
// TCPNameServer implemented DNS over TCP (RFC7766).
type TCPNameServer struct {
sync.RWMutex
name string
destination *net.Destination
ips map[string]*record
pub *pubsub.Service
cleanup *task.Periodic
reqID uint32
dial func(context.Context) (net.Conn, error)
queryStrategy QueryStrategy
}
// NewTCPNameServer creates DNS over TCP server object for remote resolving.
func NewTCPNameServer(
url *url.URL,
dispatcher routing.Dispatcher,
queryStrategy QueryStrategy,
) (*TCPNameServer, error) {
s, err := baseTCPNameServer(url, "TCP", queryStrategy)
if err != nil {
return nil, err
}
s.dial = func(ctx context.Context) (net.Conn, error) {
link, err := dispatcher.Dispatch(toDnsContext(ctx, s.destination.String()), *s.destination)
if err != nil {
return nil, err
}
return cnc.NewConnection(
cnc.ConnectionInputMulti(link.Writer),
cnc.ConnectionOutputMulti(link.Reader),
), nil
}
return s, nil
}
// NewTCPLocalNameServer creates DNS over TCP client object for local resolving
func NewTCPLocalNameServer(url *url.URL, queryStrategy QueryStrategy) (*TCPNameServer, error) {
s, err := baseTCPNameServer(url, "TCPL", queryStrategy)
if err != nil {
return nil, err
}
s.dial = func(ctx context.Context) (net.Conn, error) {
return internet.DialSystem(ctx, *s.destination, nil)
}
return s, nil
}
func baseTCPNameServer(url *url.URL, prefix string, queryStrategy QueryStrategy) (*TCPNameServer, error) {
port := net.Port(53)
if url.Port() != "" {
var err error
if port, err = net.PortFromString(url.Port()); err != nil {
return nil, err
}
}
dest := net.TCPDestination(net.ParseAddress(url.Hostname()), port)
s := &TCPNameServer{
destination: &dest,
ips: make(map[string]*record),
pub: pubsub.NewService(),
name: prefix + "//" + dest.NetAddr(),
queryStrategy: queryStrategy,
}
s.cleanup = &task.Periodic{
Interval: time.Minute,
Execute: s.Cleanup,
}
return s, nil
}
// Name implements Server.
func (s *TCPNameServer) Name() string {
return s.name
}
// Cleanup clears expired items from cache
func (s *TCPNameServer) Cleanup() error {
now := time.Now()
s.Lock()
defer s.Unlock()
if len(s.ips) == 0 {
return newError("nothing to do. stopping...")
}
for domain, record := range s.ips {
if record.A != nil && record.A.Expire.Before(now) {
record.A = nil
}
if record.AAAA != nil && record.AAAA.Expire.Before(now) {
record.AAAA = nil
}
if record.A == nil && record.AAAA == nil {
newError(s.name, " cleanup ", domain).AtDebug().WriteToLog()
delete(s.ips, domain)
} else {
s.ips[domain] = record
}
}
if len(s.ips) == 0 {
s.ips = make(map[string]*record)
}
return nil
}
func (s *TCPNameServer) updateIP(req *dnsRequest, ipRec *IPRecord) {
elapsed := time.Since(req.start)
s.Lock()
rec, found := s.ips[req.domain]
if !found {
rec = &record{}
}
updated := false
switch req.reqType {
case dnsmessage.TypeA:
if isNewer(rec.A, ipRec) {
rec.A = ipRec
updated = true
}
case dnsmessage.TypeAAAA:
addr := make([]net.Address, 0)
for _, ip := range ipRec.IP {
if len(ip.IP()) == net.IPv6len {
addr = append(addr, ip)
}
}
ipRec.IP = addr
if isNewer(rec.AAAA, ipRec) {
rec.AAAA = ipRec
updated = true
}
}
newError(s.name, " got answer: ", req.domain, " ", req.reqType, " -> ", ipRec.IP, " ", elapsed).AtInfo().WriteToLog()
if updated {
s.ips[req.domain] = rec
}
switch req.reqType {
case dnsmessage.TypeA:
s.pub.Publish(req.domain+"4", nil)
case dnsmessage.TypeAAAA:
s.pub.Publish(req.domain+"6", nil)
}
s.Unlock()
common.Must(s.cleanup.Start())
}
func (s *TCPNameServer) newReqID() uint16 {
return uint16(atomic.AddUint32(&s.reqID, 1))
}
func (s *TCPNameServer) sendQuery(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption) {
newError(s.name, " querying DNS for: ", domain).AtDebug().WriteToLog(session.ExportIDToError(ctx))
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(clientIP))
var deadline time.Time
if d, ok := ctx.Deadline(); ok {
deadline = d
} else {
deadline = time.Now().Add(time.Second * 5)
}
for _, req := range reqs {
go func(r *dnsRequest) {
dnsCtx := ctx
if inbound := session.InboundFromContext(ctx); inbound != nil {
dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
}
dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
Protocol: "dns",
SkipDNSResolve: true,
})
var cancel context.CancelFunc
dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
defer cancel()
b, err := dns.PackMessage(r.msg)
if err != nil {
newError("failed to pack dns query").Base(err).AtError().WriteToLog()
return
}
conn, err := s.dial(dnsCtx)
if err != nil {
newError("failed to dial namesever").Base(err).AtError().WriteToLog()
return
}
defer conn.Close()
dnsReqBuf := buf.New()
binary.Write(dnsReqBuf, binary.BigEndian, uint16(b.Len()))
dnsReqBuf.Write(b.Bytes())
b.Release()
_, err = conn.Write(dnsReqBuf.Bytes())
if err != nil {
newError("failed to send query").Base(err).AtError().WriteToLog()
return
}
dnsReqBuf.Release()
respBuf := buf.New()
defer respBuf.Release()
n, err := respBuf.ReadFullFrom(conn, 2)
if err != nil && n == 0 {
newError("failed to read response length").Base(err).AtError().WriteToLog()
return
}
var length int16
err = binary.Read(bytes.NewReader(respBuf.Bytes()), binary.BigEndian, &length)
if err != nil {
newError("failed to parse response length").Base(err).AtError().WriteToLog()
return
}
respBuf.Clear()
n, err = respBuf.ReadFullFrom(conn, int32(length))
if err != nil && n == 0 {
newError("failed to read response length").Base(err).AtError().WriteToLog()
return
}
rec, err := parseResponse(respBuf.Bytes())
if err != nil {
newError("failed to parse DNS over TCP response").Base(err).AtError().WriteToLog()
return
}
s.updateIP(r, rec)
}(req)
}
}
func (s *TCPNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
s.RLock()
record, found := s.ips[domain]
s.RUnlock()
if !found {
return nil, errRecordNotFound
}
var err4 error
var err6 error
var ips []net.Address
var ip6 []net.Address
if option.IPv4Enable {
ips, err4 = record.A.getIPs()
}
if option.IPv6Enable {
ip6, err6 = record.AAAA.getIPs()
ips = append(ips, ip6...)
}
if len(ips) > 0 {
return toNetIP(ips)
}
if err4 != nil {
return nil, err4
}
if err6 != nil {
return nil, err6
}
return nil, dns_feature.ErrEmptyResponse
}
// QueryIP implements Server.
func (s *TCPNameServer) QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption, disableCache bool) ([]net.IP, error) {
fqdn := Fqdn(domain)
option = ResolveIpOptionOverride(s.queryStrategy, option)
if !option.IPv4Enable && !option.IPv6Enable {
return nil, dns_feature.ErrEmptyResponse
}
if disableCache {
newError("DNS cache is disabled. Querying IP for ", domain, " at ", s.name).AtDebug().WriteToLog()
} else {
ips, err := s.findIPsForDomain(fqdn, option)
if err != errRecordNotFound {
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSCacheHit, Elapsed: 0, Error: err})
return ips, err
}
}
// ipv4 and ipv6 belong to different subscription groups
var sub4, sub6 *pubsub.Subscriber
if option.IPv4Enable {
sub4 = s.pub.Subscribe(fqdn + "4")
defer sub4.Close()
}
if option.IPv6Enable {
sub6 = s.pub.Subscribe(fqdn + "6")
defer sub6.Close()
}
done := make(chan interface{})
go func() {
if sub4 != nil {
select {
case <-sub4.Wait():
case <-ctx.Done():
}
}
if sub6 != nil {
select {
case <-sub6.Wait():
case <-ctx.Done():
}
}
close(done)
}()
s.sendQuery(ctx, fqdn, clientIP, option)
start := time.Now()
for {
ips, err := s.findIPsForDomain(fqdn, option)
if err != errRecordNotFound {
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
return ips, err
}
select {
case <-ctx.Done():
return nil, ctx.Err()
case <-done:
}
}
}

View File

@@ -1,107 +0,0 @@
package dns_test
import (
"context"
"net/url"
"testing"
"time"
"github.com/google/go-cmp/cmp"
. "github.com/xtls/xray-core/app/dns"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
dns_feature "github.com/xtls/xray-core/features/dns"
)
func TestTCPLocalNameServer(t *testing.T) {
url, err := url.Parse("tcp+local://8.8.8.8")
common.Must(err)
s, err := NewTCPLocalNameServer(url, QueryStrategy_USE_IP)
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, false)
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
}
func TestTCPLocalNameServerWithCache(t *testing.T) {
url, err := url.Parse("tcp+local://8.8.8.8")
common.Must(err)
s, err := NewTCPLocalNameServer(url, QueryStrategy_USE_IP)
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, false)
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips2, err := s.QueryIP(ctx2, "google.com", net.IP(nil), dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, true)
cancel()
common.Must(err)
if r := cmp.Diff(ips2, ips); r != "" {
t.Fatal(r)
}
}
func TestTCPLocalNameServerWithIPv4Override(t *testing.T) {
url, err := url.Parse("tcp+local://8.8.8.8")
common.Must(err)
s, err := NewTCPLocalNameServer(url, QueryStrategy_USE_IP4)
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, false)
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
for _, ip := range ips {
if len(ip) != net.IPv4len {
t.Error("expect only IPv4 response from DNS query")
}
}
}
func TestTCPLocalNameServerWithIPv6Override(t *testing.T) {
url, err := url.Parse("tcp+local://8.8.8.8")
common.Must(err)
s, err := NewTCPLocalNameServer(url, QueryStrategy_USE_IP6)
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
}, false)
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
for _, ip := range ips {
if len(ip) != net.IPv6len {
t.Error("expect only IPv6 response from DNS query")
}
}
}

View File

@@ -7,18 +7,15 @@ import (
. "github.com/xtls/xray-core/app/dns"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/features/dns"
)
func TestLocalNameServer(t *testing.T) {
s := NewLocalNameServer()
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
ips, err := s.QueryIP(ctx, "google.com", net.IP{}, dns.IPOption{
ips, err := s.QueryIP(ctx, "google.com", IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
}, false)
})
cancel()
common.Must(err)
if len(ips) == 0 {

448
app/dns/server.go Normal file
View File

@@ -0,0 +1,448 @@
package dns
//go:generate go run github.com/xtls/xray-core/common/errors/errorgen
import (
"context"
"fmt"
"log"
"net/url"
"strings"
"sync"
"time"
"github.com/xtls/xray-core/app/router"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/common/strmatcher"
"github.com/xtls/xray-core/common/uuid"
core "github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features"
"github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/features/routing"
)
// Server is a DNS rely server.
type Server struct {
sync.Mutex
hosts *StaticHosts
clientIP net.IP
clients []Client // clientIdx -> Client
ipIndexMap []*MultiGeoIPMatcher // clientIdx -> *MultiGeoIPMatcher
domainRules [][]string // clientIdx -> domainRuleIdx -> DomainRule
domainMatcher strmatcher.IndexMatcher
matcherInfos []DomainMatcherInfo // matcherIdx -> DomainMatcherInfo
tag string
}
// DomainMatcherInfo contains information attached to index returned by Server.domainMatcher
type DomainMatcherInfo struct {
clientIdx uint16
domainRuleIdx uint16
}
// MultiGeoIPMatcher for match
type MultiGeoIPMatcher struct {
matchers []*router.GeoIPMatcher
}
var errExpectedIPNonMatch = errors.New("expectIPs not match")
// Match check ip match
func (c *MultiGeoIPMatcher) Match(ip net.IP) bool {
for _, matcher := range c.matchers {
if matcher.Match(ip) {
return true
}
}
return false
}
// HasMatcher check has matcher
func (c *MultiGeoIPMatcher) HasMatcher() bool {
return len(c.matchers) > 0
}
func generateRandomTag() string {
id := uuid.New()
return "xray.system." + id.String()
}
// New creates a new DNS server with given configuration.
func New(ctx context.Context, config *Config) (*Server, error) {
server := &Server{
clients: make([]Client, 0, len(config.NameServers)+len(config.NameServer)),
tag: config.Tag,
}
if server.tag == "" {
server.tag = generateRandomTag()
}
if len(config.ClientIp) > 0 {
if len(config.ClientIp) != net.IPv4len && len(config.ClientIp) != net.IPv6len {
return nil, newError("unexpected IP length", len(config.ClientIp))
}
server.clientIP = net.IP(config.ClientIp)
}
hosts, err := NewStaticHosts(config.StaticHosts, config.Hosts)
if err != nil {
return nil, newError("failed to create hosts").Base(err)
}
server.hosts = hosts
addNameServer := func(ns *NameServer) int {
endpoint := ns.Address
address := endpoint.Address.AsAddress()
switch {
case address.Family().IsDomain() && address.Domain() == "localhost":
server.clients = append(server.clients, NewLocalNameServer())
// Priotize local domains with specific TLDs or without any dot to local DNS
// References:
// https://www.iana.org/assignments/special-use-domain-names/special-use-domain-names.xhtml
// https://unix.stackexchange.com/questions/92441/whats-the-difference-between-local-home-and-lan
localTLDsAndDotlessDomains := []*NameServer_PriorityDomain{
{Type: DomainMatchingType_Regex, Domain: "^[^.]+$"}, // This will only match domains without any dot
{Type: DomainMatchingType_Subdomain, Domain: "local"},
{Type: DomainMatchingType_Subdomain, Domain: "localdomain"},
{Type: DomainMatchingType_Subdomain, Domain: "localhost"},
{Type: DomainMatchingType_Subdomain, Domain: "lan"},
{Type: DomainMatchingType_Subdomain, Domain: "home.arpa"},
{Type: DomainMatchingType_Subdomain, Domain: "example"},
{Type: DomainMatchingType_Subdomain, Domain: "invalid"},
{Type: DomainMatchingType_Subdomain, Domain: "test"},
}
ns.PrioritizedDomain = append(ns.PrioritizedDomain, localTLDsAndDotlessDomains...)
case address.Family().IsDomain() && strings.HasPrefix(address.Domain(), "https+local://"):
// URI schemed string treated as domain
// DOH Local mode
u, err := url.Parse(address.Domain())
if err != nil {
log.Fatalln(newError("DNS config error").Base(err))
}
server.clients = append(server.clients, NewDoHLocalNameServer(u, server.clientIP))
case address.Family().IsDomain() && strings.HasPrefix(address.Domain(), "https://"):
// DOH Remote mode
u, err := url.Parse(address.Domain())
if err != nil {
log.Fatalln(newError("DNS config error").Base(err))
}
idx := len(server.clients)
server.clients = append(server.clients, nil)
// need the core dispatcher, register DOHClient at callback
common.Must(core.RequireFeatures(ctx, func(d routing.Dispatcher) {
c, err := NewDoHNameServer(u, d, server.clientIP)
if err != nil {
log.Fatalln(newError("DNS config error").Base(err))
}
server.clients[idx] = c
}))
default:
// UDP classic DNS mode
dest := endpoint.AsDestination()
if dest.Network == net.Network_Unknown {
dest.Network = net.Network_UDP
}
if dest.Network == net.Network_UDP {
idx := len(server.clients)
server.clients = append(server.clients, nil)
common.Must(core.RequireFeatures(ctx, func(d routing.Dispatcher) {
server.clients[idx] = NewClassicNameServer(dest, d, server.clientIP)
}))
}
}
server.ipIndexMap = append(server.ipIndexMap, nil)
return len(server.clients) - 1
}
if len(config.NameServers) > 0 {
features.PrintDeprecatedFeatureWarning("simple DNS server")
for _, destPB := range config.NameServers {
addNameServer(&NameServer{Address: destPB})
}
}
if len(config.NameServer) > 0 {
clientIndices := []int{}
domainRuleCount := 0
for _, ns := range config.NameServer {
idx := addNameServer(ns)
clientIndices = append(clientIndices, idx)
domainRuleCount += len(ns.PrioritizedDomain)
}
domainRules := make([][]string, len(server.clients))
domainMatcher := &strmatcher.MatcherGroup{}
matcherInfos := make([]DomainMatcherInfo, domainRuleCount+1) // matcher index starts from 1
var geoIPMatcherContainer router.GeoIPMatcherContainer
for nidx, ns := range config.NameServer {
idx := clientIndices[nidx]
// Establish domain rule matcher
rules := []string{}
ruleCurr := 0
ruleIter := 0
for _, domain := range ns.PrioritizedDomain {
matcher, err := toStrMatcher(domain.Type, domain.Domain)
if err != nil {
return nil, newError("failed to create prioritized domain").Base(err).AtWarning()
}
midx := domainMatcher.Add(matcher)
if midx >= uint32(len(matcherInfos)) { // This rarely happens according to current matcher's implementation
newError("expanding domain matcher info array to size ", midx, " when adding ", matcher).AtDebug().WriteToLog()
matcherInfos = append(matcherInfos, make([]DomainMatcherInfo, midx-uint32(len(matcherInfos))+1)...)
}
info := &matcherInfos[midx]
info.clientIdx = uint16(idx)
if ruleCurr < len(ns.OriginalRules) {
info.domainRuleIdx = uint16(ruleCurr)
rule := ns.OriginalRules[ruleCurr]
if ruleCurr >= len(rules) {
rules = append(rules, rule.Rule)
}
ruleIter++
if ruleIter >= int(rule.Size) {
ruleIter = 0
ruleCurr++
}
} else { // No original rule, generate one according to current domain matcher (majorly for compatibility with tests)
info.domainRuleIdx = uint16(len(rules))
rules = append(rules, matcher.String())
}
}
domainRules[idx] = rules
// only add to ipIndexMap if GeoIP is configured
if len(ns.Geoip) > 0 {
var matchers []*router.GeoIPMatcher
for _, geoip := range ns.Geoip {
matcher, err := geoIPMatcherContainer.Add(geoip)
if err != nil {
return nil, newError("failed to create ip matcher").Base(err).AtWarning()
}
matchers = append(matchers, matcher)
}
matcher := &MultiGeoIPMatcher{matchers: matchers}
server.ipIndexMap[idx] = matcher
}
}
server.domainRules = domainRules
server.domainMatcher = domainMatcher
server.matcherInfos = matcherInfos
}
if len(server.clients) == 0 {
server.clients = append(server.clients, NewLocalNameServer())
server.ipIndexMap = append(server.ipIndexMap, nil)
}
return server, nil
}
// Type implements common.HasType.
func (*Server) Type() interface{} {
return dns.ClientType()
}
// Start implements common.Runnable.
func (s *Server) Start() error {
return nil
}
// Close implements common.Closable.
func (s *Server) Close() error {
return nil
}
func (s *Server) IsOwnLink(ctx context.Context) bool {
inbound := session.InboundFromContext(ctx)
return inbound != nil && inbound.Tag == s.tag
}
// Match check dns ip match geoip
func (s *Server) Match(idx int, client Client, domain string, ips []net.IP) ([]net.IP, error) {
var matcher *MultiGeoIPMatcher
if idx < len(s.ipIndexMap) {
matcher = s.ipIndexMap[idx]
}
if matcher == nil {
return ips, nil
}
if !matcher.HasMatcher() {
newError("domain ", domain, " server has no valid matcher: ", client.Name(), " idx:", idx).AtDebug().WriteToLog()
return ips, nil
}
newIps := []net.IP{}
for _, ip := range ips {
if matcher.Match(ip) {
newIps = append(newIps, ip)
}
}
if len(newIps) == 0 {
return nil, errExpectedIPNonMatch
}
newError("domain ", domain, " expectIPs ", newIps, " matched at server ", client.Name(), " idx:", idx).AtDebug().WriteToLog()
return newIps, nil
}
func (s *Server) queryIPTimeout(idx int, client Client, domain string, option IPOption) ([]net.IP, error) {
ctx, cancel := context.WithTimeout(context.Background(), time.Second*4)
if len(s.tag) > 0 {
ctx = session.ContextWithInbound(ctx, &session.Inbound{
Tag: s.tag,
})
}
ips, err := client.QueryIP(ctx, domain, option)
cancel()
if err != nil {
return ips, err
}
ips, err = s.Match(idx, client, domain, ips)
return ips, err
}
// LookupIP implements dns.Client.
func (s *Server) LookupIP(domain string) ([]net.IP, error) {
return s.lookupIPInternal(domain, IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
}
// LookupIPv4 implements dns.IPv4Lookup.
func (s *Server) LookupIPv4(domain string) ([]net.IP, error) {
return s.lookupIPInternal(domain, IPOption{
IPv4Enable: true,
IPv6Enable: false,
})
}
// LookupIPv6 implements dns.IPv6Lookup.
func (s *Server) LookupIPv6(domain string) ([]net.IP, error) {
return s.lookupIPInternal(domain, IPOption{
IPv4Enable: false,
IPv6Enable: true,
})
}
func (s *Server) lookupStatic(domain string, option IPOption, depth int32) []net.Address {
ips := s.hosts.LookupIP(domain, option)
if ips == nil {
return nil
}
if ips[0].Family().IsDomain() && depth < 5 {
if newIPs := s.lookupStatic(ips[0].Domain(), option, depth+1); newIPs != nil {
return newIPs
}
}
return ips
}
func toNetIP(ips []net.Address) []net.IP {
if len(ips) == 0 {
return nil
}
netips := make([]net.IP, 0, len(ips))
for _, ip := range ips {
netips = append(netips, ip.IP())
}
return netips
}
func (s *Server) lookupIPInternal(domain string, option IPOption) ([]net.IP, error) {
if domain == "" {
return nil, newError("empty domain name")
}
domain = strings.ToLower(domain)
// normalize the FQDN form query
if domain[len(domain)-1] == '.' {
domain = domain[:len(domain)-1]
}
ips := s.lookupStatic(domain, option, 0)
if ips != nil && ips[0].Family().IsIP() {
newError("returning ", len(ips), " IPs for domain ", domain).WriteToLog()
return toNetIP(ips), nil
}
if ips != nil && ips[0].Family().IsDomain() {
newdomain := ips[0].Domain()
newError("domain replaced: ", domain, " -> ", newdomain).WriteToLog()
domain = newdomain
}
var lastErr error
var matchedClient Client
if s.domainMatcher != nil {
indices := s.domainMatcher.Match(domain)
domainRules := []string{}
matchingDNS := []string{}
for _, idx := range indices {
info := s.matcherInfos[idx]
rule := s.domainRules[info.clientIdx][info.domainRuleIdx]
domainRules = append(domainRules, fmt.Sprintf("%s(DNS idx:%d)", rule, info.clientIdx))
matchingDNS = append(matchingDNS, s.clients[info.clientIdx].Name())
}
if len(domainRules) > 0 {
newError("domain ", domain, " matches following rules: ", domainRules).AtDebug().WriteToLog()
}
if len(matchingDNS) > 0 {
newError("domain ", domain, " uses following DNS first: ", matchingDNS).AtDebug().WriteToLog()
}
for _, idx := range indices {
clientIdx := int(s.matcherInfos[idx].clientIdx)
matchedClient = s.clients[clientIdx]
ips, err := s.queryIPTimeout(clientIdx, matchedClient, domain, option)
if len(ips) > 0 {
return ips, nil
}
if err == dns.ErrEmptyResponse {
return nil, err
}
if err != nil {
newError("failed to lookup ip for domain ", domain, " at server ", matchedClient.Name()).Base(err).WriteToLog()
lastErr = err
}
}
}
for idx, client := range s.clients {
if client == matchedClient {
newError("domain ", domain, " at server ", client.Name(), " idx:", idx, " already lookup failed, just ignore").AtDebug().WriteToLog()
continue
}
ips, err := s.queryIPTimeout(idx, client, domain, option)
if len(ips) > 0 {
return ips, nil
}
if err != nil {
newError("failed to lookup ip for domain ", domain, " at server ", client.Name()).Base(err).WriteToLog()
lastErr = err
}
if err != context.Canceled && err != context.DeadlineExceeded && err != errExpectedIPNonMatch {
return nil, err
}
}
return nil, newError("returning nil for domain ", domain).Base(lastErr)
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
return New(ctx, config.(*Config))
}))
}

View File

@@ -6,6 +6,7 @@ import (
"github.com/google/go-cmp/cmp"
"github.com/miekg/dns"
"github.com/xtls/xray-core/app/dispatcher"
. "github.com/xtls/xray-core/app/dns"
"github.com/xtls/xray-core/app/policy"
@@ -13,7 +14,6 @@ import (
_ "github.com/xtls/xray-core/app/proxyman/outbound"
"github.com/xtls/xray-core/app/router"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/serial"
"github.com/xtls/xray-core/core"
@@ -22,7 +22,8 @@ import (
"github.com/xtls/xray-core/testing/servers/udp"
)
type staticHandler struct{}
type staticHandler struct {
}
func (*staticHandler) ServeDNS(w dns.ResponseWriter, r *dns.Msg) {
ans := new(dns.Msg)
@@ -100,8 +101,8 @@ func (*staticHandler) ServeDNS(w dns.ResponseWriter, r *dns.Msg) {
rr, _ := dns.NewRR("localhost-b. IN A 127.0.0.4")
ans.Answer = append(ans.Answer, rr)
case q.Name == "Mijia\\ Cloud." && q.Qtype == dns.TypeA:
rr, _ := dns.NewRR("Mijia\\ Cloud. IN A 127.0.0.1")
case q.Name == "mijia\\ cloud." && q.Qtype == dns.TypeA:
rr, _ := dns.NewRR("mijia\\ cloud. IN A 127.0.0.1")
ans.Answer = append(ans.Answer, rr)
}
}
@@ -153,11 +154,7 @@ func TestUDPServerSubnet(t *testing.T) {
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("google.com")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -212,11 +209,7 @@ func TestUDPServer(t *testing.T) {
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
{
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("google.com")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -227,11 +220,7 @@ func TestUDPServer(t *testing.T) {
}
{
ips, err := client.LookupIP("facebook.com", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("facebook.com")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -242,11 +231,7 @@ func TestUDPServer(t *testing.T) {
}
{
_, err := client.LookupIP("notexist.google.com", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
_, err := client.LookupIP("notexist.google.com")
if err == nil {
t.Fatal("nil error")
}
@@ -256,12 +241,9 @@ func TestUDPServer(t *testing.T) {
}
{
ips, err := client.LookupIP("ipv4only.google.com", feature_dns.IPOption{
IPv4Enable: false,
IPv6Enable: true,
FakeEnable: false,
})
if !errors.AllEqual(feature_dns.ErrEmptyResponse, errors.Cause(err)) {
clientv6 := client.(feature_dns.IPv6Lookup)
ips, err := clientv6.LookupIPv6("ipv4only.google.com")
if err != feature_dns.ErrEmptyResponse {
t.Fatal("error: ", err)
}
if len(ips) != 0 {
@@ -272,11 +254,7 @@ func TestUDPServer(t *testing.T) {
dnsServer.Shutdown()
{
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("google.com")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -353,11 +331,7 @@ func TestPrioritizedDomain(t *testing.T) {
startTime := time.Now()
{
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("google.com")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -416,12 +390,10 @@ func TestUDPServerIPv6(t *testing.T) {
common.Must(err)
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
client6 := client.(feature_dns.IPv6Lookup)
{
ips, err := client.LookupIP("ipv6.google.com", feature_dns.IPOption{
IPv4Enable: false,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client6.LookupIPv6("ipv6.google.com")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -484,11 +456,7 @@ func TestStaticHostDomain(t *testing.T) {
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
{
ips, err := client.LookupIP("example.com", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("example.com")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -595,11 +563,7 @@ func TestIPMatch(t *testing.T) {
startTime := time.Now()
{
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("google.com")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -718,11 +682,7 @@ func TestLocalDomain(t *testing.T) {
startTime := time.Now()
{ // Will match dotless:
ips, err := client.LookupIP("hostname", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("hostname")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -733,11 +693,7 @@ func TestLocalDomain(t *testing.T) {
}
{ // Will match domain:local
ips, err := client.LookupIP("hostname.local", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("hostname.local")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -748,11 +704,7 @@ func TestLocalDomain(t *testing.T) {
}
{ // Will match static ip
ips, err := client.LookupIP("hostnamestatic", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("hostnamestatic")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -763,11 +715,7 @@ func TestLocalDomain(t *testing.T) {
}
{ // Will match domain replacing
ips, err := client.LookupIP("hostnamealias", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("hostnamealias")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -778,11 +726,7 @@ func TestLocalDomain(t *testing.T) {
}
{ // Will match dotless:localhost, but not expectIPs: 127.0.0.2, 127.0.0.3, then matches at dotless:
ips, err := client.LookupIP("localhost", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("localhost")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -793,11 +737,7 @@ func TestLocalDomain(t *testing.T) {
}
{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
ips, err := client.LookupIP("localhost-a", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("localhost-a")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -808,11 +748,7 @@ func TestLocalDomain(t *testing.T) {
}
{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
ips, err := client.LookupIP("localhost-b", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("localhost-b")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -823,11 +759,7 @@ func TestLocalDomain(t *testing.T) {
}
{ // Will match dotless:
ips, err := client.LookupIP("Mijia Cloud", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("Mijia Cloud")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -989,11 +921,7 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
startTime := time.Now()
{ // Will match server 1,2 and server 1 returns expected ip
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("google.com")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -1004,11 +932,8 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
}
{ // Will match server 1,2 and server 1 returns unexpected ip, then server 2 returns expected one
ips, err := client.LookupIP("ipv6.google.com", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: false,
FakeEnable: false,
})
clientv4 := client.(feature_dns.IPv4Lookup)
ips, err := clientv4.LookupIPv4("ipv6.google.com")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -1019,11 +944,7 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
}
{ // Will match server 3,1,2 and server 3 returns expected one
ips, err := client.LookupIP("api.google.com", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("api.google.com")
if err != nil {
t.Fatal("unexpected error: ", err)
}
@@ -1034,11 +955,7 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
}
{ // Will match server 4,3,1,2 and server 4 returns expected one
ips, err := client.LookupIP("v2.api.google.com", feature_dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
ips, err := client.LookupIP("v2.api.google.com")
if err != nil {
t.Fatal("unexpected error: ", err)
}

View File

@@ -8,7 +8,6 @@ import (
"time"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/protocol/dns"
udp_proto "github.com/xtls/xray-core/common/protocol/udp"
@@ -21,30 +20,30 @@ import (
"golang.org/x/net/dns/dnsmessage"
)
// ClassicNameServer implemented traditional UDP DNS.
type ClassicNameServer struct {
sync.RWMutex
name string
address *net.Destination
ips map[string]*record
requests map[uint16]*dnsRequest
address net.Destination
ips map[string]record
requests map[uint16]dnsRequest
pub *pubsub.Service
udpServer *udp.Dispatcher
cleanup *task.Periodic
reqID uint32
clientIP net.IP
}
// NewClassicNameServer creates udp server object for remote resolving.
func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher) *ClassicNameServer {
func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher, clientIP net.IP) *ClassicNameServer {
// default to 53 if unspecific
if address.Port == 0 {
address.Port = net.Port(53)
}
s := &ClassicNameServer{
address: &address,
ips: make(map[string]*record),
requests: make(map[uint16]*dnsRequest),
address: address,
ips: make(map[string]record),
requests: make(map[uint16]dnsRequest),
clientIP: clientIP,
pub: pubsub.NewService(),
name: strings.ToUpper(address.String()),
}
@@ -53,16 +52,14 @@ func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher
Execute: s.Cleanup,
}
s.udpServer = udp.NewDispatcher(dispatcher, s.HandleResponse)
newError("DNS: created UDP client initialized for ", address.NetAddr()).AtInfo().WriteToLog()
newError("DNS: created udp client inited for ", address.NetAddr()).AtInfo().WriteToLog()
return s
}
// Name implements Server.
func (s *ClassicNameServer) Name() string {
return s.name
}
// Cleanup clears expired items from cache
func (s *ClassicNameServer) Cleanup() error {
now := time.Now()
s.Lock()
@@ -81,7 +78,6 @@ func (s *ClassicNameServer) Cleanup() error {
}
if record.A == nil && record.AAAA == nil {
newError(s.name, " cleanup ", domain).AtDebug().WriteToLog()
delete(s.ips, domain)
} else {
s.ips[domain] = record
@@ -89,7 +85,7 @@ func (s *ClassicNameServer) Cleanup() error {
}
if len(s.ips) == 0 {
s.ips = make(map[string]*record)
s.ips = make(map[string]record)
}
for id, req := range s.requests {
@@ -99,13 +95,12 @@ func (s *ClassicNameServer) Cleanup() error {
}
if len(s.requests) == 0 {
s.requests = make(map[uint16]*dnsRequest)
s.requests = make(map[uint16]dnsRequest)
}
return nil
}
// HandleResponse handles udp response packet from remote DNS server.
func (s *ClassicNameServer) HandleResponse(ctx context.Context, packet *udp_proto.Packet) {
ipRec, err := parseResponse(packet.Payload.Bytes())
if err != nil {
@@ -137,17 +132,15 @@ func (s *ClassicNameServer) HandleResponse(ctx context.Context, packet *udp_prot
elapsed := time.Since(req.start)
newError(s.name, " got answer: ", req.domain, " ", req.reqType, " -> ", ipRec.IP, " ", elapsed).AtInfo().WriteToLog()
if len(req.domain) > 0 && (rec.A != nil || rec.AAAA != nil) {
s.updateIP(req.domain, &rec)
s.updateIP(req.domain, rec)
}
}
func (s *ClassicNameServer) updateIP(domain string, newRec *record) {
func (s *ClassicNameServer) updateIP(domain string, newRec record) {
s.Lock()
rec, found := s.ips[domain]
if !found {
rec = &record{}
}
newError(s.name, " updating IP records for domain:", domain).AtDebug().WriteToLog()
rec := s.ips[domain]
updated := false
if isNewer(rec.A, newRec.A) {
@@ -160,7 +153,6 @@ func (s *ClassicNameServer) updateIP(domain string, newRec *record) {
}
if updated {
newError(s.name, " updating IP records for domain:", domain).AtDebug().WriteToLog()
s.ips[domain] = rec
}
if newRec.A != nil {
@@ -183,22 +175,29 @@ func (s *ClassicNameServer) addPendingRequest(req *dnsRequest) {
id := req.msg.ID
req.expire = time.Now().Add(time.Second * 8)
s.requests[id] = req
s.requests[id] = *req
}
func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption) {
func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option IPOption) {
newError(s.name, " querying DNS for: ", domain).AtDebug().WriteToLog(session.ExportIDToError(ctx))
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(clientIP))
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
for _, req := range reqs {
s.addPendingRequest(req)
b, _ := dns.PackMessage(req.msg)
s.udpServer.Dispatch(toDnsContext(ctx, s.address.String()), *s.address, b)
udpCtx := context.Background()
if inbound := session.InboundFromContext(ctx); inbound != nil {
udpCtx = session.ContextWithInbound(udpCtx, inbound)
}
udpCtx = session.ContextWithContent(udpCtx, &session.Content{
Protocol: "dns",
})
s.udpServer.Dispatch(udpCtx, s.address, b)
}
}
func (s *ClassicNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
func (s *ClassicNameServer) findIPsForDomain(domain string, option IPOption) ([]net.IP, error) {
s.RLock()
record, found := s.ips[domain]
s.RUnlock()
@@ -207,48 +206,42 @@ func (s *ClassicNameServer) findIPsForDomain(domain string, option dns_feature.I
return nil, errRecordNotFound
}
var err4 error
var err6 error
var ips []net.Address
var ip6 []net.Address
var lastErr error
if option.IPv4Enable {
ips, err4 = record.A.getIPs()
a, err := record.A.getIPs()
if err != nil {
lastErr = err
}
ips = append(ips, a...)
}
if option.IPv6Enable {
ip6, err6 = record.AAAA.getIPs()
ips = append(ips, ip6...)
aaaa, err := record.AAAA.getIPs()
if err != nil {
lastErr = err
}
ips = append(ips, aaaa...)
}
if len(ips) > 0 {
return toNetIP(ips)
return toNetIP(ips), nil
}
if err4 != nil {
return nil, err4
}
if err6 != nil {
return nil, err6
if lastErr != nil {
return nil, lastErr
}
return nil, dns_feature.ErrEmptyResponse
}
// QueryIP implements Server.
func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption, disableCache bool) ([]net.IP, error) {
func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
fqdn := Fqdn(domain)
if disableCache {
newError("DNS cache is disabled. Querying IP for ", domain, " at ", s.name).AtDebug().WriteToLog()
} else {
ips, err := s.findIPsForDomain(fqdn, option)
if err != errRecordNotFound {
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSCacheHit, Elapsed: 0, Error: err})
return ips, err
}
ips, err := s.findIPsForDomain(fqdn, option)
if err != errRecordNotFound {
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
return ips, err
}
// ipv4 and ipv6 belong to different subscription groups
@@ -277,13 +270,11 @@ func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, clientIP
}
close(done)
}()
s.sendQuery(ctx, fqdn, clientIP, option)
start := time.Now()
s.sendQuery(ctx, fqdn, option)
for {
ips, err := s.findIPsForDomain(fqdn, option)
if err != errRecordNotFound {
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
return ips, err
}

View File

@@ -5,10 +5,11 @@ package command
import (
"context"
grpc "google.golang.org/grpc"
"github.com/xtls/xray-core/app/log"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/core"
grpc "google.golang.org/grpc"
)
type LoggerServer struct {

View File

@@ -1,12 +1,13 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// protoc-gen-go v1.25.0
// protoc v3.14.0
// source: app/log/command/config.proto
package command
import (
proto "github.com/golang/protobuf/proto"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
@@ -20,6 +21,10 @@ const (
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// This is a compile-time assertion that a sufficiently up-to-date version
// of the legacy proto package is being used.
const _ = proto.ProtoPackageIsVersion4
type Config struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache

View File

@@ -1,8 +1,4 @@
// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
// versions:
// - protoc-gen-go-grpc v1.3.0
// - protoc v4.23.1
// source: app/log/command/config.proto
package command
@@ -18,10 +14,6 @@ import (
// Requires gRPC-Go v1.32.0 or later.
const _ = grpc.SupportPackageIsVersion7
const (
LoggerService_RestartLogger_FullMethodName = "/xray.app.log.command.LoggerService/RestartLogger"
)
// LoggerServiceClient is the client API for LoggerService service.
//
// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream.
@@ -39,7 +31,7 @@ func NewLoggerServiceClient(cc grpc.ClientConnInterface) LoggerServiceClient {
func (c *loggerServiceClient) RestartLogger(ctx context.Context, in *RestartLoggerRequest, opts ...grpc.CallOption) (*RestartLoggerResponse, error) {
out := new(RestartLoggerResponse)
err := c.cc.Invoke(ctx, LoggerService_RestartLogger_FullMethodName, in, out, opts...)
err := c.cc.Invoke(ctx, "/xray.app.log.command.LoggerService/RestartLogger", in, out, opts...)
if err != nil {
return nil, err
}
@@ -84,7 +76,7 @@ func _LoggerService_RestartLogger_Handler(srv interface{}, ctx context.Context,
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: LoggerService_RestartLogger_FullMethodName,
FullMethod: "/xray.app.log.command.LoggerService/RestartLogger",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(LoggerServiceServer).RestartLogger(ctx, req.(*RestartLoggerRequest))

View File

@@ -1,12 +1,13 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// protoc-gen-go v1.25.0
// protoc v3.14.0
// source: app/log/config.proto
package log
import (
proto "github.com/golang/protobuf/proto"
log "github.com/xtls/xray-core/common/log"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
@@ -21,6 +22,10 @@ const (
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// This is a compile-time assertion that a sufficiently up-to-date version
// of the legacy proto package is being used.
const _ = proto.ProtoPackageIsVersion4
type LogType int32
const (
@@ -83,7 +88,6 @@ type Config struct {
ErrorLogPath string `protobuf:"bytes,3,opt,name=error_log_path,json=errorLogPath,proto3" json:"error_log_path,omitempty"`
AccessLogType LogType `protobuf:"varint,4,opt,name=access_log_type,json=accessLogType,proto3,enum=xray.app.log.LogType" json:"access_log_type,omitempty"`
AccessLogPath string `protobuf:"bytes,5,opt,name=access_log_path,json=accessLogPath,proto3" json:"access_log_path,omitempty"`
EnableDnsLog bool `protobuf:"varint,6,opt,name=enable_dns_log,json=enableDnsLog,proto3" json:"enable_dns_log,omitempty"`
}
func (x *Config) Reset() {
@@ -129,7 +133,7 @@ func (x *Config) GetErrorLogLevel() log.Severity {
if x != nil {
return x.ErrorLogLevel
}
return log.Severity(0)
return log.Severity_Unknown
}
func (x *Config) GetErrorLogPath() string {
@@ -153,20 +157,13 @@ func (x *Config) GetAccessLogPath() string {
return ""
}
func (x *Config) GetEnableDnsLog() bool {
if x != nil {
return x.EnableDnsLog
}
return false
}
var File_app_log_config_proto protoreflect.FileDescriptor
var file_app_log_config_proto_rawDesc = []byte{
0x0a, 0x14, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0x2f, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x67,
0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x0c, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
0x2e, 0x6c, 0x6f, 0x67, 0x1a, 0x14, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2f, 0x6c, 0x6f, 0x67,
0x2f, 0x6c, 0x6f, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xbb, 0x02, 0x0a, 0x06, 0x43,
0x2f, 0x6c, 0x6f, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0x95, 0x02, 0x0a, 0x06, 0x43,
0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x3b, 0x0a, 0x0e, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x5f, 0x6c,
0x6f, 0x67, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x15, 0x2e,
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x2e, 0x4c, 0x6f, 0x67,
@@ -184,17 +181,15 @@ var file_app_log_config_proto_rawDesc = []byte{
0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x26, 0x0a, 0x0f, 0x61, 0x63,
0x63, 0x65, 0x73, 0x73, 0x5f, 0x6c, 0x6f, 0x67, 0x5f, 0x70, 0x61, 0x74, 0x68, 0x18, 0x05, 0x20,
0x01, 0x28, 0x09, 0x52, 0x0d, 0x61, 0x63, 0x63, 0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x50, 0x61,
0x74, 0x68, 0x12, 0x24, 0x0a, 0x0e, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x5f, 0x64, 0x6e, 0x73,
0x5f, 0x6c, 0x6f, 0x67, 0x18, 0x06, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x65, 0x6e, 0x61, 0x62,
0x6c, 0x65, 0x44, 0x6e, 0x73, 0x4c, 0x6f, 0x67, 0x2a, 0x35, 0x0a, 0x07, 0x4c, 0x6f, 0x67, 0x54,
0x79, 0x70, 0x65, 0x12, 0x08, 0x0a, 0x04, 0x4e, 0x6f, 0x6e, 0x65, 0x10, 0x00, 0x12, 0x0b, 0x0a,
0x07, 0x43, 0x6f, 0x6e, 0x73, 0x6f, 0x6c, 0x65, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x69,
0x6c, 0x65, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x10, 0x03, 0x42,
0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e,
0x6c, 0x6f, 0x67, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f,
0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65,
0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e,
0x41, 0x70, 0x70, 0x2e, 0x4c, 0x6f, 0x67, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
0x74, 0x68, 0x2a, 0x35, 0x0a, 0x07, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08, 0x0a,
0x04, 0x4e, 0x6f, 0x6e, 0x65, 0x10, 0x00, 0x12, 0x0b, 0x0a, 0x07, 0x43, 0x6f, 0x6e, 0x73, 0x6f,
0x6c, 0x65, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x69, 0x6c, 0x65, 0x10, 0x02, 0x12, 0x09,
0x0a, 0x05, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x10, 0x03, 0x42, 0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d,
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x50, 0x01, 0x5a,
0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73,
0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6c,
0x6f, 0x67, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x4c, 0x6f,
0x67, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
}
var (

View File

@@ -22,5 +22,4 @@ message Config {
LogType access_log_type = 4;
string access_log_path = 5;
bool enable_dns_log = 6;
}

View File

@@ -17,7 +17,6 @@ type Instance struct {
accessLogger log.Handler
errorLogger log.Handler
active bool
dns bool
}
// New creates a new log.Instance based on the given config.
@@ -25,7 +24,6 @@ func New(ctx context.Context, config *Config) (*Instance, error) {
g := &Instance{
config: config,
active: false,
dns: config.EnableDnsLog,
}
log.RegisterHandler(g)
@@ -105,10 +103,6 @@ func (g *Instance) Handle(msg log.Message) {
if g.accessLogger != nil {
g.accessLogger.Handle(msg)
}
case *log.DNSLog:
if g.dns && g.accessLogger != nil {
g.accessLogger.Handle(msg)
}
case *log.GeneralMessage:
if g.errorLogger != nil && msg.Severity <= g.config.ErrorLogLevel {
g.errorLogger.Handle(msg)

View File

@@ -1,8 +1,6 @@
package log
import (
"sync"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/log"
)
@@ -13,26 +11,20 @@ type HandlerCreatorOptions struct {
type HandlerCreator func(LogType, HandlerCreatorOptions) (log.Handler, error)
var handlerCreatorMap = make(map[LogType]HandlerCreator)
var handlerCreatorMapLock = &sync.RWMutex{}
var (
handlerCreatorMap = make(map[LogType]HandlerCreator)
)
func RegisterHandlerCreator(logType LogType, f HandlerCreator) error {
if f == nil {
return newError("nil HandlerCreator")
}
handlerCreatorMapLock.Lock()
defer handlerCreatorMapLock.Unlock()
handlerCreatorMap[logType] = f
return nil
}
func createHandler(logType LogType, options HandlerCreatorOptions) (log.Handler, error) {
handlerCreatorMapLock.RLock()
defer handlerCreatorMapLock.RUnlock()
creator, found := handlerCreatorMap[logType]
if !found {
return nil, newError("unable to create log handler for ", logType)

View File

@@ -1,149 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// source: app/metrics/config.proto
package metrics
import (
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// Config is the settings for metrics.
type Config struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
// Tag of the outbound handler that handles metrics http connections.
Tag string `protobuf:"bytes,1,opt,name=tag,proto3" json:"tag,omitempty"`
}
func (x *Config) Reset() {
*x = Config{}
if protoimpl.UnsafeEnabled {
mi := &file_app_metrics_config_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_metrics_config_proto_msgTypes[0]
if protoimpl.UnsafeEnabled && x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_metrics_config_proto_rawDescGZIP(), []int{0}
}
func (x *Config) GetTag() string {
if x != nil {
return x.Tag
}
return ""
}
var File_app_metrics_config_proto protoreflect.FileDescriptor
var file_app_metrics_config_proto_rawDesc = []byte{
0x0a, 0x18, 0x61, 0x70, 0x70, 0x2f, 0x6d, 0x65, 0x74, 0x72, 0x69, 0x63, 0x73, 0x2f, 0x63, 0x6f,
0x6e, 0x66, 0x69, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x10, 0x78, 0x72, 0x61, 0x79,
0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6d, 0x65, 0x74, 0x72, 0x69, 0x63, 0x73, 0x22, 0x1a, 0x0a, 0x06,
0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20,
0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x42, 0x52, 0x0a, 0x14, 0x63, 0x6f, 0x6d, 0x2e,
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6d, 0x65, 0x74, 0x72, 0x69, 0x63, 0x73,
0x50, 0x01, 0x5a, 0x25, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78,
0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70,
0x70, 0x2f, 0x6d, 0x65, 0x74, 0x72, 0x69, 0x63, 0x73, 0xaa, 0x02, 0x10, 0x58, 0x72, 0x61, 0x79,
0x2e, 0x41, 0x70, 0x70, 0x2e, 0x4d, 0x65, 0x74, 0x72, 0x69, 0x63, 0x73, 0x62, 0x06, 0x70, 0x72,
0x6f, 0x74, 0x6f, 0x33,
}
var (
file_app_metrics_config_proto_rawDescOnce sync.Once
file_app_metrics_config_proto_rawDescData = file_app_metrics_config_proto_rawDesc
)
func file_app_metrics_config_proto_rawDescGZIP() []byte {
file_app_metrics_config_proto_rawDescOnce.Do(func() {
file_app_metrics_config_proto_rawDescData = protoimpl.X.CompressGZIP(file_app_metrics_config_proto_rawDescData)
})
return file_app_metrics_config_proto_rawDescData
}
var file_app_metrics_config_proto_msgTypes = make([]protoimpl.MessageInfo, 1)
var file_app_metrics_config_proto_goTypes = []interface{}{
(*Config)(nil), // 0: xray.app.metrics.Config
}
var file_app_metrics_config_proto_depIdxs = []int32{
0, // [0:0] is the sub-list for method output_type
0, // [0:0] is the sub-list for method input_type
0, // [0:0] is the sub-list for extension type_name
0, // [0:0] is the sub-list for extension extendee
0, // [0:0] is the sub-list for field type_name
}
func init() { file_app_metrics_config_proto_init() }
func file_app_metrics_config_proto_init() {
if File_app_metrics_config_proto != nil {
return
}
if !protoimpl.UnsafeEnabled {
file_app_metrics_config_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
switch v := v.(*Config); i {
case 0:
return &v.state
case 1:
return &v.sizeCache
case 2:
return &v.unknownFields
default:
return nil
}
}
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: file_app_metrics_config_proto_rawDesc,
NumEnums: 0,
NumMessages: 1,
NumExtensions: 0,
NumServices: 0,
},
GoTypes: file_app_metrics_config_proto_goTypes,
DependencyIndexes: file_app_metrics_config_proto_depIdxs,
MessageInfos: file_app_metrics_config_proto_msgTypes,
}.Build()
File_app_metrics_config_proto = out.File
file_app_metrics_config_proto_rawDesc = nil
file_app_metrics_config_proto_goTypes = nil
file_app_metrics_config_proto_depIdxs = nil
}

View File

@@ -1,13 +0,0 @@
syntax = "proto3";
package xray.app.metrics;
option csharp_namespace = "Xray.App.Metrics";
option go_package = "github.com/xtls/xray-core/app/metrics";
option java_package = "com.xray.app.metrics";
option java_multiple_files = true;
// Config is the settings for metrics.
message Config {
// Tag of the outbound handler that handles metrics http connections.
string tag = 1;
}

View File

@@ -1,9 +0,0 @@
package metrics
import "github.com/xtls/xray-core/common/errors"
type errPathObjHolder struct{}
func newError(values ...interface{}) *errors.Error {
return errors.New(values...).WithPathObj(errPathObjHolder{})
}

View File

@@ -1,118 +0,0 @@
package metrics
import (
"context"
"expvar"
"net/http"
_ "net/http/pprof"
"strings"
"github.com/xtls/xray-core/app/observatory"
"github.com/xtls/xray-core/app/stats"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/signal/done"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/extension"
"github.com/xtls/xray-core/features/outbound"
feature_stats "github.com/xtls/xray-core/features/stats"
)
type MetricsHandler struct {
ohm outbound.Manager
statsManager feature_stats.Manager
observatory extension.Observatory
tag string
}
// NewMetricsHandler creates a new MetricsHandler based on the given config.
func NewMetricsHandler(ctx context.Context, config *Config) (*MetricsHandler, error) {
c := &MetricsHandler{
tag: config.Tag,
}
common.Must(core.RequireFeatures(ctx, func(om outbound.Manager, sm feature_stats.Manager) {
c.statsManager = sm
c.ohm = om
}))
expvar.Publish("stats", expvar.Func(func() interface{} {
manager, ok := c.statsManager.(*stats.Manager)
if !ok {
return nil
}
resp := map[string]map[string]map[string]int64{
"inbound": {},
"outbound": {},
"user": {},
}
manager.VisitCounters(func(name string, counter feature_stats.Counter) bool {
nameSplit := strings.Split(name, ">>>")
typeName, tagOrUser, direction := nameSplit[0], nameSplit[1], nameSplit[3]
if item, found := resp[typeName][tagOrUser]; found {
item[direction] = counter.Value()
} else {
resp[typeName][tagOrUser] = map[string]int64{
direction: counter.Value(),
}
}
return true
})
return resp
}))
expvar.Publish("observatory", expvar.Func(func() interface{} {
if c.observatory == nil {
common.Must(core.RequireFeatures(ctx, func(observatory extension.Observatory) error {
c.observatory = observatory
return nil
}))
if c.observatory == nil {
return nil
}
}
resp := map[string]*observatory.OutboundStatus{}
if o, err := c.observatory.GetObservation(context.Background()); err != nil {
return err
} else {
for _, x := range o.(*observatory.ObservationResult).GetStatus() {
resp[x.OutboundTag] = x
}
}
return resp
}))
return c, nil
}
func (p *MetricsHandler) Type() interface{} {
return (*MetricsHandler)(nil)
}
func (p *MetricsHandler) Start() error {
listener := &OutboundListener{
buffer: make(chan net.Conn, 4),
done: done.New(),
}
go func() {
if err := http.Serve(listener, http.DefaultServeMux); err != nil {
newError("failed to start metrics server").Base(err).AtError().WriteToLog()
}
}()
if err := p.ohm.RemoveHandler(context.Background(), p.tag); err != nil {
newError("failed to remove existing handler").WriteToLog()
}
return p.ohm.AddHandler(context.Background(), &Outbound{
tag: p.tag,
listener: listener,
})
}
func (p *MetricsHandler) Close() error {
return nil
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
return NewMetricsHandler(ctx, cfg.(*Config))
}))
}

View File

@@ -1,109 +0,0 @@
package metrics
import (
"context"
"sync"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/net/cnc"
"github.com/xtls/xray-core/common/signal/done"
"github.com/xtls/xray-core/transport"
)
// OutboundListener is a net.Listener for listening metrics http connections.
type OutboundListener struct {
buffer chan net.Conn
done *done.Instance
}
func (l *OutboundListener) add(conn net.Conn) {
select {
case l.buffer <- conn:
case <-l.done.Wait():
conn.Close()
default:
conn.Close()
}
}
// Accept implements net.Listener.
func (l *OutboundListener) Accept() (net.Conn, error) {
select {
case <-l.done.Wait():
return nil, newError("listen closed")
case c := <-l.buffer:
return c, nil
}
}
// Close implement net.Listener.
func (l *OutboundListener) Close() error {
common.Must(l.done.Close())
L:
for {
select {
case c := <-l.buffer:
c.Close()
default:
break L
}
}
return nil
}
// Addr implements net.Listener.
func (l *OutboundListener) Addr() net.Addr {
return &net.TCPAddr{
IP: net.IP{0, 0, 0, 0},
Port: 0,
}
}
// Outbound is an outbound.Handler that handles metrics http connections.
type Outbound struct {
tag string
listener *OutboundListener
access sync.RWMutex
closed bool
}
// Dispatch implements outbound.Handler.
func (co *Outbound) Dispatch(ctx context.Context, link *transport.Link) {
co.access.RLock()
if co.closed {
common.Interrupt(link.Reader)
common.Interrupt(link.Writer)
co.access.RUnlock()
return
}
closeSignal := done.New()
c := cnc.NewConnection(cnc.ConnectionInputMulti(link.Writer), cnc.ConnectionOutputMulti(link.Reader), cnc.ConnectionOnClose(closeSignal))
co.listener.add(c)
co.access.RUnlock()
<-closeSignal.Wait()
}
// Tag implements outbound.Handler.
func (co *Outbound) Tag() string {
return co.tag
}
// Start implements common.Runnable.
func (co *Outbound) Start() error {
co.access.Lock()
co.closed = false
co.access.Unlock()
return nil
}
// Close implements common.Closable.
func (co *Outbound) Close() error {
co.access.Lock()
defer co.access.Unlock()
co.closed = true
return co.listener.Close()
}

View File

@@ -1,50 +0,0 @@
//go:build !confonly
// +build !confonly
package command
import (
"context"
"github.com/xtls/xray-core/app/observatory"
"github.com/xtls/xray-core/common"
core "github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/extension"
"google.golang.org/grpc"
)
type service struct {
UnimplementedObservatoryServiceServer
v *core.Instance
observatory extension.Observatory
}
func (s *service) GetOutboundStatus(ctx context.Context, request *GetOutboundStatusRequest) (*GetOutboundStatusResponse, error) {
resp, err := s.observatory.GetObservation(ctx)
if err != nil {
return nil, err
}
retdata := resp.(*observatory.ObservationResult)
return &GetOutboundStatusResponse{
Status: retdata,
}, nil
}
func (s *service) Register(server *grpc.Server) {
RegisterObservatoryServiceServer(server, s)
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
s := core.MustFromContext(ctx)
sv := &service{v: s}
err := s.RequireFeatures(func(Observatory extension.Observatory) {
sv.observatory = Observatory
})
if err != nil {
return nil, err
}
return sv, nil
}))
}

View File

@@ -1,278 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// source: app/observatory/command/command.proto
package command
import (
observatory "github.com/xtls/xray-core/app/observatory"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
type GetOutboundStatusRequest struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
}
func (x *GetOutboundStatusRequest) Reset() {
*x = GetOutboundStatusRequest{}
if protoimpl.UnsafeEnabled {
mi := &file_app_observatory_command_command_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
}
func (x *GetOutboundStatusRequest) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*GetOutboundStatusRequest) ProtoMessage() {}
func (x *GetOutboundStatusRequest) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_command_command_proto_msgTypes[0]
if protoimpl.UnsafeEnabled && x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use GetOutboundStatusRequest.ProtoReflect.Descriptor instead.
func (*GetOutboundStatusRequest) Descriptor() ([]byte, []int) {
return file_app_observatory_command_command_proto_rawDescGZIP(), []int{0}
}
type GetOutboundStatusResponse struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
Status *observatory.ObservationResult `protobuf:"bytes,1,opt,name=status,proto3" json:"status,omitempty"`
}
func (x *GetOutboundStatusResponse) Reset() {
*x = GetOutboundStatusResponse{}
if protoimpl.UnsafeEnabled {
mi := &file_app_observatory_command_command_proto_msgTypes[1]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
}
func (x *GetOutboundStatusResponse) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*GetOutboundStatusResponse) ProtoMessage() {}
func (x *GetOutboundStatusResponse) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_command_command_proto_msgTypes[1]
if protoimpl.UnsafeEnabled && x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use GetOutboundStatusResponse.ProtoReflect.Descriptor instead.
func (*GetOutboundStatusResponse) Descriptor() ([]byte, []int) {
return file_app_observatory_command_command_proto_rawDescGZIP(), []int{1}
}
func (x *GetOutboundStatusResponse) GetStatus() *observatory.ObservationResult {
if x != nil {
return x.Status
}
return nil
}
type Config struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
}
func (x *Config) Reset() {
*x = Config{}
if protoimpl.UnsafeEnabled {
mi := &file_app_observatory_command_command_proto_msgTypes[2]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_command_command_proto_msgTypes[2]
if protoimpl.UnsafeEnabled && x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_observatory_command_command_proto_rawDescGZIP(), []int{2}
}
var File_app_observatory_command_command_proto protoreflect.FileDescriptor
var file_app_observatory_command_command_proto_rawDesc = []byte{
0x0a, 0x25, 0x61, 0x70, 0x70, 0x2f, 0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72,
0x79, 0x2f, 0x63, 0x6f, 0x6d, 0x6d, 0x61, 0x6e, 0x64, 0x2f, 0x63, 0x6f, 0x6d, 0x6d, 0x61, 0x6e,
0x64, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x21, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f,
0x72, 0x65, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f,
0x72, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x61, 0x6e, 0x64, 0x1a, 0x1c, 0x61, 0x70, 0x70, 0x2f,
0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2f, 0x63, 0x6f, 0x6e, 0x66,
0x69, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0x1a, 0x0a, 0x18, 0x47, 0x65, 0x74, 0x4f,
0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x71,
0x75, 0x65, 0x73, 0x74, 0x22, 0x61, 0x0a, 0x19, 0x47, 0x65, 0x74, 0x4f, 0x75, 0x74, 0x62, 0x6f,
0x75, 0x6e, 0x64, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73,
0x65, 0x12, 0x44, 0x0a, 0x06, 0x73, 0x74, 0x61, 0x74, 0x75, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28,
0x0b, 0x32, 0x2c, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x72, 0x65, 0x2e, 0x61, 0x70,
0x70, 0x2e, 0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2e, 0x4f, 0x62,
0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x52,
0x06, 0x73, 0x74, 0x61, 0x74, 0x75, 0x73, 0x22, 0x08, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69,
0x67, 0x32, 0xa7, 0x01, 0x0a, 0x12, 0x4f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72,
0x79, 0x53, 0x65, 0x72, 0x76, 0x69, 0x63, 0x65, 0x12, 0x90, 0x01, 0x0a, 0x11, 0x47, 0x65, 0x74,
0x4f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x3b,
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x72, 0x65, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6f,
0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x61,
0x6e, 0x64, 0x2e, 0x47, 0x65, 0x74, 0x4f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x74,
0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x3c, 0x2e, 0x78, 0x72,
0x61, 0x79, 0x2e, 0x63, 0x6f, 0x72, 0x65, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6f, 0x62, 0x73, 0x65,
0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x61, 0x6e, 0x64, 0x2e,
0x47, 0x65, 0x74, 0x4f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x74, 0x61, 0x74, 0x75,
0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x42, 0x80, 0x01, 0x0a, 0x25,
0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x72, 0x65, 0x2e, 0x61, 0x70,
0x70, 0x2e, 0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2e, 0x63, 0x6f,
0x6d, 0x6d, 0x61, 0x6e, 0x64, 0x50, 0x01, 0x5a, 0x31, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e,
0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f,
0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f,
0x72, 0x79, 0x2f, 0x63, 0x6f, 0x6d, 0x6d, 0x61, 0x6e, 0x64, 0xaa, 0x02, 0x21, 0x58, 0x72, 0x61,
0x79, 0x2e, 0x43, 0x6f, 0x72, 0x65, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x4f, 0x62, 0x73, 0x65, 0x72,
0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2e, 0x43, 0x6f, 0x6d, 0x6d, 0x61, 0x6e, 0x64, 0x62, 0x06,
0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
}
var (
file_app_observatory_command_command_proto_rawDescOnce sync.Once
file_app_observatory_command_command_proto_rawDescData = file_app_observatory_command_command_proto_rawDesc
)
func file_app_observatory_command_command_proto_rawDescGZIP() []byte {
file_app_observatory_command_command_proto_rawDescOnce.Do(func() {
file_app_observatory_command_command_proto_rawDescData = protoimpl.X.CompressGZIP(file_app_observatory_command_command_proto_rawDescData)
})
return file_app_observatory_command_command_proto_rawDescData
}
var file_app_observatory_command_command_proto_msgTypes = make([]protoimpl.MessageInfo, 3)
var file_app_observatory_command_command_proto_goTypes = []interface{}{
(*GetOutboundStatusRequest)(nil), // 0: xray.core.app.observatory.command.GetOutboundStatusRequest
(*GetOutboundStatusResponse)(nil), // 1: xray.core.app.observatory.command.GetOutboundStatusResponse
(*Config)(nil), // 2: xray.core.app.observatory.command.Config
(*observatory.ObservationResult)(nil), // 3: xray.core.app.observatory.ObservationResult
}
var file_app_observatory_command_command_proto_depIdxs = []int32{
3, // 0: xray.core.app.observatory.command.GetOutboundStatusResponse.status:type_name -> xray.core.app.observatory.ObservationResult
0, // 1: xray.core.app.observatory.command.ObservatoryService.GetOutboundStatus:input_type -> xray.core.app.observatory.command.GetOutboundStatusRequest
1, // 2: xray.core.app.observatory.command.ObservatoryService.GetOutboundStatus:output_type -> xray.core.app.observatory.command.GetOutboundStatusResponse
2, // [2:3] is the sub-list for method output_type
1, // [1:2] is the sub-list for method input_type
1, // [1:1] is the sub-list for extension type_name
1, // [1:1] is the sub-list for extension extendee
0, // [0:1] is the sub-list for field type_name
}
func init() { file_app_observatory_command_command_proto_init() }
func file_app_observatory_command_command_proto_init() {
if File_app_observatory_command_command_proto != nil {
return
}
if !protoimpl.UnsafeEnabled {
file_app_observatory_command_command_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
switch v := v.(*GetOutboundStatusRequest); i {
case 0:
return &v.state
case 1:
return &v.sizeCache
case 2:
return &v.unknownFields
default:
return nil
}
}
file_app_observatory_command_command_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} {
switch v := v.(*GetOutboundStatusResponse); i {
case 0:
return &v.state
case 1:
return &v.sizeCache
case 2:
return &v.unknownFields
default:
return nil
}
}
file_app_observatory_command_command_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} {
switch v := v.(*Config); i {
case 0:
return &v.state
case 1:
return &v.sizeCache
case 2:
return &v.unknownFields
default:
return nil
}
}
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: file_app_observatory_command_command_proto_rawDesc,
NumEnums: 0,
NumMessages: 3,
NumExtensions: 0,
NumServices: 1,
},
GoTypes: file_app_observatory_command_command_proto_goTypes,
DependencyIndexes: file_app_observatory_command_command_proto_depIdxs,
MessageInfos: file_app_observatory_command_command_proto_msgTypes,
}.Build()
File_app_observatory_command_command_proto = out.File
file_app_observatory_command_command_proto_rawDesc = nil
file_app_observatory_command_command_proto_goTypes = nil
file_app_observatory_command_command_proto_depIdxs = nil
}

View File

@@ -1,24 +0,0 @@
syntax = "proto3";
package xray.core.app.observatory.command;
option csharp_namespace = "Xray.Core.App.Observatory.Command";
option go_package = "github.com/xtls/xray-core/app/observatory/command";
option java_package = "com.xray.core.app.observatory.command";
option java_multiple_files = true;
import "app/observatory/config.proto";
message GetOutboundStatusRequest {
}
message GetOutboundStatusResponse {
xray.core.app.observatory.ObservationResult status = 1;
}
service ObservatoryService {
rpc GetOutboundStatus(GetOutboundStatusRequest)
returns (GetOutboundStatusResponse) {}
}
message Config {}

View File

@@ -1,109 +0,0 @@
// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
// versions:
// - protoc-gen-go-grpc v1.3.0
// - protoc v4.23.1
// source: app/observatory/command/command.proto
package command
import (
context "context"
grpc "google.golang.org/grpc"
codes "google.golang.org/grpc/codes"
status "google.golang.org/grpc/status"
)
// This is a compile-time assertion to ensure that this generated file
// is compatible with the grpc package it is being compiled against.
// Requires gRPC-Go v1.32.0 or later.
const _ = grpc.SupportPackageIsVersion7
const (
ObservatoryService_GetOutboundStatus_FullMethodName = "/xray.core.app.observatory.command.ObservatoryService/GetOutboundStatus"
)
// ObservatoryServiceClient is the client API for ObservatoryService service.
//
// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream.
type ObservatoryServiceClient interface {
GetOutboundStatus(ctx context.Context, in *GetOutboundStatusRequest, opts ...grpc.CallOption) (*GetOutboundStatusResponse, error)
}
type observatoryServiceClient struct {
cc grpc.ClientConnInterface
}
func NewObservatoryServiceClient(cc grpc.ClientConnInterface) ObservatoryServiceClient {
return &observatoryServiceClient{cc}
}
func (c *observatoryServiceClient) GetOutboundStatus(ctx context.Context, in *GetOutboundStatusRequest, opts ...grpc.CallOption) (*GetOutboundStatusResponse, error) {
out := new(GetOutboundStatusResponse)
err := c.cc.Invoke(ctx, ObservatoryService_GetOutboundStatus_FullMethodName, in, out, opts...)
if err != nil {
return nil, err
}
return out, nil
}
// ObservatoryServiceServer is the server API for ObservatoryService service.
// All implementations must embed UnimplementedObservatoryServiceServer
// for forward compatibility
type ObservatoryServiceServer interface {
GetOutboundStatus(context.Context, *GetOutboundStatusRequest) (*GetOutboundStatusResponse, error)
mustEmbedUnimplementedObservatoryServiceServer()
}
// UnimplementedObservatoryServiceServer must be embedded to have forward compatible implementations.
type UnimplementedObservatoryServiceServer struct {
}
func (UnimplementedObservatoryServiceServer) GetOutboundStatus(context.Context, *GetOutboundStatusRequest) (*GetOutboundStatusResponse, error) {
return nil, status.Errorf(codes.Unimplemented, "method GetOutboundStatus not implemented")
}
func (UnimplementedObservatoryServiceServer) mustEmbedUnimplementedObservatoryServiceServer() {}
// UnsafeObservatoryServiceServer may be embedded to opt out of forward compatibility for this service.
// Use of this interface is not recommended, as added methods to ObservatoryServiceServer will
// result in compilation errors.
type UnsafeObservatoryServiceServer interface {
mustEmbedUnimplementedObservatoryServiceServer()
}
func RegisterObservatoryServiceServer(s grpc.ServiceRegistrar, srv ObservatoryServiceServer) {
s.RegisterService(&ObservatoryService_ServiceDesc, srv)
}
func _ObservatoryService_GetOutboundStatus_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
in := new(GetOutboundStatusRequest)
if err := dec(in); err != nil {
return nil, err
}
if interceptor == nil {
return srv.(ObservatoryServiceServer).GetOutboundStatus(ctx, in)
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: ObservatoryService_GetOutboundStatus_FullMethodName,
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(ObservatoryServiceServer).GetOutboundStatus(ctx, req.(*GetOutboundStatusRequest))
}
return interceptor(ctx, in, info, handler)
}
// ObservatoryService_ServiceDesc is the grpc.ServiceDesc for ObservatoryService service.
// It's only intended for direct use with grpc.RegisterService,
// and not to be introspected or modified (even as a copy)
var ObservatoryService_ServiceDesc = grpc.ServiceDesc{
ServiceName: "xray.core.app.observatory.command.ObservatoryService",
HandlerType: (*ObservatoryServiceServer)(nil),
Methods: []grpc.MethodDesc{
{
MethodName: "GetOutboundStatus",
Handler: _ObservatoryService_GetOutboundStatus_Handler,
},
},
Streams: []grpc.StreamDesc{},
Metadata: "app/observatory/command/command.proto",
}

View File

@@ -1,530 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// source: app/observatory/config.proto
package observatory
import (
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
type ObservationResult struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
Status []*OutboundStatus `protobuf:"bytes,1,rep,name=status,proto3" json:"status,omitempty"`
}
func (x *ObservationResult) Reset() {
*x = ObservationResult{}
if protoimpl.UnsafeEnabled {
mi := &file_app_observatory_config_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
}
func (x *ObservationResult) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*ObservationResult) ProtoMessage() {}
func (x *ObservationResult) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_config_proto_msgTypes[0]
if protoimpl.UnsafeEnabled && x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use ObservationResult.ProtoReflect.Descriptor instead.
func (*ObservationResult) Descriptor() ([]byte, []int) {
return file_app_observatory_config_proto_rawDescGZIP(), []int{0}
}
func (x *ObservationResult) GetStatus() []*OutboundStatus {
if x != nil {
return x.Status
}
return nil
}
type OutboundStatus struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
// @Document Whether this outbound is usable
// @Restriction ReadOnlyForUser
Alive bool `protobuf:"varint,1,opt,name=alive,proto3" json:"alive,omitempty"`
// @Document The time for probe request to finish.
// @Type time.ms
// @Restriction ReadOnlyForUser
Delay int64 `protobuf:"varint,2,opt,name=delay,proto3" json:"delay,omitempty"`
// @Document The last error caused this outbound failed to relay probe request
// @Restriction NotMachineReadable
LastErrorReason string `protobuf:"bytes,3,opt,name=last_error_reason,json=lastErrorReason,proto3" json:"last_error_reason,omitempty"`
// @Document The outbound tag for this Server
// @Type id.outboundTag
OutboundTag string `protobuf:"bytes,4,opt,name=outbound_tag,json=outboundTag,proto3" json:"outbound_tag,omitempty"`
// @Document The time this outbound is known to be alive
// @Type id.outboundTag
LastSeenTime int64 `protobuf:"varint,5,opt,name=last_seen_time,json=lastSeenTime,proto3" json:"last_seen_time,omitempty"`
// @Document The time this outbound is tried
// @Type id.outboundTag
LastTryTime int64 `protobuf:"varint,6,opt,name=last_try_time,json=lastTryTime,proto3" json:"last_try_time,omitempty"`
}
func (x *OutboundStatus) Reset() {
*x = OutboundStatus{}
if protoimpl.UnsafeEnabled {
mi := &file_app_observatory_config_proto_msgTypes[1]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
}
func (x *OutboundStatus) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*OutboundStatus) ProtoMessage() {}
func (x *OutboundStatus) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_config_proto_msgTypes[1]
if protoimpl.UnsafeEnabled && x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use OutboundStatus.ProtoReflect.Descriptor instead.
func (*OutboundStatus) Descriptor() ([]byte, []int) {
return file_app_observatory_config_proto_rawDescGZIP(), []int{1}
}
func (x *OutboundStatus) GetAlive() bool {
if x != nil {
return x.Alive
}
return false
}
func (x *OutboundStatus) GetDelay() int64 {
if x != nil {
return x.Delay
}
return 0
}
func (x *OutboundStatus) GetLastErrorReason() string {
if x != nil {
return x.LastErrorReason
}
return ""
}
func (x *OutboundStatus) GetOutboundTag() string {
if x != nil {
return x.OutboundTag
}
return ""
}
func (x *OutboundStatus) GetLastSeenTime() int64 {
if x != nil {
return x.LastSeenTime
}
return 0
}
func (x *OutboundStatus) GetLastTryTime() int64 {
if x != nil {
return x.LastTryTime
}
return 0
}
type ProbeResult struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
// @Document Whether this outbound is usable
// @Restriction ReadOnlyForUser
Alive bool `protobuf:"varint,1,opt,name=alive,proto3" json:"alive,omitempty"`
// @Document The time for probe request to finish.
// @Type time.ms
// @Restriction ReadOnlyForUser
Delay int64 `protobuf:"varint,2,opt,name=delay,proto3" json:"delay,omitempty"`
// @Document The error caused this outbound failed to relay probe request
// @Restriction NotMachineReadable
LastErrorReason string `protobuf:"bytes,3,opt,name=last_error_reason,json=lastErrorReason,proto3" json:"last_error_reason,omitempty"`
}
func (x *ProbeResult) Reset() {
*x = ProbeResult{}
if protoimpl.UnsafeEnabled {
mi := &file_app_observatory_config_proto_msgTypes[2]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
}
func (x *ProbeResult) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*ProbeResult) ProtoMessage() {}
func (x *ProbeResult) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_config_proto_msgTypes[2]
if protoimpl.UnsafeEnabled && x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use ProbeResult.ProtoReflect.Descriptor instead.
func (*ProbeResult) Descriptor() ([]byte, []int) {
return file_app_observatory_config_proto_rawDescGZIP(), []int{2}
}
func (x *ProbeResult) GetAlive() bool {
if x != nil {
return x.Alive
}
return false
}
func (x *ProbeResult) GetDelay() int64 {
if x != nil {
return x.Delay
}
return 0
}
func (x *ProbeResult) GetLastErrorReason() string {
if x != nil {
return x.LastErrorReason
}
return ""
}
type Intensity struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
// @Document The time interval for a probe request in ms.
// @Type time.ms
ProbeInterval uint32 `protobuf:"varint,1,opt,name=probe_interval,json=probeInterval,proto3" json:"probe_interval,omitempty"`
}
func (x *Intensity) Reset() {
*x = Intensity{}
if protoimpl.UnsafeEnabled {
mi := &file_app_observatory_config_proto_msgTypes[3]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
}
func (x *Intensity) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Intensity) ProtoMessage() {}
func (x *Intensity) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_config_proto_msgTypes[3]
if protoimpl.UnsafeEnabled && x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Intensity.ProtoReflect.Descriptor instead.
func (*Intensity) Descriptor() ([]byte, []int) {
return file_app_observatory_config_proto_rawDescGZIP(), []int{3}
}
func (x *Intensity) GetProbeInterval() uint32 {
if x != nil {
return x.ProbeInterval
}
return 0
}
type Config struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
// @Document The selectors for outbound under observation
SubjectSelector []string `protobuf:"bytes,2,rep,name=subject_selector,json=subjectSelector,proto3" json:"subject_selector,omitempty"`
ProbeUrl string `protobuf:"bytes,3,opt,name=probe_url,json=probeUrl,proto3" json:"probe_url,omitempty"`
ProbeInterval int64 `protobuf:"varint,4,opt,name=probe_interval,json=probeInterval,proto3" json:"probe_interval,omitempty"`
EnableConcurrency bool `protobuf:"varint,5,opt,name=enable_concurrency,json=enableConcurrency,proto3" json:"enable_concurrency,omitempty"`
}
func (x *Config) Reset() {
*x = Config{}
if protoimpl.UnsafeEnabled {
mi := &file_app_observatory_config_proto_msgTypes[4]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_config_proto_msgTypes[4]
if protoimpl.UnsafeEnabled && x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_observatory_config_proto_rawDescGZIP(), []int{4}
}
func (x *Config) GetSubjectSelector() []string {
if x != nil {
return x.SubjectSelector
}
return nil
}
func (x *Config) GetProbeUrl() string {
if x != nil {
return x.ProbeUrl
}
return ""
}
func (x *Config) GetProbeInterval() int64 {
if x != nil {
return x.ProbeInterval
}
return 0
}
func (x *Config) GetEnableConcurrency() bool {
if x != nil {
return x.EnableConcurrency
}
return false
}
var File_app_observatory_config_proto protoreflect.FileDescriptor
var file_app_observatory_config_proto_rawDesc = []byte{
0x0a, 0x1c, 0x61, 0x70, 0x70, 0x2f, 0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72,
0x79, 0x2f, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x19,
0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x72, 0x65, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6f, 0x62,
0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x22, 0x56, 0x0a, 0x11, 0x4f, 0x62, 0x73,
0x65, 0x72, 0x76, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x12, 0x41,
0x0a, 0x06, 0x73, 0x74, 0x61, 0x74, 0x75, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x29,
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x72, 0x65, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6f,
0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2e, 0x4f, 0x75, 0x74, 0x62, 0x6f,
0x75, 0x6e, 0x64, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x06, 0x73, 0x74, 0x61, 0x74, 0x75,
0x73, 0x22, 0xd5, 0x01, 0x0a, 0x0e, 0x4f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x74,
0x61, 0x74, 0x75, 0x73, 0x12, 0x14, 0x0a, 0x05, 0x61, 0x6c, 0x69, 0x76, 0x65, 0x18, 0x01, 0x20,
0x01, 0x28, 0x08, 0x52, 0x05, 0x61, 0x6c, 0x69, 0x76, 0x65, 0x12, 0x14, 0x0a, 0x05, 0x64, 0x65,
0x6c, 0x61, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x05, 0x64, 0x65, 0x6c, 0x61, 0x79,
0x12, 0x2a, 0x0a, 0x11, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x5f, 0x72,
0x65, 0x61, 0x73, 0x6f, 0x6e, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0f, 0x6c, 0x61, 0x73,
0x74, 0x45, 0x72, 0x72, 0x6f, 0x72, 0x52, 0x65, 0x61, 0x73, 0x6f, 0x6e, 0x12, 0x21, 0x0a, 0x0c,
0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x04, 0x20, 0x01,
0x28, 0x09, 0x52, 0x0b, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x54, 0x61, 0x67, 0x12,
0x24, 0x0a, 0x0e, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x73, 0x65, 0x65, 0x6e, 0x5f, 0x74, 0x69, 0x6d,
0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0c, 0x6c, 0x61, 0x73, 0x74, 0x53, 0x65, 0x65,
0x6e, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x22, 0x0a, 0x0d, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x74, 0x72,
0x79, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x18, 0x06, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, 0x6c, 0x61,
0x73, 0x74, 0x54, 0x72, 0x79, 0x54, 0x69, 0x6d, 0x65, 0x22, 0x65, 0x0a, 0x0b, 0x50, 0x72, 0x6f,
0x62, 0x65, 0x52, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x12, 0x14, 0x0a, 0x05, 0x61, 0x6c, 0x69, 0x76,
0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x05, 0x61, 0x6c, 0x69, 0x76, 0x65, 0x12, 0x14,
0x0a, 0x05, 0x64, 0x65, 0x6c, 0x61, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x05, 0x64,
0x65, 0x6c, 0x61, 0x79, 0x12, 0x2a, 0x0a, 0x11, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x65, 0x72, 0x72,
0x6f, 0x72, 0x5f, 0x72, 0x65, 0x61, 0x73, 0x6f, 0x6e, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52,
0x0f, 0x6c, 0x61, 0x73, 0x74, 0x45, 0x72, 0x72, 0x6f, 0x72, 0x52, 0x65, 0x61, 0x73, 0x6f, 0x6e,
0x22, 0x32, 0x0a, 0x09, 0x49, 0x6e, 0x74, 0x65, 0x6e, 0x73, 0x69, 0x74, 0x79, 0x12, 0x25, 0x0a,
0x0e, 0x70, 0x72, 0x6f, 0x62, 0x65, 0x5f, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x76, 0x61, 0x6c, 0x18,
0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x62, 0x65, 0x49, 0x6e, 0x74, 0x65,
0x72, 0x76, 0x61, 0x6c, 0x22, 0xa6, 0x01, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12,
0x29, 0x0a, 0x10, 0x73, 0x75, 0x62, 0x6a, 0x65, 0x63, 0x74, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63,
0x74, 0x6f, 0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09, 0x52, 0x0f, 0x73, 0x75, 0x62, 0x6a, 0x65,
0x63, 0x74, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x12, 0x1b, 0x0a, 0x09, 0x70, 0x72,
0x6f, 0x62, 0x65, 0x5f, 0x75, 0x72, 0x6c, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x70,
0x72, 0x6f, 0x62, 0x65, 0x55, 0x72, 0x6c, 0x12, 0x25, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x62, 0x65,
0x5f, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x76, 0x61, 0x6c, 0x18, 0x04, 0x20, 0x01, 0x28, 0x03, 0x52,
0x0d, 0x70, 0x72, 0x6f, 0x62, 0x65, 0x49, 0x6e, 0x74, 0x65, 0x72, 0x76, 0x61, 0x6c, 0x12, 0x2d,
0x0a, 0x12, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x5f, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72,
0x65, 0x6e, 0x63, 0x79, 0x18, 0x05, 0x20, 0x01, 0x28, 0x08, 0x52, 0x11, 0x65, 0x6e, 0x61, 0x62,
0x6c, 0x65, 0x43, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x42, 0x5e, 0x0a,
0x18, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6f, 0x62,
0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x50, 0x01, 0x5a, 0x29, 0x67, 0x69, 0x74,
0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61,
0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6f, 0x62, 0x73, 0x65, 0x72,
0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0xaa, 0x02, 0x14, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70,
0x70, 0x2e, 0x4f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x62, 0x06, 0x70,
0x72, 0x6f, 0x74, 0x6f, 0x33,
}
var (
file_app_observatory_config_proto_rawDescOnce sync.Once
file_app_observatory_config_proto_rawDescData = file_app_observatory_config_proto_rawDesc
)
func file_app_observatory_config_proto_rawDescGZIP() []byte {
file_app_observatory_config_proto_rawDescOnce.Do(func() {
file_app_observatory_config_proto_rawDescData = protoimpl.X.CompressGZIP(file_app_observatory_config_proto_rawDescData)
})
return file_app_observatory_config_proto_rawDescData
}
var file_app_observatory_config_proto_msgTypes = make([]protoimpl.MessageInfo, 5)
var file_app_observatory_config_proto_goTypes = []interface{}{
(*ObservationResult)(nil), // 0: xray.core.app.observatory.ObservationResult
(*OutboundStatus)(nil), // 1: xray.core.app.observatory.OutboundStatus
(*ProbeResult)(nil), // 2: xray.core.app.observatory.ProbeResult
(*Intensity)(nil), // 3: xray.core.app.observatory.Intensity
(*Config)(nil), // 4: xray.core.app.observatory.Config
}
var file_app_observatory_config_proto_depIdxs = []int32{
1, // 0: xray.core.app.observatory.ObservationResult.status:type_name -> xray.core.app.observatory.OutboundStatus
1, // [1:1] is the sub-list for method output_type
1, // [1:1] is the sub-list for method input_type
1, // [1:1] is the sub-list for extension type_name
1, // [1:1] is the sub-list for extension extendee
0, // [0:1] is the sub-list for field type_name
}
func init() { file_app_observatory_config_proto_init() }
func file_app_observatory_config_proto_init() {
if File_app_observatory_config_proto != nil {
return
}
if !protoimpl.UnsafeEnabled {
file_app_observatory_config_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
switch v := v.(*ObservationResult); i {
case 0:
return &v.state
case 1:
return &v.sizeCache
case 2:
return &v.unknownFields
default:
return nil
}
}
file_app_observatory_config_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} {
switch v := v.(*OutboundStatus); i {
case 0:
return &v.state
case 1:
return &v.sizeCache
case 2:
return &v.unknownFields
default:
return nil
}
}
file_app_observatory_config_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} {
switch v := v.(*ProbeResult); i {
case 0:
return &v.state
case 1:
return &v.sizeCache
case 2:
return &v.unknownFields
default:
return nil
}
}
file_app_observatory_config_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} {
switch v := v.(*Intensity); i {
case 0:
return &v.state
case 1:
return &v.sizeCache
case 2:
return &v.unknownFields
default:
return nil
}
}
file_app_observatory_config_proto_msgTypes[4].Exporter = func(v interface{}, i int) interface{} {
switch v := v.(*Config); i {
case 0:
return &v.state
case 1:
return &v.sizeCache
case 2:
return &v.unknownFields
default:
return nil
}
}
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: file_app_observatory_config_proto_rawDesc,
NumEnums: 0,
NumMessages: 5,
NumExtensions: 0,
NumServices: 0,
},
GoTypes: file_app_observatory_config_proto_goTypes,
DependencyIndexes: file_app_observatory_config_proto_depIdxs,
MessageInfos: file_app_observatory_config_proto_msgTypes,
}.Build()
File_app_observatory_config_proto = out.File
file_app_observatory_config_proto_rawDesc = nil
file_app_observatory_config_proto_goTypes = nil
file_app_observatory_config_proto_depIdxs = nil
}

View File

@@ -1,73 +0,0 @@
syntax = "proto3";
package xray.core.app.observatory;
option csharp_namespace = "Xray.App.Observatory";
option go_package = "github.com/xtls/xray-core/app/observatory";
option java_package = "com.xray.app.observatory";
option java_multiple_files = true;
message ObservationResult {
repeated OutboundStatus status = 1;
}
message OutboundStatus{
/* @Document Whether this outbound is usable
@Restriction ReadOnlyForUser
*/
bool alive = 1;
/* @Document The time for probe request to finish.
@Type time.ms
@Restriction ReadOnlyForUser
*/
int64 delay = 2;
/* @Document The last error caused this outbound failed to relay probe request
@Restriction NotMachineReadable
*/
string last_error_reason = 3;
/* @Document The outbound tag for this Server
@Type id.outboundTag
*/
string outbound_tag = 4;
/* @Document The time this outbound is known to be alive
@Type id.outboundTag
*/
int64 last_seen_time = 5;
/* @Document The time this outbound is tried
@Type id.outboundTag
*/
int64 last_try_time = 6;
}
message ProbeResult{
/* @Document Whether this outbound is usable
@Restriction ReadOnlyForUser
*/
bool alive = 1;
/* @Document The time for probe request to finish.
@Type time.ms
@Restriction ReadOnlyForUser
*/
int64 delay = 2;
/* @Document The error caused this outbound failed to relay probe request
@Restriction NotMachineReadable
*/
string last_error_reason = 3;
}
message Intensity{
/* @Document The time interval for a probe request in ms.
@Type time.ms
*/
uint32 probe_interval = 1;
}
message Config {
/* @Document The selectors for outbound under observation
*/
repeated string subject_selector = 2;
string probe_url = 3;
int64 probe_interval = 4;
bool enable_concurrency = 5;
}

View File

@@ -1,9 +0,0 @@
package observatory
import "github.com/xtls/xray-core/common/errors"
type errPathObjHolder struct{}
func newError(values ...interface{}) *errors.Error {
return errors.New(values...).WithPathObj(errPathObjHolder{})
}

View File

@@ -1,26 +0,0 @@
package observatory
import "github.com/xtls/xray-core/common/errors"
type errorCollector struct {
errors *errors.Error
}
func (e *errorCollector) SubmitError(err error) {
if e.errors == nil {
e.errors = newError("underlying connection error").Base(err)
return
}
e.errors = e.errors.Base(newError("underlying connection error").Base(err))
}
func newErrorCollector() *errorCollector {
return &errorCollector{}
}
func (e *errorCollector) UnderlyingError() error {
if e.errors == nil {
return newError("failed to produce report")
}
return e.errors
}

View File

@@ -1,3 +0,0 @@
package observatory
//go:generate go run github.com/xtls/xray-core/common/errors/errorgen

View File

@@ -1,238 +0,0 @@
package observatory
import (
"context"
"net"
"net/http"
"net/url"
"sort"
"sync"
"time"
"github.com/xtls/xray-core/common"
v2net "github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/common/signal/done"
"github.com/xtls/xray-core/common/task"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/extension"
"github.com/xtls/xray-core/features/outbound"
"github.com/xtls/xray-core/transport/internet/tagged"
"google.golang.org/protobuf/proto"
)
type Observer struct {
config *Config
ctx context.Context
statusLock sync.Mutex
status []*OutboundStatus
finished *done.Instance
ohm outbound.Manager
}
func (o *Observer) GetObservation(ctx context.Context) (proto.Message, error) {
return &ObservationResult{Status: o.status}, nil
}
func (o *Observer) Type() interface{} {
return extension.ObservatoryType()
}
func (o *Observer) Start() error {
if o.config != nil && len(o.config.SubjectSelector) != 0 {
o.finished = done.New()
go o.background()
}
return nil
}
func (o *Observer) Close() error {
if o.finished != nil {
return o.finished.Close()
}
return nil
}
func (o *Observer) background() {
for !o.finished.Done() {
hs, ok := o.ohm.(outbound.HandlerSelector)
if !ok {
newError("outbound.Manager is not a HandlerSelector").WriteToLog()
return
}
outbounds := hs.Select(o.config.SubjectSelector)
o.updateStatus(outbounds)
sleepTime := time.Second * 10
if o.config.ProbeInterval != 0 {
sleepTime = time.Duration(o.config.ProbeInterval)
}
if !o.config.EnableConcurrency {
sort.Strings(outbounds)
for _, v := range outbounds {
result := o.probe(v)
o.updateStatusForResult(v, &result)
if o.finished.Done() {
return
}
time.Sleep(sleepTime)
}
continue
}
ch := make(chan struct{}, len(outbounds))
for _, v := range outbounds {
go func(v string) {
result := o.probe(v)
o.updateStatusForResult(v, &result)
ch <- struct{}{}
}(v)
}
for range outbounds {
select {
case <-ch:
case <-o.finished.Wait():
return
}
}
time.Sleep(sleepTime)
}
}
func (o *Observer) updateStatus(outbounds []string) {
o.statusLock.Lock()
defer o.statusLock.Unlock()
// TODO should remove old inbound that is removed
_ = outbounds
}
func (o *Observer) probe(outbound string) ProbeResult {
errorCollectorForRequest := newErrorCollector()
httpTransport := http.Transport{
Proxy: func(*http.Request) (*url.URL, error) {
return nil, nil
},
DialContext: func(ctx context.Context, network string, addr string) (net.Conn, error) {
var connection net.Conn
taskErr := task.Run(ctx, func() error {
// MUST use Xray's built in context system
dest, err := v2net.ParseDestination(network + ":" + addr)
if err != nil {
return newError("cannot understand address").Base(err)
}
trackedCtx := session.TrackedConnectionError(o.ctx, errorCollectorForRequest)
conn, err := tagged.Dialer(trackedCtx, dest, outbound)
if err != nil {
return newError("cannot dial remote address ", dest).Base(err)
}
connection = conn
return nil
})
if taskErr != nil {
return nil, newError("cannot finish connection").Base(taskErr)
}
return connection, nil
},
TLSHandshakeTimeout: time.Second * 5,
}
httpClient := &http.Client{
Transport: &httpTransport,
CheckRedirect: func(req *http.Request, via []*http.Request) error {
return http.ErrUseLastResponse
},
Jar: nil,
Timeout: time.Second * 5,
}
var GETTime time.Duration
err := task.Run(o.ctx, func() error {
startTime := time.Now()
probeURL := "https://www.google.com/generate_204"
if o.config.ProbeUrl != "" {
probeURL = o.config.ProbeUrl
}
response, err := httpClient.Get(probeURL)
if err != nil {
return newError("outbound failed to relay connection").Base(err)
}
if response.Body != nil {
response.Body.Close()
}
endTime := time.Now()
GETTime = endTime.Sub(startTime)
return nil
})
if err != nil {
fullerr := newError("underlying connection failed").Base(errorCollectorForRequest.UnderlyingError())
fullerr = newError("with outbound handler report").Base(fullerr)
fullerr = newError("GET request failed:", err).Base(fullerr)
fullerr = newError("the outbound ", outbound, " is dead:").Base(fullerr)
fullerr = fullerr.AtInfo()
fullerr.WriteToLog()
return ProbeResult{Alive: false, LastErrorReason: fullerr.Error()}
}
newError("the outbound ", outbound, " is alive:", GETTime.Seconds()).AtInfo().WriteToLog()
return ProbeResult{Alive: true, Delay: GETTime.Milliseconds()}
}
func (o *Observer) updateStatusForResult(outbound string, result *ProbeResult) {
o.statusLock.Lock()
defer o.statusLock.Unlock()
var status *OutboundStatus
if location := o.findStatusLocationLockHolderOnly(outbound); location != -1 {
status = o.status[location]
} else {
status = &OutboundStatus{}
o.status = append(o.status, status)
}
status.LastTryTime = time.Now().Unix()
status.OutboundTag = outbound
status.Alive = result.Alive
if result.Alive {
status.Delay = result.Delay
status.LastSeenTime = status.LastTryTime
status.LastErrorReason = ""
} else {
status.LastErrorReason = result.LastErrorReason
status.Delay = 99999999
}
}
func (o *Observer) findStatusLocationLockHolderOnly(outbound string) int {
for i, v := range o.status {
if v.OutboundTag == outbound {
return i
}
}
return -1
}
func New(ctx context.Context, config *Config) (*Observer, error) {
var outboundManager outbound.Manager
err := core.RequireFeatures(ctx, func(om outbound.Manager) {
outboundManager = om
})
if err != nil {
return nil, newError("Cannot get depended features").Base(err)
}
return &Observer{
config: config,
ctx: ctx,
ohm: outboundManager,
}, nil
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
return New(ctx, config.(*Config))
}))
}

View File

@@ -1,12 +1,13 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// protoc-gen-go v1.25.0
// protoc v3.14.0
// source: app/policy/config.proto
package policy
import (
proto "github.com/golang/protobuf/proto"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
@@ -20,6 +21,10 @@ const (
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// This is a compile-time assertion that a sufficiently up-to-date version
// of the legacy proto package is being used.
const _ = proto.ProtoPackageIsVersion4
type Second struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache

View File

@@ -3,12 +3,13 @@ package command
import (
"context"
grpc "google.golang.org/grpc"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/inbound"
"github.com/xtls/xray-core/features/outbound"
"github.com/xtls/xray-core/proxy"
grpc "google.golang.org/grpc"
)
// InboundOperation is the interface for operations that applies to inbound handlers.

View File

@@ -1,12 +1,13 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// protoc-gen-go v1.25.0
// protoc v3.14.0
// source: app/proxyman/command/command.proto
package command
import (
proto "github.com/golang/protobuf/proto"
protocol "github.com/xtls/xray-core/common/protocol"
serial "github.com/xtls/xray-core/common/serial"
core "github.com/xtls/xray-core/core"
@@ -23,6 +24,10 @@ const (
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// This is a compile-time assertion that a sufficiently up-to-date version
// of the legacy proto package is being used.
const _ = proto.ProtoPackageIsVersion4
type AddUserOperation struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache

View File

@@ -1,8 +1,4 @@
// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
// versions:
// - protoc-gen-go-grpc v1.3.0
// - protoc v4.23.1
// source: app/proxyman/command/command.proto
package command
@@ -18,15 +14,6 @@ import (
// Requires gRPC-Go v1.32.0 or later.
const _ = grpc.SupportPackageIsVersion7
const (
HandlerService_AddInbound_FullMethodName = "/xray.app.proxyman.command.HandlerService/AddInbound"
HandlerService_RemoveInbound_FullMethodName = "/xray.app.proxyman.command.HandlerService/RemoveInbound"
HandlerService_AlterInbound_FullMethodName = "/xray.app.proxyman.command.HandlerService/AlterInbound"
HandlerService_AddOutbound_FullMethodName = "/xray.app.proxyman.command.HandlerService/AddOutbound"
HandlerService_RemoveOutbound_FullMethodName = "/xray.app.proxyman.command.HandlerService/RemoveOutbound"
HandlerService_AlterOutbound_FullMethodName = "/xray.app.proxyman.command.HandlerService/AlterOutbound"
)
// HandlerServiceClient is the client API for HandlerService service.
//
// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream.
@@ -49,7 +36,7 @@ func NewHandlerServiceClient(cc grpc.ClientConnInterface) HandlerServiceClient {
func (c *handlerServiceClient) AddInbound(ctx context.Context, in *AddInboundRequest, opts ...grpc.CallOption) (*AddInboundResponse, error) {
out := new(AddInboundResponse)
err := c.cc.Invoke(ctx, HandlerService_AddInbound_FullMethodName, in, out, opts...)
err := c.cc.Invoke(ctx, "/xray.app.proxyman.command.HandlerService/AddInbound", in, out, opts...)
if err != nil {
return nil, err
}
@@ -58,7 +45,7 @@ func (c *handlerServiceClient) AddInbound(ctx context.Context, in *AddInboundReq
func (c *handlerServiceClient) RemoveInbound(ctx context.Context, in *RemoveInboundRequest, opts ...grpc.CallOption) (*RemoveInboundResponse, error) {
out := new(RemoveInboundResponse)
err := c.cc.Invoke(ctx, HandlerService_RemoveInbound_FullMethodName, in, out, opts...)
err := c.cc.Invoke(ctx, "/xray.app.proxyman.command.HandlerService/RemoveInbound", in, out, opts...)
if err != nil {
return nil, err
}
@@ -67,7 +54,7 @@ func (c *handlerServiceClient) RemoveInbound(ctx context.Context, in *RemoveInbo
func (c *handlerServiceClient) AlterInbound(ctx context.Context, in *AlterInboundRequest, opts ...grpc.CallOption) (*AlterInboundResponse, error) {
out := new(AlterInboundResponse)
err := c.cc.Invoke(ctx, HandlerService_AlterInbound_FullMethodName, in, out, opts...)
err := c.cc.Invoke(ctx, "/xray.app.proxyman.command.HandlerService/AlterInbound", in, out, opts...)
if err != nil {
return nil, err
}
@@ -76,7 +63,7 @@ func (c *handlerServiceClient) AlterInbound(ctx context.Context, in *AlterInboun
func (c *handlerServiceClient) AddOutbound(ctx context.Context, in *AddOutboundRequest, opts ...grpc.CallOption) (*AddOutboundResponse, error) {
out := new(AddOutboundResponse)
err := c.cc.Invoke(ctx, HandlerService_AddOutbound_FullMethodName, in, out, opts...)
err := c.cc.Invoke(ctx, "/xray.app.proxyman.command.HandlerService/AddOutbound", in, out, opts...)
if err != nil {
return nil, err
}
@@ -85,7 +72,7 @@ func (c *handlerServiceClient) AddOutbound(ctx context.Context, in *AddOutboundR
func (c *handlerServiceClient) RemoveOutbound(ctx context.Context, in *RemoveOutboundRequest, opts ...grpc.CallOption) (*RemoveOutboundResponse, error) {
out := new(RemoveOutboundResponse)
err := c.cc.Invoke(ctx, HandlerService_RemoveOutbound_FullMethodName, in, out, opts...)
err := c.cc.Invoke(ctx, "/xray.app.proxyman.command.HandlerService/RemoveOutbound", in, out, opts...)
if err != nil {
return nil, err
}
@@ -94,7 +81,7 @@ func (c *handlerServiceClient) RemoveOutbound(ctx context.Context, in *RemoveOut
func (c *handlerServiceClient) AlterOutbound(ctx context.Context, in *AlterOutboundRequest, opts ...grpc.CallOption) (*AlterOutboundResponse, error) {
out := new(AlterOutboundResponse)
err := c.cc.Invoke(ctx, HandlerService_AlterOutbound_FullMethodName, in, out, opts...)
err := c.cc.Invoke(ctx, "/xray.app.proxyman.command.HandlerService/AlterOutbound", in, out, opts...)
if err != nil {
return nil, err
}
@@ -159,7 +146,7 @@ func _HandlerService_AddInbound_Handler(srv interface{}, ctx context.Context, de
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: HandlerService_AddInbound_FullMethodName,
FullMethod: "/xray.app.proxyman.command.HandlerService/AddInbound",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(HandlerServiceServer).AddInbound(ctx, req.(*AddInboundRequest))
@@ -177,7 +164,7 @@ func _HandlerService_RemoveInbound_Handler(srv interface{}, ctx context.Context,
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: HandlerService_RemoveInbound_FullMethodName,
FullMethod: "/xray.app.proxyman.command.HandlerService/RemoveInbound",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(HandlerServiceServer).RemoveInbound(ctx, req.(*RemoveInboundRequest))
@@ -195,7 +182,7 @@ func _HandlerService_AlterInbound_Handler(srv interface{}, ctx context.Context,
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: HandlerService_AlterInbound_FullMethodName,
FullMethod: "/xray.app.proxyman.command.HandlerService/AlterInbound",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(HandlerServiceServer).AlterInbound(ctx, req.(*AlterInboundRequest))
@@ -213,7 +200,7 @@ func _HandlerService_AddOutbound_Handler(srv interface{}, ctx context.Context, d
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: HandlerService_AddOutbound_FullMethodName,
FullMethod: "/xray.app.proxyman.command.HandlerService/AddOutbound",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(HandlerServiceServer).AddOutbound(ctx, req.(*AddOutboundRequest))
@@ -231,7 +218,7 @@ func _HandlerService_RemoveOutbound_Handler(srv interface{}, ctx context.Context
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: HandlerService_RemoveOutbound_FullMethodName,
FullMethod: "/xray.app.proxyman.command.HandlerService/RemoveOutbound",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(HandlerServiceServer).RemoveOutbound(ctx, req.(*RemoveOutboundRequest))
@@ -249,7 +236,7 @@ func _HandlerService_AlterOutbound_Handler(srv interface{}, ctx context.Context,
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: HandlerService_AlterOutbound_FullMethodName,
FullMethod: "/xray.app.proxyman.command.HandlerService/AlterOutbound",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(HandlerServiceServer).AlterOutbound(ctx, req.(*AlterOutboundRequest))

View File

@@ -1,12 +1,13 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// protoc-gen-go v1.25.0
// protoc v3.14.0
// source: app/proxyman/config.proto
package proxyman
import (
proto "github.com/golang/protobuf/proto"
net "github.com/xtls/xray-core/common/net"
serial "github.com/xtls/xray-core/common/serial"
internet "github.com/xtls/xray-core/transport/internet"
@@ -23,6 +24,10 @@ const (
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// This is a compile-time assertion that a sufficiently up-to-date version
// of the legacy proto package is being used.
const _ = proto.ProtoPackageIsVersion4
type KnownProtocols int32
const (
@@ -234,14 +239,9 @@ type SniffingConfig struct {
// Whether or not to enable content sniffing on an inbound connection.
Enabled bool `protobuf:"varint,1,opt,name=enabled,proto3" json:"enabled,omitempty"`
// Override target destination if sniff'ed protocol is in the given list.
// Supported values are "http", "tls", "fakedns".
// Supported values are "http", "tls".
DestinationOverride []string `protobuf:"bytes,2,rep,name=destination_override,json=destinationOverride,proto3" json:"destination_override,omitempty"`
DomainsExcluded []string `protobuf:"bytes,3,rep,name=domains_excluded,json=domainsExcluded,proto3" json:"domains_excluded,omitempty"`
// Whether should only try to sniff metadata without waiting for client input.
// Can be used to support SMTP like protocol where server send the first
// message.
MetadataOnly bool `protobuf:"varint,4,opt,name=metadata_only,json=metadataOnly,proto3" json:"metadata_only,omitempty"`
RouteOnly bool `protobuf:"varint,5,opt,name=route_only,json=routeOnly,proto3" json:"route_only,omitempty"`
}
func (x *SniffingConfig) Reset() {
@@ -297,27 +297,13 @@ func (x *SniffingConfig) GetDomainsExcluded() []string {
return nil
}
func (x *SniffingConfig) GetMetadataOnly() bool {
if x != nil {
return x.MetadataOnly
}
return false
}
func (x *SniffingConfig) GetRouteOnly() bool {
if x != nil {
return x.RouteOnly
}
return false
}
type ReceiverConfig struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
// PortList specifies the ports which the Receiver should listen on.
PortList *net.PortList `protobuf:"bytes,1,opt,name=port_list,json=portList,proto3" json:"port_list,omitempty"`
// PortRange specifies the ports which the Receiver should listen on.
PortRange *net.PortRange `protobuf:"bytes,1,opt,name=port_range,json=portRange,proto3" json:"port_range,omitempty"`
// Listen specifies the IP address that the Receiver should listen on.
Listen *net.IPOrDomain `protobuf:"bytes,2,opt,name=listen,proto3" json:"listen,omitempty"`
AllocationStrategy *AllocationStrategy `protobuf:"bytes,3,opt,name=allocation_strategy,json=allocationStrategy,proto3" json:"allocation_strategy,omitempty"`
@@ -326,7 +312,7 @@ type ReceiverConfig struct {
// Override domains for the given protocol.
// Deprecated. Use sniffing_settings.
//
// Deprecated: Marked as deprecated in app/proxyman/config.proto.
// Deprecated: Do not use.
DomainOverride []KnownProtocols `protobuf:"varint,7,rep,packed,name=domain_override,json=domainOverride,proto3,enum=xray.app.proxyman.KnownProtocols" json:"domain_override,omitempty"`
SniffingSettings *SniffingConfig `protobuf:"bytes,8,opt,name=sniffing_settings,json=sniffingSettings,proto3" json:"sniffing_settings,omitempty"`
}
@@ -363,9 +349,9 @@ func (*ReceiverConfig) Descriptor() ([]byte, []int) {
return file_app_proxyman_config_proto_rawDescGZIP(), []int{3}
}
func (x *ReceiverConfig) GetPortList() *net.PortList {
func (x *ReceiverConfig) GetPortRange() *net.PortRange {
if x != nil {
return x.PortList
return x.PortRange
}
return nil
}
@@ -398,7 +384,7 @@ func (x *ReceiverConfig) GetReceiveOriginalDestination() bool {
return false
}
// Deprecated: Marked as deprecated in app/proxyman/config.proto.
// Deprecated: Do not use.
func (x *ReceiverConfig) GetDomainOverride() []KnownProtocols {
if x != nil {
return x.DomainOverride
@@ -594,11 +580,7 @@ type MultiplexingConfig struct {
// Whether or not Mux is enabled.
Enabled bool `protobuf:"varint,1,opt,name=enabled,proto3" json:"enabled,omitempty"`
// Max number of concurrent connections that one Mux connection can handle.
Concurrency int32 `protobuf:"varint,2,opt,name=concurrency,proto3" json:"concurrency,omitempty"`
// Transport XUDP in another Mux.
XudpConcurrency int32 `protobuf:"varint,3,opt,name=xudpConcurrency,proto3" json:"xudpConcurrency,omitempty"`
// "reject" (default), "allow" or "skip".
XudpProxyUDP443 string `protobuf:"bytes,4,opt,name=xudpProxyUDP443,proto3" json:"xudpProxyUDP443,omitempty"`
Concurrency uint32 `protobuf:"varint,2,opt,name=concurrency,proto3" json:"concurrency,omitempty"`
}
func (x *MultiplexingConfig) Reset() {
@@ -640,27 +622,13 @@ func (x *MultiplexingConfig) GetEnabled() bool {
return false
}
func (x *MultiplexingConfig) GetConcurrency() int32 {
func (x *MultiplexingConfig) GetConcurrency() uint32 {
if x != nil {
return x.Concurrency
}
return 0
}
func (x *MultiplexingConfig) GetXudpConcurrency() int32 {
if x != nil {
return x.XudpConcurrency
}
return 0
}
func (x *MultiplexingConfig) GetXudpProxyUDP443() string {
if x != nil {
return x.XudpProxyUDP443
}
return ""
}
type AllocationStrategy_AllocationStrategyConcurrency struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
@@ -796,7 +764,7 @@ var file_app_proxyman_config_proto_rawDesc = []byte{
0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x22, 0x2c, 0x0a, 0x04, 0x54, 0x79, 0x70, 0x65, 0x12,
0x0a, 0x0a, 0x06, 0x41, 0x6c, 0x77, 0x61, 0x79, 0x73, 0x10, 0x00, 0x12, 0x0a, 0x0a, 0x06, 0x52,
0x61, 0x6e, 0x64, 0x6f, 0x6d, 0x10, 0x01, 0x12, 0x0c, 0x0a, 0x08, 0x45, 0x78, 0x74, 0x65, 0x72,
0x6e, 0x61, 0x6c, 0x10, 0x02, 0x22, 0xcc, 0x01, 0x0a, 0x0e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69,
0x6e, 0x61, 0x6c, 0x10, 0x02, 0x22, 0x88, 0x01, 0x0a, 0x0e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69,
0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62,
0x6c, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c,
0x65, 0x64, 0x12, 0x31, 0x0a, 0x14, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f,
@@ -805,95 +773,86 @@ var file_app_proxyman_config_proto_rawDesc = []byte{
0x72, 0x72, 0x69, 0x64, 0x65, 0x12, 0x29, 0x0a, 0x10, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x73,
0x5f, 0x65, 0x78, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x64, 0x18, 0x03, 0x20, 0x03, 0x28, 0x09, 0x52,
0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x73, 0x45, 0x78, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x64,
0x12, 0x23, 0x0a, 0x0d, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x6f, 0x6e, 0x6c,
0x79, 0x18, 0x04, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74,
0x61, 0x4f, 0x6e, 0x6c, 0x79, 0x12, 0x1d, 0x0a, 0x0a, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x5f, 0x6f,
0x6e, 0x6c, 0x79, 0x18, 0x05, 0x20, 0x01, 0x28, 0x08, 0x52, 0x09, 0x72, 0x6f, 0x75, 0x74, 0x65,
0x4f, 0x6e, 0x6c, 0x79, 0x22, 0x8d, 0x04, 0x0a, 0x0e, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65,
0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x36, 0x0a, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x5f,
0x6c, 0x69, 0x73, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61,
0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f, 0x72,
0x74, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x08, 0x70, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x12,
0x33, 0x0a, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32,
0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65,
0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x06, 0x6c, 0x69,
0x73, 0x74, 0x65, 0x6e, 0x12, 0x56, 0x0a, 0x13, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69,
0x6f, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28,
0x22, 0x90, 0x04, 0x0a, 0x0e, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x43, 0x6f, 0x6e,
0x66, 0x69, 0x67, 0x12, 0x39, 0x0a, 0x0a, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x72, 0x61, 0x6e, 0x67,
0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63,
0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f, 0x72, 0x74, 0x52, 0x61,
0x6e, 0x67, 0x65, 0x52, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x12, 0x33,
0x0a, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b,
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74,
0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x06, 0x6c, 0x69, 0x73,
0x74, 0x65, 0x6e, 0x12, 0x56, 0x0a, 0x13, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f,
0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b,
0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78,
0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x53,
0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x12, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74,
0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x4e, 0x0a, 0x0f, 0x73,
0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x04,
0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e,
0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x53,
0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74, 0x72,
0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x40, 0x0a, 0x1c, 0x72,
0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x5f, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x5f,
0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x05, 0x20, 0x01, 0x28,
0x08, 0x52, 0x1a, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e,
0x61, 0x6c, 0x44, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x4e, 0x0a,
0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65,
0x18, 0x07, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e,
0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0e, 0x64,
0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65, 0x12, 0x4e, 0x0a,
0x11, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e,
0x67, 0x73, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x53, 0x6e, 0x69,
0x66, 0x66, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x10, 0x73, 0x6e, 0x69,
0x66, 0x66, 0x69, 0x6e, 0x67, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x4a, 0x04, 0x08,
0x06, 0x10, 0x07, 0x22, 0xc0, 0x01, 0x0a, 0x14, 0x49, 0x6e, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x48,
0x61, 0x6e, 0x64, 0x6c, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x10, 0x0a, 0x03,
0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x4d,
0x0a, 0x11, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69,
0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79,
0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e, 0x54,
0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x10, 0x72, 0x65, 0x63,
0x65, 0x69, 0x76, 0x65, 0x72, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x47, 0x0a,
0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18,
0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e, 0x54, 0x79, 0x70, 0x65, 0x64,
0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x53, 0x65,
0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x10, 0x0a, 0x0e, 0x4f, 0x75, 0x74, 0x62, 0x6f, 0x75,
0x6e, 0x64, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x22, 0xb0, 0x02, 0x0a, 0x0c, 0x53, 0x65, 0x6e,
0x64, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x2d, 0x0a, 0x03, 0x76, 0x69, 0x61,
0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f,
0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d,
0x61, 0x69, 0x6e, 0x52, 0x03, 0x76, 0x69, 0x61, 0x12, 0x4e, 0x0a, 0x0f, 0x73, 0x74, 0x72, 0x65,
0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28,
0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f,
0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x53, 0x74, 0x72, 0x65,
0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d,
0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x4b, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78,
0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b,
0x32, 0x24, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72,
0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79,
0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x53, 0x65, 0x74,
0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x54, 0x0a, 0x12, 0x6d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c,
0x65, 0x78, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x04, 0x20, 0x01, 0x28,
0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f,
0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e,
0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x12, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61,
0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x4e, 0x0a, 0x0f,
0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18,
0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61,
0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e,
0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74,
0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x40, 0x0a, 0x1c,
0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x5f, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c,
0x5f, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x05, 0x20, 0x01,
0x28, 0x08, 0x52, 0x1a, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x4f, 0x72, 0x69, 0x67, 0x69,
0x6e, 0x61, 0x6c, 0x44, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x4e,
0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64,
0x65, 0x18, 0x07, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61,
0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4b, 0x6e, 0x6f, 0x77,
0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0e,
0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65, 0x12, 0x4e,
0x0a, 0x11, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69,
0x6e, 0x67, 0x73, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61, 0x79,
0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x53, 0x6e,
0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x10, 0x73, 0x6e,
0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x4a, 0x04,
0x08, 0x06, 0x10, 0x07, 0x22, 0xc0, 0x01, 0x0a, 0x14, 0x49, 0x6e, 0x62, 0x6f, 0x75, 0x6e, 0x64,
0x48, 0x61, 0x6e, 0x64, 0x6c, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x10, 0x0a,
0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12,
0x4d, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x5f, 0x73, 0x65, 0x74, 0x74,
0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61,
0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e,
0x54, 0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x10, 0x72, 0x65,
0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x47,
0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f,
0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e, 0x54, 0x79, 0x70, 0x65,
0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x53,
0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x10, 0x0a, 0x0e, 0x4f, 0x75, 0x74, 0x62, 0x6f,
0x75, 0x6e, 0x64, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x22, 0xb0, 0x02, 0x0a, 0x0c, 0x53, 0x65,
0x6e, 0x64, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x2d, 0x0a, 0x03, 0x76, 0x69,
0x61, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63,
0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f,
0x6d, 0x61, 0x69, 0x6e, 0x52, 0x03, 0x76, 0x69, 0x61, 0x12, 0x4e, 0x0a, 0x0f, 0x73, 0x74, 0x72,
0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01,
0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70,
0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x53, 0x74, 0x72,
0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74, 0x72, 0x65, 0x61,
0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x4b, 0x0a, 0x0e, 0x70, 0x72, 0x6f,
0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28,
0x0b, 0x32, 0x24, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f,
0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x72, 0x6f, 0x78,
0x79, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x53, 0x65,
0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x54, 0x0a, 0x12, 0x6d, 0x75, 0x6c, 0x74, 0x69, 0x70,
0x6c, 0x65, 0x78, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x04, 0x20, 0x01,
0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72,
0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78,
0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x11, 0x6d, 0x75, 0x6c, 0x74, 0x69,
0x70, 0x6c, 0x65, 0x78, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0xa4, 0x01, 0x0a,
0x12, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e,
0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x18, 0x01,
0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x12, 0x20, 0x0a,
0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x18, 0x02, 0x20, 0x01,
0x28, 0x05, 0x52, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x12,
0x28, 0x0a, 0x0f, 0x78, 0x75, 0x64, 0x70, 0x43, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e,
0x63, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28, 0x05, 0x52, 0x0f, 0x78, 0x75, 0x64, 0x70, 0x43, 0x6f,
0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x12, 0x28, 0x0a, 0x0f, 0x78, 0x75, 0x64,
0x70, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x55, 0x44, 0x50, 0x34, 0x34, 0x33, 0x18, 0x04, 0x20, 0x01,
0x28, 0x09, 0x52, 0x0f, 0x78, 0x75, 0x64, 0x70, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x55, 0x44, 0x50,
0x34, 0x34, 0x33, 0x2a, 0x23, 0x0a, 0x0e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74,
0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x12, 0x08, 0x0a, 0x04, 0x48, 0x54, 0x54, 0x50, 0x10, 0x00, 0x12,
0x07, 0x0a, 0x03, 0x54, 0x4c, 0x53, 0x10, 0x01, 0x42, 0x55, 0x0a, 0x15, 0x63, 0x6f, 0x6d, 0x2e,
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61,
0x6e, 0x50, 0x01, 0x5a, 0x26, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f,
0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61,
0x70, 0x70, 0x2f, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0xaa, 0x02, 0x11, 0x58, 0x72,
0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x62,
0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69,
0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x11, 0x6d, 0x75, 0x6c, 0x74, 0x69, 0x70,
0x6c, 0x65, 0x78, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x50, 0x0a, 0x12, 0x4d,
0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69,
0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01,
0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x12, 0x20, 0x0a, 0x0b, 0x63,
0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d,
0x52, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x2a, 0x23, 0x0a,
0x0e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x12,
0x08, 0x0a, 0x04, 0x48, 0x54, 0x54, 0x50, 0x10, 0x00, 0x12, 0x07, 0x0a, 0x03, 0x54, 0x4c, 0x53,
0x10, 0x01, 0x42, 0x55, 0x0a, 0x15, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61,
0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x50, 0x01, 0x5a, 0x26, 0x67,
0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78,
0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x70, 0x72, 0x6f,
0x78, 0x79, 0x6d, 0x61, 0x6e, 0xaa, 0x02, 0x11, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70,
0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f,
0x33,
}
var (
@@ -923,7 +882,7 @@ var file_app_proxyman_config_proto_goTypes = []interface{}{
(*MultiplexingConfig)(nil), // 9: xray.app.proxyman.MultiplexingConfig
(*AllocationStrategy_AllocationStrategyConcurrency)(nil), // 10: xray.app.proxyman.AllocationStrategy.AllocationStrategyConcurrency
(*AllocationStrategy_AllocationStrategyRefresh)(nil), // 11: xray.app.proxyman.AllocationStrategy.AllocationStrategyRefresh
(*net.PortList)(nil), // 12: xray.common.net.PortList
(*net.PortRange)(nil), // 12: xray.common.net.PortRange
(*net.IPOrDomain)(nil), // 13: xray.common.net.IPOrDomain
(*internet.StreamConfig)(nil), // 14: xray.transport.internet.StreamConfig
(*serial.TypedMessage)(nil), // 15: xray.common.serial.TypedMessage
@@ -933,7 +892,7 @@ var file_app_proxyman_config_proto_depIdxs = []int32{
1, // 0: xray.app.proxyman.AllocationStrategy.type:type_name -> xray.app.proxyman.AllocationStrategy.Type
10, // 1: xray.app.proxyman.AllocationStrategy.concurrency:type_name -> xray.app.proxyman.AllocationStrategy.AllocationStrategyConcurrency
11, // 2: xray.app.proxyman.AllocationStrategy.refresh:type_name -> xray.app.proxyman.AllocationStrategy.AllocationStrategyRefresh
12, // 3: xray.app.proxyman.ReceiverConfig.port_list:type_name -> xray.common.net.PortList
12, // 3: xray.app.proxyman.ReceiverConfig.port_range:type_name -> xray.common.net.PortRange
13, // 4: xray.app.proxyman.ReceiverConfig.listen:type_name -> xray.common.net.IPOrDomain
3, // 5: xray.app.proxyman.ReceiverConfig.allocation_strategy:type_name -> xray.app.proxyman.AllocationStrategy
14, // 6: xray.app.proxyman.ReceiverConfig.stream_settings:type_name -> xray.transport.internet.StreamConfig

View File

@@ -27,13 +27,17 @@ message AllocationStrategy {
Type type = 1;
message AllocationStrategyConcurrency { uint32 value = 1; }
message AllocationStrategyConcurrency {
uint32 value = 1;
}
// Number of handlers (ports) running in parallel.
// Default value is 3 if unset.
AllocationStrategyConcurrency concurrency = 2;
message AllocationStrategyRefresh { uint32 value = 1; }
message AllocationStrategyRefresh {
uint32 value = 1;
}
// Number of minutes before a handler is regenerated.
// Default value is 5 if unset.
@@ -50,21 +54,14 @@ message SniffingConfig {
bool enabled = 1;
// Override target destination if sniff'ed protocol is in the given list.
// Supported values are "http", "tls", "fakedns".
// Supported values are "http", "tls".
repeated string destination_override = 2;
repeated string domains_excluded = 3;
// Whether should only try to sniff metadata without waiting for client input.
// Can be used to support SMTP like protocol where server send the first
// message.
bool metadata_only = 4;
bool route_only = 5;
}
message ReceiverConfig {
// PortList specifies the ports which the Receiver should listen on.
xray.common.net.PortList port_list = 1;
// PortRange specifies the ports which the Receiver should listen on.
xray.common.net.PortRange port_range = 1;
// Listen specifies the IP address that the Receiver should listen on.
xray.common.net.IPOrDomain listen = 2;
AllocationStrategy allocation_strategy = 3;
@@ -73,7 +70,7 @@ message ReceiverConfig {
reserved 6;
// Override domains for the given protocol.
// Deprecated. Use sniffing_settings.
repeated KnownProtocols domain_override = 7 [ deprecated = true ];
repeated KnownProtocols domain_override = 7 [deprecated = true];
SniffingConfig sniffing_settings = 8;
}
@@ -97,9 +94,5 @@ message MultiplexingConfig {
// Whether or not Mux is enabled.
bool enabled = 1;
// Max number of concurrent connections that one Mux connection can handle.
int32 concurrency = 2;
// Transport XUDP in another Mux.
int32 xudpConcurrency = 3;
// "reject" (default), "allow" or "skip".
string xudpProxyUDP443 = 4;
uint32 concurrency = 2;
}

View File

@@ -67,7 +67,7 @@ func NewAlwaysOnInboundHandler(ctx context.Context, tag string, receiverConfig *
uplinkCounter, downlinkCounter := getStatCounter(core.MustFromContext(ctx), tag)
nl := p.Network()
pl := receiverConfig.PortList
pr := receiverConfig.PortRange
address := receiverConfig.Listen.AsAddress()
if address == nil {
address = net.AnyIP
@@ -87,7 +87,7 @@ func NewAlwaysOnInboundHandler(ctx context.Context, tag string, receiverConfig *
}
mss.SocketSettings.ReceiveOriginalDestAddress = true
}
if pl == nil {
if pr == nil {
if net.HasNetwork(nl, net.Network_UNIX) {
newError("creating unix domain socket worker on ", address).AtDebug().WriteToLog()
@@ -105,43 +105,40 @@ func NewAlwaysOnInboundHandler(ctx context.Context, tag string, receiverConfig *
h.workers = append(h.workers, worker)
}
}
if pl != nil {
for _, pr := range pl.Range {
for port := pr.From; port <= pr.To; port++ {
if net.HasNetwork(nl, net.Network_TCP) {
newError("creating stream worker on ", address, ":", port).AtDebug().WriteToLog()
if pr != nil {
for port := pr.From; port <= pr.To; port++ {
if net.HasNetwork(nl, net.Network_TCP) {
newError("creating stream worker on ", address, ":", port).AtDebug().WriteToLog()
worker := &tcpWorker{
address: address,
port: net.Port(port),
proxy: p,
stream: mss,
recvOrigDest: receiverConfig.ReceiveOriginalDestination,
tag: tag,
dispatcher: h.mux,
sniffingConfig: receiverConfig.GetEffectiveSniffingSettings(),
uplinkCounter: uplinkCounter,
downlinkCounter: downlinkCounter,
ctx: ctx,
}
h.workers = append(h.workers, worker)
worker := &tcpWorker{
address: address,
port: net.Port(port),
proxy: p,
stream: mss,
recvOrigDest: receiverConfig.ReceiveOriginalDestination,
tag: tag,
dispatcher: h.mux,
sniffingConfig: receiverConfig.GetEffectiveSniffingSettings(),
uplinkCounter: uplinkCounter,
downlinkCounter: downlinkCounter,
ctx: ctx,
}
h.workers = append(h.workers, worker)
}
if net.HasNetwork(nl, net.Network_UDP) {
worker := &udpWorker{
tag: tag,
proxy: p,
address: address,
port: net.Port(port),
dispatcher: h.mux,
sniffingConfig: receiverConfig.GetEffectiveSniffingSettings(),
uplinkCounter: uplinkCounter,
downlinkCounter: downlinkCounter,
stream: mss,
ctx: ctx,
}
h.workers = append(h.workers, worker)
if net.HasNetwork(nl, net.Network_UDP) {
worker := &udpWorker{
tag: tag,
proxy: p,
address: address,
port: net.Port(port),
dispatcher: h.mux,
uplinkCounter: uplinkCounter,
downlinkCounter: downlinkCounter,
stream: mss,
ctx: ctx,
}
h.workers = append(h.workers, worker)
}
}
}

View File

@@ -69,18 +69,15 @@ func NewDynamicInboundHandler(ctx context.Context, tag string, receiverConfig *p
}
func (h *DynamicInboundHandler) allocatePort() net.Port {
allPorts := []int32{}
for _, pr := range h.receiverConfig.PortList.Range {
for i := pr.From; i <= pr.To; i++ {
allPorts = append(allPorts, int32(i))
}
}
from := int(h.receiverConfig.PortRange.From)
delta := int(h.receiverConfig.PortRange.To) - from + 1
h.portMutex.Lock()
defer h.portMutex.Unlock()
for {
r := dice.Roll(len(allPorts))
port := net.Port(allPorts[r])
r := dice.Roll(delta)
port := net.Port(from + r)
_, used := h.portsInUse[port]
if !used {
h.portsInUse[port] = true
@@ -156,7 +153,6 @@ func (h *DynamicInboundHandler) refresh() error {
address: address,
port: port,
dispatcher: h.mux,
sniffingConfig: h.receiverConfig.GetEffectiveSniffingSettings(),
uplinkCounter: uplinkCounter,
downlinkCounter: downlinkCounter,
stream: h.streamSettings,

View File

@@ -18,7 +18,6 @@ import (
"github.com/xtls/xray-core/features/stats"
"github.com/xtls/xray-core/proxy"
"github.com/xtls/xray-core/transport/internet"
"github.com/xtls/xray-core/transport/internet/stat"
"github.com/xtls/xray-core/transport/internet/tcp"
"github.com/xtls/xray-core/transport/internet/udp"
"github.com/xtls/xray-core/transport/pipe"
@@ -55,12 +54,11 @@ func getTProxyType(s *internet.MemoryStreamConfig) internet.SocketConfig_TProxyM
return s.SocketSettings.Tproxy
}
func (w *tcpWorker) callback(conn stat.Connection) {
func (w *tcpWorker) callback(conn internet.Connection) {
ctx, cancel := context.WithCancel(w.ctx)
sid := session.NewID()
ctx = session.ContextWithID(ctx, sid)
var outbound = &session.Outbound{}
if w.recvOrigDest {
var dest net.Destination
switch getTProxyType(w.stream) {
@@ -75,13 +73,14 @@ func (w *tcpWorker) callback(conn stat.Connection) {
dest = net.DestinationFromAddr(conn.LocalAddr())
}
if dest.IsValid() {
outbound.Target = dest
ctx = session.ContextWithOutbound(ctx, &session.Outbound{
Target: dest,
})
}
}
ctx = session.ContextWithOutbound(ctx, outbound)
if w.uplinkCounter != nil || w.downlinkCounter != nil {
conn = &stat.CounterConnection{
conn = &internet.StatCouterConnection{
Connection: conn,
ReadCounter: w.uplinkCounter,
WriteCounter: w.downlinkCounter,
@@ -99,8 +98,6 @@ func (w *tcpWorker) callback(conn stat.Connection) {
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
content.SniffingRequest.ExcludeForDomain = w.sniffingConfig.DomainsExcluded
content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
content.SniffingRequest.RouteOnly = w.sniffingConfig.RouteOnly
}
ctx = session.ContextWithContent(ctx, content)
@@ -108,7 +105,9 @@ func (w *tcpWorker) callback(conn stat.Connection) {
newError("connection ends").Base(err).WriteToLog(session.ExportIDToError(ctx))
}
cancel()
conn.Close()
if err := conn.Close(); err != nil {
newError("failed to close connection").Base(err).WriteToLog(session.ExportIDToError(ctx))
}
}
func (w *tcpWorker) Proxy() proxy.Inbound {
@@ -117,7 +116,7 @@ func (w *tcpWorker) Proxy() proxy.Inbound {
func (w *tcpWorker) Start() error {
ctx := context.Background()
hub, err := internet.ListenTCP(ctx, w.address, w.port, w.stream, func(conn stat.Connection) {
hub, err := internet.ListenTCP(ctx, w.address, w.port, w.stream, func(conn internet.Connection) {
go w.callback(conn)
})
if err != nil {
@@ -158,11 +157,6 @@ type udpConn struct {
done *done.Instance
uplink stats.Counter
downlink stats.Counter
inactive bool
}
func (c *udpConn) setInactive() {
c.inactive = true
}
func (c *udpConn) updateActivity() {
@@ -241,7 +235,6 @@ type udpWorker struct {
tag string
stream *internet.MemoryStreamConfig
dispatcher routing.Dispatcher
sniffingConfig *proxyman.SniffingConfig
uplinkCounter stats.Counter
downlinkCounter stats.Counter
@@ -304,7 +297,7 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
common.Must(w.checker.Start())
go func() {
ctx := w.ctx
ctx := context.Background()
sid := session.NewID()
ctx = session.ContextWithID(ctx, sid)
@@ -318,23 +311,11 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
Gateway: net.UDPDestination(w.address, w.port),
Tag: w.tag,
})
content := new(session.Content)
if w.sniffingConfig != nil {
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
content.SniffingRequest.RouteOnly = w.sniffingConfig.RouteOnly
}
ctx = session.ContextWithContent(ctx, content)
if err := w.proxy.Process(ctx, net.Network_UDP, conn, w.dispatcher); err != nil {
newError("connection ends").Base(err).WriteToLog(session.ExportIDToError(ctx))
}
conn.Close()
// conn not removed by checker TODO may be lock worker here is better
if !conn.inactive {
conn.setInactive()
w.removeConn(id)
}
w.removeConn(id)
}()
}
}
@@ -362,11 +343,8 @@ func (w *udpWorker) clean() error {
}
for addr, conn := range w.activeConn {
if nowSec-atomic.LoadInt64(&conn.lastActivityTime) > 2*60 {
if !conn.inactive {
conn.setInactive()
delete(w.activeConn, addr)
}
if nowSec-atomic.LoadInt64(&conn.lastActivityTime) > 300 {
delete(w.activeConn, addr)
conn.Close()
}
}
@@ -449,13 +427,13 @@ type dsWorker struct {
ctx context.Context
}
func (w *dsWorker) callback(conn stat.Connection) {
func (w *dsWorker) callback(conn internet.Connection) {
ctx, cancel := context.WithCancel(w.ctx)
sid := session.NewID()
ctx = session.ContextWithID(ctx, sid)
if w.uplinkCounter != nil || w.downlinkCounter != nil {
conn = &stat.CounterConnection{
conn = &internet.StatCouterConnection{
Connection: conn,
ReadCounter: w.uplinkCounter,
WriteCounter: w.downlinkCounter,
@@ -473,8 +451,6 @@ func (w *dsWorker) callback(conn stat.Connection) {
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
content.SniffingRequest.ExcludeForDomain = w.sniffingConfig.DomainsExcluded
content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
content.SniffingRequest.RouteOnly = w.sniffingConfig.RouteOnly
}
ctx = session.ContextWithContent(ctx, content)
@@ -494,10 +470,9 @@ func (w *dsWorker) Proxy() proxy.Inbound {
func (w *dsWorker) Port() net.Port {
return net.Port(0)
}
func (w *dsWorker) Start() error {
ctx := context.Background()
hub, err := internet.ListenUnix(ctx, w.address, w.stream, func(conn stat.Connection) {
hub, err := internet.ListenUnix(ctx, w.address, w.stream, func(conn internet.Connection) {
go w.callback(conn)
})
if err != nil {

View File

@@ -2,13 +2,9 @@ package outbound
import (
"context"
"errors"
"io"
"os"
"github.com/xtls/xray-core/app/proxyman"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/buf"
"github.com/xtls/xray-core/common/mux"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/net/cnc"
@@ -20,7 +16,6 @@ import (
"github.com/xtls/xray-core/proxy"
"github.com/xtls/xray-core/transport"
"github.com/xtls/xray-core/transport/internet"
"github.com/xtls/xray-core/transport/internet/stat"
"github.com/xtls/xray-core/transport/internet/tls"
"github.com/xtls/xray-core/transport/pipe"
)
@@ -58,13 +53,11 @@ type Handler struct {
proxy proxy.Outbound
outboundManager outbound.Manager
mux *mux.ClientManager
xudp *mux.ClientManager
udp443 string
uplinkCounter stats.Counter
downlinkCounter stats.Counter
}
// NewHandler creates a new Handler based on the given configuration.
// NewHandler create a new Handler based on the given configuration.
func NewHandler(ctx context.Context, config *core.OutboundHandlerConfig) (outbound.Handler, error) {
v := core.MustFromContext(ctx)
uplinkCounter, downlinkCounter := getStatCounter(v, config.Tag)
@@ -109,50 +102,22 @@ func NewHandler(ctx context.Context, config *core.OutboundHandlerConfig) (outbou
}
if h.senderSettings != nil && h.senderSettings.MultiplexSettings != nil {
if config := h.senderSettings.MultiplexSettings; config.Enabled {
if config.Concurrency < 0 {
h.mux = &mux.ClientManager{Enabled: false}
}
if config.Concurrency == 0 {
config.Concurrency = 8 // same as before
}
if config.Concurrency > 0 {
h.mux = &mux.ClientManager{
Enabled: true,
Picker: &mux.IncrementalWorkerPicker{
Factory: &mux.DialingWorkerFactory{
Proxy: proxyHandler,
Dialer: h,
Strategy: mux.ClientStrategy{
MaxConcurrency: uint32(config.Concurrency),
MaxConnection: 128,
},
},
config := h.senderSettings.MultiplexSettings
if config.Concurrency < 1 || config.Concurrency > 1024 {
return nil, newError("invalid mux concurrency: ", config.Concurrency).AtWarning()
}
h.mux = &mux.ClientManager{
Enabled: h.senderSettings.MultiplexSettings.Enabled,
Picker: &mux.IncrementalWorkerPicker{
Factory: &mux.DialingWorkerFactory{
Proxy: proxyHandler,
Dialer: h,
Strategy: mux.ClientStrategy{
MaxConcurrency: config.Concurrency,
MaxConnection: 128,
},
}
}
if config.XudpConcurrency < 0 {
h.xudp = &mux.ClientManager{Enabled: false}
}
if config.XudpConcurrency == 0 {
h.xudp = nil // same as before
}
if config.XudpConcurrency > 0 {
h.xudp = &mux.ClientManager{
Enabled: true,
Picker: &mux.IncrementalWorkerPicker{
Factory: &mux.DialingWorkerFactory{
Proxy: proxyHandler,
Dialer: h,
Strategy: mux.ClientStrategy{
MaxConcurrency: uint32(config.XudpConcurrency),
MaxConnection: 128,
},
},
},
}
}
h.udp443 = config.XudpProxyUDP443
},
},
}
}
@@ -167,58 +132,21 @@ func (h *Handler) Tag() string {
// Dispatch implements proxy.Outbound.Dispatch.
func (h *Handler) Dispatch(ctx context.Context, link *transport.Link) {
outbound := session.OutboundFromContext(ctx)
if outbound.Target.Network == net.Network_UDP && outbound.OriginalTarget.Address != nil && outbound.OriginalTarget.Address != outbound.Target.Address {
link.Reader = &buf.EndpointOverrideReader{Reader: link.Reader, Dest: outbound.Target.Address, OriginalDest: outbound.OriginalTarget.Address}
link.Writer = &buf.EndpointOverrideWriter{Writer: link.Writer, Dest: outbound.Target.Address, OriginalDest: outbound.OriginalTarget.Address}
}
if h.mux != nil {
test := func(err error) {
if err != nil {
err := newError("failed to process mux outbound traffic").Base(err)
session.SubmitOutboundErrorToOriginator(ctx, err)
err.WriteToLog(session.ExportIDToError(ctx))
common.Interrupt(link.Writer)
}
if h.mux != nil && (h.mux.Enabled || session.MuxPreferedFromContext(ctx)) {
if err := h.mux.Dispatch(ctx, link); err != nil {
newError("failed to process mux outbound traffic").Base(err).WriteToLog(session.ExportIDToError(ctx))
common.Interrupt(link.Writer)
}
if outbound.Target.Network == net.Network_UDP && outbound.Target.Port == 443 {
switch h.udp443 {
case "reject":
test(newError("XUDP rejected UDP/443 traffic").AtInfo())
return
case "skip":
goto out
}
}
if h.xudp != nil && outbound.Target.Network == net.Network_UDP {
if !h.xudp.Enabled {
goto out
}
test(h.xudp.Dispatch(ctx, link))
return
}
if h.mux.Enabled {
test(h.mux.Dispatch(ctx, link))
return
}
}
out:
err := h.proxy.Process(ctx, link, h)
if err != nil {
if errors.Is(err, io.EOF) || errors.Is(err, io.ErrClosedPipe) || errors.Is(err, context.Canceled) {
err = nil
}
}
if err != nil {
// Ensure outbound ray is properly closed.
err := newError("failed to process outbound traffic").Base(err)
session.SubmitOutboundErrorToOriginator(ctx, err)
err.WriteToLog(session.ExportIDToError(ctx))
common.Interrupt(link.Writer)
} else {
common.Close(link.Writer)
if err := h.proxy.Process(ctx, link, h); err != nil {
// Ensure outbound ray is properly closed.
newError("failed to process outbound traffic").Base(err).WriteToLog(session.ExportIDToError(ctx))
common.Interrupt(link.Writer)
} else {
common.Must(common.Close(link.Writer))
}
common.Interrupt(link.Reader)
}
common.Interrupt(link.Reader)
}
// Address implements internet.Dialer.
@@ -229,12 +157,8 @@ func (h *Handler) Address() net.Address {
return h.senderSettings.Via.AsAddress()
}
func (h *Handler) DestIpAddress() net.IP {
return internet.DestIpAddress()
}
// Dial implements internet.Dialer.
func (h *Handler) Dial(ctx context.Context, dest net.Destination) (stat.Connection, error) {
func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Connection, error) {
if h.senderSettings != nil {
if h.senderSettings.ProxySettings.HasTag() {
tag := h.senderSettings.ProxySettings.Tag
@@ -273,22 +197,13 @@ func (h *Handler) Dial(ctx context.Context, dest net.Destination) (stat.Connecti
}
}
if conn, err := h.getUoTConnection(ctx, dest); err != os.ErrInvalid {
return conn, err
}
conn, err := internet.Dial(ctx, dest, h.streamSettings)
conn = h.getStatCouterConnection(conn)
outbound := session.OutboundFromContext(ctx)
if outbound != nil {
outbound.Conn = conn
}
return conn, err
return h.getStatCouterConnection(conn), err
}
func (h *Handler) getStatCouterConnection(conn stat.Connection) stat.Connection {
func (h *Handler) getStatCouterConnection(conn internet.Connection) internet.Connection {
if h.uplinkCounter != nil || h.downlinkCounter != nil {
return &stat.CounterConnection{
return &internet.StatCouterConnection{
Connection: conn,
ReadCounter: h.downlinkCounter,
WriteCounter: h.uplinkCounter,

View File

@@ -12,7 +12,7 @@ import (
core "github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/outbound"
"github.com/xtls/xray-core/proxy/freedom"
"github.com/xtls/xray-core/transport/internet/stat"
"github.com/xtls/xray-core/transport/internet"
)
func TestInterfaces(t *testing.T) {
@@ -44,9 +44,9 @@ func TestOutboundWithoutStatCounter(t *testing.T) {
ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
})
conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
_, ok := conn.(*stat.CounterConnection)
_, ok := conn.(*internet.StatCouterConnection)
if ok {
t.Errorf("Expected conn to not be CounterConnection")
t.Errorf("Expected conn to not be StatCouterConnection")
}
}
@@ -73,8 +73,8 @@ func TestOutboundWithStatCounter(t *testing.T) {
ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
})
conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
_, ok := conn.(*stat.CounterConnection)
_, ok := conn.(*internet.StatCouterConnection)
if !ok {
t.Errorf("Expected conn to be CounterConnection")
t.Errorf("Expected conn to be StatCouterConnection")
}
}

View File

@@ -1,34 +0,0 @@
package outbound
import (
"context"
"os"
"github.com/sagernet/sing/common/uot"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/transport/internet"
"github.com/xtls/xray-core/transport/internet/stat"
)
func (h *Handler) getUoTConnection(ctx context.Context, dest net.Destination) (stat.Connection, error) {
if dest.Address == nil {
return nil, newError("nil destination address")
}
if !dest.Address.Family().IsDomain() {
return nil, os.ErrInvalid
}
var uotVersion int
if dest.Address.Domain() == uot.MagicAddress {
uotVersion = uot.Version
} else if dest.Address.Domain() == uot.LegacyMagicAddress {
uotVersion = uot.LegacyVersion
} else {
return nil, os.ErrInvalid
}
packetConn, err := internet.ListenSystemPacket(ctx, &net.UDPAddr{IP: net.AnyIP.IP(), Port: 0}, h.streamSettings.SocketSettings)
if err != nil {
return nil, newError("unable to listen socket").Base(err)
}
conn := uot.NewServerConn(packetConn, uotVersion)
return h.getStatCouterConnection(conn), nil
}

View File

@@ -4,6 +4,7 @@ import (
"context"
"time"
"github.com/golang/protobuf/proto"
"github.com/xtls/xray-core/common/mux"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/session"
@@ -11,7 +12,6 @@ import (
"github.com/xtls/xray-core/features/routing"
"github.com/xtls/xray-core/transport"
"github.com/xtls/xray-core/transport/pipe"
"google.golang.org/protobuf/proto"
)
// Bridge is a component in reverse proxy, that relays connections from Portal to local address.
@@ -146,7 +146,7 @@ func (w *BridgeWorker) Connections() uint32 {
return w.worker.ActiveConnections()
}
func (w *BridgeWorker) handleInternalConn(link *transport.Link) {
func (w *BridgeWorker) handleInternalConn(link transport.Link) {
go func() {
reader := link.Reader
for {
@@ -180,7 +180,7 @@ func (w *BridgeWorker) Dispatch(ctx context.Context, dest net.Destination) (*tra
uplinkReader, uplinkWriter := pipe.New(opt...)
downlinkReader, downlinkWriter := pipe.New(opt...)
w.handleInternalConn(&transport.Link{
w.handleInternalConn(transport.Link{
Reader: downlinkReader,
Writer: uplinkWriter,
})
@@ -190,16 +190,3 @@ func (w *BridgeWorker) Dispatch(ctx context.Context, dest net.Destination) (*tra
Writer: downlinkWriter,
}, nil
}
func (w *BridgeWorker) DispatchLink(ctx context.Context, dest net.Destination, link *transport.Link) error {
if !isInternalDomain(dest) {
ctx = session.ContextWithInbound(ctx, &session.Inbound{
Tag: w.tag,
})
return w.dispatcher.DispatchLink(ctx, dest, link)
}
w.handleInternalConn(link)
return nil
}

View File

@@ -1,12 +1,13 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// protoc-gen-go v1.25.0
// protoc v3.14.0
// source: app/reverse/config.proto
package reverse
import (
proto "github.com/golang/protobuf/proto"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
@@ -20,6 +21,10 @@ const (
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// This is a compile-time assertion that a sufficiently up-to-date version
// of the legacy proto package is being used.
const _ = proto.ProtoPackageIsVersion4
type Control_State int32
const (

View File

@@ -5,6 +5,7 @@ import (
"sync"
"time"
"github.com/golang/protobuf/proto"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/buf"
"github.com/xtls/xray-core/common/mux"
@@ -14,7 +15,6 @@ import (
"github.com/xtls/xray-core/features/outbound"
"github.com/xtls/xray-core/transport"
"github.com/xtls/xray-core/transport/pipe"
"google.golang.org/protobuf/proto"
)
type Portal struct {

View File

@@ -14,7 +14,7 @@ import (
)
const (
internalDomain = "reverse.internal.v2fly.org" // make reverse proxy compatible with v2fly
internalDomain = "reverse.internal.example.com"
)
func isDomain(dest net.Destination, domain string) bool {

View File

@@ -1,12 +1,7 @@
package router
import (
"context"
reflect "reflect"
sync "sync"
"github.com/xtls/xray-core/common/dice"
"github.com/xtls/xray-core/features/extension"
"github.com/xtls/xray-core/features/outbound"
)
@@ -14,7 +9,8 @@ type BalancingStrategy interface {
PickOutbound([]string) string
}
type RandomStrategy struct{}
type RandomStrategy struct {
}
func (s *RandomStrategy) PickOutbound(tags []string) string {
n := len(tags)
@@ -25,39 +21,6 @@ func (s *RandomStrategy) PickOutbound(tags []string) string {
return tags[dice.Roll(n)]
}
type RoundRobinStrategy struct {
mu sync.Mutex
tags []string
index int
roundRobin *RoundRobinStrategy
}
func NewRoundRobin(tags []string) *RoundRobinStrategy {
return &RoundRobinStrategy{
tags: tags,
}
}
func (r *RoundRobinStrategy) NextTag() string {
r.mu.Lock()
defer r.mu.Unlock()
tags := r.tags[r.index]
r.index = (r.index + 1) % len(r.tags)
return tags
}
func (s *RoundRobinStrategy) PickOutbound(tags []string) string {
if len(tags) == 0 {
panic("0 tags")
}
if s.roundRobin == nil || !reflect.DeepEqual(s.roundRobin.tags, tags) {
s.roundRobin = NewRoundRobin(tags)
}
tag := s.roundRobin.NextTag()
return tag
}
type Balancer struct {
selectors []string
strategy BalancingStrategy
@@ -79,9 +42,3 @@ func (b *Balancer) PickOutbound() (string, error) {
}
return tag, nil
}
func (b *Balancer) InjectContext(ctx context.Context) {
if contextReceiver, ok := b.strategy.(extension.ContextReceiver); ok {
contextReceiver.InjectContext(ctx)
}
}

View File

@@ -6,11 +6,12 @@ import (
"context"
"time"
"google.golang.org/grpc"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/routing"
"github.com/xtls/xray-core/features/stats"
"google.golang.org/grpc"
)
// routingServer is an implementation of RoutingService.

View File

@@ -1,12 +1,13 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// protoc-gen-go v1.25.0
// protoc v3.14.0
// source: app/router/command/command.proto
package command
import (
proto "github.com/golang/protobuf/proto"
net "github.com/xtls/xray-core/common/net"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
@@ -21,6 +22,10 @@ const (
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// This is a compile-time assertion that a sufficiently up-to-date version
// of the legacy proto package is being used.
const _ = proto.ProtoPackageIsVersion4
// RoutingContext is the context with information relative to routing process.
// It conforms to the structure of xray.features.routing.Context and
// xray.features.routing.Route.
@@ -86,7 +91,7 @@ func (x *RoutingContext) GetNetwork() net.Network {
if x != nil {
return x.Network
}
return net.Network(0)
return net.Network_Unknown
}
func (x *RoutingContext) GetSourceIPs() [][]byte {
@@ -163,19 +168,18 @@ func (x *RoutingContext) GetOutboundTag() string {
// opened by xray-core.
// * FieldSelectors selects a subset of fields in routing statistics to return.
// Valid selectors:
// - inbound: Selects connection's inbound tag.
// - network: Selects connection's network.
// - ip: Equivalent as "ip_source" and "ip_target", selects both source and
// target IP.
// - port: Equivalent as "port_source" and "port_target", selects both source
// and target port.
// - domain: Selects target domain.
// - protocol: Select connection's protocol.
// - user: Select connection's inbound user email.
// - attributes: Select connection's additional attributes.
// - outbound: Equivalent as "outbound" and "outbound_group", select both
// outbound tag and outbound group tags.
//
// - inbound: Selects connection's inbound tag.
// - network: Selects connection's network.
// - ip: Equivalent as "ip_source" and "ip_target", selects both source and
// target IP.
// - port: Equivalent as "port_source" and "port_target", selects both source
// and target port.
// - domain: Selects target domain.
// - protocol: Select connection's protocol.
// - user: Select connection's inbound user email.
// - attributes: Select connection's additional attributes.
// - outbound: Equivalent as "outbound" and "outbound_group", select both
// outbound tag and outbound group tags.
// * If FieldSelectors is left empty, all fields will be returned.
type SubscribeRoutingStatsRequest struct {
state protoimpl.MessageState

View File

@@ -1,8 +1,4 @@
// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
// versions:
// - protoc-gen-go-grpc v1.3.0
// - protoc v4.23.1
// source: app/router/command/command.proto
package command
@@ -18,11 +14,6 @@ import (
// Requires gRPC-Go v1.32.0 or later.
const _ = grpc.SupportPackageIsVersion7
const (
RoutingService_SubscribeRoutingStats_FullMethodName = "/xray.app.router.command.RoutingService/SubscribeRoutingStats"
RoutingService_TestRoute_FullMethodName = "/xray.app.router.command.RoutingService/TestRoute"
)
// RoutingServiceClient is the client API for RoutingService service.
//
// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream.
@@ -40,7 +31,7 @@ func NewRoutingServiceClient(cc grpc.ClientConnInterface) RoutingServiceClient {
}
func (c *routingServiceClient) SubscribeRoutingStats(ctx context.Context, in *SubscribeRoutingStatsRequest, opts ...grpc.CallOption) (RoutingService_SubscribeRoutingStatsClient, error) {
stream, err := c.cc.NewStream(ctx, &RoutingService_ServiceDesc.Streams[0], RoutingService_SubscribeRoutingStats_FullMethodName, opts...)
stream, err := c.cc.NewStream(ctx, &RoutingService_ServiceDesc.Streams[0], "/xray.app.router.command.RoutingService/SubscribeRoutingStats", opts...)
if err != nil {
return nil, err
}
@@ -73,7 +64,7 @@ func (x *routingServiceSubscribeRoutingStatsClient) Recv() (*RoutingContext, err
func (c *routingServiceClient) TestRoute(ctx context.Context, in *TestRouteRequest, opts ...grpc.CallOption) (*RoutingContext, error) {
out := new(RoutingContext)
err := c.cc.Invoke(ctx, RoutingService_TestRoute_FullMethodName, in, out, opts...)
err := c.cc.Invoke(ctx, "/xray.app.router.command.RoutingService/TestRoute", in, out, opts...)
if err != nil {
return nil, err
}
@@ -143,7 +134,7 @@ func _RoutingService_TestRoute_Handler(srv interface{}, ctx context.Context, dec
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: RoutingService_TestRoute_FullMethodName,
FullMethod: "/xray.app.router.command.RoutingService/TestRoute",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(RoutingServiceServer).TestRoute(ctx, req.(*TestRouteRequest))

View File

@@ -44,6 +44,7 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
{SourceIPs: [][]byte{{127, 0, 0, 1}}, Attributes: map[string]string{"attr": "value"}, OutboundTag: "out"},
}
errCh := make(chan error)
nextPub := make(chan struct{})
// Server goroutine
go func() {
@@ -75,6 +76,13 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
if err := publishTestCases(); err != nil {
errCh <- err
}
// Wait for next round of publishing
<-nextPub
if err := publishTestCases(); err != nil {
errCh <- err
}
}()
// Client goroutine
@@ -136,92 +144,6 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
return nil
}
if err := testRetrievingAllFields(); err != nil {
errCh <- err
}
errCh <- nil // Client passed all tests successfully
}()
// Wait for goroutines to complete
select {
case <-time.After(2 * time.Second):
t.Fatal("Test timeout after 2s")
case err := <-errCh:
if err != nil {
t.Fatal(err)
}
}
}
func TestServiceSubscribeSubsetOfFields(t *testing.T) {
c := stats.NewChannel(&stats.ChannelConfig{
SubscriberLimit: 1,
BufferSize: 0,
Blocking: true,
})
common.Must(c.Start())
defer c.Close()
lis := bufconn.Listen(1024 * 1024)
bufDialer := func(context.Context, string) (net.Conn, error) {
return lis.Dial()
}
testCases := []*RoutingContext{
{InboundTag: "in", OutboundTag: "out"},
{TargetIPs: [][]byte{{1, 2, 3, 4}}, TargetPort: 8080, OutboundTag: "out"},
{TargetDomain: "example.com", TargetPort: 443, OutboundTag: "out"},
{SourcePort: 9999, TargetPort: 9999, OutboundTag: "out"},
{Network: net.Network_UDP, OutboundGroupTags: []string{"outergroup", "innergroup"}, OutboundTag: "out"},
{Protocol: "bittorrent", OutboundTag: "blocked"},
{User: "example@example.com", OutboundTag: "out"},
{SourceIPs: [][]byte{{127, 0, 0, 1}}, Attributes: map[string]string{"attr": "value"}, OutboundTag: "out"},
}
errCh := make(chan error)
// Server goroutine
go func() {
server := grpc.NewServer()
RegisterRoutingServiceServer(server, NewRoutingServer(nil, c))
errCh <- server.Serve(lis)
}()
// Publisher goroutine
go func() {
publishTestCases := func() error {
ctx, cancel := context.WithTimeout(context.Background(), time.Second)
defer cancel()
for { // Wait until there's one subscriber in routing stats channel
if len(c.Subscribers()) > 0 {
break
}
if ctx.Err() != nil {
return ctx.Err()
}
}
for _, tc := range testCases {
c.Publish(context.Background(), AsRoutingRoute(tc))
time.Sleep(time.Millisecond)
}
return nil
}
if err := publishTestCases(); err != nil {
errCh <- err
}
}()
// Client goroutine
go func() {
defer lis.Close()
conn, err := grpc.DialContext(context.Background(), "bufnet", grpc.WithContextDialer(bufDialer), grpc.WithInsecure())
if err != nil {
errCh <- err
return
}
defer conn.Close()
client := NewRoutingServiceClient(conn)
// Test retrieving only a subset of fields
testRetrievingSubsetOfFields := func() error {
streamCtx, streamClose := context.WithCancel(context.Background())
@@ -233,6 +155,9 @@ func TestServiceSubscribeSubsetOfFields(t *testing.T) {
return err
}
// Send nextPub signal to start next round of publishing
close(nextPub)
for _, tc := range testCases {
msg, err := stream.Recv()
if err != nil {
@@ -254,6 +179,10 @@ func TestServiceSubscribeSubsetOfFields(t *testing.T) {
return nil
}
if err := testRetrievingAllFields(); err != nil {
errCh <- err
}
if err := testRetrievingSubsetOfFields(); err != nil {
errCh <- err
}
@@ -283,7 +212,7 @@ func TestSerivceTestRoute(t *testing.T) {
r := new(router.Router)
mockCtl := gomock.NewController(t)
defer mockCtl.Finish()
common.Must(r.Init(context.TODO(), &router.Config{
common.Must(r.Init(&router.Config{
Rule: []*router.RoutingRule{
{
InboundTag: []string{"in"},

View File

@@ -28,13 +28,6 @@ func (c routingContext) GetTargetPort() net.Port {
return net.Port(c.RoutingContext.GetTargetPort())
}
// GetSkipDNSResolve is a mock implementation here to match the interface,
// SkipDNSResolve is set from dns module, no use if coming from a protobuf object?
// TODO: please confirm @Vigilans
func (c routingContext) GetSkipDNSResolve() bool {
return false
}
// AsRoutingContext converts a protobuf RoutingContext into an implementation of routing.Context.
func AsRoutingContext(r *RoutingContext) routing.Context {
return routingContext{r}

View File

@@ -1,9 +1,11 @@
package router
import (
"regexp"
"strings"
"go.starlark.net/starlark"
"go.starlark.net/syntax"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/strmatcher"
"github.com/xtls/xray-core/features/routing"
@@ -64,24 +66,6 @@ type DomainMatcher struct {
matchers strmatcher.IndexMatcher
}
func NewMphMatcherGroup(domains []*Domain) (*DomainMatcher, error) {
g := strmatcher.NewMphMatcherGroup()
for _, d := range domains {
matcherType, f := matcherTypeMap[d.Type]
if !f {
return nil, newError("unsupported domain type", d.Type)
}
_, err := g.AddPattern(d.Value, matcherType)
if err != nil {
return nil, err
}
}
g.Build()
return &DomainMatcher{
matchers: g,
}, nil
}
func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
g := new(strmatcher.MatcherGroup)
for _, d := range domains {
@@ -98,7 +82,7 @@ func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
}
func (m *DomainMatcher) ApplyDomain(domain string) bool {
return len(m.matchers.Match(strings.ToLower(domain))) > 0
return len(m.matchers.Match(domain)) > 0
}
// Apply implements Condition.
@@ -107,7 +91,7 @@ func (m *DomainMatcher) Apply(ctx routing.Context) bool {
if len(domain) == 0 {
return false
}
return m.ApplyDomain(domain)
return m.ApplyDomain(strings.ToLower(domain))
}
type MultiGeoIPMatcher struct {
@@ -283,22 +267,44 @@ func (m *ProtocolMatcher) Apply(ctx routing.Context) bool {
}
type AttributeMatcher struct {
configuredKeys map[string]*regexp.Regexp
program *starlark.Program
}
func NewAttributeMatcher(code string) (*AttributeMatcher, error) {
starFile, err := syntax.Parse("attr.star", "satisfied=("+code+")", 0)
if err != nil {
return nil, newError("attr rule").Base(err)
}
p, err := starlark.FileProgram(starFile, func(name string) bool {
return name == "attrs"
})
if err != nil {
return nil, err
}
return &AttributeMatcher{
program: p,
}, nil
}
// Match implements attributes matching.
func (m *AttributeMatcher) Match(attrs map[string]string) bool {
// header keys are case insensitive most likely. So we do a convert
httpHeaders := make(map[string]string)
attrsDict := new(starlark.Dict)
for key, value := range attrs {
httpHeaders[strings.ToLower(key)] = value
attrsDict.SetKey(starlark.String(key), starlark.String(value))
}
for key, regex := range m.configuredKeys {
if a, ok := httpHeaders[key]; !ok || !regex.MatchString(a) {
return false
}
predefined := make(starlark.StringDict)
predefined["attrs"] = attrsDict
thread := &starlark.Thread{
Name: "matcher",
}
return true
results, err := m.program.Init(thread, predefined)
if err != nil {
newError("attr matcher").Base(err).WriteToLog()
}
satisfied := results["satisfied"]
return satisfied != nil && bool(satisfied.Truth())
}
// Apply implements Condition.

View File

@@ -1,89 +1,161 @@
package router
import (
"net/netip"
"strconv"
"encoding/binary"
"sort"
"github.com/xtls/xray-core/common/net"
"go4.org/netipx"
)
type ipv6 struct {
a uint64
b uint64
}
type GeoIPMatcher struct {
countryCode string
reverseMatch bool
ip4 *netipx.IPSet
ip6 *netipx.IPSet
countryCode string
ip4 []uint32
prefix4 []uint8
ip6 []ipv6
prefix6 []uint8
}
func normalize4(ip uint32, prefix uint8) uint32 {
return (ip >> (32 - prefix)) << (32 - prefix)
}
func normalize6(ip ipv6, prefix uint8) ipv6 {
if prefix <= 64 {
ip.a = (ip.a >> (64 - prefix)) << (64 - prefix)
ip.b = 0
} else {
ip.b = (ip.b >> (128 - prefix)) << (128 - prefix)
}
return ip
}
func (m *GeoIPMatcher) Init(cidrs []*CIDR) error {
var builder4, builder6 netipx.IPSetBuilder
ip4Count := 0
ip6Count := 0
for _, cidr := range cidrs {
ip := net.IP(cidr.GetIp())
ipPrefixString := ip.String() + "/" + strconv.Itoa(int(cidr.GetPrefix()))
ipPrefix, err := netip.ParsePrefix(ipPrefixString)
if err != nil {
return err
}
ip := cidr.Ip
switch len(ip) {
case net.IPv4len:
builder4.AddPrefix(ipPrefix)
case net.IPv6len:
builder6.AddPrefix(ipPrefix)
case 4:
ip4Count++
case 16:
ip6Count++
default:
return newError("unexpect ip length: ", len(ip))
}
}
if ip4, err := builder4.IPSet(); err != nil {
return err
} else {
m.ip4 = ip4
}
cidrList := CIDRList(cidrs)
sort.Sort(&cidrList)
if ip6, err := builder6.IPSet(); err != nil {
return err
} else {
m.ip6 = ip6
m.ip4 = make([]uint32, 0, ip4Count)
m.prefix4 = make([]uint8, 0, ip4Count)
m.ip6 = make([]ipv6, 0, ip6Count)
m.prefix6 = make([]uint8, 0, ip6Count)
for _, cidr := range cidrs {
ip := cidr.Ip
prefix := uint8(cidr.Prefix)
switch len(ip) {
case 4:
m.ip4 = append(m.ip4, normalize4(binary.BigEndian.Uint32(ip), prefix))
m.prefix4 = append(m.prefix4, prefix)
case 16:
ip6 := ipv6{
a: binary.BigEndian.Uint64(ip[0:8]),
b: binary.BigEndian.Uint64(ip[8:16]),
}
ip6 = normalize6(ip6, prefix)
m.ip6 = append(m.ip6, ip6)
m.prefix6 = append(m.prefix6, prefix)
}
}
return nil
}
func (m *GeoIPMatcher) SetReverseMatch(isReverseMatch bool) {
m.reverseMatch = isReverseMatch
}
func (m *GeoIPMatcher) match4(ip net.IP) bool {
nip, ok := netipx.FromStdIP(ip)
if !ok {
func (m *GeoIPMatcher) match4(ip uint32) bool {
if len(m.ip4) == 0 {
return false
}
return m.ip4.Contains(nip)
}
func (m *GeoIPMatcher) match6(ip net.IP) bool {
nip, ok := netipx.FromStdIP(ip)
if !ok {
if ip < m.ip4[0] {
return false
}
return m.ip6.Contains(nip)
size := uint32(len(m.ip4))
l := uint32(0)
r := size
for l < r {
x := ((l + r) >> 1)
if ip < m.ip4[x] {
r = x
continue
}
nip := normalize4(ip, m.prefix4[x])
if nip == m.ip4[x] {
return true
}
l = x + 1
}
return l > 0 && normalize4(ip, m.prefix4[l-1]) == m.ip4[l-1]
}
func less6(a ipv6, b ipv6) bool {
return a.a < b.a || (a.a == b.a && a.b < b.b)
}
func (m *GeoIPMatcher) match6(ip ipv6) bool {
if len(m.ip6) == 0 {
return false
}
if less6(ip, m.ip6[0]) {
return false
}
size := uint32(len(m.ip6))
l := uint32(0)
r := size
for l < r {
x := (l + r) / 2
if less6(ip, m.ip6[x]) {
r = x
continue
}
if normalize6(ip, m.prefix6[x]) == m.ip6[x] {
return true
}
l = x + 1
}
return l > 0 && normalize6(ip, m.prefix6[l-1]) == m.ip6[l-1]
}
// Match returns true if the given ip is included by the GeoIP.
func (m *GeoIPMatcher) Match(ip net.IP) bool {
isMatched := false
switch len(ip) {
case net.IPv4len:
isMatched = m.match4(ip)
case net.IPv6len:
isMatched = m.match6(ip)
case 4:
return m.match4(binary.BigEndian.Uint32(ip))
case 16:
return m.match6(ipv6{
a: binary.BigEndian.Uint64(ip[0:8]),
b: binary.BigEndian.Uint64(ip[8:16]),
})
default:
return false
}
if m.reverseMatch {
return !isMatched
}
return isMatched
}
// GeoIPMatcherContainer is a container for GeoIPMatchers. It keeps unique copies of GeoIPMatcher by country code.
@@ -96,15 +168,14 @@ type GeoIPMatcherContainer struct {
func (c *GeoIPMatcherContainer) Add(geoip *GeoIP) (*GeoIPMatcher, error) {
if len(geoip.CountryCode) > 0 {
for _, m := range c.matchers {
if m.countryCode == geoip.CountryCode && m.reverseMatch == geoip.ReverseMatch {
if m.countryCode == geoip.CountryCode {
return m, nil
}
}
}
m := &GeoIPMatcher{
countryCode: geoip.CountryCode,
reverseMatch: geoip.ReverseMatch,
countryCode: geoip.CountryCode,
}
if err := m.Init(geoip.Cidr); err != nil {
return nil, err
@@ -115,4 +186,6 @@ func (c *GeoIPMatcherContainer) Add(geoip *GeoIP) (*GeoIPMatcher, error) {
return m, nil
}
var globalGeoIPContainer GeoIPMatcherContainer
var (
globalGeoIPContainer GeoIPMatcherContainer
)

View File

@@ -5,12 +5,12 @@ import (
"path/filepath"
"testing"
"github.com/golang/protobuf/proto"
"github.com/xtls/xray-core/app/router"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/platform"
"github.com/xtls/xray-core/common/platform/filesystem"
"google.golang.org/protobuf/proto"
)
func init() {
@@ -53,7 +53,7 @@ func TestGeoIPMatcherContainer(t *testing.T) {
}
func TestGeoIPMatcher(t *testing.T) {
cidrList := []*router.CIDR{
cidrList := router.CIDRList{
{Ip: []byte{0, 0, 0, 0}, Prefix: 8},
{Ip: []byte{10, 0, 0, 0}, Prefix: 8},
{Ip: []byte{100, 64, 0, 0}, Prefix: 10},
@@ -88,8 +88,7 @@ func TestGeoIPMatcher(t *testing.T) {
{
Input: "192.0.1.0",
Output: false,
},
{
}, {
Input: "0.1.0.0",
Output: true,
},
@@ -124,74 +123,6 @@ func TestGeoIPMatcher(t *testing.T) {
}
}
func TestGeoIPMatcherRegression(t *testing.T) {
cidrList := []*router.CIDR{
{Ip: []byte{98, 108, 20, 0}, Prefix: 22},
{Ip: []byte{98, 108, 20, 0}, Prefix: 23},
}
matcher := &router.GeoIPMatcher{}
common.Must(matcher.Init(cidrList))
testCases := []struct {
Input string
Output bool
}{
{
Input: "98.108.22.11",
Output: true,
},
{
Input: "98.108.25.0",
Output: false,
},
}
for _, testCase := range testCases {
ip := net.ParseAddress(testCase.Input).IP()
actual := matcher.Match(ip)
if actual != testCase.Output {
t.Error("expect input", testCase.Input, "to be", testCase.Output, ", but actually", actual)
}
}
}
func TestGeoIPReverseMatcher(t *testing.T) {
cidrList := []*router.CIDR{
{Ip: []byte{8, 8, 8, 8}, Prefix: 32},
{Ip: []byte{91, 108, 4, 0}, Prefix: 16},
}
matcher := &router.GeoIPMatcher{}
matcher.SetReverseMatch(true) // Reverse match
common.Must(matcher.Init(cidrList))
testCases := []struct {
Input string
Output bool
}{
{
Input: "8.8.8.8",
Output: false,
},
{
Input: "2001:cdba::3257:9652",
Output: true,
},
{
Input: "91.108.255.254",
Output: false,
},
}
for _, testCase := range testCases {
ip := net.ParseAddress(testCase.Input).IP()
actual := matcher.Match(ip)
if actual != testCase.Output {
t.Error("expect input", testCase.Input, "to be", testCase.Output, ", but actually", actual)
}
}
}
func TestGeoIPMatcher4CN(t *testing.T) {
ips, err := loadGeoIP("CN")
common.Must(err)

View File

@@ -6,6 +6,8 @@ import (
"strconv"
"testing"
"github.com/golang/protobuf/proto"
. "github.com/xtls/xray-core/app/router"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
@@ -17,7 +19,6 @@ import (
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/features/routing"
routing_session "github.com/xtls/xray-core/features/routing/session"
"google.golang.org/protobuf/proto"
)
func init() {
@@ -307,10 +308,8 @@ func TestRoutingRule(t *testing.T) {
},
{
rule: &RoutingRule{
Protocol: []string{"http"},
Attributes: map[string]string{
":path": "/test",
},
Protocol: []string{"http"},
Attributes: "attrs[':path'].startswith('/test')",
},
test: []ruleTest{
{
@@ -319,19 +318,6 @@ func TestRoutingRule(t *testing.T) {
},
},
},
{
rule: &RoutingRule{
Attributes: map[string]string{
"Custom": "p([a-z]+)ch",
},
},
test: []ruleTest{
{
input: withContent(&session.Content{Attributes: map[string]string{"custom": "peach"}}),
output: true,
},
},
},
}
for _, test := range cases {
@@ -373,9 +359,6 @@ func TestChinaSites(t *testing.T) {
matcher, err := NewDomainMatcher(domains)
common.Must(err)
acMatcher, err := NewMphMatcherGroup(domains)
common.Must(err)
type TestCase struct {
Domain string
Output bool
@@ -404,96 +387,9 @@ func TestChinaSites(t *testing.T) {
}
for _, testCase := range testCases {
r1 := matcher.ApplyDomain(testCase.Domain)
r2 := acMatcher.ApplyDomain(testCase.Domain)
if r1 != testCase.Output {
t.Error("DomainMatcher expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r1)
} else if r2 != testCase.Output {
t.Error("ACDomainMatcher expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r2)
}
}
}
func BenchmarkMphDomainMatcher(b *testing.B) {
domains, err := loadGeoSite("CN")
common.Must(err)
matcher, err := NewMphMatcherGroup(domains)
common.Must(err)
type TestCase struct {
Domain string
Output bool
}
testCases := []TestCase{
{
Domain: "163.com",
Output: true,
},
{
Domain: "163.com",
Output: true,
},
{
Domain: "164.com",
Output: false,
},
{
Domain: "164.com",
Output: false,
},
}
for i := 0; i < 1024; i++ {
testCases = append(testCases, TestCase{Domain: strconv.Itoa(i) + ".not-exists.com", Output: false})
}
b.ResetTimer()
for i := 0; i < b.N; i++ {
for _, testCase := range testCases {
_ = matcher.ApplyDomain(testCase.Domain)
}
}
}
func BenchmarkDomainMatcher(b *testing.B) {
domains, err := loadGeoSite("CN")
common.Must(err)
matcher, err := NewDomainMatcher(domains)
common.Must(err)
type TestCase struct {
Domain string
Output bool
}
testCases := []TestCase{
{
Domain: "163.com",
Output: true,
},
{
Domain: "163.com",
Output: true,
},
{
Domain: "164.com",
Output: false,
},
{
Domain: "164.com",
Output: false,
},
}
for i := 0; i < 1024; i++ {
testCases = append(testCases, TestCase{Domain: strconv.Itoa(i) + ".not-exists.com", Output: false})
}
b.ResetTimer()
for i := 0; i < b.N; i++ {
for _, testCase := range testCases {
_ = matcher.ApplyDomain(testCase.Domain)
r := matcher.ApplyDomain(testCase.Domain)
if r != testCase.Output {
t.Error("expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r)
}
}
}

View File

@@ -1,14 +1,50 @@
package router
import (
"regexp"
"strings"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/features/outbound"
"github.com/xtls/xray-core/features/routing"
)
// CIDRList is an alias of []*CIDR to provide sort.Interface.
type CIDRList []*CIDR
// Len implements sort.Interface.
func (l *CIDRList) Len() int {
return len(*l)
}
// Less implements sort.Interface.
func (l *CIDRList) Less(i int, j int) bool {
ci := (*l)[i]
cj := (*l)[j]
if len(ci.Ip) < len(cj.Ip) {
return true
}
if len(ci.Ip) > len(cj.Ip) {
return false
}
for k := 0; k < len(ci.Ip); k++ {
if ci.Ip[k] < cj.Ip[k] {
return true
}
if ci.Ip[k] > cj.Ip[k] {
return false
}
}
return ci.Prefix < cj.Prefix
}
// Swap implements sort.Interface.
func (l *CIDRList) Swap(i int, j int) {
(*l)[i], (*l)[j] = (*l)[j], (*l)[i]
}
type Rule struct {
Tag string
Balancer *Balancer
@@ -31,23 +67,11 @@ func (rr *RoutingRule) BuildCondition() (Condition, error) {
conds := NewConditionChan()
if len(rr.Domain) > 0 {
switch rr.DomainMatcher {
case "linear":
matcher, err := NewDomainMatcher(rr.Domain)
if err != nil {
return nil, newError("failed to build domain condition").Base(err)
}
conds.Add(matcher)
case "mph", "hybrid":
fallthrough
default:
matcher, err := NewMphMatcherGroup(rr.Domain)
if err != nil {
return nil, newError("failed to build domain condition with MphDomainMatcher").Base(err)
}
newError("MphDomainMatcher is enabled for ", len(rr.Domain), " domain rule(s)").AtDebug().WriteToLog()
conds.Add(matcher)
matcher, err := NewDomainMatcher(rr.Domain)
if err != nil {
return nil, newError("failed to build domain condition").Base(err)
}
conds.Add(matcher)
}
if len(rr.UserEmail) > 0 {
@@ -107,11 +131,11 @@ func (rr *RoutingRule) BuildCondition() (Condition, error) {
}
if len(rr.Attributes) > 0 {
configuredKeys := make(map[string]*regexp.Regexp)
for key, value := range rr.Attributes {
configuredKeys[strings.ToLower(key)] = regexp.MustCompile(value)
cond, err := NewAttributeMatcher(rr.Attributes)
if err != nil {
return nil, err
}
conds.Add(&AttributeMatcher{configuredKeys})
conds.Add(cond)
}
if conds.Len() == 0 {
@@ -122,27 +146,9 @@ func (rr *RoutingRule) BuildCondition() (Condition, error) {
}
func (br *BalancingRule) Build(ohm outbound.Manager) (*Balancer, error) {
switch br.Strategy {
case "leastPing":
return &Balancer{
selectors: br.OutboundSelector,
strategy: &LeastPingStrategy{},
ohm: ohm,
}, nil
case "roundRobin":
return &Balancer{
selectors: br.OutboundSelector,
strategy: &RoundRobinStrategy{},
ohm: ohm,
}, nil
case "random":
fallthrough
default:
return &Balancer{
selectors: br.OutboundSelector,
strategy: &RandomStrategy{},
ohm: ohm,
}, nil
}
return &Balancer{
selectors: br.OutboundSelector,
strategy: &RandomStrategy{},
ohm: ohm,
}, nil
}

View File

@@ -1,12 +1,13 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.31.0
// protoc v4.23.1
// protoc-gen-go v1.25.0
// protoc v3.14.0
// source: app/router/config.proto
package router
import (
proto "github.com/golang/protobuf/proto"
net "github.com/xtls/xray-core/common/net"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
@@ -21,6 +22,10 @@ const (
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// This is a compile-time assertion that a sufficiently up-to-date version
// of the legacy proto package is being used.
const _ = proto.ProtoPackageIsVersion4
// Type of domain value.
type Domain_Type int32
@@ -264,9 +269,8 @@ type GeoIP struct {
sizeCache protoimpl.SizeCache
unknownFields protoimpl.UnknownFields
CountryCode string `protobuf:"bytes,1,opt,name=country_code,json=countryCode,proto3" json:"country_code,omitempty"`
Cidr []*CIDR `protobuf:"bytes,2,rep,name=cidr,proto3" json:"cidr,omitempty"`
ReverseMatch bool `protobuf:"varint,3,opt,name=reverse_match,json=reverseMatch,proto3" json:"reverse_match,omitempty"`
CountryCode string `protobuf:"bytes,1,opt,name=country_code,json=countryCode,proto3" json:"country_code,omitempty"`
Cidr []*CIDR `protobuf:"bytes,2,rep,name=cidr,proto3" json:"cidr,omitempty"`
}
func (x *GeoIP) Reset() {
@@ -315,13 +319,6 @@ func (x *GeoIP) GetCidr() []*CIDR {
return nil
}
func (x *GeoIP) GetReverseMatch() bool {
if x != nil {
return x.ReverseMatch
}
return false
}
type GeoIPList struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
@@ -477,7 +474,6 @@ type RoutingRule struct {
unknownFields protoimpl.UnknownFields
// Types that are assignable to TargetTag:
//
// *RoutingRule_Tag
// *RoutingRule_BalancingTag
TargetTag isRoutingRule_TargetTag `protobuf_oneof:"target_tag"`
@@ -486,7 +482,7 @@ type RoutingRule struct {
// List of CIDRs for target IP address matching.
// Deprecated. Use geoip below.
//
// Deprecated: Marked as deprecated in app/router/config.proto.
// Deprecated: Do not use.
Cidr []*CIDR `protobuf:"bytes,3,rep,name=cidr,proto3" json:"cidr,omitempty"`
// List of GeoIPs for target IP address matching. If this entry exists, the
// cidr above will have no effect. GeoIP fields with the same country code are
@@ -496,30 +492,29 @@ type RoutingRule struct {
// A range of port [from, to]. If the destination port is in this range, this
// rule takes effect. Deprecated. Use port_list.
//
// Deprecated: Marked as deprecated in app/router/config.proto.
// Deprecated: Do not use.
PortRange *net.PortRange `protobuf:"bytes,4,opt,name=port_range,json=portRange,proto3" json:"port_range,omitempty"`
// List of ports.
PortList *net.PortList `protobuf:"bytes,14,opt,name=port_list,json=portList,proto3" json:"port_list,omitempty"`
// List of networks. Deprecated. Use networks.
//
// Deprecated: Marked as deprecated in app/router/config.proto.
// Deprecated: Do not use.
NetworkList *net.NetworkList `protobuf:"bytes,5,opt,name=network_list,json=networkList,proto3" json:"network_list,omitempty"`
// List of networks for matching.
Networks []net.Network `protobuf:"varint,13,rep,packed,name=networks,proto3,enum=xray.common.net.Network" json:"networks,omitempty"`
// List of CIDRs for source IP address matching.
//
// Deprecated: Marked as deprecated in app/router/config.proto.
// Deprecated: Do not use.
SourceCidr []*CIDR `protobuf:"bytes,6,rep,name=source_cidr,json=sourceCidr,proto3" json:"source_cidr,omitempty"`
// List of GeoIPs for source IP address matching. If this entry exists, the
// source_cidr above will have no effect.
SourceGeoip []*GeoIP `protobuf:"bytes,11,rep,name=source_geoip,json=sourceGeoip,proto3" json:"source_geoip,omitempty"`
// List of ports for source port matching.
SourcePortList *net.PortList `protobuf:"bytes,16,opt,name=source_port_list,json=sourcePortList,proto3" json:"source_port_list,omitempty"`
UserEmail []string `protobuf:"bytes,7,rep,name=user_email,json=userEmail,proto3" json:"user_email,omitempty"`
InboundTag []string `protobuf:"bytes,8,rep,name=inbound_tag,json=inboundTag,proto3" json:"inbound_tag,omitempty"`
Protocol []string `protobuf:"bytes,9,rep,name=protocol,proto3" json:"protocol,omitempty"`
Attributes map[string]string `protobuf:"bytes,15,rep,name=attributes,proto3" json:"attributes,omitempty" protobuf_key:"bytes,1,opt,name=key,proto3" protobuf_val:"bytes,2,opt,name=value,proto3"`
DomainMatcher string `protobuf:"bytes,17,opt,name=domain_matcher,json=domainMatcher,proto3" json:"domain_matcher,omitempty"`
SourcePortList *net.PortList `protobuf:"bytes,16,opt,name=source_port_list,json=sourcePortList,proto3" json:"source_port_list,omitempty"`
UserEmail []string `protobuf:"bytes,7,rep,name=user_email,json=userEmail,proto3" json:"user_email,omitempty"`
InboundTag []string `protobuf:"bytes,8,rep,name=inbound_tag,json=inboundTag,proto3" json:"inbound_tag,omitempty"`
Protocol []string `protobuf:"bytes,9,rep,name=protocol,proto3" json:"protocol,omitempty"`
Attributes string `protobuf:"bytes,15,opt,name=attributes,proto3" json:"attributes,omitempty"`
}
func (x *RoutingRule) Reset() {
@@ -582,7 +577,7 @@ func (x *RoutingRule) GetDomain() []*Domain {
return nil
}
// Deprecated: Marked as deprecated in app/router/config.proto.
// Deprecated: Do not use.
func (x *RoutingRule) GetCidr() []*CIDR {
if x != nil {
return x.Cidr
@@ -597,7 +592,7 @@ func (x *RoutingRule) GetGeoip() []*GeoIP {
return nil
}
// Deprecated: Marked as deprecated in app/router/config.proto.
// Deprecated: Do not use.
func (x *RoutingRule) GetPortRange() *net.PortRange {
if x != nil {
return x.PortRange
@@ -612,7 +607,7 @@ func (x *RoutingRule) GetPortList() *net.PortList {
return nil
}
// Deprecated: Marked as deprecated in app/router/config.proto.
// Deprecated: Do not use.
func (x *RoutingRule) GetNetworkList() *net.NetworkList {
if x != nil {
return x.NetworkList
@@ -627,7 +622,7 @@ func (x *RoutingRule) GetNetworks() []net.Network {
return nil
}
// Deprecated: Marked as deprecated in app/router/config.proto.
// Deprecated: Do not use.
func (x *RoutingRule) GetSourceCidr() []*CIDR {
if x != nil {
return x.SourceCidr
@@ -670,17 +665,10 @@ func (x *RoutingRule) GetProtocol() []string {
return nil
}
func (x *RoutingRule) GetAttributes() map[string]string {
func (x *RoutingRule) GetAttributes() string {
if x != nil {
return x.Attributes
}
return nil
}
func (x *RoutingRule) GetDomainMatcher() string {
if x != nil {
return x.DomainMatcher
}
return ""
}
@@ -709,7 +697,6 @@ type BalancingRule struct {
Tag string `protobuf:"bytes,1,opt,name=tag,proto3" json:"tag,omitempty"`
OutboundSelector []string `protobuf:"bytes,2,rep,name=outbound_selector,json=outboundSelector,proto3" json:"outbound_selector,omitempty"`
Strategy string `protobuf:"bytes,3,opt,name=strategy,proto3" json:"strategy,omitempty"`
}
func (x *BalancingRule) Reset() {
@@ -758,13 +745,6 @@ func (x *BalancingRule) GetOutboundSelector() []string {
return nil
}
func (x *BalancingRule) GetStrategy() string {
if x != nil {
return x.Strategy
}
return ""
}
type Config struct {
state protoimpl.MessageState
sizeCache protoimpl.SizeCache
@@ -835,7 +815,6 @@ type Domain_Attribute struct {
Key string `protobuf:"bytes,1,opt,name=key,proto3" json:"key,omitempty"`
// Types that are assignable to TypedValue:
//
// *Domain_Attribute_BoolValue
// *Domain_Attribute_IntValue
TypedValue isDomain_Attribute_TypedValue `protobuf_oneof:"typed_value"`
@@ -948,116 +927,103 @@ var file_app_router_config_proto_rawDesc = []byte{
0x03, 0x22, 0x2e, 0x0a, 0x04, 0x43, 0x49, 0x44, 0x52, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x70, 0x18,
0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x70, 0x12, 0x16, 0x0a, 0x06, 0x70, 0x72, 0x65,
0x66, 0x69, 0x78, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x06, 0x70, 0x72, 0x65, 0x66, 0x69,
0x78, 0x22, 0x7a, 0x0a, 0x05, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x12, 0x21, 0x0a, 0x0c, 0x63, 0x6f,
0x78, 0x22, 0x55, 0x0a, 0x05, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x12, 0x21, 0x0a, 0x0c, 0x63, 0x6f,
0x75, 0x6e, 0x74, 0x72, 0x79, 0x5f, 0x63, 0x6f, 0x64, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09,
0x52, 0x0b, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x72, 0x79, 0x43, 0x6f, 0x64, 0x65, 0x12, 0x29, 0x0a,
0x04, 0x63, 0x69, 0x64, 0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x15, 0x2e, 0x78, 0x72,
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x49,
0x44, 0x52, 0x52, 0x04, 0x63, 0x69, 0x64, 0x72, 0x12, 0x23, 0x0a, 0x0d, 0x72, 0x65, 0x76, 0x65,
0x72, 0x73, 0x65, 0x5f, 0x6d, 0x61, 0x74, 0x63, 0x68, 0x18, 0x03, 0x20, 0x01, 0x28, 0x08, 0x52,
0x0c, 0x72, 0x65, 0x76, 0x65, 0x72, 0x73, 0x65, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x22, 0x39, 0x0a,
0x09, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x2c, 0x0a, 0x05, 0x65, 0x6e,
0x74, 0x72, 0x79, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79,
0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49,
0x50, 0x52, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x22, 0x5d, 0x0a, 0x07, 0x47, 0x65, 0x6f, 0x53,
0x69, 0x74, 0x65, 0x12, 0x21, 0x0a, 0x0c, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x72, 0x79, 0x5f, 0x63,
0x6f, 0x64, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0b, 0x63, 0x6f, 0x75, 0x6e, 0x74,
0x72, 0x79, 0x43, 0x6f, 0x64, 0x65, 0x12, 0x2f, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x17, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52,
0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x22, 0x3d, 0x0a, 0x0b, 0x47, 0x65, 0x6f, 0x53, 0x69,
0x74, 0x65, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x2e, 0x0a, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x18,
0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x52,
0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x22, 0xa2, 0x07, 0x0a, 0x0b, 0x52, 0x6f, 0x75, 0x74, 0x69,
0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x12, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20,
0x01, 0x28, 0x09, 0x48, 0x00, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x25, 0x0a, 0x0d, 0x62, 0x61,
0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x0c, 0x20, 0x01, 0x28,
0x09, 0x48, 0x00, 0x52, 0x0c, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x54, 0x61,
0x67, 0x12, 0x2f, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18, 0x02, 0x20, 0x03, 0x28,
0x44, 0x52, 0x52, 0x04, 0x63, 0x69, 0x64, 0x72, 0x22, 0x39, 0x0a, 0x09, 0x47, 0x65, 0x6f, 0x49,
0x50, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x2c, 0x0a, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x18, 0x01,
0x20, 0x03, 0x28, 0x0b, 0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e,
0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x05, 0x65, 0x6e,
0x74, 0x72, 0x79, 0x22, 0x5d, 0x0a, 0x07, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x12, 0x21,
0x0a, 0x0c, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x72, 0x79, 0x5f, 0x63, 0x6f, 0x64, 0x65, 0x18, 0x01,
0x20, 0x01, 0x28, 0x09, 0x52, 0x0b, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x72, 0x79, 0x43, 0x6f, 0x64,
0x65, 0x12, 0x2f, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18, 0x02, 0x20, 0x03, 0x28,
0x0b, 0x32, 0x17, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75,
0x74, 0x65, 0x72, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61,
0x69, 0x6e, 0x12, 0x2d, 0x0a, 0x04, 0x63, 0x69, 0x64, 0x72, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b,
0x32, 0x15, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
0x65, 0x72, 0x2e, 0x43, 0x49, 0x44, 0x52, 0x42, 0x02, 0x18, 0x01, 0x52, 0x04, 0x63, 0x69, 0x64,
0x72, 0x12, 0x2c, 0x0a, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x0a, 0x20, 0x03, 0x28, 0x0b,
0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x12,
0x3d, 0x0a, 0x0a, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x72, 0x61, 0x6e, 0x67, 0x65, 0x18, 0x04, 0x20,
0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f,
0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x42,
0x02, 0x18, 0x01, 0x52, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x12, 0x36,
0x0a, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x6c, 0x69, 0x73, 0x74, 0x18, 0x0e, 0x20, 0x01, 0x28,
0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e,
0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x08, 0x70, 0x6f,
0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x43, 0x0a, 0x0c, 0x6e, 0x65, 0x74, 0x77, 0x6f, 0x72,
0x6b, 0x5f, 0x6c, 0x69, 0x73, 0x74, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78,
0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x4e,
0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b, 0x4c, 0x69, 0x73, 0x74, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0b,
0x6e, 0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x34, 0x0a, 0x08, 0x6e,
0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b, 0x73, 0x18, 0x0d, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x18, 0x2e,
0x69, 0x6e, 0x22, 0x3d, 0x0a, 0x0b, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x4c, 0x69, 0x73,
0x74, 0x12, 0x2e, 0x0a, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b,
0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x52, 0x05, 0x65, 0x6e, 0x74, 0x72,
0x79, 0x22, 0x8e, 0x06, 0x0a, 0x0b, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
0x65, 0x12, 0x12, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00,
0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x25, 0x0a, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69,
0x6e, 0x67, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x0c, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00, 0x52, 0x0c,
0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x54, 0x61, 0x67, 0x12, 0x2f, 0x0a, 0x06,
0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x17, 0x2e, 0x78,
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x44,
0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x12, 0x2d, 0x0a,
0x04, 0x63, 0x69, 0x64, 0x72, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x15, 0x2e, 0x78, 0x72,
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x49,
0x44, 0x52, 0x42, 0x02, 0x18, 0x01, 0x52, 0x04, 0x63, 0x69, 0x64, 0x72, 0x12, 0x2c, 0x0a, 0x05,
0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x0a, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x16, 0x2e, 0x78, 0x72,
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x47, 0x65,
0x6f, 0x49, 0x50, 0x52, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x12, 0x3d, 0x0a, 0x0a, 0x70, 0x6f,
0x72, 0x74, 0x5f, 0x72, 0x61, 0x6e, 0x67, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a,
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74,
0x2e, 0x50, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x42, 0x02, 0x18, 0x01, 0x52, 0x09,
0x70, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x12, 0x36, 0x0a, 0x09, 0x70, 0x6f, 0x72,
0x74, 0x5f, 0x6c, 0x69, 0x73, 0x74, 0x18, 0x0e, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78,
0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50,
0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x08, 0x70, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73,
0x74, 0x12, 0x43, 0x0a, 0x0c, 0x6e, 0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b, 0x5f, 0x6c, 0x69, 0x73,
0x74, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63,
0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x4e, 0x65, 0x74, 0x77, 0x6f, 0x72,
0x6b, 0x4c, 0x69, 0x73, 0x74, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0b, 0x6e, 0x65, 0x74, 0x77, 0x6f,
0x72, 0x6b, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x34, 0x0a, 0x08, 0x6e, 0x65, 0x74, 0x77, 0x6f, 0x72,
0x6b, 0x73, 0x18, 0x0d, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x4e, 0x65, 0x74, 0x77, 0x6f,
0x72, 0x6b, 0x52, 0x08, 0x6e, 0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b, 0x73, 0x12, 0x3a, 0x0a, 0x0b,
0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x5f, 0x63, 0x69, 0x64, 0x72, 0x18, 0x06, 0x20, 0x03, 0x28,
0x0b, 0x32, 0x15, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75,
0x74, 0x65, 0x72, 0x2e, 0x43, 0x49, 0x44, 0x52, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0a, 0x73, 0x6f,
0x75, 0x72, 0x63, 0x65, 0x43, 0x69, 0x64, 0x72, 0x12, 0x39, 0x0a, 0x0c, 0x73, 0x6f, 0x75, 0x72,
0x63, 0x65, 0x5f, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x0b, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x16,
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72,
0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x0b, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x47, 0x65,
0x6f, 0x69, 0x70, 0x12, 0x43, 0x0a, 0x10, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x5f, 0x70, 0x6f,
0x72, 0x74, 0x5f, 0x6c, 0x69, 0x73, 0x74, 0x18, 0x10, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e,
0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e,
0x4e, 0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b, 0x52, 0x08, 0x6e, 0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b,
0x73, 0x12, 0x3a, 0x0a, 0x0b, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x5f, 0x63, 0x69, 0x64, 0x72,
0x18, 0x06, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x15, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x49, 0x44, 0x52, 0x42, 0x02, 0x18,
0x01, 0x52, 0x0a, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x43, 0x69, 0x64, 0x72, 0x12, 0x39, 0x0a,
0x0c, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x5f, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x0b, 0x20,
0x03, 0x28, 0x0b, 0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72,
0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x0b, 0x73, 0x6f, 0x75,
0x72, 0x63, 0x65, 0x47, 0x65, 0x6f, 0x69, 0x70, 0x12, 0x43, 0x0a, 0x10, 0x73, 0x6f, 0x75, 0x72,
0x63, 0x65, 0x5f, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x6c, 0x69, 0x73, 0x74, 0x18, 0x10, 0x20, 0x01,
0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e,
0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x0e, 0x73,
0x6f, 0x75, 0x72, 0x63, 0x65, 0x50, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x1d, 0x0a,
0x0a, 0x75, 0x73, 0x65, 0x72, 0x5f, 0x65, 0x6d, 0x61, 0x69, 0x6c, 0x18, 0x07, 0x20, 0x03, 0x28,
0x09, 0x52, 0x09, 0x75, 0x73, 0x65, 0x72, 0x45, 0x6d, 0x61, 0x69, 0x6c, 0x12, 0x1f, 0x0a, 0x0b,
0x69, 0x6e, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x08, 0x20, 0x03, 0x28,
0x09, 0x52, 0x0a, 0x69, 0x6e, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x54, 0x61, 0x67, 0x12, 0x1a, 0x0a,
0x08, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x18, 0x09, 0x20, 0x03, 0x28, 0x09, 0x52,
0x08, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x12, 0x4c, 0x0a, 0x0a, 0x61, 0x74, 0x74,
0x72, 0x69, 0x62, 0x75, 0x74, 0x65, 0x73, 0x18, 0x0f, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2c, 0x2e,
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e,
0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x2e, 0x41, 0x74, 0x74, 0x72,
0x69, 0x62, 0x75, 0x74, 0x65, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x52, 0x0a, 0x61, 0x74, 0x74,
0x72, 0x69, 0x62, 0x75, 0x74, 0x65, 0x73, 0x12, 0x25, 0x0a, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69,
0x6e, 0x5f, 0x6d, 0x61, 0x74, 0x63, 0x68, 0x65, 0x72, 0x18, 0x11, 0x20, 0x01, 0x28, 0x09, 0x52,
0x0d, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x65, 0x72, 0x1a, 0x3d,
0x0a, 0x0f, 0x41, 0x74, 0x74, 0x72, 0x69, 0x62, 0x75, 0x74, 0x65, 0x73, 0x45, 0x6e, 0x74, 0x72,
0x79, 0x12, 0x10, 0x0a, 0x03, 0x6b, 0x65, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03,
0x6b, 0x65, 0x79, 0x12, 0x14, 0x0a, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01,
0x28, 0x09, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38, 0x01, 0x42, 0x0c, 0x0a,
0x0a, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74, 0x61, 0x67, 0x22, 0x6a, 0x0a, 0x0d, 0x42,
0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x10, 0x0a, 0x03,
0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x2b,
0x0a, 0x11, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63,
0x74, 0x6f, 0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09, 0x52, 0x10, 0x6f, 0x75, 0x74, 0x62, 0x6f,
0x75, 0x6e, 0x64, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x12, 0x1a, 0x0a, 0x08, 0x73,
0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x73,
0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x22, 0x9b, 0x02, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66,
0x69, 0x67, 0x12, 0x4f, 0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x73, 0x74, 0x72,
0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x26, 0x2e, 0x78, 0x72,
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x6f,
0x6e, 0x66, 0x69, 0x67, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74,
0x65, 0x67, 0x79, 0x52, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74,
0x65, 0x67, 0x79, 0x12, 0x30, 0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x02, 0x20, 0x03, 0x28,
0x0b, 0x32, 0x1c, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75,
0x74, 0x65, 0x72, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52,
0x04, 0x72, 0x75, 0x6c, 0x65, 0x12, 0x45, 0x0a, 0x0e, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69,
0x6e, 0x67, 0x5f, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1e, 0x2e,
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e,
0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x0d, 0x62,
0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x22, 0x47, 0x0a, 0x0e,
0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x08,
0x0a, 0x04, 0x41, 0x73, 0x49, 0x73, 0x10, 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55, 0x73, 0x65, 0x49,
0x70, 0x10, 0x01, 0x12, 0x10, 0x0a, 0x0c, 0x49, 0x70, 0x49, 0x66, 0x4e, 0x6f, 0x6e, 0x4d, 0x61,
0x74, 0x63, 0x68, 0x10, 0x02, 0x12, 0x0e, 0x0a, 0x0a, 0x49, 0x70, 0x4f, 0x6e, 0x44, 0x65, 0x6d,
0x61, 0x6e, 0x64, 0x10, 0x03, 0x42, 0x4f, 0x0a, 0x13, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61,
0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x50, 0x01, 0x5a, 0x24,
0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f,
0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x72, 0x6f,
0x75, 0x74, 0x65, 0x72, 0xaa, 0x02, 0x0f, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e,
0x52, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
0x50, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x0e, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65,
0x50, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x1d, 0x0a, 0x0a, 0x75, 0x73, 0x65, 0x72,
0x5f, 0x65, 0x6d, 0x61, 0x69, 0x6c, 0x18, 0x07, 0x20, 0x03, 0x28, 0x09, 0x52, 0x09, 0x75, 0x73,
0x65, 0x72, 0x45, 0x6d, 0x61, 0x69, 0x6c, 0x12, 0x1f, 0x0a, 0x0b, 0x69, 0x6e, 0x62, 0x6f, 0x75,
0x6e, 0x64, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x08, 0x20, 0x03, 0x28, 0x09, 0x52, 0x0a, 0x69, 0x6e,
0x62, 0x6f, 0x75, 0x6e, 0x64, 0x54, 0x61, 0x67, 0x12, 0x1a, 0x0a, 0x08, 0x70, 0x72, 0x6f, 0x74,
0x6f, 0x63, 0x6f, 0x6c, 0x18, 0x09, 0x20, 0x03, 0x28, 0x09, 0x52, 0x08, 0x70, 0x72, 0x6f, 0x74,
0x6f, 0x63, 0x6f, 0x6c, 0x12, 0x1e, 0x0a, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62, 0x75, 0x74,
0x65, 0x73, 0x18, 0x0f, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62,
0x75, 0x74, 0x65, 0x73, 0x42, 0x0c, 0x0a, 0x0a, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74,
0x61, 0x67, 0x22, 0x4e, 0x0a, 0x0d, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52,
0x75, 0x6c, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09,
0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x2b, 0x0a, 0x11, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e,
0x64, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09,
0x52, 0x10, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74,
0x6f, 0x72, 0x22, 0x9b, 0x02, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x4f, 0x0a,
0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x26, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e,
0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0e,
0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x30,
0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78,
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x52,
0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x04, 0x72, 0x75, 0x6c, 0x65,
0x12, 0x45, 0x0a, 0x0e, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x5f, 0x72, 0x75,
0x6c, 0x65, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1e, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e,
0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63,
0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x22, 0x47, 0x0a, 0x0e, 0x44, 0x6f, 0x6d, 0x61, 0x69,
0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x08, 0x0a, 0x04, 0x41, 0x73, 0x49,
0x73, 0x10, 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55, 0x73, 0x65, 0x49, 0x70, 0x10, 0x01, 0x12, 0x10,
0x0a, 0x0c, 0x49, 0x70, 0x49, 0x66, 0x4e, 0x6f, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x10, 0x02,
0x12, 0x0e, 0x0a, 0x0a, 0x49, 0x70, 0x4f, 0x6e, 0x44, 0x65, 0x6d, 0x61, 0x6e, 0x64, 0x10, 0x03,
0x42, 0x4f, 0x0a, 0x13, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x50, 0x01, 0x5a, 0x24, 0x67, 0x69, 0x74, 0x68, 0x75,
0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d,
0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0xaa,
0x02, 0x0f, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x65,
0x72, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
}
var (
@@ -1073,7 +1039,7 @@ func file_app_router_config_proto_rawDescGZIP() []byte {
}
var file_app_router_config_proto_enumTypes = make([]protoimpl.EnumInfo, 2)
var file_app_router_config_proto_msgTypes = make([]protoimpl.MessageInfo, 11)
var file_app_router_config_proto_msgTypes = make([]protoimpl.MessageInfo, 10)
var file_app_router_config_proto_goTypes = []interface{}{
(Domain_Type)(0), // 0: xray.app.router.Domain.Type
(Config_DomainStrategy)(0), // 1: xray.app.router.Config.DomainStrategy
@@ -1087,11 +1053,10 @@ var file_app_router_config_proto_goTypes = []interface{}{
(*BalancingRule)(nil), // 9: xray.app.router.BalancingRule
(*Config)(nil), // 10: xray.app.router.Config
(*Domain_Attribute)(nil), // 11: xray.app.router.Domain.Attribute
nil, // 12: xray.app.router.RoutingRule.AttributesEntry
(*net.PortRange)(nil), // 13: xray.common.net.PortRange
(*net.PortList)(nil), // 14: xray.common.net.PortList
(*net.NetworkList)(nil), // 15: xray.common.net.NetworkList
(net.Network)(0), // 16: xray.common.net.Network
(*net.PortRange)(nil), // 12: xray.common.net.PortRange
(*net.PortList)(nil), // 13: xray.common.net.PortList
(*net.NetworkList)(nil), // 14: xray.common.net.NetworkList
(net.Network)(0), // 15: xray.common.net.Network
}
var file_app_router_config_proto_depIdxs = []int32{
0, // 0: xray.app.router.Domain.type:type_name -> xray.app.router.Domain.Type
@@ -1103,22 +1068,21 @@ var file_app_router_config_proto_depIdxs = []int32{
2, // 6: xray.app.router.RoutingRule.domain:type_name -> xray.app.router.Domain
3, // 7: xray.app.router.RoutingRule.cidr:type_name -> xray.app.router.CIDR
4, // 8: xray.app.router.RoutingRule.geoip:type_name -> xray.app.router.GeoIP
13, // 9: xray.app.router.RoutingRule.port_range:type_name -> xray.common.net.PortRange
14, // 10: xray.app.router.RoutingRule.port_list:type_name -> xray.common.net.PortList
15, // 11: xray.app.router.RoutingRule.network_list:type_name -> xray.common.net.NetworkList
16, // 12: xray.app.router.RoutingRule.networks:type_name -> xray.common.net.Network
12, // 9: xray.app.router.RoutingRule.port_range:type_name -> xray.common.net.PortRange
13, // 10: xray.app.router.RoutingRule.port_list:type_name -> xray.common.net.PortList
14, // 11: xray.app.router.RoutingRule.network_list:type_name -> xray.common.net.NetworkList
15, // 12: xray.app.router.RoutingRule.networks:type_name -> xray.common.net.Network
3, // 13: xray.app.router.RoutingRule.source_cidr:type_name -> xray.app.router.CIDR
4, // 14: xray.app.router.RoutingRule.source_geoip:type_name -> xray.app.router.GeoIP
14, // 15: xray.app.router.RoutingRule.source_port_list:type_name -> xray.common.net.PortList
12, // 16: xray.app.router.RoutingRule.attributes:type_name -> xray.app.router.RoutingRule.AttributesEntry
1, // 17: xray.app.router.Config.domain_strategy:type_name -> xray.app.router.Config.DomainStrategy
8, // 18: xray.app.router.Config.rule:type_name -> xray.app.router.RoutingRule
9, // 19: xray.app.router.Config.balancing_rule:type_name -> xray.app.router.BalancingRule
20, // [20:20] is the sub-list for method output_type
20, // [20:20] is the sub-list for method input_type
20, // [20:20] is the sub-list for extension type_name
20, // [20:20] is the sub-list for extension extendee
0, // [0:20] is the sub-list for field type_name
13, // 15: xray.app.router.RoutingRule.source_port_list:type_name -> xray.common.net.PortList
1, // 16: xray.app.router.Config.domain_strategy:type_name -> xray.app.router.Config.DomainStrategy
8, // 17: xray.app.router.Config.rule:type_name -> xray.app.router.RoutingRule
9, // 18: xray.app.router.Config.balancing_rule:type_name -> xray.app.router.BalancingRule
19, // [19:19] is the sub-list for method output_type
19, // [19:19] is the sub-list for method input_type
19, // [19:19] is the sub-list for extension type_name
19, // [19:19] is the sub-list for extension extendee
0, // [0:19] is the sub-list for field type_name
}
func init() { file_app_router_config_proto_init() }
@@ -1262,7 +1226,7 @@ func file_app_router_config_proto_init() {
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: file_app_router_config_proto_rawDesc,
NumEnums: 2,
NumMessages: 11,
NumMessages: 10,
NumExtensions: 0,
NumServices: 0,
},

Some files were not shown because too many files have changed in this diff Show More