v1.5.0

Bumps [github.com/lucas-clemente/quic-go](https://github.com/lucas-clemente/quic-go) from 0.23.0 to 0.24.0.
- [Release notes](https://github.com/lucas-clemente/quic-go/releases)
- [Changelog](https://github.com/lucas-clemente/quic-go/blob/master/Changelog.md)
- [Commits](https://github.com/lucas-clemente/quic-go/compare/v0.23.0...v0.24.0)

---
updated-dependencies:
- dependency-name: github.com/lucas-clemente/quic-go
  dependency-type: direct:production
  update-type: version-update:semver-minor
...

Signed-off-by: dependabot[bot] <support@github.com>

Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com>

.github/build/friendly-filenames.json

@@ -0,0 +1,34 @@
+{
+  "android-arm64": { "friendlyName": "android-arm64-v8a" },
+  "darwin-amd64": { "friendlyName": "macos-64" },
+  "darwin-arm64": { "friendlyName": "macos-arm64-v8a" },
+  "dragonfly-amd64": { "friendlyName": "dragonfly-64" },
+  "freebsd-386": { "friendlyName": "freebsd-32" },
+  "freebsd-amd64": { "friendlyName": "freebsd-64" },
+  "freebsd-arm64": { "friendlyName": "freebsd-arm64-v8a" },
+  "freebsd-arm7": { "friendlyName": "freebsd-arm32-v7a" },
+  "linux-386": { "friendlyName": "linux-32" },
+  "linux-amd64": { "friendlyName": "linux-64" },
+  "linux-arm5": { "friendlyName": "linux-arm32-v5" },
+  "linux-arm64": { "friendlyName": "linux-arm64-v8a" },
+  "linux-arm6": { "friendlyName": "linux-arm32-v6" },
+  "linux-arm7": { "friendlyName": "linux-arm32-v7a" },
+  "linux-mips64le": { "friendlyName": "linux-mips64le" },
+  "linux-mips64": { "friendlyName": "linux-mips64" },
+  "linux-mipslesoftfloat": { "friendlyName": "linux-mips32le-softfloat" },
+  "linux-mipsle": { "friendlyName": "linux-mips32le" },
+  "linux-mipssoftfloat": { "friendlyName": "linux-mips32-softfloat" },
+  "linux-mips": { "friendlyName": "linux-mips32" },
+  "linux-ppc64le": { "friendlyName": "linux-ppc64le" },
+  "linux-ppc64": { "friendlyName": "linux-ppc64" },
+  "linux-riscv64": { "friendlyName": "linux-riscv64" },
+  "linux-s390x": { "friendlyName": "linux-s390x" },
+  "openbsd-386": { "friendlyName": "openbsd-32" },
+  "openbsd-amd64": { "friendlyName": "openbsd-64" },
+  "openbsd-arm64": { "friendlyName": "openbsd-arm64-v8a" },
+  "openbsd-arm7": { "friendlyName": "openbsd-arm32-v7a" },
+  "windows-386": { "friendlyName": "windows-32" },
+  "windows-amd64": { "friendlyName": "windows-64" },
+  "windows-arm64": { "friendlyName": "windows-arm64-v8a" },
+  "windows-arm7": { "friendlyName": "windows-arm32-v7a" }
+}

.github/dependabot.yml

@@ -0,0 +1,11 @@
+# To get started with Dependabot version updates, you'll need to specify which
+# package ecosystems to update and where the package manifests are located.
+# Please see the documentation for all configuration options:
+# https://help.github.com/github/administering-a-repository/configuration-options-for-dependency-updates
+
+version: 2
+updates:
+  - package-ecosystem: "gomod"
+    directory: "/" # Location of package manifests
+    schedule:
+      interval: "daily"

.github/workflows/release.yml

@@ -0,0 +1,206 @@
+name: Build and Release
+
+on:
+  workflow_dispatch:
+  release:
+    types: [published]
+  push:
+    branches:
+      - main
+    paths:
+      - "**/*.go"
+      - "go.mod"
+      - "go.sum"
+      - ".github/workflows/*.yml"
+  pull_request:
+    types: [opened, synchronize, reopened]
+    paths:
+      - "**/*.go"
+      - "go.mod"
+      - "go.sum"
+      - ".github/workflows/*.yml"
+jobs:
+  build:
+    strategy:
+      matrix:
+        # Include amd64 on all platforms.
+        goos: [windows, freebsd, openbsd, linux, dragonfly, darwin]
+        goarch: [amd64, 386]
+        exclude:
+          # Exclude i386 on darwin and dragonfly.
+          - goarch: 386
+            goos: dragonfly
+          - goarch: 386
+            goos: darwin
+        include:
+          # BEIGIN MacOS ARM64
+          - goos: darwin
+            goarch: arm64
+          # END MacOS ARM64
+          # BEGIN Linux ARM 5 6 7
+          - goos: linux
+            goarch: arm
+            goarm: 7
+          - goos: linux
+            goarch: arm
+            goarm: 6
+          - goos: linux
+            goarch: arm
+            goarm: 5
+          # END Linux ARM 5 6 7
+          # BEGIN Android ARM 8
+          - goos: android
+            goarch: arm64
+          # END Android ARM 8
+          # Windows ARM
+          - goos: windows
+            goarch: arm64
+          - goos: windows
+            goarch: arm
+            goarm: 7
+          # BEGIN Other architectures
+          # BEGIN riscv64 & ARM64
+          - goos: linux
+            goarch: arm64
+          - goos: linux
+            goarch: riscv64
+          # END riscv64 & ARM64
+          # BEGIN MIPS
+          - goos: linux
+            goarch: mips64
+          - goos: linux
+            goarch: mips64le
+          - goos: linux
+            goarch: mipsle
+          - goos: linux
+            goarch: mips
+          # END MIPS
+          # BEGIN PPC
+          - goos: linux
+            goarch: ppc64
+          - goos: linux
+            goarch: ppc64le
+          # END PPC
+          # BEGIN FreeBSD ARM
+          - goos: freebsd
+            goarch: arm64
+          - goos: freebsd
+            goarch: arm
+            goarm: 7
+          # END FreeBSD ARM
+          # BEGIN S390X
+          - goos: linux
+            goarch: s390x
+          # END S390X
+          # END Other architectures
+          # BEGIN OPENBSD ARM
+          - goos: openbsd
+            goarch: arm64
+          - goos: openbsd
+            goarch: arm
+            goarm: 7
+          # END OPENBSD ARM
+      fail-fast: false
+
+    runs-on: ubuntu-latest
+    env:
+      GOOS: ${{ matrix.goos }}
+      GOARCH: ${{ matrix.goarch }}
+      GOARM: ${{ matrix.goarm }}
+      CGO_ENABLED: 0
+    steps:
+      - name: Checkout codebase
+        uses: actions/checkout@v2
+
+      - name: Show workflow information 
+        id: get_filename
+        run: |
+          export _NAME=$(jq ".[\"$GOOS-$GOARCH$GOARM$GOMIPS\"].friendlyName" -r < .github/build/friendly-filenames.json)
+          echo "GOOS: $GOOS, GOARCH: $GOARCH, GOARM: $GOARM, GOMIPS: $GOMIPS, RELEASE_NAME: $_NAME"
+          echo "::set-output name=ASSET_NAME::$_NAME"
+          echo "ASSET_NAME=$_NAME" >> $GITHUB_ENV
+
+      - name: Set up Go
+        uses: actions/setup-go@v2
+        with:
+          go-version: ^1.17.2
+
+      - name: Get project dependencies
+        run: go mod download
+      
+      - name: Replace Custom to Commit ID
+        if: github.event_name != 'release'
+        run: |
+          ID=$(git rev-parse --short ${{ github.sha }})
+          if [ "${{ github.event_name }}" == 'pull_request' ]
+          then
+            ID=$(git rev-parse --short ${{ github.event.pull_request.head.sha }})
+          fi
+          sed -i '/build/ s/Custom/'$ID'/' ./core/core.go
+ 
+      - name: Build Xray
+        run: |
+          mkdir -p build_assets
+          go build -v -o build_assets/xray -trimpath -ldflags "-s -w -buildid=" ./main
+    
+      - name: Build Mips softfloat Xray
+        if: matrix.goarch == 'mips' || matrix.goarch == 'mipsle'
+        run: |
+          GOMIPS=softfloat go build -v -o build_assets/xray_softfloat -trimpath -ldflags "-s -w -buildid=" ./main
+
+      - name: Rename Windows Xray
+        if: matrix.goos == 'windows'
+        run: |
+          cd ./build_assets || exit 1
+          mv xray xray.exe
+
+      - name: Prepare to release
+        run: |
+          cp ${GITHUB_WORKSPACE}/README.md ./build_assets/README.md
+          cp ${GITHUB_WORKSPACE}/LICENSE ./build_assets/LICENSE
+          LIST=('geoip geoip geoip' 'domain-list-community dlc geosite')
+          for i in "${LIST[@]}"
+          do
+            INFO=($(echo $i | awk 'BEGIN{FS=" ";OFS=" "} {print $1,$2,$3}'))
+            LASTEST_TAG="$(curl -sL "https://api.github.com/repos/v2fly/${INFO[0]}/releases" | jq -r ".[0].tag_name" || echo "latest")"
+            FILE_NAME="${INFO[2]}.dat"
+            echo -e "Downloading ${FILE_NAME}..."
+            curl -L "https://github.com/v2fly/${INFO[0]}/releases/download/${LASTEST_TAG}/${INFO[1]}.dat" -o ./build_assets/${FILE_NAME}
+            echo -e "Verifying HASH key..."
+            HASH="$(curl -sL "https://github.com/v2fly/${INFO[0]}/releases/download/${LASTEST_TAG}/${INFO[1]}.dat.sha256sum" | awk -F ' ' '{print $1}')"
+            [ "$(sha256sum "./build_assets/${FILE_NAME}" | awk -F ' ' '{print $1}')" == "${HASH}" ] || { echo -e "The HASH key of ${FILE_NAME} does not match cloud one."; exit 1; }
+          done
+
+      - name: Create ZIP archive
+        shell: bash
+        run: |
+          pushd build_assets || exit 1
+          touch -mt $(date +%Y01010000) *
+          zip -9vr ../Xray-$ASSET_NAME.zip .
+          popd || exit 1
+          FILE=./Xray-$ASSET_NAME.zip
+          DGST=$FILE.dgst
+          for METHOD in {"md5","sha1","sha256","sha512"}
+          do
+            openssl dgst -$METHOD $FILE | sed 's/([^)]*)//g' >>$DGST
+          done
+
+      - name: Change the name
+        run: |
+          mv build_assets Xray-$ASSET_NAME
+
+      - name: Upload files to Artifacts
+        uses: actions/upload-artifact@v2
+        with:
+          name: Xray-${{ steps.get_filename.outputs.ASSET_NAME }}
+          path: |
+            ./Xray-${{ steps.get_filename.outputs.ASSET_NAME }}/*
+
+      - name: Upload binaries to release
+        uses: svenstaro/upload-release-action@v2
+        if: github.event_name == 'release'
+        with:
+          repo_token: ${{ secrets.GITHUB_TOKEN }}
+          file: ./Xray-${{ steps.get_filename.outputs.ASSET_NAME }}.zip*
+          tag: ${{ github.ref }}
+          file_glob: true

.github/workflows/test.yml

@@ -0,0 +1,48 @@
+name: Test
+
+on:
+  push:
+    branches:
+      - main
+    paths:
+      - "**/*.go"
+      - "go.mod"
+      - "go.sum"
+      - ".github/workflows/*.yml"
+  pull_request:
+    types: [opened, synchronize, reopened]
+    paths:
+      - "**/*.go"
+      - "go.mod"
+      - "go.sum"
+      - ".github/workflows/*.yml"
+
+jobs:
+  test:
+    runs-on: ${{ matrix.os }}
+    strategy:
+      fail-fast: false
+      matrix:
+        os: [windows-latest, ubuntu-latest, macos-latest]
+    steps:
+      - name: Set up Go
+        uses: actions/setup-go@v2
+        with:
+          go-version: ^1.17.2
+      - name: Checkout codebase
+        uses: actions/checkout@v2
+
+      - name: Prepare geo*dat
+        if: ${{ matrix.os != 'windows-latest' }}
+        run: |
+          mkdir resources
+          wget -O ./resources/geoip.dat https://github.com/v2fly/geoip/releases/latest/download/geoip.dat
+          wget -O ./resources/geosite.dat https://github.com/v2fly/domain-list-community/releases/latest/download/dlc.dat
+      - name: Prepare geo*dat for Windows
+        if: ${{ matrix.os == 'windows-latest' }}
+        run: |
+          mkdir resources
+          Invoke-WebRequest -Uri "https://github.com/v2fly/geoip/releases/latest/download/geoip.dat" -OutFile "./resources/geoip.dat"
+          Invoke-WebRequest -Uri "https://github.com/v2fly/domain-list-community/releases/latest/download/dlc.dat" -OutFile "./resources/geosite.dat"
+      - name: Test
+        run: go test -timeout 1h -v ./...

README.md

@@ -17,12 +17,15 @@
 - One Click
   - [ProxySU](https://github.com/proxysu/ProxySU)
   - [v2ray-agent](https://github.com/mack-a/v2ray-agent)
+  - [Xray-yes](https://github.com/jiuqi9997/Xray-yes)
+  - [Xray_onekey](https://github.com/wulabing/Xray_onekey)
 - Magisk
   - [Xray4Magisk](https://github.com/CerteKim/Xray4Magisk)
   - [Xray_For_Magisk](https://github.com/E7KMbb/Xray_For_Magisk)
 - Homebrew
-  - [Repository 0](https://github.com/N4FA/homebrew-xray)
-  - [Repository 1](https://github.com/xiruizhao/homebrew-xray)
+  - `brew install xray`
+  - [(Tap) Repository 0](https://github.com/N4FA/homebrew-xray)
+  - [(Tap) Repository 1](https://github.com/xiruizhao/homebrew-xray)
 
 ## Usage
 
@@ -37,12 +40,16 @@
   - [luci-app-xray](https://github.com/yichya/luci-app-xray) ([openwrt-xray](https://github.com/yichya/openwrt-xray))
 - Windows
   - [v2rayN](https://github.com/2dust/v2rayN)
-  - [Qv2ray](https://github.com/Qv2ray/Qv2ray)
+  - [Qv2ray](https://github.com/Qv2ray/Qv2ray)  (This project had been archived and currently inactive)
+  - [Netch (NetFilter & TUN/TAP)](https://github.com/NetchX/Netch)
 - Android
   - [v2rayNG](https://github.com/2dust/v2rayNG)
+  - [AnXray](https://github.com/XTLS/AnXray)
   - [Kitsunebi](https://github.com/rurirei/Kitsunebi/tree/release_xtls)
-- iOS / Mac
+- iOS & macOS (with M1 chip)
   - [Shadowrocket](https://apps.apple.com/app/shadowrocket/id932747118)
+- macOS (Intel chip & M1 chip)
+  - [Qv2ray](https://github.com/Qv2ray/Qv2ray) (This project had been archived and currently inactive)
 
 ## Credits
 

app/commander/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/commander/config.proto
 
 package commander
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	serial "github.com/xtls/xray-core/common/serial"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
@@ -22,10 +21,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 // Config is the settings for Commander.
 type Config struct {
 	state         protoimpl.MessageState

app/commander/service.go

@@ -3,9 +3,10 @@ package commander
 import (
 	"context"
 
-	"github.com/xtls/xray-core/common"
 	"google.golang.org/grpc"
 	"google.golang.org/grpc/reflection"
+
+	"github.com/xtls/xray-core/common"
 )
 
 // Service is a Commander service.

app/dispatcher/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/dispatcher/config.proto
 
 package dispatcher
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type SessionConfig struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache

app/dispatcher/default.go

@@ -15,6 +15,7 @@ import (
 	"github.com/xtls/xray-core/common/protocol"
 	"github.com/xtls/xray-core/common/session"
 	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/dns"
 	"github.com/xtls/xray-core/features/outbound"
 	"github.com/xtls/xray-core/features/policy"
 	"github.com/xtls/xray-core/features/routing"
@@ -24,9 +25,7 @@ import (
 	"github.com/xtls/xray-core/transport/pipe"
 )
 
-var (
-	errSniffingTimeout = newError("timeout on sniffing")
-)
+var errSniffingTimeout = newError("timeout on sniffing")
 
 type cachedReader struct {
 	sync.Mutex
@@ -175,19 +174,35 @@ func (d *DefaultDispatcher) getLink(ctx context.Context) (*transport.Link, *tran
 	return inboundLink, outboundLink
 }
 
-func shouldOverride(result SniffResult, request session.SniffingRequest) bool {
+func shouldOverride(ctx context.Context, result SniffResult, request session.SniffingRequest, destination net.Destination) bool {
 	domain := result.Domain()
 	for _, d := range request.ExcludeForDomain {
-		if domain == d {
+		if strings.ToLower(domain) == d {
 			return false
 		}
 	}
-
-	protocol := result.Protocol()
+	var fakeDNSEngine dns.FakeDNSEngine
+	core.RequireFeatures(ctx, func(fdns dns.FakeDNSEngine) {
+		fakeDNSEngine = fdns
+	})
+	protocolString := result.Protocol()
+	if resComp, ok := result.(SnifferResultComposite); ok {
+		protocolString = resComp.ProtocolForDomainResult()
+	}
 	for _, p := range request.OverrideDestinationForProtocol {
-		if strings.HasPrefix(protocol, p) {
+		if strings.HasPrefix(protocolString, p) {
 			return true
 		}
+		if fkr0, ok := fakeDNSEngine.(dns.FakeDNSEngineRev0); ok && protocolString != "bittorrent" && p == "fakedns" &&
+			destination.Address.Family().IsIP() && fkr0.IsIPInIPPool(destination.Address) {
+				newError("Using sniffer ", protocolString, " since the fake DNS missed").WriteToLog(session.ExportIDToError(ctx))
+				return true
+		}
+		if resultSubset, ok := result.(SnifferIsProtoSubsetOf); ok {
+			if resultSubset.IsProtoSubsetOf(p) {
+				return true
+			}
+		}
 	}
 
 	return false
@@ -210,19 +225,33 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
 		ctx = session.ContextWithContent(ctx, content)
 	}
 	sniffingRequest := content.SniffingRequest
-	if destination.Network != net.Network_TCP || !sniffingRequest.Enabled {
+	switch {
+	case !sniffingRequest.Enabled:
 		go d.routedDispatch(ctx, outbound, destination)
-	} else {
+	case destination.Network != net.Network_TCP:
+		// Only metadata sniff will be used for non tcp connection
+		result, err := sniffer(ctx, nil, true)
+		if err == nil {
+			content.Protocol = result.Protocol()
+			if shouldOverride(ctx, result, sniffingRequest, destination) {
+				domain := result.Domain()
+				newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
+				destination.Address = net.ParseAddress(domain)
+				ob.Target = destination
+			}
+		}
+		go d.routedDispatch(ctx, outbound, destination)
+	default:
 		go func() {
 			cReader := &cachedReader{
 				reader: outbound.Reader.(*pipe.Reader),
 			}
 			outbound.Reader = cReader
-			result, err := sniffer(ctx, cReader)
+			result, err := sniffer(ctx, cReader, sniffingRequest.MetadataOnly)
 			if err == nil {
 				content.Protocol = result.Protocol()
 			}
-			if err == nil && shouldOverride(result, sniffingRequest) {
+			if err == nil && shouldOverride(ctx, result, sniffingRequest, destination) {
 				domain := result.Domain()
 				newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
 				destination.Address = net.ParseAddress(domain)
@@ -234,11 +263,19 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
 	return inbound, nil
 }
 
-func sniffer(ctx context.Context, cReader *cachedReader) (SniffResult, error) {
+func sniffer(ctx context.Context, cReader *cachedReader, metadataOnly bool) (SniffResult, error) {
 	payload := buf.New()
 	defer payload.Release()
 
-	sniffer := NewSniffer()
+	sniffer := NewSniffer(ctx)
+
+	metaresult, metadataErr := sniffer.SniffMetadata(ctx)
+
+	if metadataOnly {
+		return metaresult, metadataErr
+	}
+
+	contentResult, contentErr := func() (SniffResult, error) {
 		totalAttempt := 0
 		for {
 			select {
@@ -252,7 +289,7 @@ func sniffer(ctx context.Context, cReader *cachedReader) (SniffResult, error) {
 
 				cReader.Cache(payload)
 				if !payload.IsEmpty() {
-				result, err := sniffer.Sniff(payload.Bytes())
+					result, err := sniffer.Sniff(ctx, payload.Bytes())
 					if err != common.ErrNoClue {
 						return result, err
 					}
@@ -262,28 +299,27 @@ func sniffer(ctx context.Context, cReader *cachedReader) (SniffResult, error) {
 				}
 			}
 		}
+	}()
+	if contentErr != nil && metadataErr == nil {
+		return metaresult, nil
+	}
+	if contentErr == nil && metadataErr == nil {
+		return CompositeResult(metaresult, contentResult), nil
+	}
+	return contentResult, contentErr
 }
 
 func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.Link, destination net.Destination) {
 	var handler outbound.Handler
 
-	skipRoutePick := false
-	if content := session.ContentFromContext(ctx); content != nil {
-		skipRoutePick = content.SkipRoutePick
-	}
-
-	routingLink := routing_session.AsRoutingContext(ctx)
-	inTag := routingLink.GetInboundTag()
-	isPickRoute := false
-	if d.router != nil && !skipRoutePick {
-		if route, err := d.router.PickRoute(routingLink); err == nil {
-			outTag := route.GetOutboundTag()
-			isPickRoute = true
-			if h := d.ohm.GetHandler(outTag); h != nil {
-				newError("taking detour [", outTag, "] for [", destination, "]").WriteToLog(session.ExportIDToError(ctx))
+	if d.router != nil {
+		if route, err := d.router.PickRoute(routing_session.AsRoutingContext(ctx)); err == nil {
+			tag := route.GetOutboundTag()
+			if h := d.ohm.GetHandler(tag); h != nil {
+				newError("taking detour [", tag, "] for [", destination, "]").WriteToLog(session.ExportIDToError(ctx))
 				handler = h
 			} else {
-				newError("non existing outTag: ", outTag).AtWarning().WriteToLog(session.ExportIDToError(ctx))
+				newError("non existing outTag: ", tag).AtWarning().WriteToLog(session.ExportIDToError(ctx))
 			}
 		} else {
 			newError("default route for ", destination).WriteToLog(session.ExportIDToError(ctx))
@@ -303,20 +339,8 @@ func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.
 
 	if accessMessage := log.AccessMessageFromContext(ctx); accessMessage != nil {
 		if tag := handler.Tag(); tag != "" {
-			if isPickRoute {
-				if inTag != "" {
-					accessMessage.Detour = inTag + " -> " + tag
-				} else {
 			accessMessage.Detour = tag
 		}
-			} else {
-				if inTag != "" {
-					accessMessage.Detour = inTag + " >> " + tag
-				} else {
-					accessMessage.Detour = tag
-				}
-			}
-		}
 		log.Record(accessMessage)
 	}
 

app/dispatcher/fakednssniffer.go

@@ -0,0 +1,117 @@
+package dispatcher
+
+import (
+	"context"
+	"strings"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+// newFakeDNSSniffer Create a Fake DNS metadata sniffer
+func newFakeDNSSniffer(ctx context.Context) (protocolSnifferWithMetadata, error) {
+	var fakeDNSEngine dns.FakeDNSEngine
+	err := core.RequireFeatures(ctx, func(fdns dns.FakeDNSEngine) {
+		fakeDNSEngine = fdns
+	})
+	if err != nil {
+		return protocolSnifferWithMetadata{}, err
+	}
+	if fakeDNSEngine == nil {
+		errNotInit := newError("FakeDNSEngine is not initialized, but such a sniffer is used").AtError()
+		return protocolSnifferWithMetadata{}, errNotInit
+	}
+	return protocolSnifferWithMetadata{protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
+		Target := session.OutboundFromContext(ctx).Target
+		if Target.Network == net.Network_TCP || Target.Network == net.Network_UDP {
+			domainFromFakeDNS := fakeDNSEngine.GetDomainFromFakeDNS(Target.Address)
+			if domainFromFakeDNS != "" {
+				newError("fake dns got domain: ", domainFromFakeDNS, " for ip: ", Target.Address.String()).WriteToLog(session.ExportIDToError(ctx))
+				return &fakeDNSSniffResult{domainName: domainFromFakeDNS}, nil
+			}
+		}
+
+		if ipAddressInRangeValueI := ctx.Value(ipAddressInRange); ipAddressInRangeValueI != nil {
+			ipAddressInRangeValue := ipAddressInRangeValueI.(*ipAddressInRangeOpt)
+			if fkr0, ok := fakeDNSEngine.(dns.FakeDNSEngineRev0); ok {
+				inPool := fkr0.IsIPInIPPool(Target.Address)
+				ipAddressInRangeValue.addressInRange = &inPool
+			}
+		}
+
+		return nil, common.ErrNoClue
+	}, metadataSniffer: true}, nil
+}
+
+type fakeDNSSniffResult struct {
+	domainName string
+}
+
+func (fakeDNSSniffResult) Protocol() string {
+	return "fakedns"
+}
+
+func (f fakeDNSSniffResult) Domain() string {
+	return f.domainName
+}
+
+type fakeDNSExtraOpts int
+
+const ipAddressInRange fakeDNSExtraOpts = 1
+
+type ipAddressInRangeOpt struct {
+	addressInRange *bool
+}
+
+type DNSThenOthersSniffResult struct {
+	domainName           string
+	protocolOriginalName string
+}
+
+func (f DNSThenOthersSniffResult) IsProtoSubsetOf(protocolName string) bool {
+	return strings.HasPrefix(protocolName, f.protocolOriginalName)
+}
+
+func (DNSThenOthersSniffResult) Protocol() string {
+	return "fakedns+others"
+}
+
+func (f DNSThenOthersSniffResult) Domain() string {
+	return f.domainName
+}
+
+func newFakeDNSThenOthers(ctx context.Context, fakeDNSSniffer protocolSnifferWithMetadata, others []protocolSnifferWithMetadata) (
+	protocolSnifferWithMetadata, error) { // nolint: unparam
+	// ctx may be used in the future
+	_ = ctx
+	return protocolSnifferWithMetadata{
+		protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
+			ipAddressInRangeValue := &ipAddressInRangeOpt{}
+			ctx = context.WithValue(ctx, ipAddressInRange, ipAddressInRangeValue)
+			result, err := fakeDNSSniffer.protocolSniffer(ctx, bytes)
+			if err == nil {
+				return result, nil
+			}
+			if ipAddressInRangeValue.addressInRange != nil {
+				if *ipAddressInRangeValue.addressInRange {
+					for _, v := range others {
+						if v.metadataSniffer || bytes != nil {
+							if result, err := v.protocolSniffer(ctx, bytes); err == nil {
+								return DNSThenOthersSniffResult{domainName: result.Domain(), protocolOriginalName: result.Protocol()}, nil
+							}
+						}
+					}
+					return nil, common.ErrNoClue
+				}
+				newError("ip address not in fake dns range, return as is").AtDebug().WriteToLog()
+				return nil, common.ErrNoClue
+			}
+			newError("fake dns sniffer did not set address in range option, assume false.").AtWarning().WriteToLog()
+			return nil, common.ErrNoClue
+		},
+		metadataSniffer: false,
+	}, nil
+}

app/dispatcher/sniffer.go

@@ -1,6 +1,8 @@
 package dispatcher
 
 import (
+	"context"
+
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/protocol/bittorrent"
 	"github.com/xtls/xray-core/common/protocol/http"
@@ -12,30 +14,51 @@ type SniffResult interface {
 	Domain() string
 }
 
-type protocolSniffer func([]byte) (SniffResult, error)
+type protocolSniffer func(context.Context, []byte) (SniffResult, error)
 
-type Sniffer struct {
-	sniffer []protocolSniffer
+type protocolSnifferWithMetadata struct {
+	protocolSniffer protocolSniffer
+	// A Metadata sniffer will be invoked on connection establishment only, with nil body,
+	// for both TCP and UDP connections
+	// It will not be shown as a traffic type for routing unless there is no other successful sniffing.
+	metadataSniffer bool
 }
 
-func NewSniffer() *Sniffer {
-	return &Sniffer{
-		sniffer: []protocolSniffer{
-			func(b []byte) (SniffResult, error) { return http.SniffHTTP(b) },
-			func(b []byte) (SniffResult, error) { return tls.SniffTLS(b) },
-			func(b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) },
+type Sniffer struct {
+	sniffer []protocolSnifferWithMetadata
+}
+
+func NewSniffer(ctx context.Context) *Sniffer {
+	ret := &Sniffer{
+		sniffer: []protocolSnifferWithMetadata{
+			{func(c context.Context, b []byte) (SniffResult, error) { return http.SniffHTTP(b) }, false},
+			{func(c context.Context, b []byte) (SniffResult, error) { return tls.SniffTLS(b) }, false},
+			{func(c context.Context, b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) }, false},
 		},
 	}
+	if sniffer, err := newFakeDNSSniffer(ctx); err == nil {
+		others := ret.sniffer
+		ret.sniffer = append(ret.sniffer, sniffer)
+		fakeDNSThenOthers, err := newFakeDNSThenOthers(ctx, sniffer, others)
+		if err == nil {
+			ret.sniffer = append([]protocolSnifferWithMetadata{fakeDNSThenOthers}, ret.sniffer...)
+		}
+	}
+	return ret
 }
 
 var errUnknownContent = newError("unknown content")
 
-func (s *Sniffer) Sniff(payload []byte) (SniffResult, error) {
-	var pendingSniffer []protocolSniffer
-	for _, s := range s.sniffer {
-		result, err := s(payload)
+func (s *Sniffer) Sniff(c context.Context, payload []byte) (SniffResult, error) {
+	var pendingSniffer []protocolSnifferWithMetadata
+	for _, si := range s.sniffer {
+		s := si.protocolSniffer
+		if si.metadataSniffer {
+			continue
+		}
+		result, err := s(c, payload)
 		if err == common.ErrNoClue {
-			pendingSniffer = append(pendingSniffer, s)
+			pendingSniffer = append(pendingSniffer, si)
 			continue
 		}
 
@@ -51,3 +74,59 @@ func (s *Sniffer) Sniff(payload []byte) (SniffResult, error) {
 
 	return nil, errUnknownContent
 }
+
+func (s *Sniffer) SniffMetadata(c context.Context) (SniffResult, error) {
+	var pendingSniffer []protocolSnifferWithMetadata
+	for _, si := range s.sniffer {
+		s := si.protocolSniffer
+		if !si.metadataSniffer {
+			pendingSniffer = append(pendingSniffer, si)
+			continue
+		}
+		result, err := s(c, nil)
+		if err == common.ErrNoClue {
+			pendingSniffer = append(pendingSniffer, si)
+			continue
+		}
+
+		if err == nil && result != nil {
+			return result, nil
+		}
+	}
+
+	if len(pendingSniffer) > 0 {
+		s.sniffer = pendingSniffer
+		return nil, common.ErrNoClue
+	}
+
+	return nil, errUnknownContent
+}
+
+func CompositeResult(domainResult SniffResult, protocolResult SniffResult) SniffResult {
+	return &compositeResult{domainResult: domainResult, protocolResult: protocolResult}
+}
+
+type compositeResult struct {
+	domainResult   SniffResult
+	protocolResult SniffResult
+}
+
+func (c compositeResult) Protocol() string {
+	return c.protocolResult.Protocol()
+}
+
+func (c compositeResult) Domain() string {
+	return c.domainResult.Domain()
+}
+
+func (c compositeResult) ProtocolForDomainResult() string {
+	return c.domainResult.Protocol()
+}
+
+type SnifferResultComposite interface {
+	ProtocolForDomainResult() string
+}
+
+type SnifferIsProtoSubsetOf interface {
+	IsProtoSubsetOf(protocolName string) bool
+}

app/dns/config.go

@@ -0,0 +1,63 @@
+package dns
+
+import (
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/strmatcher"
+	"github.com/xtls/xray-core/common/uuid"
+)
+
+var typeMap = map[DomainMatchingType]strmatcher.Type{
+	DomainMatchingType_Full:      strmatcher.Full,
+	DomainMatchingType_Subdomain: strmatcher.Domain,
+	DomainMatchingType_Keyword:   strmatcher.Substr,
+	DomainMatchingType_Regex:     strmatcher.Regex,
+}
+
+// References:
+// https://www.iana.org/assignments/special-use-domain-names/special-use-domain-names.xhtml
+// https://unix.stackexchange.com/questions/92441/whats-the-difference-between-local-home-and-lan
+var localTLDsAndDotlessDomains = []*NameServer_PriorityDomain{
+	{Type: DomainMatchingType_Regex, Domain: "^[^.]+$"}, // This will only match domains without any dot
+	{Type: DomainMatchingType_Subdomain, Domain: "local"},
+	{Type: DomainMatchingType_Subdomain, Domain: "localdomain"},
+	{Type: DomainMatchingType_Subdomain, Domain: "localhost"},
+	{Type: DomainMatchingType_Subdomain, Domain: "lan"},
+	{Type: DomainMatchingType_Subdomain, Domain: "home.arpa"},
+	{Type: DomainMatchingType_Subdomain, Domain: "example"},
+	{Type: DomainMatchingType_Subdomain, Domain: "invalid"},
+	{Type: DomainMatchingType_Subdomain, Domain: "test"},
+}
+
+var localTLDsAndDotlessDomainsRule = &NameServer_OriginalRule{
+	Rule: "geosite:private",
+	Size: uint32(len(localTLDsAndDotlessDomains)),
+}
+
+func toStrMatcher(t DomainMatchingType, domain string) (strmatcher.Matcher, error) {
+	strMType, f := typeMap[t]
+	if !f {
+		return nil, newError("unknown mapping type", t).AtWarning()
+	}
+	matcher, err := strMType.New(domain)
+	if err != nil {
+		return nil, newError("failed to create str matcher").Base(err)
+	}
+	return matcher, nil
+}
+
+func toNetIP(addrs []net.Address) ([]net.IP, error) {
+	ips := make([]net.IP, 0, len(addrs))
+	for _, addr := range addrs {
+		if addr.Family().IsIP() {
+			ips = append(ips, addr.IP())
+		} else {
+			return nil, newError("Failed to convert address", addr, "to Net IP.").AtWarning()
+		}
+	}
+	return ips, nil
+}
+
+func generateRandomTag() string {
+	id := uuid.New()
+	return "xray.system." + id.String()
+}

app/dns/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/dns/config.proto
 
 package dns
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	router "github.com/xtls/xray-core/app/router"
 	net "github.com/xtls/xray-core/common/net"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
@@ -23,10 +22,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type DomainMatchingType int32
 
 const (
@@ -79,12 +74,63 @@ func (DomainMatchingType) EnumDescriptor() ([]byte, []int) {
 	return file_app_dns_config_proto_rawDescGZIP(), []int{0}
 }
 
+type QueryStrategy int32
+
+const (
+	QueryStrategy_USE_IP  QueryStrategy = 0
+	QueryStrategy_USE_IP4 QueryStrategy = 1
+	QueryStrategy_USE_IP6 QueryStrategy = 2
+)
+
+// Enum value maps for QueryStrategy.
+var (
+	QueryStrategy_name = map[int32]string{
+		0: "USE_IP",
+		1: "USE_IP4",
+		2: "USE_IP6",
+	}
+	QueryStrategy_value = map[string]int32{
+		"USE_IP":  0,
+		"USE_IP4": 1,
+		"USE_IP6": 2,
+	}
+)
+
+func (x QueryStrategy) Enum() *QueryStrategy {
+	p := new(QueryStrategy)
+	*p = x
+	return p
+}
+
+func (x QueryStrategy) String() string {
+	return protoimpl.X.EnumStringOf(x.Descriptor(), protoreflect.EnumNumber(x))
+}
+
+func (QueryStrategy) Descriptor() protoreflect.EnumDescriptor {
+	return file_app_dns_config_proto_enumTypes[1].Descriptor()
+}
+
+func (QueryStrategy) Type() protoreflect.EnumType {
+	return &file_app_dns_config_proto_enumTypes[1]
+}
+
+func (x QueryStrategy) Number() protoreflect.EnumNumber {
+	return protoreflect.EnumNumber(x)
+}
+
+// Deprecated: Use QueryStrategy.Descriptor instead.
+func (QueryStrategy) EnumDescriptor() ([]byte, []int) {
+	return file_app_dns_config_proto_rawDescGZIP(), []int{1}
+}
+
 type NameServer struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache
 	unknownFields protoimpl.UnknownFields
 
 	Address           *net.Endpoint                `protobuf:"bytes,1,opt,name=address,proto3" json:"address,omitempty"`
+	ClientIp          []byte                       `protobuf:"bytes,5,opt,name=client_ip,json=clientIp,proto3" json:"client_ip,omitempty"`
+	SkipFallback      bool                         `protobuf:"varint,6,opt,name=skipFallback,proto3" json:"skipFallback,omitempty"`
 	PrioritizedDomain []*NameServer_PriorityDomain `protobuf:"bytes,2,rep,name=prioritized_domain,json=prioritizedDomain,proto3" json:"prioritized_domain,omitempty"`
 	Geoip             []*router.GeoIP              `protobuf:"bytes,3,rep,name=geoip,proto3" json:"geoip,omitempty"`
 	OriginalRules     []*NameServer_OriginalRule   `protobuf:"bytes,4,rep,name=original_rules,json=originalRules,proto3" json:"original_rules,omitempty"`
@@ -129,6 +175,20 @@ func (x *NameServer) GetAddress() *net.Endpoint {
 	return nil
 }
 
+func (x *NameServer) GetClientIp() []byte {
+	if x != nil {
+		return x.ClientIp
+	}
+	return nil
+}
+
+func (x *NameServer) GetSkipFallback() bool {
+	if x != nil {
+		return x.SkipFallback
+	}
+	return false
+}
+
 func (x *NameServer) GetPrioritizedDomain() []*NameServer_PriorityDomain {
 	if x != nil {
 		return x.PrioritizedDomain
@@ -174,6 +234,11 @@ type Config struct {
 	StaticHosts []*Config_HostMapping `protobuf:"bytes,4,rep,name=static_hosts,json=staticHosts,proto3" json:"static_hosts,omitempty"`
 	// Tag is the inbound tag of DNS client.
 	Tag string `protobuf:"bytes,6,opt,name=tag,proto3" json:"tag,omitempty"`
+	// DisableCache disables DNS cache
+	DisableCache           bool          `protobuf:"varint,8,opt,name=disableCache,proto3" json:"disableCache,omitempty"`
+	QueryStrategy          QueryStrategy `protobuf:"varint,9,opt,name=query_strategy,json=queryStrategy,proto3,enum=xray.app.dns.QueryStrategy" json:"query_strategy,omitempty"`
+	DisableFallback        bool          `protobuf:"varint,10,opt,name=disableFallback,proto3" json:"disableFallback,omitempty"`
+	DisableFallbackIfMatch bool          `protobuf:"varint,11,opt,name=disableFallbackIfMatch,proto3" json:"disableFallbackIfMatch,omitempty"`
 }
 
 func (x *Config) Reset() {
@@ -252,6 +317,34 @@ func (x *Config) GetTag() string {
 	return ""
 }
 
+func (x *Config) GetDisableCache() bool {
+	if x != nil {
+		return x.DisableCache
+	}
+	return false
+}
+
+func (x *Config) GetQueryStrategy() QueryStrategy {
+	if x != nil {
+		return x.QueryStrategy
+	}
+	return QueryStrategy_USE_IP
+}
+
+func (x *Config) GetDisableFallback() bool {
+	if x != nil {
+		return x.DisableFallback
+	}
+	return false
+}
+
+func (x *Config) GetDisableFallbackIfMatch() bool {
+	if x != nil {
+		return x.DisableFallbackIfMatch
+	}
+	return false
+}
+
 type NameServer_PriorityDomain struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache
@@ -371,8 +464,7 @@ type Config_HostMapping struct {
 	Domain string             `protobuf:"bytes,2,opt,name=domain,proto3" json:"domain,omitempty"`
 	Ip     [][]byte           `protobuf:"bytes,3,rep,name=ip,proto3" json:"ip,omitempty"`
 	// ProxiedDomain indicates the mapped domain has the same IP address on this
-	// domain. Xray will use this domain for IP queries. This field is only
-	// effective if ip is empty.
+	// domain. Xray will use this domain for IP queries.
 	ProxiedDomain string `protobuf:"bytes,4,opt,name=proxied_domain,json=proxiedDomain,proto3" json:"proxied_domain,omitempty"`
 }
 
@@ -446,77 +538,98 @@ var file_app_dns_config_proto_rawDesc = []byte{
 	0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2f, 0x6e, 0x65, 0x74, 0x2f, 0x64, 0x65, 0x73, 0x74, 0x69,
 	0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x1a, 0x17, 0x61, 0x70,
 	0x70, 0x2f, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2f, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e,
-	0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xad, 0x03, 0x0a, 0x0a, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65,
+	0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xee, 0x03, 0x0a, 0x0a, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65,
 	0x72, 0x76, 0x65, 0x72, 0x12, 0x33, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18,
 	0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
 	0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64, 0x70, 0x6f, 0x69, 0x6e, 0x74,
-	0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x56, 0x0a, 0x12, 0x70, 0x72, 0x69,
-	0x6f, 0x72, 0x69, 0x74, 0x69, 0x7a, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18,
-	0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x27, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
-	0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x2e,
-	0x50, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x79, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x11,
-	0x70, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x69, 0x7a, 0x65, 0x64, 0x44, 0x6f, 0x6d, 0x61, 0x69,
-	0x6e, 0x12, 0x2c, 0x0a, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b,
-	0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
-	0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x12,
-	0x4c, 0x0a, 0x0e, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x5f, 0x72, 0x75, 0x6c, 0x65,
-	0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61,
-	0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65,
-	0x72, 0x2e, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x0d,
-	0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x73, 0x1a, 0x5e, 0x0a,
-	0x0e, 0x50, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x79, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x12,
-	0x34, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x20, 0x2e,
-	0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x44, 0x6f, 0x6d,
-	0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x52,
-	0x04, 0x74, 0x79, 0x70, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18,
-	0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x1a, 0x36, 0x0a,
-	0x0c, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x12, 0x0a,
-	0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x72, 0x75, 0x6c,
-	0x65, 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52,
-	0x04, 0x73, 0x69, 0x7a, 0x65, 0x22, 0x9f, 0x04, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
-	0x12, 0x3f, 0x0a, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x18,
-	0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
-	0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64, 0x70, 0x6f, 0x69, 0x6e, 0x74,
-	0x42, 0x02, 0x18, 0x01, 0x52, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72,
-	0x73, 0x12, 0x39, 0x0a, 0x0b, 0x6e, 0x61, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72,
-	0x18, 0x05, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
+	0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x1b, 0x0a, 0x09, 0x63, 0x6c, 0x69,
+	0x65, 0x6e, 0x74, 0x5f, 0x69, 0x70, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x08, 0x63, 0x6c,
+	0x69, 0x65, 0x6e, 0x74, 0x49, 0x70, 0x12, 0x22, 0x0a, 0x0c, 0x73, 0x6b, 0x69, 0x70, 0x46, 0x61,
+	0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x18, 0x06, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x73, 0x6b,
+	0x69, 0x70, 0x46, 0x61, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x12, 0x56, 0x0a, 0x12, 0x70, 0x72,
+	0x69, 0x6f, 0x72, 0x69, 0x74, 0x69, 0x7a, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
+	0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x27, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
 	0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72,
-	0x52, 0x0a, 0x6e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x12, 0x39, 0x0a, 0x05,
-	0x48, 0x6f, 0x73, 0x74, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1f, 0x2e, 0x78, 0x72,
+	0x2e, 0x50, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x79, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52,
+	0x11, 0x70, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x69, 0x7a, 0x65, 0x64, 0x44, 0x6f, 0x6d, 0x61,
+	0x69, 0x6e, 0x12, 0x2c, 0x0a, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28,
+	0x0b, 0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75,
+	0x74, 0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70,
+	0x12, 0x4c, 0x0a, 0x0e, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x5f, 0x72, 0x75, 0x6c,
+	0x65, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
+	0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76,
+	0x65, 0x72, 0x2e, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x52,
+	0x0d, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x73, 0x1a, 0x5e,
+	0x0a, 0x0e, 0x50, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x79, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
+	0x12, 0x34, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x20,
+	0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x44, 0x6f,
+	0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65,
+	0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
+	0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x1a, 0x36,
+	0x0a, 0x0c, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x12,
+	0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x72, 0x75,
+	0x6c, 0x65, 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d,
+	0x52, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x22, 0xef, 0x05, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69,
+	0x67, 0x12, 0x3f, 0x0a, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73,
+	0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f,
+	0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64, 0x70, 0x6f, 0x69, 0x6e,
+	0x74, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65,
+	0x72, 0x73, 0x12, 0x39, 0x0a, 0x0b, 0x6e, 0x61, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65,
+	0x72, 0x18, 0x05, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61,
+	0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65,
+	0x72, 0x52, 0x0a, 0x6e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x12, 0x39, 0x0a,
+	0x05, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1f, 0x2e, 0x78,
+	0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x43, 0x6f, 0x6e, 0x66,
+	0x69, 0x67, 0x2e, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x42, 0x02, 0x18,
+	0x01, 0x52, 0x05, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x12, 0x1b, 0x0a, 0x09, 0x63, 0x6c, 0x69, 0x65,
+	0x6e, 0x74, 0x5f, 0x69, 0x70, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x08, 0x63, 0x6c, 0x69,
+	0x65, 0x6e, 0x74, 0x49, 0x70, 0x12, 0x43, 0x0a, 0x0c, 0x73, 0x74, 0x61, 0x74, 0x69, 0x63, 0x5f,
+	0x68, 0x6f, 0x73, 0x74, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72,
 	0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69,
-	0x67, 0x2e, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x42, 0x02, 0x18, 0x01,
-	0x52, 0x05, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x12, 0x1b, 0x0a, 0x09, 0x63, 0x6c, 0x69, 0x65, 0x6e,
-	0x74, 0x5f, 0x69, 0x70, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x08, 0x63, 0x6c, 0x69, 0x65,
-	0x6e, 0x74, 0x49, 0x70, 0x12, 0x43, 0x0a, 0x0c, 0x73, 0x74, 0x61, 0x74, 0x69, 0x63, 0x5f, 0x68,
-	0x6f, 0x73, 0x74, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61,
-	0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
-	0x2e, 0x48, 0x6f, 0x73, 0x74, 0x4d, 0x61, 0x70, 0x70, 0x69, 0x6e, 0x67, 0x52, 0x0b, 0x73, 0x74,
-	0x61, 0x74, 0x69, 0x63, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67,
-	0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x1a, 0x55, 0x0a, 0x0a, 0x48,
-	0x6f, 0x73, 0x74, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, 0x03, 0x6b, 0x65, 0x79,
-	0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, 0x31, 0x0a, 0x05, 0x76,
-	0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61,
-	0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f,
-	0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02,
-	0x38, 0x01, 0x1a, 0x92, 0x01, 0x0a, 0x0b, 0x48, 0x6f, 0x73, 0x74, 0x4d, 0x61, 0x70, 0x70, 0x69,
-	0x6e, 0x67, 0x12, 0x34, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e,
-	0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e,
-	0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79,
-	0x70, 0x65, 0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61,
-	0x69, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
-	0x12, 0x0e, 0x0a, 0x02, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x70,
-	0x12, 0x25, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61,
-	0x69, 0x6e, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65,
-	0x64, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x2a, 0x45, 0x0a, 0x12, 0x44, 0x6f, 0x6d, 0x61, 0x69,
-	0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08, 0x0a,
-	0x04, 0x46, 0x75, 0x6c, 0x6c, 0x10, 0x00, 0x12, 0x0d, 0x0a, 0x09, 0x53, 0x75, 0x62, 0x64, 0x6f,
-	0x6d, 0x61, 0x69, 0x6e, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07, 0x4b, 0x65, 0x79, 0x77, 0x6f, 0x72,
-	0x64, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x52, 0x65, 0x67, 0x65, 0x78, 0x10, 0x03, 0x42, 0x46,
-	0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64,
-	0x6e, 0x73, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d,
-	0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f,
-	0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41,
-	0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
+	0x67, 0x2e, 0x48, 0x6f, 0x73, 0x74, 0x4d, 0x61, 0x70, 0x70, 0x69, 0x6e, 0x67, 0x52, 0x0b, 0x73,
+	0x74, 0x61, 0x74, 0x69, 0x63, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61,
+	0x67, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x22, 0x0a, 0x0c,
+	0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x43, 0x61, 0x63, 0x68, 0x65, 0x18, 0x08, 0x20, 0x01,
+	0x28, 0x08, 0x52, 0x0c, 0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x43, 0x61, 0x63, 0x68, 0x65,
+	0x12, 0x42, 0x0a, 0x0e, 0x71, 0x75, 0x65, 0x72, 0x79, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65,
+	0x67, 0x79, 0x18, 0x09, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
+	0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x53, 0x74, 0x72,
+	0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0d, 0x71, 0x75, 0x65, 0x72, 0x79, 0x53, 0x74, 0x72, 0x61,
+	0x74, 0x65, 0x67, 0x79, 0x12, 0x28, 0x0a, 0x0f, 0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x46,
+	0x61, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0f, 0x64,
+	0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x46, 0x61, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x12, 0x36,
+	0x0a, 0x16, 0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x46, 0x61, 0x6c, 0x6c, 0x62, 0x61, 0x63,
+	0x6b, 0x49, 0x66, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x18, 0x0b, 0x20, 0x01, 0x28, 0x08, 0x52, 0x16,
+	0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x46, 0x61, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x49,
+	0x66, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x1a, 0x55, 0x0a, 0x0a, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x45,
+	0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, 0x03, 0x6b, 0x65, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28,
+	0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, 0x31, 0x0a, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18,
+	0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
+	0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61,
+	0x69, 0x6e, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38, 0x01, 0x1a, 0x92, 0x01,
+	0x0a, 0x0b, 0x48, 0x6f, 0x73, 0x74, 0x4d, 0x61, 0x70, 0x70, 0x69, 0x6e, 0x67, 0x12, 0x34, 0x0a,
+	0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x20, 0x2e, 0x78, 0x72,
+	0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69,
+	0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x52, 0x04, 0x74,
+	0x79, 0x70, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18, 0x02, 0x20,
+	0x01, 0x28, 0x09, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x12, 0x0e, 0x0a, 0x02, 0x69,
+	0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x70, 0x12, 0x25, 0x0a, 0x0e, 0x70,
+	0x72, 0x6f, 0x78, 0x69, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18, 0x04, 0x20,
+	0x01, 0x28, 0x09, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65, 0x64, 0x44, 0x6f, 0x6d, 0x61,
+	0x69, 0x6e, 0x4a, 0x04, 0x08, 0x07, 0x10, 0x08, 0x2a, 0x45, 0x0a, 0x12, 0x44, 0x6f, 0x6d, 0x61,
+	0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08,
+	0x0a, 0x04, 0x46, 0x75, 0x6c, 0x6c, 0x10, 0x00, 0x12, 0x0d, 0x0a, 0x09, 0x53, 0x75, 0x62, 0x64,
+	0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07, 0x4b, 0x65, 0x79, 0x77, 0x6f,
+	0x72, 0x64, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x52, 0x65, 0x67, 0x65, 0x78, 0x10, 0x03, 0x2a,
+	0x35, 0x0a, 0x0d, 0x51, 0x75, 0x65, 0x72, 0x79, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
+	0x12, 0x0a, 0x0a, 0x06, 0x55, 0x53, 0x45, 0x5f, 0x49, 0x50, 0x10, 0x00, 0x12, 0x0b, 0x0a, 0x07,
+	0x55, 0x53, 0x45, 0x5f, 0x49, 0x50, 0x34, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07, 0x55, 0x53, 0x45,
+	0x5f, 0x49, 0x50, 0x36, 0x10, 0x02, 0x42, 0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72,
+	0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69,
+	0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72,
+	0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0xaa,
+	0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x62, 0x06,
+	0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
 }
 
 var (
@@ -531,37 +644,39 @@ func file_app_dns_config_proto_rawDescGZIP() []byte {
 	return file_app_dns_config_proto_rawDescData
 }
 
-var file_app_dns_config_proto_enumTypes = make([]protoimpl.EnumInfo, 1)
+var file_app_dns_config_proto_enumTypes = make([]protoimpl.EnumInfo, 2)
 var file_app_dns_config_proto_msgTypes = make([]protoimpl.MessageInfo, 6)
 var file_app_dns_config_proto_goTypes = []interface{}{
 	(DomainMatchingType)(0),           // 0: xray.app.dns.DomainMatchingType
-	(*NameServer)(nil),                // 1: xray.app.dns.NameServer
-	(*Config)(nil),                    // 2: xray.app.dns.Config
-	(*NameServer_PriorityDomain)(nil), // 3: xray.app.dns.NameServer.PriorityDomain
-	(*NameServer_OriginalRule)(nil),   // 4: xray.app.dns.NameServer.OriginalRule
-	nil,                               // 5: xray.app.dns.Config.HostsEntry
-	(*Config_HostMapping)(nil),        // 6: xray.app.dns.Config.HostMapping
-	(*net.Endpoint)(nil),              // 7: xray.common.net.Endpoint
-	(*router.GeoIP)(nil),              // 8: xray.app.router.GeoIP
-	(*net.IPOrDomain)(nil),            // 9: xray.common.net.IPOrDomain
+	(QueryStrategy)(0),                // 1: xray.app.dns.QueryStrategy
+	(*NameServer)(nil),                // 2: xray.app.dns.NameServer
+	(*Config)(nil),                    // 3: xray.app.dns.Config
+	(*NameServer_PriorityDomain)(nil), // 4: xray.app.dns.NameServer.PriorityDomain
+	(*NameServer_OriginalRule)(nil),   // 5: xray.app.dns.NameServer.OriginalRule
+	nil,                               // 6: xray.app.dns.Config.HostsEntry
+	(*Config_HostMapping)(nil),        // 7: xray.app.dns.Config.HostMapping
+	(*net.Endpoint)(nil),              // 8: xray.common.net.Endpoint
+	(*router.GeoIP)(nil),              // 9: xray.app.router.GeoIP
+	(*net.IPOrDomain)(nil),            // 10: xray.common.net.IPOrDomain
 }
 var file_app_dns_config_proto_depIdxs = []int32{
-	7,  // 0: xray.app.dns.NameServer.address:type_name -> xray.common.net.Endpoint
-	3,  // 1: xray.app.dns.NameServer.prioritized_domain:type_name -> xray.app.dns.NameServer.PriorityDomain
-	8,  // 2: xray.app.dns.NameServer.geoip:type_name -> xray.app.router.GeoIP
-	4,  // 3: xray.app.dns.NameServer.original_rules:type_name -> xray.app.dns.NameServer.OriginalRule
-	7,  // 4: xray.app.dns.Config.NameServers:type_name -> xray.common.net.Endpoint
-	1,  // 5: xray.app.dns.Config.name_server:type_name -> xray.app.dns.NameServer
-	5,  // 6: xray.app.dns.Config.Hosts:type_name -> xray.app.dns.Config.HostsEntry
-	6,  // 7: xray.app.dns.Config.static_hosts:type_name -> xray.app.dns.Config.HostMapping
-	0,  // 8: xray.app.dns.NameServer.PriorityDomain.type:type_name -> xray.app.dns.DomainMatchingType
-	9,  // 9: xray.app.dns.Config.HostsEntry.value:type_name -> xray.common.net.IPOrDomain
-	0,  // 10: xray.app.dns.Config.HostMapping.type:type_name -> xray.app.dns.DomainMatchingType
-	11, // [11:11] is the sub-list for method output_type
-	11, // [11:11] is the sub-list for method input_type
-	11, // [11:11] is the sub-list for extension type_name
-	11, // [11:11] is the sub-list for extension extendee
-	0,  // [0:11] is the sub-list for field type_name
+	8,  // 0: xray.app.dns.NameServer.address:type_name -> xray.common.net.Endpoint
+	4,  // 1: xray.app.dns.NameServer.prioritized_domain:type_name -> xray.app.dns.NameServer.PriorityDomain
+	9,  // 2: xray.app.dns.NameServer.geoip:type_name -> xray.app.router.GeoIP
+	5,  // 3: xray.app.dns.NameServer.original_rules:type_name -> xray.app.dns.NameServer.OriginalRule
+	8,  // 4: xray.app.dns.Config.NameServers:type_name -> xray.common.net.Endpoint
+	2,  // 5: xray.app.dns.Config.name_server:type_name -> xray.app.dns.NameServer
+	6,  // 6: xray.app.dns.Config.Hosts:type_name -> xray.app.dns.Config.HostsEntry
+	7,  // 7: xray.app.dns.Config.static_hosts:type_name -> xray.app.dns.Config.HostMapping
+	1,  // 8: xray.app.dns.Config.query_strategy:type_name -> xray.app.dns.QueryStrategy
+	0,  // 9: xray.app.dns.NameServer.PriorityDomain.type:type_name -> xray.app.dns.DomainMatchingType
+	10, // 10: xray.app.dns.Config.HostsEntry.value:type_name -> xray.common.net.IPOrDomain
+	0,  // 11: xray.app.dns.Config.HostMapping.type:type_name -> xray.app.dns.DomainMatchingType
+	12, // [12:12] is the sub-list for method output_type
+	12, // [12:12] is the sub-list for method input_type
+	12, // [12:12] is the sub-list for extension type_name
+	12, // [12:12] is the sub-list for extension extendee
+	0,  // [0:12] is the sub-list for field type_name
 }
 
 func init() { file_app_dns_config_proto_init() }
@@ -636,7 +751,7 @@ func file_app_dns_config_proto_init() {
 		File: protoimpl.DescBuilder{
 			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
 			RawDescriptor: file_app_dns_config_proto_rawDesc,
-			NumEnums:      1,
+			NumEnums:      2,
 			NumMessages:   6,
 			NumExtensions: 0,
 			NumServices:   0,

app/dns/config.proto

@@ -12,6 +12,8 @@ import "app/router/config.proto";
 
 message NameServer {
   xray.common.net.Endpoint address = 1;
+  bytes client_ip = 5;
+  bool skipFallback = 6;
 
   message PriorityDomain {
     DomainMatchingType type = 1;
@@ -35,6 +37,12 @@ enum DomainMatchingType {
   Regex = 3;
 }
 
+enum QueryStrategy {
+  USE_IP = 0;
+  USE_IP4 = 1;
+  USE_IP6 = 2;
+}
+
 message Config {
   // Nameservers used by this DNS. Only traditional UDP servers are support at
   // the moment. A special value 'localhost' as a domain address can be set to
@@ -59,8 +67,7 @@ message Config {
     repeated bytes ip = 3;
 
     // ProxiedDomain indicates the mapped domain has the same IP address on this
-    // domain. Xray will use this domain for IP queries. This field is only
-    // effective if ip is empty.
+    // domain. Xray will use this domain for IP queries.
     string proxied_domain = 4;
   }
 
@@ -68,4 +75,14 @@ message Config {
 
   // Tag is the inbound tag of DNS client.
   string tag = 6;
+
+  reserved 7;
+
+  // DisableCache disables DNS cache
+  bool disableCache = 8;
+
+  QueryStrategy query_strategy = 9;
+
+  bool disableFallback = 10;
+  bool disableFallbackIfMatch = 11;
 }

app/dns/dns.go

@@ -2,3 +2,295 @@
 package dns
 
 //go:generate go run github.com/xtls/xray-core/common/errors/errorgen
+
+import (
+	"context"
+	"fmt"
+	"strings"
+	"sync"
+
+	"github.com/xtls/xray-core/app/router"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/common/strmatcher"
+	"github.com/xtls/xray-core/features"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+// DNS is a DNS rely server.
+type DNS struct {
+	sync.Mutex
+	tag                    string
+	disableCache           bool
+	disableFallback        bool
+	disableFallbackIfMatch bool
+	ipOption               *dns.IPOption
+	hosts                  *StaticHosts
+	clients                []*Client
+	ctx                    context.Context
+	domainMatcher          strmatcher.IndexMatcher
+	matcherInfos           []*DomainMatcherInfo
+}
+
+// DomainMatcherInfo contains information attached to index returned by Server.domainMatcher
+type DomainMatcherInfo struct {
+	clientIdx     uint16
+	domainRuleIdx uint16
+}
+
+// New creates a new DNS server with given configuration.
+func New(ctx context.Context, config *Config) (*DNS, error) {
+	var tag string
+	if len(config.Tag) > 0 {
+		tag = config.Tag
+	} else {
+		tag = generateRandomTag()
+	}
+
+	var clientIP net.IP
+	switch len(config.ClientIp) {
+	case 0, net.IPv4len, net.IPv6len:
+		clientIP = net.IP(config.ClientIp)
+	default:
+		return nil, newError("unexpected client IP length ", len(config.ClientIp))
+	}
+
+	var ipOption *dns.IPOption
+	switch config.QueryStrategy {
+	case QueryStrategy_USE_IP:
+		ipOption = &dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		}
+	case QueryStrategy_USE_IP4:
+		ipOption = &dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: false,
+			FakeEnable: false,
+		}
+	case QueryStrategy_USE_IP6:
+		ipOption = &dns.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: true,
+			FakeEnable: false,
+		}
+	}
+
+	hosts, err := NewStaticHosts(config.StaticHosts, config.Hosts)
+	if err != nil {
+		return nil, newError("failed to create hosts").Base(err)
+	}
+
+	clients := []*Client{}
+	domainRuleCount := 0
+	for _, ns := range config.NameServer {
+		domainRuleCount += len(ns.PrioritizedDomain)
+	}
+
+	// MatcherInfos is ensured to cover the maximum index domainMatcher could return, where matcher's index starts from 1
+	matcherInfos := make([]*DomainMatcherInfo, domainRuleCount+1)
+	domainMatcher := &strmatcher.MatcherGroup{}
+	geoipContainer := router.GeoIPMatcherContainer{}
+
+	for _, endpoint := range config.NameServers {
+		features.PrintDeprecatedFeatureWarning("simple DNS server")
+		client, err := NewSimpleClient(ctx, endpoint, clientIP)
+		if err != nil {
+			return nil, newError("failed to create client").Base(err)
+		}
+		clients = append(clients, client)
+	}
+
+	for _, ns := range config.NameServer {
+		clientIdx := len(clients)
+		updateDomain := func(domainRule strmatcher.Matcher, originalRuleIdx int, matcherInfos []*DomainMatcherInfo) error {
+			midx := domainMatcher.Add(domainRule)
+			matcherInfos[midx] = &DomainMatcherInfo{
+				clientIdx:     uint16(clientIdx),
+				domainRuleIdx: uint16(originalRuleIdx),
+			}
+			return nil
+		}
+
+		myClientIP := clientIP
+		switch len(ns.ClientIp) {
+		case net.IPv4len, net.IPv6len:
+			myClientIP = net.IP(ns.ClientIp)
+		}
+		client, err := NewClient(ctx, ns, myClientIP, geoipContainer, &matcherInfos, updateDomain)
+		if err != nil {
+			return nil, newError("failed to create client").Base(err)
+		}
+		clients = append(clients, client)
+	}
+
+	// If there is no DNS client in config, add a `localhost` DNS client
+	if len(clients) == 0 {
+		clients = append(clients, NewLocalDNSClient())
+	}
+
+	return &DNS{
+		tag:                    tag,
+		hosts:                  hosts,
+		ipOption:               ipOption,
+		clients:                clients,
+		ctx:                    ctx,
+		domainMatcher:          domainMatcher,
+		matcherInfos:           matcherInfos,
+		disableCache:           config.DisableCache,
+		disableFallback:        config.DisableFallback,
+		disableFallbackIfMatch: config.DisableFallbackIfMatch,
+	}, nil
+}
+
+// Type implements common.HasType.
+func (*DNS) Type() interface{} {
+	return dns.ClientType()
+}
+
+// Start implements common.Runnable.
+func (s *DNS) Start() error {
+	return nil
+}
+
+// Close implements common.Closable.
+func (s *DNS) Close() error {
+	return nil
+}
+
+// IsOwnLink implements proxy.dns.ownLinkVerifier
+func (s *DNS) IsOwnLink(ctx context.Context) bool {
+	inbound := session.InboundFromContext(ctx)
+	return inbound != nil && inbound.Tag == s.tag
+}
+
+// LookupIP implements dns.Client.
+func (s *DNS) LookupIP(domain string, option dns.IPOption) ([]net.IP, error) {
+	if domain == "" {
+		return nil, newError("empty domain name")
+	}
+
+	option.IPv4Enable = option.IPv4Enable && s.ipOption.IPv4Enable
+	option.IPv6Enable = option.IPv6Enable && s.ipOption.IPv6Enable
+
+	if !option.IPv4Enable && !option.IPv6Enable {
+		return nil, dns.ErrEmptyResponse
+	}
+
+	// Normalize the FQDN form query
+	if strings.HasSuffix(domain, ".") {
+		domain = domain[:len(domain)-1]
+	}
+
+	// Static host lookup
+	switch addrs := s.hosts.Lookup(domain, option); {
+	case addrs == nil: // Domain not recorded in static host
+		break
+	case len(addrs) == 0: // Domain recorded, but no valid IP returned (e.g. IPv4 address with only IPv6 enabled)
+		return nil, dns.ErrEmptyResponse
+	case len(addrs) == 1 && addrs[0].Family().IsDomain(): // Domain replacement
+		newError("domain replaced: ", domain, " -> ", addrs[0].Domain()).WriteToLog()
+		domain = addrs[0].Domain()
+	default: // Successfully found ip records in static host
+		newError("returning ", len(addrs), " IP(s) for domain ", domain, " -> ", addrs).WriteToLog()
+		return toNetIP(addrs)
+	}
+
+	// Name servers lookup
+	errs := []error{}
+	ctx := session.ContextWithInbound(s.ctx, &session.Inbound{Tag: s.tag})
+	for _, client := range s.sortClients(domain) {
+		if !option.FakeEnable && strings.EqualFold(client.Name(), "FakeDNS") {
+			newError("skip DNS resolution for domain ", domain, " at server ", client.Name()).AtDebug().WriteToLog()
+			continue
+		}
+		ips, err := client.QueryIP(ctx, domain, option, s.disableCache)
+		if len(ips) > 0 {
+			return ips, nil
+		}
+		if err != nil {
+			newError("failed to lookup ip for domain ", domain, " at server ", client.Name()).Base(err).WriteToLog()
+			errs = append(errs, err)
+		}
+		if err != context.Canceled && err != context.DeadlineExceeded && err != errExpectedIPNonMatch {
+			return nil, err
+		}
+	}
+
+	return nil, newError("returning nil for domain ", domain).Base(errors.Combine(errs...))
+}
+
+// GetIPOption implements ClientWithIPOption.
+func (s *DNS) GetIPOption() *dns.IPOption {
+	return s.ipOption
+}
+
+// SetQueryOption implements ClientWithIPOption.
+func (s *DNS) SetQueryOption(isIPv4Enable, isIPv6Enable bool) {
+	s.ipOption.IPv4Enable = isIPv4Enable
+	s.ipOption.IPv6Enable = isIPv6Enable
+}
+
+// SetFakeDNSOption implements ClientWithIPOption.
+func (s *DNS) SetFakeDNSOption(isFakeEnable bool) {
+	s.ipOption.FakeEnable = isFakeEnable
+}
+
+func (s *DNS) sortClients(domain string) []*Client {
+	clients := make([]*Client, 0, len(s.clients))
+	clientUsed := make([]bool, len(s.clients))
+	clientNames := make([]string, 0, len(s.clients))
+	domainRules := []string{}
+
+	// Priority domain matching
+	hasMatch := false
+	for _, match := range s.domainMatcher.Match(domain) {
+		info := s.matcherInfos[match]
+		client := s.clients[info.clientIdx]
+		domainRule := client.domains[info.domainRuleIdx]
+		domainRules = append(domainRules, fmt.Sprintf("%s(DNS idx:%d)", domainRule, info.clientIdx))
+		if clientUsed[info.clientIdx] {
+			continue
+		}
+		clientUsed[info.clientIdx] = true
+		clients = append(clients, client)
+		clientNames = append(clientNames, client.Name())
+		hasMatch = true
+	}
+
+	if !(s.disableFallback || s.disableFallbackIfMatch && hasMatch) {
+		// Default round-robin query
+		for idx, client := range s.clients {
+			if clientUsed[idx] || client.skipFallback {
+				continue
+			}
+			clientUsed[idx] = true
+			clients = append(clients, client)
+			clientNames = append(clientNames, client.Name())
+		}
+	}
+
+	if len(domainRules) > 0 {
+		newError("domain ", domain, " matches following rules: ", domainRules).AtDebug().WriteToLog()
+	}
+	if len(clientNames) > 0 {
+		newError("domain ", domain, " will use DNS in order: ", clientNames).AtDebug().WriteToLog()
+	}
+
+	if len(clients) == 0 {
+		clients = append(clients, s.clients[0])
+		clientNames = append(clientNames, s.clients[0].Name())
+		newError("domain ", domain, " will use the first DNS: ", clientNames).AtDebug().WriteToLog()
+	}
+
+	return clients
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
+		return New(ctx, config.(*Config))
+	}))
+}

app/dns/dns_test.go

@@ -6,7 +6,6 @@ import (
 
 	"github.com/google/go-cmp/cmp"
 	"github.com/miekg/dns"
-
 	"github.com/xtls/xray-core/app/dispatcher"
 	. "github.com/xtls/xray-core/app/dns"
 	"github.com/xtls/xray-core/app/policy"
@@ -22,8 +21,7 @@ import (
 	"github.com/xtls/xray-core/testing/servers/udp"
 )
 
-type staticHandler struct {
-}
+type staticHandler struct{}
 
 func (*staticHandler) ServeDNS(w dns.ResponseWriter, r *dns.Msg) {
 	ans := new(dns.Msg)
@@ -154,7 +152,11 @@ func TestUDPServerSubnet(t *testing.T) {
 
 	client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
 
-	ips, err := client.LookupIP("google.com")
+	ips, err := client.LookupIP("google.com", feature_dns.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+		FakeEnable: false,
+	})
 	if err != nil {
 		t.Fatal("unexpected error: ", err)
 	}
@@ -209,7 +211,11 @@ func TestUDPServer(t *testing.T) {
 	client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
 
 	{
-		ips, err := client.LookupIP("google.com")
+		ips, err := client.LookupIP("google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -220,7 +226,11 @@ func TestUDPServer(t *testing.T) {
 	}
 
 	{
-		ips, err := client.LookupIP("facebook.com")
+		ips, err := client.LookupIP("facebook.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -231,7 +241,11 @@ func TestUDPServer(t *testing.T) {
 	}
 
 	{
-		_, err := client.LookupIP("notexist.google.com")
+		_, err := client.LookupIP("notexist.google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err == nil {
 			t.Fatal("nil error")
 		}
@@ -241,8 +255,11 @@ func TestUDPServer(t *testing.T) {
 	}
 
 	{
-		clientv6 := client.(feature_dns.IPv6Lookup)
-		ips, err := clientv6.LookupIPv6("ipv4only.google.com")
+		ips, err := client.LookupIP("ipv4only.google.com", feature_dns.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != feature_dns.ErrEmptyResponse {
 			t.Fatal("error: ", err)
 		}
@@ -254,7 +271,11 @@ func TestUDPServer(t *testing.T) {
 	dnsServer.Shutdown()
 
 	{
-		ips, err := client.LookupIP("google.com")
+		ips, err := client.LookupIP("google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -331,7 +352,11 @@ func TestPrioritizedDomain(t *testing.T) {
 	startTime := time.Now()
 
 	{
-		ips, err := client.LookupIP("google.com")
+		ips, err := client.LookupIP("google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -390,10 +415,12 @@ func TestUDPServerIPv6(t *testing.T) {
 	common.Must(err)
 
 	client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
-	client6 := client.(feature_dns.IPv6Lookup)
-
 	{
-		ips, err := client6.LookupIPv6("ipv6.google.com")
+		ips, err := client.LookupIP("ipv6.google.com", feature_dns.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -456,7 +483,11 @@ func TestStaticHostDomain(t *testing.T) {
 	client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
 
 	{
-		ips, err := client.LookupIP("example.com")
+		ips, err := client.LookupIP("example.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -563,7 +594,11 @@ func TestIPMatch(t *testing.T) {
 	startTime := time.Now()
 
 	{
-		ips, err := client.LookupIP("google.com")
+		ips, err := client.LookupIP("google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -682,7 +717,11 @@ func TestLocalDomain(t *testing.T) {
 	startTime := time.Now()
 
 	{ // Will match dotless:
-		ips, err := client.LookupIP("hostname")
+		ips, err := client.LookupIP("hostname", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -693,7 +732,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match domain:local
-		ips, err := client.LookupIP("hostname.local")
+		ips, err := client.LookupIP("hostname.local", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -704,7 +747,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match static ip
-		ips, err := client.LookupIP("hostnamestatic")
+		ips, err := client.LookupIP("hostnamestatic", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -715,7 +762,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match domain replacing
-		ips, err := client.LookupIP("hostnamealias")
+		ips, err := client.LookupIP("hostnamealias", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -726,7 +777,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match dotless:localhost, but not expectIPs: 127.0.0.2, 127.0.0.3, then matches at dotless:
-		ips, err := client.LookupIP("localhost")
+		ips, err := client.LookupIP("localhost", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -737,7 +792,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
-		ips, err := client.LookupIP("localhost-a")
+		ips, err := client.LookupIP("localhost-a", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -748,7 +807,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
-		ips, err := client.LookupIP("localhost-b")
+		ips, err := client.LookupIP("localhost-b", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -759,7 +822,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match dotless:
-		ips, err := client.LookupIP("Mijia Cloud")
+		ips, err := client.LookupIP("Mijia Cloud", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -921,7 +988,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
 	startTime := time.Now()
 
 	{ // Will match server 1,2 and server 1 returns expected ip
-		ips, err := client.LookupIP("google.com")
+		ips, err := client.LookupIP("google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -932,8 +1003,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
 	}
 
 	{ // Will match server 1,2 and server 1 returns unexpected ip, then server 2 returns expected one
-		clientv4 := client.(feature_dns.IPv4Lookup)
-		ips, err := clientv4.LookupIPv4("ipv6.google.com")
+		ips, err := client.LookupIP("ipv6.google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: false,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -944,7 +1018,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
 	}
 
 	{ // Will match server 3,1,2 and server 3 returns expected one
-		ips, err := client.LookupIP("api.google.com")
+		ips, err := client.LookupIP("api.google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -955,7 +1033,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
 	}
 
 	{ // Will match server 4,3,1,2 and server 4 returns expected one
-		ips, err := client.LookupIP("v2.api.google.com")
+		ips, err := client.LookupIP("v2.api.google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}

app/dns/dnscommon.go

@@ -2,18 +2,20 @@ package dns
 
 import (
 	"encoding/binary"
+	"strings"
 	"time"
 
+	"golang.org/x/net/dns/dnsmessage"
+
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/errors"
 	"github.com/xtls/xray-core/common/net"
 	dns_feature "github.com/xtls/xray-core/features/dns"
-	"golang.org/x/net/dns/dnsmessage"
 )
 
 // Fqdn normalize domain make sure it ends with '.'
 func Fqdn(domain string) string {
-	if len(domain) > 0 && domain[len(domain)-1] == '.' {
+	if len(domain) > 0 && strings.HasSuffix(domain, ".") {
 		return domain
 	}
 	return domain + "."
@@ -52,9 +54,7 @@ func isNewer(baseRec *IPRecord, newRec *IPRecord) bool {
 	return baseRec.Expire.Before(newRec.Expire)
 }
 
-var (
-	errRecordNotFound = errors.New("record not found")
-)
+var errRecordNotFound = errors.New("record not found")
 
 type dnsRequest struct {
 	reqType dnsmessage.Type
@@ -112,7 +112,7 @@ func genEDNS0Options(clientIP net.IP) *dnsmessage.Resource {
 	return opt
 }
 
-func buildReqMsgs(domain string, option IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
+func buildReqMsgs(domain string, option dns_feature.IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
 	qA := dnsmessage.Question{
 		Name:  dnsmessage.MustNewName(domain),
 		Type:  dnsmessage.TypeA,
@@ -211,7 +211,7 @@ L:
 		case dnsmessage.TypeAAAA:
 			ans, err := parser.AAAAResource()
 			if err != nil {
-				newError("failed to parse A record for domain: ", ah.Name).Base(err).WriteToLog()
+				newError("failed to parse AAAA record for domain: ", ah.Name).Base(err).WriteToLog()
 				break L
 			}
 			ipRecord.IP = append(ipRecord.IP, net.IPAddress(ans.AAAA[:]))

app/dns/dnscommon_test.go

@@ -7,9 +7,11 @@ import (
 
 	"github.com/google/go-cmp/cmp"
 	"github.com/miekg/dns"
+	"golang.org/x/net/dns/dnsmessage"
+
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/net"
-	"golang.org/x/net/dns/dnsmessage"
+	dns_feature "github.com/xtls/xray-core/features/dns"
 )
 
 func Test_parseResponse(t *testing.T) {
@@ -48,20 +50,28 @@ func Test_parseResponse(t *testing.T) {
 		want    *IPRecord
 		wantErr bool
 	}{
-		{"empty",
+		{
+			"empty",
 			&IPRecord{0, []net.Address(nil), time.Time{}, dnsmessage.RCodeSuccess},
 			false,
 		},
-		{"error",
+		{
+			"error",
 			nil,
 			true,
 		},
-		{"a record",
-			&IPRecord{1, []net.Address{net.ParseAddress("8.8.8.8"), net.ParseAddress("8.8.4.4")},
-				time.Time{}, dnsmessage.RCodeSuccess},
+		{
+			"a record",
+			&IPRecord{
+				1,
+				[]net.Address{net.ParseAddress("8.8.8.8"), net.ParseAddress("8.8.4.4")},
+				time.Time{},
+				dnsmessage.RCodeSuccess,
+			},
 			false,
 		},
-		{"aaaa record",
+		{
+			"aaaa record",
 			&IPRecord{2, []net.Address{net.ParseAddress("2001::123:8888"), net.ParseAddress("2001::123:8844")}, time.Time{}, dnsmessage.RCodeSuccess},
 			false,
 		},
@@ -92,7 +102,7 @@ func Test_buildReqMsgs(t *testing.T) {
 	}
 	type args struct {
 		domain  string
-		option  IPOption
+		option  dns_feature.IPOption
 		reqOpts *dnsmessage.Resource
 	}
 	tests := []struct {
@@ -100,10 +110,26 @@ func Test_buildReqMsgs(t *testing.T) {
 		args args
 		want int
 	}{
-		{"dual stack", args{"test.com", IPOption{true, true}, nil}, 2},
-		{"ipv4 only", args{"test.com", IPOption{true, false}, nil}, 1},
-		{"ipv6 only", args{"test.com", IPOption{false, true}, nil}, 1},
-		{"none/error", args{"test.com", IPOption{false, false}, nil}, 0},
+		{"dual stack", args{"test.com", dns_feature.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		}, nil}, 2},
+		{"ipv4 only", args{"test.com", dns_feature.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: false,
+			FakeEnable: false,
+		}, nil}, 1},
+		{"ipv6 only", args{"test.com", dns_feature.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: true,
+			FakeEnable: false,
+		}, nil}, 1},
+		{"none/error", args{"test.com", dns_feature.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: false,
+			FakeEnable: false,
+		}, nil}, 0},
 	}
 	for _, tt := range tests {
 		t.Run(tt.name, func(t *testing.T) {

app/dns/fakedns/errors.generated.go

@@ -0,0 +1,9 @@
+package fakedns
+
+import "github.com/xtls/xray-core/common/errors"
+
+type errPathObjHolder struct{}
+
+func newError(values ...interface{}) *errors.Error {
+	return errors.New(values...).WithPathObj(errPathObjHolder{})
+}

app/dns/fakedns/fake.go

@@ -0,0 +1,244 @@
+package fakedns
+
+import (
+	"context"
+	"math"
+	"math/big"
+	gonet "net"
+	"time"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/cache"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+type Holder struct {
+	domainToIP cache.Lru
+	ipRange    *gonet.IPNet
+
+	config *FakeDnsPool
+}
+
+func (fkdns *Holder) IsIPInIPPool(ip net.Address) bool {
+	if ip.Family().IsDomain() {
+		return false
+	}
+	return fkdns.ipRange.Contains(ip.IP())
+}
+
+func (fkdns *Holder) GetFakeIPForDomain3(domain string, ipv4, ipv6 bool) []net.Address {
+	isIPv6 := fkdns.ipRange.IP.To4() == nil
+	if (isIPv6 && ipv6) || (!isIPv6 && ipv4) {
+		return fkdns.GetFakeIPForDomain(domain)
+	}
+	return []net.Address{}
+}
+
+func (*Holder) Type() interface{} {
+	return (*dns.FakeDNSEngine)(nil)
+}
+
+func (fkdns *Holder) Start() error {
+	if fkdns.config != nil && fkdns.config.IpPool != "" && fkdns.config.LruSize != 0 {
+		return fkdns.initializeFromConfig()
+	}
+	return newError("invalid fakeDNS setting")
+}
+
+func (fkdns *Holder) Close() error {
+	fkdns.domainToIP = nil
+	fkdns.ipRange = nil
+	return nil
+}
+
+func NewFakeDNSHolder() (*Holder, error) {
+	var fkdns *Holder
+	var err error
+
+	if fkdns, err = NewFakeDNSHolderConfigOnly(nil); err != nil {
+		return nil, newError("Unable to create Fake Dns Engine").Base(err).AtError()
+	}
+	err = fkdns.initialize(dns.FakeIPv4Pool, 65535)
+	if err != nil {
+		return nil, err
+	}
+	return fkdns, nil
+}
+
+func NewFakeDNSHolderConfigOnly(conf *FakeDnsPool) (*Holder, error) {
+	return &Holder{nil, nil, conf}, nil
+}
+
+func (fkdns *Holder) initializeFromConfig() error {
+	return fkdns.initialize(fkdns.config.IpPool, int(fkdns.config.LruSize))
+}
+
+func (fkdns *Holder) initialize(ipPoolCidr string, lruSize int) error {
+	var ipRange *gonet.IPNet
+	var err error
+
+	if _, ipRange, err = gonet.ParseCIDR(ipPoolCidr); err != nil {
+		return newError("Unable to parse CIDR for Fake DNS IP assignment").Base(err).AtError()
+	}
+
+	ones, bits := ipRange.Mask.Size()
+	rooms := bits - ones
+	if math.Log2(float64(lruSize)) >= float64(rooms) {
+		return newError("LRU size is bigger than subnet size").AtError()
+	}
+	fkdns.domainToIP = cache.NewLru(lruSize)
+	fkdns.ipRange = ipRange
+	return nil
+}
+
+// GetFakeIPForDomain check and generate a fake IP for a domain name
+func (fkdns *Holder) GetFakeIPForDomain(domain string) []net.Address {
+	if v, ok := fkdns.domainToIP.Get(domain); ok {
+		return []net.Address{v.(net.Address)}
+	}
+	currentTimeMillis := uint64(time.Now().UnixNano() / 1e6)
+	ones, bits := fkdns.ipRange.Mask.Size()
+	rooms := bits - ones
+	if rooms < 64 {
+		currentTimeMillis %= (uint64(1) << rooms)
+	}
+	bigIntIP := big.NewInt(0).SetBytes(fkdns.ipRange.IP)
+	bigIntIP = bigIntIP.Add(bigIntIP, new(big.Int).SetUint64(currentTimeMillis))
+	var ip net.Address
+	for {
+		ip = net.IPAddress(bigIntIP.Bytes())
+
+		// if we run for a long time, we may go back to beginning and start seeing the IP in use
+		if _, ok := fkdns.domainToIP.PeekKeyFromValue(ip); !ok {
+			break
+		}
+
+		bigIntIP = bigIntIP.Add(bigIntIP, big.NewInt(1))
+		if !fkdns.ipRange.Contains(bigIntIP.Bytes()) {
+			bigIntIP = big.NewInt(0).SetBytes(fkdns.ipRange.IP)
+		}
+	}
+	fkdns.domainToIP.Put(domain, ip)
+	return []net.Address{ip}
+}
+
+// GetDomainFromFakeDNS check if an IP is a fake IP and have corresponding domain name
+func (fkdns *Holder) GetDomainFromFakeDNS(ip net.Address) string {
+	if !ip.Family().IsIP() || !fkdns.ipRange.Contains(ip.IP()) {
+		return ""
+	}
+	if k, ok := fkdns.domainToIP.GetKeyFromValue(ip); ok {
+		return k.(string)
+	}
+	newError("A fake ip request to ", ip, ", however there is no matching domain name in fake DNS").AtInfo().WriteToLog()
+	return ""
+}
+
+type HolderMulti struct {
+	holders []*Holder
+
+	config *FakeDnsPoolMulti
+}
+
+func (h *HolderMulti) IsIPInIPPool(ip net.Address) bool {
+	if ip.Family().IsDomain() {
+		return false
+	}
+	for _, v := range h.holders {
+		if v.IsIPInIPPool(ip) {
+			return true
+		}
+	}
+	return false
+}
+
+func (h *HolderMulti) GetFakeIPForDomain3(domain string, ipv4, ipv6 bool) []net.Address {
+	var ret []net.Address
+	for _, v := range h.holders {
+		ret = append(ret, v.GetFakeIPForDomain3(domain, ipv4, ipv6)...)
+	}
+	return ret
+}
+
+func (h *HolderMulti) GetFakeIPForDomain(domain string) []net.Address {
+	var ret []net.Address
+	for _, v := range h.holders {
+		ret = append(ret, v.GetFakeIPForDomain(domain)...)
+	}
+	return ret
+}
+
+func (h *HolderMulti) GetDomainFromFakeDNS(ip net.Address) string {
+	for _, v := range h.holders {
+		if domain := v.GetDomainFromFakeDNS(ip); domain != "" {
+			return domain
+		}
+	}
+	return ""
+}
+
+func (h *HolderMulti) Type() interface{} {
+	return (*dns.FakeDNSEngine)(nil)
+}
+
+func (h *HolderMulti) Start() error {
+	for _, v := range h.holders {
+		if v.config != nil && v.config.IpPool != "" && v.config.LruSize != 0 {
+			if err := v.Start(); err != nil {
+				return newError("Cannot start all fake dns pools").Base(err)
+			}
+		} else {
+			return newError("invalid fakeDNS setting")
+		}
+	}
+	return nil
+}
+
+func (h *HolderMulti) Close() error {
+	for _, v := range h.holders {
+		if err := v.Close(); err != nil {
+			return newError("Cannot close all fake dns pools").Base(err)
+		}
+	}
+	return nil
+}
+
+func (h *HolderMulti) createHolderGroups() error {
+	for _, v := range h.config.Pools {
+		holder, err := NewFakeDNSHolderConfigOnly(v)
+		if err != nil {
+			return err
+		}
+		h.holders = append(h.holders, holder)
+	}
+	return nil
+}
+
+func NewFakeDNSHolderMulti(conf *FakeDnsPoolMulti) (*HolderMulti, error) {
+	holderMulti := &HolderMulti{nil, conf}
+	if err := holderMulti.createHolderGroups(); err != nil {
+		return nil, err
+	}
+	return holderMulti, nil
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*FakeDnsPool)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
+		var f *Holder
+		var err error
+		if f, err = NewFakeDNSHolderConfigOnly(config.(*FakeDnsPool)); err != nil {
+			return nil, err
+		}
+		return f, nil
+	}))
+
+	common.Must(common.RegisterConfig((*FakeDnsPoolMulti)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
+		var f *HolderMulti
+		var err error
+		if f, err = NewFakeDNSHolderMulti(config.(*FakeDnsPoolMulti)); err != nil {
+			return nil, err
+		}
+		return f, nil
+	}))
+}

app/dns/fakedns/fakedns.go

@@ -0,0 +1,3 @@
+package fakedns
+
+//go:generate go run github.com/xtls/xray-core/common/errors/errorgen

app/dns/fakedns/fakedns.pb.go

@@ -0,0 +1,224 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
+// source: app/dns/fakedns/fakedns.proto
+
+package fakedns
+
+import (
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type FakeDnsPool struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	IpPool  string `protobuf:"bytes,1,opt,name=ip_pool,json=ipPool,proto3" json:"ip_pool,omitempty"` //CIDR of IP pool used as fake DNS IP
+	LruSize int64  `protobuf:"varint,2,opt,name=lruSize,proto3" json:"lruSize,omitempty"`            //Size of Pool for remembering relationship between domain name and IP address
+}
+
+func (x *FakeDnsPool) Reset() {
+	*x = FakeDnsPool{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *FakeDnsPool) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*FakeDnsPool) ProtoMessage() {}
+
+func (x *FakeDnsPool) ProtoReflect() protoreflect.Message {
+	mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use FakeDnsPool.ProtoReflect.Descriptor instead.
+func (*FakeDnsPool) Descriptor() ([]byte, []int) {
+	return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *FakeDnsPool) GetIpPool() string {
+	if x != nil {
+		return x.IpPool
+	}
+	return ""
+}
+
+func (x *FakeDnsPool) GetLruSize() int64 {
+	if x != nil {
+		return x.LruSize
+	}
+	return 0
+}
+
+type FakeDnsPoolMulti struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Pools []*FakeDnsPool `protobuf:"bytes,1,rep,name=pools,proto3" json:"pools,omitempty"`
+}
+
+func (x *FakeDnsPoolMulti) Reset() {
+	*x = FakeDnsPoolMulti{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[1]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *FakeDnsPoolMulti) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*FakeDnsPoolMulti) ProtoMessage() {}
+
+func (x *FakeDnsPoolMulti) ProtoReflect() protoreflect.Message {
+	mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[1]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use FakeDnsPoolMulti.ProtoReflect.Descriptor instead.
+func (*FakeDnsPoolMulti) Descriptor() ([]byte, []int) {
+	return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{1}
+}
+
+func (x *FakeDnsPoolMulti) GetPools() []*FakeDnsPool {
+	if x != nil {
+		return x.Pools
+	}
+	return nil
+}
+
+var File_app_dns_fakedns_fakedns_proto protoreflect.FileDescriptor
+
+var file_app_dns_fakedns_fakedns_proto_rawDesc = []byte{
+	0x0a, 0x1d, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e,
+	0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12,
+	0x14, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61,
+	0x6b, 0x65, 0x64, 0x6e, 0x73, 0x22, 0x40, 0x0a, 0x0b, 0x46, 0x61, 0x6b, 0x65, 0x44, 0x6e, 0x73,
+	0x50, 0x6f, 0x6f, 0x6c, 0x12, 0x17, 0x0a, 0x07, 0x69, 0x70, 0x5f, 0x70, 0x6f, 0x6f, 0x6c, 0x18,
+	0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x69, 0x70, 0x50, 0x6f, 0x6f, 0x6c, 0x12, 0x18, 0x0a,
+	0x07, 0x6c, 0x72, 0x75, 0x53, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x07,
+	0x6c, 0x72, 0x75, 0x53, 0x69, 0x7a, 0x65, 0x22, 0x4b, 0x0a, 0x10, 0x46, 0x61, 0x6b, 0x65, 0x44,
+	0x6e, 0x73, 0x50, 0x6f, 0x6f, 0x6c, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x12, 0x37, 0x0a, 0x05, 0x70,
+	0x6f, 0x6f, 0x6c, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61,
+	0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e,
+	0x73, 0x2e, 0x46, 0x61, 0x6b, 0x65, 0x44, 0x6e, 0x73, 0x50, 0x6f, 0x6f, 0x6c, 0x52, 0x05, 0x70,
+	0x6f, 0x6f, 0x6c, 0x73, 0x42, 0x5e, 0x0a, 0x18, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79,
+	0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73,
+	0x50, 0x01, 0x5a, 0x29, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78,
+	0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70,
+	0x70, 0x2f, 0x64, 0x6e, 0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73, 0xaa, 0x02, 0x14,
+	0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x2e, 0x46, 0x61, 0x6b,
+	0x65, 0x64, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
+}
+
+var (
+	file_app_dns_fakedns_fakedns_proto_rawDescOnce sync.Once
+	file_app_dns_fakedns_fakedns_proto_rawDescData = file_app_dns_fakedns_fakedns_proto_rawDesc
+)
+
+func file_app_dns_fakedns_fakedns_proto_rawDescGZIP() []byte {
+	file_app_dns_fakedns_fakedns_proto_rawDescOnce.Do(func() {
+		file_app_dns_fakedns_fakedns_proto_rawDescData = protoimpl.X.CompressGZIP(file_app_dns_fakedns_fakedns_proto_rawDescData)
+	})
+	return file_app_dns_fakedns_fakedns_proto_rawDescData
+}
+
+var file_app_dns_fakedns_fakedns_proto_msgTypes = make([]protoimpl.MessageInfo, 2)
+var file_app_dns_fakedns_fakedns_proto_goTypes = []interface{}{
+	(*FakeDnsPool)(nil),      // 0: xray.app.dns.fakedns.FakeDnsPool
+	(*FakeDnsPoolMulti)(nil), // 1: xray.app.dns.fakedns.FakeDnsPoolMulti
+}
+var file_app_dns_fakedns_fakedns_proto_depIdxs = []int32{
+	0, // 0: xray.app.dns.fakedns.FakeDnsPoolMulti.pools:type_name -> xray.app.dns.fakedns.FakeDnsPool
+	1, // [1:1] is the sub-list for method output_type
+	1, // [1:1] is the sub-list for method input_type
+	1, // [1:1] is the sub-list for extension type_name
+	1, // [1:1] is the sub-list for extension extendee
+	0, // [0:1] is the sub-list for field type_name
+}
+
+func init() { file_app_dns_fakedns_fakedns_proto_init() }
+func file_app_dns_fakedns_fakedns_proto_init() {
+	if File_app_dns_fakedns_fakedns_proto != nil {
+		return
+	}
+	if !protoimpl.UnsafeEnabled {
+		file_app_dns_fakedns_fakedns_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*FakeDnsPool); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_app_dns_fakedns_fakedns_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*FakeDnsPoolMulti); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: file_app_dns_fakedns_fakedns_proto_rawDesc,
+			NumEnums:      0,
+			NumMessages:   2,
+			NumExtensions: 0,
+			NumServices:   0,
+		},
+		GoTypes:           file_app_dns_fakedns_fakedns_proto_goTypes,
+		DependencyIndexes: file_app_dns_fakedns_fakedns_proto_depIdxs,
+		MessageInfos:      file_app_dns_fakedns_fakedns_proto_msgTypes,
+	}.Build()
+	File_app_dns_fakedns_fakedns_proto = out.File
+	file_app_dns_fakedns_fakedns_proto_rawDesc = nil
+	file_app_dns_fakedns_fakedns_proto_goTypes = nil
+	file_app_dns_fakedns_fakedns_proto_depIdxs = nil
+}

app/dns/fakedns/fakedns.proto

@@ -0,0 +1,16 @@
+syntax = "proto3";
+
+package xray.app.dns.fakedns;
+option csharp_namespace = "Xray.App.Dns.Fakedns";
+option go_package = "github.com/xtls/xray-core/app/dns/fakedns";
+option java_package = "com.xray.app.dns.fakedns";
+option java_multiple_files = true;
+
+message FakeDnsPool{
+  string ip_pool = 1; //CIDR of IP pool used as fake DNS IP
+  int64  lruSize = 2; //Size of Pool for remembering relationship between domain name and IP address
+}
+
+message FakeDnsPoolMulti{
+  repeated FakeDnsPool pools = 1;
+}

app/dns/fakedns/fakedns_test.go

@@ -0,0 +1,181 @@
+package fakedns
+
+import (
+	"testing"
+
+	gonet "net"
+
+	"github.com/stretchr/testify/assert"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/uuid"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+var ipPrefix = "198.1"
+
+func TestNewFakeDnsHolder(_ *testing.T) {
+	_, err := NewFakeDNSHolder()
+	common.Must(err)
+}
+
+func TestFakeDnsHolderCreateMapping(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
+}
+
+func TestFakeDnsHolderCreateMappingMany(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
+
+	addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
+	assert.Equal(t, ipPrefix, addr2[0].IP().String()[0:len(ipPrefix)])
+	assert.NotEqual(t, addr[0].IP().String(), addr2[0].IP().String())
+}
+
+func TestFakeDnsHolderCreateMappingManyAndResolve(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
+
+	{
+		result := fkdns.GetDomainFromFakeDNS(addr[0])
+		assert.Equal(t, "fakednstest.example.com", result)
+	}
+
+	{
+		result := fkdns.GetDomainFromFakeDNS(addr2[0])
+		assert.Equal(t, "fakednstest2.example.com", result)
+	}
+}
+
+func TestFakeDnsHolderCreateMappingManySingleDomain(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	addr2 := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	assert.Equal(t, addr[0].IP().String(), addr2[0].IP().String())
+}
+
+func TestFakeDnsHolderCreateMappingAndRollOver(t *testing.T) {
+	fkdns, err := NewFakeDNSHolderConfigOnly(&FakeDnsPool{
+		IpPool:  dns.FakeIPv4Pool,
+		LruSize: 256,
+	})
+	common.Must(err)
+
+	err = fkdns.Start()
+
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
+
+	for i := 0; i <= 8192; i++ {
+		{
+			result := fkdns.GetDomainFromFakeDNS(addr[0])
+			assert.Equal(t, "fakednstest.example.com", result)
+		}
+
+		{
+			result := fkdns.GetDomainFromFakeDNS(addr2[0])
+			assert.Equal(t, "fakednstest2.example.com", result)
+		}
+
+		{
+			uuid := uuid.New()
+			domain := uuid.String() + ".fakednstest.example.com"
+			tempAddr := fkdns.GetFakeIPForDomain(domain)
+			rsaddr := tempAddr[0].IP().String()
+
+			result := fkdns.GetDomainFromFakeDNS(net.ParseAddress(rsaddr))
+			assert.Equal(t, domain, result)
+		}
+	}
+}
+
+func TestFakeDNSMulti(t *testing.T) {
+	fakeMulti, err := NewFakeDNSHolderMulti(&FakeDnsPoolMulti{
+		Pools: []*FakeDnsPool{{
+			IpPool:  "240.0.0.0/12",
+			LruSize: 256,
+		}, {
+			IpPool:  "fddd:c5b4:ff5f:f4f0::/64",
+			LruSize: 256,
+		}},
+	},
+	)
+	common.Must(err)
+
+	err = fakeMulti.Start()
+
+	common.Must(err)
+
+	assert.Nil(t, err, "Should not throw error")
+	_ = fakeMulti
+
+	t.Run("checkInRange", func(t *testing.T) {
+		t.Run("ipv4", func(t *testing.T) {
+			inPool := fakeMulti.IsIPInIPPool(net.IPAddress([]byte{240, 0, 0, 5}))
+			assert.True(t, inPool)
+		})
+		t.Run("ipv6", func(t *testing.T) {
+			ip, err := gonet.ResolveIPAddr("ip", "fddd:c5b4:ff5f:f4f0::5")
+			assert.Nil(t, err)
+			inPool := fakeMulti.IsIPInIPPool(net.IPAddress(ip.IP))
+			assert.True(t, inPool)
+		})
+		t.Run("ipv4_inverse", func(t *testing.T) {
+			inPool := fakeMulti.IsIPInIPPool(net.IPAddress([]byte{241, 0, 0, 5}))
+			assert.False(t, inPool)
+		})
+		t.Run("ipv6_inverse", func(t *testing.T) {
+			ip, err := gonet.ResolveIPAddr("ip", "fcdd:c5b4:ff5f:f4f0::5")
+			assert.Nil(t, err)
+			inPool := fakeMulti.IsIPInIPPool(net.IPAddress(ip.IP))
+			assert.False(t, inPool)
+		})
+	})
+
+	t.Run("allocateTwoAddressForTwoPool", func(t *testing.T) {
+		address := fakeMulti.GetFakeIPForDomain("fakednstest.v2fly.org")
+		assert.Len(t, address, 2, "should be 2 address one for each pool")
+		t.Run("eachOfThemShouldResolve:0", func(t *testing.T) {
+			domain := fakeMulti.GetDomainFromFakeDNS(address[0])
+			assert.Equal(t, "fakednstest.v2fly.org", domain)
+		})
+		t.Run("eachOfThemShouldResolve:1", func(t *testing.T) {
+			domain := fakeMulti.GetDomainFromFakeDNS(address[1])
+			assert.Equal(t, "fakednstest.v2fly.org", domain)
+		})
+	})
+
+	t.Run("understandIPTypeSelector", func(t *testing.T) {
+		t.Run("ipv4", func(t *testing.T) {
+			address := fakeMulti.GetFakeIPForDomain3("fakednstestipv4.v2fly.org", true, false)
+			assert.Len(t, address, 1, "should be 1 address")
+			assert.True(t, address[0].Family().IsIPv4())
+		})
+		t.Run("ipv6", func(t *testing.T) {
+			address := fakeMulti.GetFakeIPForDomain3("fakednstestipv6.v2fly.org", false, true)
+			assert.Len(t, address, 1, "should be 1 address")
+			assert.True(t, address[0].Family().IsIPv6())
+		})
+		t.Run("ipv46", func(t *testing.T) {
+			address := fakeMulti.GetFakeIPForDomain3("fakednstestipv46.v2fly.org", true, true)
+			assert.Len(t, address, 2, "should be 2 address")
+			assert.True(t, address[0].Family().IsIPv4())
+			assert.True(t, address[1].Family().IsIPv6())
+		})
+	})
+}

app/dns/hosts.go

@@ -5,6 +5,7 @@ import (
 	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/common/strmatcher"
 	"github.com/xtls/xray-core/features"
+	"github.com/xtls/xray-core/features/dns"
 )
 
 // StaticHosts represents static domain-ip mapping in DNS server.
@@ -13,25 +14,6 @@ type StaticHosts struct {
 	matchers *strmatcher.MatcherGroup
 }
 
-var typeMap = map[DomainMatchingType]strmatcher.Type{
-	DomainMatchingType_Full:      strmatcher.Full,
-	DomainMatchingType_Subdomain: strmatcher.Domain,
-	DomainMatchingType_Keyword:   strmatcher.Substr,
-	DomainMatchingType_Regex:     strmatcher.Regex,
-}
-
-func toStrMatcher(t DomainMatchingType, domain string) (strmatcher.Matcher, error) {
-	strMType, f := typeMap[t]
-	if !f {
-		return nil, newError("unknown mapping type", t).AtWarning()
-	}
-	matcher, err := strMType.New(domain)
-	if err != nil {
-		return nil, newError("failed to create str matcher").Base(err)
-	}
-	return matcher, nil
-}
-
 // NewStaticHosts creates a new StaticHosts instance.
 func NewStaticHosts(hosts []*Config_HostMapping, legacy map[string]*net.IPOrDomain) (*StaticHosts, error) {
 	g := new(strmatcher.MatcherGroup)
@@ -65,6 +47,8 @@ func NewStaticHosts(hosts []*Config_HostMapping, legacy map[string]*net.IPOrDoma
 		id := g.Add(matcher)
 		ips := make([]net.Address, 0, len(mapping.Ip)+1)
 		switch {
+		case len(mapping.ProxiedDomain) > 0:
+			ips = append(ips, net.DomainAddress(mapping.ProxiedDomain))
 		case len(mapping.Ip) > 0:
 			for _, ip := range mapping.Ip {
 				addr := net.IPAddress(ip)
@@ -73,50 +57,53 @@ func NewStaticHosts(hosts []*Config_HostMapping, legacy map[string]*net.IPOrDoma
 				}
 				ips = append(ips, addr)
 			}
-
-		case len(mapping.ProxiedDomain) > 0:
-			ips = append(ips, net.DomainAddress(mapping.ProxiedDomain))
-
 		default:
 			return nil, newError("neither IP address nor proxied domain specified for domain: ", mapping.Domain).AtWarning()
 		}
 
-		// Special handling for localhost IPv6. This is a dirty workaround as JSON config supports only single IP mapping.
-		if len(ips) == 1 && ips[0] == net.LocalHostIP {
-			ips = append(ips, net.LocalHostIPv6)
-		}
-
 		sh.ips[id] = ips
 	}
 
 	return sh, nil
 }
 
-func filterIP(ips []net.Address, option IPOption) []net.Address {
+func filterIP(ips []net.Address, option dns.IPOption) []net.Address {
 	filtered := make([]net.Address, 0, len(ips))
 	for _, ip := range ips {
 		if (ip.Family().IsIPv4() && option.IPv4Enable) || (ip.Family().IsIPv6() && option.IPv6Enable) {
 			filtered = append(filtered, ip)
 		}
 	}
-	if len(filtered) == 0 {
-		return nil
-	}
 	return filtered
 }
 
-// LookupIP returns IP address for the given domain, if exists in this StaticHosts.
-func (h *StaticHosts) LookupIP(domain string, option IPOption) []net.Address {
-	indices := h.matchers.Match(domain)
-	if len(indices) == 0 {
-		return nil
-	}
-	ips := []net.Address{}
-	for _, id := range indices {
+func (h *StaticHosts) lookupInternal(domain string) []net.Address {
+	var ips []net.Address
+	for _, id := range h.matchers.Match(domain) {
 		ips = append(ips, h.ips[id]...)
 	}
-	if len(ips) == 1 && ips[0].Family().IsDomain() {
 	return ips
-	}
-	return filterIP(ips, option)
+}
+
+func (h *StaticHosts) lookup(domain string, option dns.IPOption, maxDepth int) []net.Address {
+	switch addrs := h.lookupInternal(domain); {
+	case len(addrs) == 0: // Not recorded in static hosts, return nil
+		return nil
+	case len(addrs) == 1 && addrs[0].Family().IsDomain(): // Try to unwrap domain
+		newError("found replaced domain: ", domain, " -> ", addrs[0].Domain(), ". Try to unwrap it").AtDebug().WriteToLog()
+		if maxDepth > 0 {
+			unwrapped := h.lookup(addrs[0].Domain(), option, maxDepth-1)
+			if unwrapped != nil {
+				return unwrapped
+			}
+		}
+		return addrs
+	default: // IP record found, return a non-nil IP array
+		return filterIP(addrs, option)
+	}
+}
+
+// Lookup returns IP addresses or proxied domain for the given domain, if exists in this StaticHosts.
+func (h *StaticHosts) Lookup(domain string, option dns.IPOption) []net.Address {
+	return h.lookup(domain, option, 5)
 }

app/dns/hosts_test.go

@@ -4,10 +4,10 @@ import (
 	"testing"
 
 	"github.com/google/go-cmp/cmp"
-
 	. "github.com/xtls/xray-core/app/dns"
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/features/dns"
 )
 
 func TestStaticHosts(t *testing.T) {
@@ -19,6 +19,20 @@ func TestStaticHosts(t *testing.T) {
 				{1, 1, 1, 1},
 			},
 		},
+		{
+			Type:   DomainMatchingType_Full,
+			Domain: "proxy.xray.com",
+			Ip: [][]byte{
+				{1, 2, 3, 4},
+				{0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1},
+			},
+			ProxiedDomain: "another-proxy.xray.com",
+		},
+		{
+			Type:          DomainMatchingType_Full,
+			Domain:        "proxy2.xray.com",
+			ProxiedDomain: "proxy.xray.com",
+		},
 		{
 			Type:   DomainMatchingType_Subdomain,
 			Domain: "example.cn",
@@ -31,6 +45,7 @@ func TestStaticHosts(t *testing.T) {
 			Domain: "baidu.com",
 			Ip: [][]byte{
 				{127, 0, 0, 1},
+				{0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1},
 			},
 		},
 	}
@@ -39,7 +54,7 @@ func TestStaticHosts(t *testing.T) {
 	common.Must(err)
 
 	{
-		ips := hosts.LookupIP("example.com", IPOption{
+		ips := hosts.Lookup("example.com", dns.IPOption{
 			IPv4Enable: true,
 			IPv6Enable: true,
 		})
@@ -52,7 +67,33 @@ func TestStaticHosts(t *testing.T) {
 	}
 
 	{
-		ips := hosts.LookupIP("www.example.cn", IPOption{
+		domain := hosts.Lookup("proxy.xray.com", dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: false,
+		})
+		if len(domain) != 1 {
+			t.Error("expect 1 domain, but got ", len(domain))
+		}
+		if diff := cmp.Diff(domain[0].Domain(), "another-proxy.xray.com"); diff != "" {
+			t.Error(diff)
+		}
+	}
+
+	{
+		domain := hosts.Lookup("proxy2.xray.com", dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: false,
+		})
+		if len(domain) != 1 {
+			t.Error("expect 1 domain, but got ", len(domain))
+		}
+		if diff := cmp.Diff(domain[0].Domain(), "another-proxy.xray.com"); diff != "" {
+			t.Error(diff)
+		}
+	}
+
+	{
+		ips := hosts.Lookup("www.example.cn", dns.IPOption{
 			IPv4Enable: true,
 			IPv6Enable: true,
 		})
@@ -65,7 +106,7 @@ func TestStaticHosts(t *testing.T) {
 	}
 
 	{
-		ips := hosts.LookupIP("baidu.com", IPOption{
+		ips := hosts.Lookup("baidu.com", dns.IPOption{
 			IPv4Enable: false,
 			IPv6Enable: true,
 		})

app/dns/nameserver.go

@@ -2,53 +2,219 @@ package dns
 
 import (
 	"context"
+	"net/url"
+	"strings"
+	"time"
 
+	"github.com/xtls/xray-core/app/router"
+	"github.com/xtls/xray-core/common/errors"
 	"github.com/xtls/xray-core/common/net"
-	"github.com/xtls/xray-core/features/dns/localdns"
+	"github.com/xtls/xray-core/common/strmatcher"
+	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/dns"
+	"github.com/xtls/xray-core/features/routing"
 )
 
-// IPOption is an object for IP query options.
-type IPOption struct {
-	IPv4Enable bool
-	IPv6Enable bool
+// Server is the interface for Name Server.
+type Server interface {
+	// Name of the Client.
+	Name() string
+	// QueryIP sends IP queries to its configured server.
+	QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns.IPOption, disableCache bool) ([]net.IP, error)
 }
 
 // Client is the interface for DNS client.
-type Client interface {
-	// Name of the Client.
-	Name() string
-
-	// QueryIP sends IP queries to its configured server.
-	QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error)
+type Client struct {
+	server       Server
+	clientIP     net.IP
+	skipFallback bool
+	domains      []string
+	expectIPs    []*router.GeoIPMatcher
 }
 
-type LocalNameServer struct {
-	client *localdns.Client
+var errExpectedIPNonMatch = errors.New("expectIPs not match")
+
+// NewServer creates a name server object according to the network destination url.
+func NewServer(dest net.Destination, dispatcher routing.Dispatcher) (Server, error) {
+	if address := dest.Address; address.Family().IsDomain() {
+		u, err := url.Parse(address.Domain())
+		if err != nil {
+			return nil, err
+		}
+		switch {
+		case strings.EqualFold(u.String(), "localhost"):
+			return NewLocalNameServer(), nil
+		case strings.EqualFold(u.Scheme, "https"): // DOH Remote mode
+			return NewDoHNameServer(u, dispatcher)
+		case strings.EqualFold(u.Scheme, "https+local"): // DOH Local mode
+			return NewDoHLocalNameServer(u), nil
+		case strings.EqualFold(u.Scheme, "quic+local"): // DNS-over-QUIC Local mode
+			return NewQUICNameServer(u)
+		case strings.EqualFold(u.Scheme, "tcp"): // DNS-over-TCP Remote mode
+			return NewTCPNameServer(u, dispatcher)
+		case strings.EqualFold(u.Scheme, "tcp+local"): // DNS-over-TCP Local mode
+			return NewTCPLocalNameServer(u)
+		case strings.EqualFold(u.String(), "fakedns"):
+			return NewFakeDNSServer(), nil
+		}
+	}
+	if dest.Network == net.Network_Unknown {
+		dest.Network = net.Network_UDP
+	}
+	if dest.Network == net.Network_UDP { // UDP classic DNS mode
+		return NewClassicNameServer(dest, dispatcher), nil
+	}
+	return nil, newError("No available name server could be created from ", dest).AtWarning()
 }
 
-func (s *LocalNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
-	if option.IPv4Enable && option.IPv6Enable {
-		return s.client.LookupIP(domain)
+// NewClient creates a DNS client managing a name server with client IP, domain rules and expected IPs.
+func NewClient(ctx context.Context, ns *NameServer, clientIP net.IP, container router.GeoIPMatcherContainer, matcherInfos *[]*DomainMatcherInfo, updateDomainRule func(strmatcher.Matcher, int, []*DomainMatcherInfo) error) (*Client, error) {
+	client := &Client{}
+
+	err := core.RequireFeatures(ctx, func(dispatcher routing.Dispatcher) error {
+		// Create a new server for each client for now
+		server, err := NewServer(ns.Address.AsDestination(), dispatcher)
+		if err != nil {
+			return newError("failed to create nameserver").Base(err).AtWarning()
 		}
 
-	if option.IPv4Enable {
-		return s.client.LookupIPv4(domain)
+		// Priotize local domains with specific TLDs or without any dot to local DNS
+		if _, isLocalDNS := server.(*LocalNameServer); isLocalDNS {
+			ns.PrioritizedDomain = append(ns.PrioritizedDomain, localTLDsAndDotlessDomains...)
+			ns.OriginalRules = append(ns.OriginalRules, localTLDsAndDotlessDomainsRule)
+			// The following lines is a solution to avoid core panics（rule index out of range） when setting `localhost` DNS client in config.
+			// Because the `localhost` DNS client will apend len(localTLDsAndDotlessDomains) rules into matcherInfos to match `geosite:private` default rule.
+			// But `matcherInfos` has no enough length to add rules, which leads to core panics (rule index out of range).
+			// To avoid this, the length of `matcherInfos` must be equal to the expected, so manually append it with Golang default zero value first for later modification.
+			// Related issues:
+			// https://github.com/v2fly/v2ray-core/issues/529
+			// https://github.com/v2fly/v2ray-core/issues/719
+			for i := 0; i < len(localTLDsAndDotlessDomains); i++ {
+				*matcherInfos = append(*matcherInfos, &DomainMatcherInfo{
+					clientIdx:     uint16(0),
+					domainRuleIdx: uint16(0),
+				})
+			}
 		}
 
-	if option.IPv6Enable {
-		return s.client.LookupIPv6(domain)
+		// Establish domain rules
+		var rules []string
+		ruleCurr := 0
+		ruleIter := 0
+		for _, domain := range ns.PrioritizedDomain {
+			domainRule, err := toStrMatcher(domain.Type, domain.Domain)
+			if err != nil {
+				return newError("failed to create prioritized domain").Base(err).AtWarning()
+			}
+			originalRuleIdx := ruleCurr
+			if ruleCurr < len(ns.OriginalRules) {
+				rule := ns.OriginalRules[ruleCurr]
+				if ruleCurr >= len(rules) {
+					rules = append(rules, rule.Rule)
+				}
+				ruleIter++
+				if ruleIter >= int(rule.Size) {
+					ruleIter = 0
+					ruleCurr++
+				}
+			} else { // No original rule, generate one according to current domain matcher (majorly for compatibility with tests)
+				rules = append(rules, domainRule.String())
+				ruleCurr++
+			}
+			err = updateDomainRule(domainRule, originalRuleIdx, *matcherInfos)
+			if err != nil {
+				return newError("failed to create prioritized domain").Base(err).AtWarning()
+			}
 		}
 
-	return nil, newError("neither IPv4 nor IPv6 is enabled")
-}
-
-func (s *LocalNameServer) Name() string {
-	return "localhost"
-}
-
-func NewLocalNameServer() *LocalNameServer {
-	newError("DNS: created localhost client").AtInfo().WriteToLog()
-	return &LocalNameServer{
-		client: localdns.New(),
+		// Establish expected IPs
+		var matchers []*router.GeoIPMatcher
+		for _, geoip := range ns.Geoip {
+			matcher, err := container.Add(geoip)
+			if err != nil {
+				return newError("failed to create ip matcher").Base(err).AtWarning()
 			}
+			matchers = append(matchers, matcher)
+		}
+
+		if len(clientIP) > 0 {
+			switch ns.Address.Address.GetAddress().(type) {
+			case *net.IPOrDomain_Domain:
+				newError("DNS: client ", ns.Address.Address.GetDomain(), " uses clientIP ", clientIP.String()).AtInfo().WriteToLog()
+			case *net.IPOrDomain_Ip:
+				newError("DNS: client ", ns.Address.Address.GetIp(), " uses clientIP ", clientIP.String()).AtInfo().WriteToLog()
+			}
+		}
+
+		client.server = server
+		client.clientIP = clientIP
+		client.skipFallback = ns.SkipFallback
+		client.domains = rules
+		client.expectIPs = matchers
+		return nil
+	})
+	return client, err
+}
+
+// NewSimpleClient creates a DNS client with a simple destination.
+func NewSimpleClient(ctx context.Context, endpoint *net.Endpoint, clientIP net.IP) (*Client, error) {
+	client := &Client{}
+	err := core.RequireFeatures(ctx, func(dispatcher routing.Dispatcher) error {
+		server, err := NewServer(endpoint.AsDestination(), dispatcher)
+		if err != nil {
+			return newError("failed to create nameserver").Base(err).AtWarning()
+		}
+		client.server = server
+		client.clientIP = clientIP
+		return nil
+	})
+
+	if len(clientIP) > 0 {
+		switch endpoint.Address.GetAddress().(type) {
+		case *net.IPOrDomain_Domain:
+			newError("DNS: client ", endpoint.Address.GetDomain(), " uses clientIP ", clientIP.String()).AtInfo().WriteToLog()
+		case *net.IPOrDomain_Ip:
+			newError("DNS: client ", endpoint.Address.GetIp(), " uses clientIP ", clientIP.String()).AtInfo().WriteToLog()
+		}
+	}
+
+	return client, err
+}
+
+// Name returns the server name the client manages.
+func (c *Client) Name() string {
+	return c.server.Name()
+}
+
+// QueryIP send DNS query to the name server with the client's IP.
+func (c *Client) QueryIP(ctx context.Context, domain string, option dns.IPOption, disableCache bool) ([]net.IP, error) {
+	ctx, cancel := context.WithTimeout(ctx, 4*time.Second)
+	ips, err := c.server.QueryIP(ctx, domain, c.clientIP, option, disableCache)
+	cancel()
+
+	if err != nil {
+		return ips, err
+	}
+	return c.MatchExpectedIPs(domain, ips)
+}
+
+// MatchExpectedIPs matches queried domain IPs with expected IPs and returns matched ones.
+func (c *Client) MatchExpectedIPs(domain string, ips []net.IP) ([]net.IP, error) {
+	if len(c.expectIPs) == 0 {
+		return ips, nil
+	}
+	newIps := []net.IP{}
+	for _, ip := range ips {
+		for _, matcher := range c.expectIPs {
+			if matcher.Match(ip) {
+				newIps = append(newIps, ip)
+				break
+			}
+		}
+	}
+	if len(newIps) == 0 {
+		return nil, errExpectedIPNonMatch
+	}
+	newError("domain ", domain, " expectIPs ", newIps, " matched at server ", c.Name()).AtDebug().WriteToLog()
+	return newIps, nil
 }

app/dns/nameserver_doh.go

@@ -5,14 +5,16 @@ import (
 	"context"
 	"fmt"
 	"io"
-	"io/ioutil"
 	"net/http"
 	"net/url"
 	"sync"
 	"sync/atomic"
 	"time"
 
+	"golang.org/x/net/dns/dnsmessage"
+
 	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/log"
 	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/common/net/cnc"
 	"github.com/xtls/xray-core/common/protocol/dns"
@@ -22,7 +24,6 @@ import (
 	dns_feature "github.com/xtls/xray-core/features/dns"
 	"github.com/xtls/xray-core/features/routing"
 	"github.com/xtls/xray-core/transport/internet"
-	"golang.org/x/net/dns/dnsmessage"
 )
 
 // DoHNameServer implemented DNS over HTTPS (RFC8484) Wire Format,
@@ -31,30 +32,80 @@ import (
 type DoHNameServer struct {
 	dispatcher routing.Dispatcher
 	sync.RWMutex
-	ips        map[string]record
+	ips        map[string]*record
 	pub        *pubsub.Service
 	cleanup    *task.Periodic
 	reqID      uint32
-	clientIP   net.IP
 	httpClient *http.Client
 	dohURL     string
 	name       string
 }
 
-// NewDoHNameServer creates DOH client object for remote resolving
-func NewDoHNameServer(url *url.URL, dispatcher routing.Dispatcher, clientIP net.IP) (*DoHNameServer, error) {
+// NewDoHNameServer creates DOH server object for remote resolving.
+func NewDoHNameServer(url *url.URL, dispatcher routing.Dispatcher) (*DoHNameServer, error) {
 	newError("DNS: created Remote DOH client for ", url.String()).AtInfo().WriteToLog()
-	s := baseDOHNameServer(url, "DOH", clientIP)
+	s := baseDOHNameServer(url, "DOH")
 
 	s.dispatcher = dispatcher
+	tr := &http.Transport{
+		MaxIdleConns:        30,
+		IdleConnTimeout:     90 * time.Second,
+		TLSHandshakeTimeout: 30 * time.Second,
+		ForceAttemptHTTP2:   true,
+		DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
+			dispatcherCtx := context.Background()
+
+			dest, err := net.ParseDestination(network + ":" + addr)
+			if err != nil {
+				return nil, err
+			}
+
+			dispatcherCtx = session.ContextWithContent(dispatcherCtx, session.ContentFromContext(ctx))
+			dispatcherCtx = session.ContextWithInbound(dispatcherCtx, session.InboundFromContext(ctx))
+			dispatcherCtx = log.ContextWithAccessMessage(dispatcherCtx, &log.AccessMessage{
+				From:   "DoH",
+				To:     s.dohURL,
+				Status: log.AccessAccepted,
+				Reason: "",
+			})
+
+			link, err := s.dispatcher.Dispatch(dispatcherCtx, dest)
+			select {
+			case <-ctx.Done():
+				return nil, ctx.Err()
+			default:
+
+			}
+			if err != nil {
+				return nil, err
+			}
+
+			cc := common.ChainedClosable{}
+			if cw, ok := link.Writer.(common.Closable); ok {
+				cc = append(cc, cw)
+			}
+			if cr, ok := link.Reader.(common.Closable); ok {
+				cc = append(cc, cr)
+			}
+			return cnc.NewConnection(
+				cnc.ConnectionInputMulti(link.Writer),
+				cnc.ConnectionOutputMulti(link.Reader),
+				cnc.ConnectionOnClose(cc),
+			), nil
+		},
+	}
+	s.httpClient = &http.Client{
+		Timeout:   time.Second * 180,
+		Transport: tr,
+	}
 
 	return s, nil
 }
 
 // NewDoHLocalNameServer creates DOH client object for local resolving
-func NewDoHLocalNameServer(url *url.URL, clientIP net.IP) *DoHNameServer {
+func NewDoHLocalNameServer(url *url.URL) *DoHNameServer {
 	url.Scheme = "https"
-	s := baseDOHNameServer(url, "DOHL", clientIP)
+	s := baseDOHNameServer(url, "DOHL")
 	tr := &http.Transport{
 		IdleConnTimeout:   90 * time.Second,
 		ForceAttemptHTTP2: true,
@@ -64,6 +115,12 @@ func NewDoHLocalNameServer(url *url.URL, clientIP net.IP) *DoHNameServer {
 				return nil, err
 			}
 			conn, err := internet.DialSystem(ctx, dest, nil)
+			log.Record(&log.AccessMessage{
+				From:   "DoH",
+				To:     s.dohURL,
+				Status: log.AccessAccepted,
+				Detour: "local",
+			})
 			if err != nil {
 				return nil, err
 			}
@@ -78,10 +135,9 @@ func NewDoHLocalNameServer(url *url.URL, clientIP net.IP) *DoHNameServer {
 	return s
 }
 
-func baseDOHNameServer(url *url.URL, prefix string, clientIP net.IP) *DoHNameServer {
+func baseDOHNameServer(url *url.URL, prefix string) *DoHNameServer {
 	s := &DoHNameServer{
-		ips:      make(map[string]record),
-		clientIP: clientIP,
+		ips:    make(map[string]*record),
 		pub:    pubsub.NewService(),
 		name:   prefix + "//" + url.Host,
 		dohURL: url.String(),
@@ -90,11 +146,10 @@ func baseDOHNameServer(url *url.URL, prefix string, clientIP net.IP) *DoHNameSer
 		Interval: time.Minute,
 		Execute:  s.Cleanup,
 	}
-
 	return s
 }
 
-// Name returns client name
+// Name implements Server.
 func (s *DoHNameServer) Name() string {
 	return s.name
 }
@@ -126,7 +181,7 @@ func (s *DoHNameServer) Cleanup() error {
 	}
 
 	if len(s.ips) == 0 {
-		s.ips = make(map[string]record)
+		s.ips = make(map[string]*record)
 	}
 
 	return nil
@@ -136,7 +191,10 @@ func (s *DoHNameServer) updateIP(req *dnsRequest, ipRec *IPRecord) {
 	elapsed := time.Since(req.start)
 
 	s.Lock()
-	rec := s.ips[req.domain]
+	rec, found := s.ips[req.domain]
+	if !found {
+		rec = &record{}
+	}
 	updated := false
 
 	switch req.reqType {
@@ -146,7 +204,7 @@ func (s *DoHNameServer) updateIP(req *dnsRequest, ipRec *IPRecord) {
 			updated = true
 		}
 	case dnsmessage.TypeAAAA:
-		addr := make([]net.Address, 0)
+		addr := make([]net.Address, 0, len(ipRec.IP))
 		for _, ip := range ipRec.IP {
 			if len(ip.IP()) == net.IPv6len {
 				addr = append(addr, ip)
@@ -177,7 +235,7 @@ func (s *DoHNameServer) newReqID() uint16 {
 	return uint16(atomic.AddUint32(&s.reqID, 1))
 }
 
-func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPOption) {
+func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption) {
 	newError(s.name, " querying: ", domain).AtInfo().WriteToLog(session.ExportIDToError(ctx))
 
 	if s.name+"." == "DOH//"+domain {
@@ -185,7 +243,7 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPO
 		return
 	}
 
-	reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
+	reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(clientIP))
 
 	var deadline time.Time
 	if d, ok := ctx.Deadline(); ok {
@@ -198,7 +256,7 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPO
 		go func(r *dnsRequest) {
 			// generate new context for each req, using same context
 			// may cause reqs all aborted if any one encounter an error
-			dnsCtx := context.Background()
+			dnsCtx := ctx
 
 			// reserve internal dns server requested Inbound
 			if inbound := session.InboundFromContext(ctx); inbound != nil {
@@ -207,7 +265,7 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPO
 
 			dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
 				Protocol:       "https",
-				//SkipRoutePick: true,
+				SkipDNSResolve: true,
 			})
 
 			// forced to use mux for DOH
@@ -249,41 +307,6 @@ func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte,
 
 	hc := s.httpClient
 
-	// Dispatched connection will be closed (interrupted) after each request
-	// This makes DOH inefficient without a keep-alived connection
-	// See: core/app/proxyman/outbound/handler.go:113
-	// Using mux (https request wrapped in a stream layer) improves the situation.
-	// Recommend to use NewDoHLocalNameServer (DOHL:) if xray instance is running on
-	//  a normal network eg. the server side of xray
-
-	if s.dispatcher != nil {
-		tr := &http.Transport{
-			MaxIdleConns:        30,
-			IdleConnTimeout:     90 * time.Second,
-			TLSHandshakeTimeout: 30 * time.Second,
-			ForceAttemptHTTP2:   true,
-			DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
-				dest, err := net.ParseDestination(network + ":" + addr)
-				if err != nil {
-					return nil, err
-				}
-
-				link, err := s.dispatcher.Dispatch(ctx, dest)
-				if err != nil {
-					return nil, err
-				}
-				return cnc.NewConnection(
-					cnc.ConnectionInputMulti(link.Writer),
-					cnc.ConnectionOutputMulti(link.Reader),
-				), nil
-			},
-		}
-		hc = &http.Client{
-			Timeout:   time.Second * 180,
-			Transport: tr,
-		}
-	}
-
 	resp, err := hc.Do(req.WithContext(ctx))
 	if err != nil {
 		return nil, err
@@ -291,14 +314,14 @@ func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte,
 
 	defer resp.Body.Close()
 	if resp.StatusCode != http.StatusOK {
-		io.Copy(ioutil.Discard, resp.Body) // flush resp.Body so that the conn is reusable
+		io.Copy(io.Discard, resp.Body) // flush resp.Body so that the conn is reusable
 		return nil, fmt.Errorf("DOH server returned code %d", resp.StatusCode)
 	}
 
-	return ioutil.ReadAll(resp.Body)
+	return io.ReadAll(resp.Body)
 }
 
-func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.IP, error) {
+func (s *DoHNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
 	s.RLock()
 	record, found := s.ips[domain]
 	s.RUnlock()
@@ -307,30 +330,30 @@ func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.
 		return nil, errRecordNotFound
 	}
 
+	var err4 error
+	var err6 error
 	var ips []net.Address
-	var lastErr error
-	if option.IPv6Enable && record.AAAA != nil && record.AAAA.RCode == dnsmessage.RCodeSuccess {
-		aaaa, err := record.AAAA.getIPs()
-		if err != nil {
-			lastErr = err
-		}
-		ips = append(ips, aaaa...)
+	var ip6 []net.Address
+
+	if option.IPv4Enable {
+		ips, err4 = record.A.getIPs()
 	}
 
-	if option.IPv4Enable && record.A != nil && record.A.RCode == dnsmessage.RCodeSuccess {
-		a, err := record.A.getIPs()
-		if err != nil {
-			lastErr = err
-		}
-		ips = append(ips, a...)
+	if option.IPv6Enable {
+		ip6, err6 = record.AAAA.getIPs()
+		ips = append(ips, ip6...)
 	}
 
 	if len(ips) > 0 {
-		return toNetIP(ips), nil
+		return toNetIP(ips)
 	}
 
-	if lastErr != nil {
-		return nil, lastErr
+	if err4 != nil {
+		return nil, err4
+	}
+
+	if err6 != nil {
+		return nil, err6
 	}
 
 	if (option.IPv4Enable && record.A != nil) || (option.IPv6Enable && record.AAAA != nil) {
@@ -340,15 +363,20 @@ func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.
 	return nil, errRecordNotFound
 }
 
-// QueryIP is called from dns.Server->queryIPTimeout
-func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
+// QueryIP implements Server.
+func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption, disableCache bool) ([]net.IP, error) { // nolint: dupl
 	fqdn := Fqdn(domain)
 
+	if disableCache {
+		newError("DNS cache is disabled. Querying IP for ", domain, " at ", s.name).AtDebug().WriteToLog()
+	} else {
 		ips, err := s.findIPsForDomain(fqdn, option)
 		if err != errRecordNotFound {
 			newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
+			log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSCacheHit, Elapsed: 0, Error: err})
 			return ips, err
 		}
+	}
 
 	// ipv4 and ipv6 belong to different subscription groups
 	var sub4, sub6 *pubsub.Subscriber
@@ -376,11 +404,13 @@ func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option IPOpt
 		}
 		close(done)
 	}()
-	s.sendQuery(ctx, fqdn, option)
+	s.sendQuery(ctx, fqdn, clientIP, option)
+	start := time.Now()
 
 	for {
 		ips, err := s.findIPsForDomain(fqdn, option)
 		if err != errRecordNotFound {
+			log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
 			return ips, err
 		}
 

app/dns/nameserver_doh_test.go

@@ -0,0 +1,60 @@
+package dns_test
+
+import (
+	"context"
+	"net/url"
+	"testing"
+	"time"
+
+	"github.com/google/go-cmp/cmp"
+
+	. "github.com/xtls/xray-core/app/dns"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+)
+
+func TestDOHNameServer(t *testing.T) {
+	url, err := url.Parse("https+local://1.1.1.1/dns-query")
+	common.Must(err)
+
+	s := NewDoHLocalNameServer(url)
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	}, false)
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+}
+
+func TestDOHNameServerWithCache(t *testing.T) {
+	url, err := url.Parse("https+local://1.1.1.1/dns-query")
+	common.Must(err)
+
+	s := NewDoHLocalNameServer(url)
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	}, false)
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+
+	ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips2, err := s.QueryIP(ctx2, "google.com", net.IP(nil), dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	}, true)
+	cancel()
+	common.Must(err)
+	if r := cmp.Diff(ips2, ips); r != "" {
+		t.Fatal(r)
+	}
+}

app/dns/nameserver_fakedns.go

@@ -0,0 +1,49 @@
+package dns
+
+import (
+	"context"
+
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+type FakeDNSServer struct {
+	fakeDNSEngine dns.FakeDNSEngine
+}
+
+func NewFakeDNSServer() *FakeDNSServer {
+	return &FakeDNSServer{}
+}
+
+func (FakeDNSServer) Name() string {
+	return "FakeDNS"
+}
+
+func (f *FakeDNSServer) QueryIP(ctx context.Context, domain string, _ net.IP, opt dns.IPOption, _ bool) ([]net.IP, error) {
+	if f.fakeDNSEngine == nil {
+		if err := core.RequireFeatures(ctx, func(fd dns.FakeDNSEngine) {
+			f.fakeDNSEngine = fd
+		}); err != nil {
+			return nil, newError("Unable to locate a fake DNS Engine").Base(err).AtError()
+		}
+	}
+	var ips []net.Address
+	if fkr0, ok := f.fakeDNSEngine.(dns.FakeDNSEngineRev0); ok {
+		ips = fkr0.GetFakeIPForDomain3(domain, opt.IPv4Enable, opt.IPv6Enable)
+	} else {
+		ips = f.fakeDNSEngine.GetFakeIPForDomain(domain)
+	}
+
+	netIP, err := toNetIP(ips)
+	if err != nil {
+		return nil, newError("Unable to convert IP to net ip").Base(err).AtError()
+	}
+
+	newError(f.Name(), " got answer: ", domain, " -> ", ips).AtInfo().WriteToLog()
+
+	if len(netIP) > 0 {
+		return netIP, nil
+	}
+	return nil, dns.ErrEmptyResponse
+}

app/dns/nameserver_local.go

@@ -0,0 +1,51 @@
+package dns
+
+import (
+	"context"
+	"strings"
+
+	"github.com/xtls/xray-core/features/dns"
+
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/features/dns/localdns"
+)
+
+// LocalNameServer is an wrapper over local DNS feature.
+type LocalNameServer struct {
+	client *localdns.Client
+}
+
+const errEmptyResponse = "No address associated with hostname"
+
+// QueryIP implements Server.
+func (s *LocalNameServer) QueryIP(_ context.Context, domain string, _ net.IP, option dns.IPOption, _ bool) (ips []net.IP, err error) {
+	ips, err = s.client.LookupIP(domain, option)
+
+	if err != nil && strings.HasSuffix(err.Error(), errEmptyResponse) {
+		err = dns.ErrEmptyResponse
+	}
+
+	if len(ips) > 0 {
+		newError("Localhost got answer: ", domain, " -> ", ips).AtInfo().WriteToLog()
+	}
+
+	return
+}
+
+// Name implements Server.
+func (s *LocalNameServer) Name() string {
+	return "localhost"
+}
+
+// NewLocalNameServer creates localdns server object for directly lookup in system DNS.
+func NewLocalNameServer() *LocalNameServer {
+	newError("DNS: created localhost client").AtInfo().WriteToLog()
+	return &LocalNameServer{
+		client: localdns.New(),
+	}
+}
+
+// NewLocalDNSClient creates localdns client object for directly lookup in system DNS.
+func NewLocalDNSClient() *Client {
+	return &Client{server: NewLocalNameServer()}
+}

app/dns/nameserver_local_test.go

@@ -5,17 +5,21 @@ import (
 	"testing"
 	"time"
 
+	"github.com/xtls/xray-core/common/net"
+
 	. "github.com/xtls/xray-core/app/dns"
 	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/features/dns"
 )
 
 func TestLocalNameServer(t *testing.T) {
 	s := NewLocalNameServer()
 	ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
-	ips, err := s.QueryIP(ctx, "google.com", IPOption{
+	ips, err := s.QueryIP(ctx, "google.com", net.IP{}, dns.IPOption{
 		IPv4Enable: true,
 		IPv6Enable: true,
-	})
+		FakeEnable: false,
+	}, false)
 	cancel()
 	common.Must(err)
 	if len(ips) == 0 {

app/dns/nameserver_quic.go

@@ -0,0 +1,389 @@
+package dns
+
+import (
+	"context"
+	"net/url"
+	"sync"
+	"sync/atomic"
+	"time"
+
+	"github.com/lucas-clemente/quic-go"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/buf"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/protocol/dns"
+	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/common/signal/pubsub"
+	"github.com/xtls/xray-core/common/task"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+	"github.com/xtls/xray-core/transport/internet/tls"
+	"golang.org/x/net/dns/dnsmessage"
+	"golang.org/x/net/http2"
+)
+
+// NextProtoDQ - During connection establishment, DNS/QUIC support is indicated
+// by selecting the ALPN token "dq" in the crypto handshake.
+const NextProtoDQ = "doq-i00"
+
+const handshakeTimeout = time.Second * 8
+
+// QUICNameServer implemented DNS over QUIC
+type QUICNameServer struct {
+	sync.RWMutex
+	ips         map[string]*record
+	pub         *pubsub.Service
+	cleanup     *task.Periodic
+	reqID       uint32
+	name        string
+	destination *net.Destination
+	session     quic.Session
+}
+
+// NewQUICNameServer creates DNS-over-QUIC client object for local resolving
+func NewQUICNameServer(url *url.URL) (*QUICNameServer, error) {
+	newError("DNS: created Local DNS-over-QUIC client for ", url.String()).AtInfo().WriteToLog()
+
+	var err error
+	port := net.Port(784)
+	if url.Port() != "" {
+		port, err = net.PortFromString(url.Port())
+		if err != nil {
+			return nil, err
+		}
+	}
+	dest := net.UDPDestination(net.ParseAddress(url.Hostname()), port)
+
+	s := &QUICNameServer{
+		ips:         make(map[string]*record),
+		pub:         pubsub.NewService(),
+		name:        url.String(),
+		destination: &dest,
+	}
+	s.cleanup = &task.Periodic{
+		Interval: time.Minute,
+		Execute:  s.Cleanup,
+	}
+
+	return s, nil
+}
+
+// Name returns client name
+func (s *QUICNameServer) Name() string {
+	return s.name
+}
+
+// Cleanup clears expired items from cache
+func (s *QUICNameServer) Cleanup() error {
+	now := time.Now()
+	s.Lock()
+	defer s.Unlock()
+
+	if len(s.ips) == 0 {
+		return newError("nothing to do. stopping...")
+	}
+
+	for domain, record := range s.ips {
+		if record.A != nil && record.A.Expire.Before(now) {
+			record.A = nil
+		}
+		if record.AAAA != nil && record.AAAA.Expire.Before(now) {
+			record.AAAA = nil
+		}
+
+		if record.A == nil && record.AAAA == nil {
+			newError(s.name, " cleanup ", domain).AtDebug().WriteToLog()
+			delete(s.ips, domain)
+		} else {
+			s.ips[domain] = record
+		}
+	}
+
+	if len(s.ips) == 0 {
+		s.ips = make(map[string]*record)
+	}
+
+	return nil
+}
+
+func (s *QUICNameServer) updateIP(req *dnsRequest, ipRec *IPRecord) {
+	elapsed := time.Since(req.start)
+
+	s.Lock()
+	rec, found := s.ips[req.domain]
+	if !found {
+		rec = &record{}
+	}
+	updated := false
+
+	switch req.reqType {
+	case dnsmessage.TypeA:
+		if isNewer(rec.A, ipRec) {
+			rec.A = ipRec
+			updated = true
+		}
+	case dnsmessage.TypeAAAA:
+		addr := make([]net.Address, 0)
+		for _, ip := range ipRec.IP {
+			if len(ip.IP()) == net.IPv6len {
+				addr = append(addr, ip)
+			}
+		}
+		ipRec.IP = addr
+		if isNewer(rec.AAAA, ipRec) {
+			rec.AAAA = ipRec
+			updated = true
+		}
+	}
+	newError(s.name, " got answer: ", req.domain, " ", req.reqType, " -> ", ipRec.IP, " ", elapsed).AtInfo().WriteToLog()
+
+	if updated {
+		s.ips[req.domain] = rec
+	}
+	switch req.reqType {
+	case dnsmessage.TypeA:
+		s.pub.Publish(req.domain+"4", nil)
+	case dnsmessage.TypeAAAA:
+		s.pub.Publish(req.domain+"6", nil)
+	}
+	s.Unlock()
+	common.Must(s.cleanup.Start())
+}
+
+func (s *QUICNameServer) newReqID() uint16 {
+	return uint16(atomic.AddUint32(&s.reqID, 1))
+}
+
+func (s *QUICNameServer) sendQuery(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption) {
+	newError(s.name, " querying: ", domain).AtInfo().WriteToLog(session.ExportIDToError(ctx))
+
+	reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(clientIP))
+
+	var deadline time.Time
+	if d, ok := ctx.Deadline(); ok {
+		deadline = d
+	} else {
+		deadline = time.Now().Add(time.Second * 5)
+	}
+
+	for _, req := range reqs {
+		go func(r *dnsRequest) {
+			// generate new context for each req, using same context
+			// may cause reqs all aborted if any one encounter an error
+			dnsCtx := ctx
+
+			// reserve internal dns server requested Inbound
+			if inbound := session.InboundFromContext(ctx); inbound != nil {
+				dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
+			}
+
+			dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
+				Protocol:       "quic",
+				SkipDNSResolve: true,
+			})
+
+			var cancel context.CancelFunc
+			dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
+			defer cancel()
+
+			b, err := dns.PackMessage(r.msg)
+			if err != nil {
+				newError("failed to pack dns query").Base(err).AtError().WriteToLog()
+				return
+			}
+
+			conn, err := s.openStream(dnsCtx)
+			if err != nil {
+				newError("failed to open quic session").Base(err).AtError().WriteToLog()
+				return
+			}
+
+			_, err = conn.Write(b.Bytes())
+			if err != nil {
+				newError("failed to send query").Base(err).AtError().WriteToLog()
+				return
+			}
+
+			_ = conn.Close()
+
+			respBuf := buf.New()
+			defer respBuf.Release()
+			n, err := respBuf.ReadFrom(conn)
+			if err != nil && n == 0 {
+				newError("failed to read response").Base(err).AtError().WriteToLog()
+				return
+			}
+
+			rec, err := parseResponse(respBuf.Bytes())
+			if err != nil {
+				newError("failed to handle response").Base(err).AtError().WriteToLog()
+				return
+			}
+			s.updateIP(r, rec)
+		}(req)
+	}
+}
+
+func (s *QUICNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
+	s.RLock()
+	record, found := s.ips[domain]
+	s.RUnlock()
+
+	if !found {
+		return nil, errRecordNotFound
+	}
+
+	var err4 error
+	var err6 error
+	var ips []net.Address
+	var ip6 []net.Address
+
+	if option.IPv4Enable {
+		ips, err4 = record.A.getIPs()
+	}
+
+	if option.IPv6Enable {
+		ip6, err6 = record.AAAA.getIPs()
+		ips = append(ips, ip6...)
+	}
+
+	if len(ips) > 0 {
+		return toNetIP(ips)
+	}
+
+	if err4 != nil {
+		return nil, err4
+	}
+
+	if err6 != nil {
+		return nil, err6
+	}
+
+	if (option.IPv4Enable && record.A != nil) || (option.IPv6Enable && record.AAAA != nil) {
+		return nil, dns_feature.ErrEmptyResponse
+	}
+
+	return nil, errRecordNotFound
+}
+
+// QueryIP is called from dns.Server->queryIPTimeout
+func (s *QUICNameServer) QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption, disableCache bool) ([]net.IP, error) {
+	fqdn := Fqdn(domain)
+
+	if disableCache {
+		newError("DNS cache is disabled. Querying IP for ", domain, " at ", s.name).AtDebug().WriteToLog()
+	} else {
+		ips, err := s.findIPsForDomain(fqdn, option)
+		if err != errRecordNotFound {
+			newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
+			return ips, err
+		}
+	}
+
+	// ipv4 and ipv6 belong to different subscription groups
+	var sub4, sub6 *pubsub.Subscriber
+	if option.IPv4Enable {
+		sub4 = s.pub.Subscribe(fqdn + "4")
+		defer sub4.Close()
+	}
+	if option.IPv6Enable {
+		sub6 = s.pub.Subscribe(fqdn + "6")
+		defer sub6.Close()
+	}
+	done := make(chan interface{})
+	go func() {
+		if sub4 != nil {
+			select {
+			case <-sub4.Wait():
+			case <-ctx.Done():
+			}
+		}
+		if sub6 != nil {
+			select {
+			case <-sub6.Wait():
+			case <-ctx.Done():
+			}
+		}
+		close(done)
+	}()
+	s.sendQuery(ctx, fqdn, clientIP, option)
+
+	for {
+		ips, err := s.findIPsForDomain(fqdn, option)
+		if err != errRecordNotFound {
+			return ips, err
+		}
+
+		select {
+		case <-ctx.Done():
+			return nil, ctx.Err()
+		case <-done:
+		}
+	}
+}
+
+func isActive(s quic.Session) bool {
+	select {
+	case <-s.Context().Done():
+		return false
+	default:
+		return true
+	}
+}
+
+func (s *QUICNameServer) getSession() (quic.Session, error) {
+	var session quic.Session
+	s.RLock()
+	session = s.session
+	if session != nil && isActive(session) {
+		s.RUnlock()
+		return session, nil
+	}
+	if session != nil {
+		// we're recreating the session, let's create a new one
+		_ = session.CloseWithError(0, "")
+	}
+	s.RUnlock()
+
+	s.Lock()
+	defer s.Unlock()
+
+	var err error
+	session, err = s.openSession()
+	if err != nil {
+		// This does not look too nice, but QUIC (or maybe quic-go)
+		// doesn't seem stable enough.
+		// Maybe retransmissions aren't fully implemented in quic-go?
+		// Anyways, the simple solution is to make a second try when
+		// it fails to open the QUIC session.
+		session, err = s.openSession()
+		if err != nil {
+			return nil, err
+		}
+	}
+	s.session = session
+	return session, nil
+}
+
+func (s *QUICNameServer) openSession() (quic.Session, error) {
+	tlsConfig := tls.Config{}
+	quicConfig := &quic.Config{
+		HandshakeIdleTimeout: handshakeTimeout,
+	}
+
+	session, err := quic.DialAddrContext(context.Background(), s.destination.NetAddr(), tlsConfig.GetTLSConfig(tls.WithNextProto("http/1.1", http2.NextProtoTLS, NextProtoDQ)), quicConfig)
+	if err != nil {
+		return nil, err
+	}
+
+	return session, nil
+}
+
+func (s *QUICNameServer) openStream(ctx context.Context) (quic.Stream, error) {
+	session, err := s.getSession()
+	if err != nil {
+		return nil, err
+	}
+
+	// open a new stream
+	return session.OpenStreamSync(ctx)
+}

app/dns/nameserver_quic_test.go

@@ -0,0 +1,44 @@
+package dns_test
+
+import (
+	"context"
+	"net/url"
+	"testing"
+	"time"
+
+	"github.com/xtls/xray-core/features/dns"
+
+	"github.com/google/go-cmp/cmp"
+
+	. "github.com/xtls/xray-core/app/dns"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+)
+
+func TestQUICNameServer(t *testing.T) {
+	url, err := url.Parse("quic://dns.adguard.com")
+	common.Must(err)
+	s, err := NewQUICNameServer(url)
+	common.Must(err)
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
+	ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	}, false)
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+
+	ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips2, err := s.QueryIP(ctx2, "google.com", net.IP(nil), dns.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	}, true)
+	cancel()
+	common.Must(err)
+	if r := cmp.Diff(ips2, ips); r != "" {
+		t.Fatal(r)
+	}
+}

app/dns/nameserver_tcp.go

@@ -0,0 +1,362 @@
+package dns
+
+import (
+	"bytes"
+	"context"
+	"encoding/binary"
+	"net/url"
+	"sync"
+	"sync/atomic"
+	"time"
+
+	"golang.org/x/net/dns/dnsmessage"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/buf"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/net/cnc"
+	"github.com/xtls/xray-core/common/protocol/dns"
+	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/common/signal/pubsub"
+	"github.com/xtls/xray-core/common/task"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+	"github.com/xtls/xray-core/features/routing"
+	"github.com/xtls/xray-core/transport/internet"
+)
+
+// TCPNameServer implemented DNS over TCP (RFC7766).
+type TCPNameServer struct {
+	sync.RWMutex
+	name        string
+	destination *net.Destination
+	ips         map[string]*record
+	pub         *pubsub.Service
+	cleanup     *task.Periodic
+	reqID       uint32
+	dial        func(context.Context) (net.Conn, error)
+}
+
+// NewTCPNameServer creates DNS over TCP server object for remote resolving.
+func NewTCPNameServer(url *url.URL, dispatcher routing.Dispatcher) (*TCPNameServer, error) {
+	s, err := baseTCPNameServer(url, "TCP")
+	if err != nil {
+		return nil, err
+	}
+
+	s.dial = func(ctx context.Context) (net.Conn, error) {
+		link, err := dispatcher.Dispatch(ctx, *s.destination)
+		if err != nil {
+			return nil, err
+		}
+
+		return cnc.NewConnection(
+			cnc.ConnectionInputMulti(link.Writer),
+			cnc.ConnectionOutputMulti(link.Reader),
+		), nil
+	}
+
+	return s, nil
+}
+
+// NewTCPLocalNameServer creates DNS over TCP client object for local resolving
+func NewTCPLocalNameServer(url *url.URL) (*TCPNameServer, error) {
+	s, err := baseTCPNameServer(url, "TCPL")
+	if err != nil {
+		return nil, err
+	}
+
+	s.dial = func(ctx context.Context) (net.Conn, error) {
+		return internet.DialSystem(ctx, *s.destination, nil)
+	}
+
+	return s, nil
+}
+
+func baseTCPNameServer(url *url.URL, prefix string) (*TCPNameServer, error) {
+	var err error
+	port := net.Port(53)
+	if url.Port() != "" {
+		port, err = net.PortFromString(url.Port())
+		if err != nil {
+			return nil, err
+		}
+	}
+	dest := net.TCPDestination(net.ParseAddress(url.Hostname()), port)
+
+	s := &TCPNameServer{
+		destination: &dest,
+		ips:         make(map[string]*record),
+		pub:         pubsub.NewService(),
+		name:        prefix + "//" + dest.NetAddr(),
+	}
+	s.cleanup = &task.Periodic{
+		Interval: time.Minute,
+		Execute:  s.Cleanup,
+	}
+
+	return s, nil
+}
+
+// Name implements Server.
+func (s *TCPNameServer) Name() string {
+	return s.name
+}
+
+// Cleanup clears expired items from cache
+func (s *TCPNameServer) Cleanup() error {
+	now := time.Now()
+	s.Lock()
+	defer s.Unlock()
+
+	if len(s.ips) == 0 {
+		return newError("nothing to do. stopping...")
+	}
+
+	for domain, record := range s.ips {
+		if record.A != nil && record.A.Expire.Before(now) {
+			record.A = nil
+		}
+		if record.AAAA != nil && record.AAAA.Expire.Before(now) {
+			record.AAAA = nil
+		}
+
+		if record.A == nil && record.AAAA == nil {
+			newError(s.name, " cleanup ", domain).AtDebug().WriteToLog()
+			delete(s.ips, domain)
+		} else {
+			s.ips[domain] = record
+		}
+	}
+
+	if len(s.ips) == 0 {
+		s.ips = make(map[string]*record)
+	}
+
+	return nil
+}
+
+func (s *TCPNameServer) updateIP(req *dnsRequest, ipRec *IPRecord) {
+	elapsed := time.Since(req.start)
+
+	s.Lock()
+	rec, found := s.ips[req.domain]
+	if !found {
+		rec = &record{}
+	}
+	updated := false
+
+	switch req.reqType {
+	case dnsmessage.TypeA:
+		if isNewer(rec.A, ipRec) {
+			rec.A = ipRec
+			updated = true
+		}
+	case dnsmessage.TypeAAAA:
+		addr := make([]net.Address, 0)
+		for _, ip := range ipRec.IP {
+			if len(ip.IP()) == net.IPv6len {
+				addr = append(addr, ip)
+			}
+		}
+		ipRec.IP = addr
+		if isNewer(rec.AAAA, ipRec) {
+			rec.AAAA = ipRec
+			updated = true
+		}
+	}
+	newError(s.name, " got answer: ", req.domain, " ", req.reqType, " -> ", ipRec.IP, " ", elapsed).AtInfo().WriteToLog()
+
+	if updated {
+		s.ips[req.domain] = rec
+	}
+	switch req.reqType {
+	case dnsmessage.TypeA:
+		s.pub.Publish(req.domain+"4", nil)
+	case dnsmessage.TypeAAAA:
+		s.pub.Publish(req.domain+"6", nil)
+	}
+	s.Unlock()
+	common.Must(s.cleanup.Start())
+}
+
+func (s *TCPNameServer) newReqID() uint16 {
+	return uint16(atomic.AddUint32(&s.reqID, 1))
+}
+
+func (s *TCPNameServer) sendQuery(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption) {
+	newError(s.name, " querying DNS for: ", domain).AtDebug().WriteToLog(session.ExportIDToError(ctx))
+
+	reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(clientIP))
+
+	var deadline time.Time
+	if d, ok := ctx.Deadline(); ok {
+		deadline = d
+	} else {
+		deadline = time.Now().Add(time.Second * 5)
+	}
+
+	for _, req := range reqs {
+		go func(r *dnsRequest) {
+			dnsCtx := ctx
+
+			if inbound := session.InboundFromContext(ctx); inbound != nil {
+				dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
+			}
+
+			dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
+				Protocol:       "dns",
+				SkipDNSResolve: true,
+			})
+
+			var cancel context.CancelFunc
+			dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
+			defer cancel()
+
+			b, err := dns.PackMessage(r.msg)
+			if err != nil {
+				newError("failed to pack dns query").Base(err).AtError().WriteToLog()
+				return
+			}
+
+			conn, err := s.dial(dnsCtx)
+			if err != nil {
+				newError("failed to dial namesever").Base(err).AtError().WriteToLog()
+				return
+			}
+			defer conn.Close()
+			dnsReqBuf := buf.New()
+			binary.Write(dnsReqBuf, binary.BigEndian, uint16(b.Len()))
+			dnsReqBuf.Write(b.Bytes())
+			b.Release()
+
+			_, err = conn.Write(dnsReqBuf.Bytes())
+			if err != nil {
+				newError("failed to send query").Base(err).AtError().WriteToLog()
+				return
+			}
+			dnsReqBuf.Release()
+
+			respBuf := buf.New()
+			defer respBuf.Release()
+			n, err := respBuf.ReadFullFrom(conn, 2)
+			if err != nil && n == 0 {
+				newError("failed to read response length").Base(err).AtError().WriteToLog()
+				return
+			}
+			var length int16
+			err = binary.Read(bytes.NewReader(respBuf.Bytes()), binary.BigEndian, &length)
+			if err != nil {
+				newError("failed to parse response length").Base(err).AtError().WriteToLog()
+				return
+			}
+			respBuf.Clear()
+			n, err = respBuf.ReadFullFrom(conn, int32(length))
+			if err != nil && n == 0 {
+				newError("failed to read response length").Base(err).AtError().WriteToLog()
+				return
+			}
+
+			rec, err := parseResponse(respBuf.Bytes())
+			if err != nil {
+				newError("failed to parse DNS over TCP response").Base(err).AtError().WriteToLog()
+				return
+			}
+
+			s.updateIP(r, rec)
+		}(req)
+	}
+}
+
+func (s *TCPNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
+	s.RLock()
+	record, found := s.ips[domain]
+	s.RUnlock()
+
+	if !found {
+		return nil, errRecordNotFound
+	}
+
+	var err4 error
+	var err6 error
+	var ips []net.Address
+	var ip6 []net.Address
+
+	if option.IPv4Enable {
+		ips, err4 = record.A.getIPs()
+	}
+
+	if option.IPv6Enable {
+		ip6, err6 = record.AAAA.getIPs()
+		ips = append(ips, ip6...)
+	}
+
+	if len(ips) > 0 {
+		return toNetIP(ips)
+	}
+
+	if err4 != nil {
+		return nil, err4
+	}
+
+	if err6 != nil {
+		return nil, err6
+	}
+
+	return nil, dns_feature.ErrEmptyResponse
+}
+
+// QueryIP implements Server.
+func (s *TCPNameServer) QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption, disableCache bool) ([]net.IP, error) {
+	fqdn := Fqdn(domain)
+
+	if disableCache {
+		newError("DNS cache is disabled. Querying IP for ", domain, " at ", s.name).AtDebug().WriteToLog()
+	} else {
+		ips, err := s.findIPsForDomain(fqdn, option)
+		if err != errRecordNotFound {
+			newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
+			return ips, err
+		}
+	}
+
+	// ipv4 and ipv6 belong to different subscription groups
+	var sub4, sub6 *pubsub.Subscriber
+	if option.IPv4Enable {
+		sub4 = s.pub.Subscribe(fqdn + "4")
+		defer sub4.Close()
+	}
+	if option.IPv6Enable {
+		sub6 = s.pub.Subscribe(fqdn + "6")
+		defer sub6.Close()
+	}
+	done := make(chan interface{})
+	go func() {
+		if sub4 != nil {
+			select {
+			case <-sub4.Wait():
+			case <-ctx.Done():
+			}
+		}
+		if sub6 != nil {
+			select {
+			case <-sub6.Wait():
+			case <-ctx.Done():
+			}
+		}
+		close(done)
+	}()
+	s.sendQuery(ctx, fqdn, clientIP, option)
+
+	for {
+		ips, err := s.findIPsForDomain(fqdn, option)
+		if err != errRecordNotFound {
+			return ips, err
+		}
+
+		select {
+		case <-ctx.Done():
+			return nil, ctx.Err()
+		case <-done:
+		}
+	}
+}

app/dns/nameserver_tcp_test.go

@@ -0,0 +1,60 @@
+package dns_test
+
+import (
+	"context"
+	"net/url"
+	"testing"
+	"time"
+
+	"github.com/google/go-cmp/cmp"
+
+	. "github.com/xtls/xray-core/app/dns"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+)
+
+func TestTCPLocalNameServer(t *testing.T) {
+	url, err := url.Parse("tcp+local://8.8.8.8")
+	common.Must(err)
+	s, err := NewTCPLocalNameServer(url)
+	common.Must(err)
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	}, false)
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+}
+
+func TestTCPLocalNameServerWithCache(t *testing.T) {
+	url, err := url.Parse("tcp+local://8.8.8.8")
+	common.Must(err)
+	s, err := NewTCPLocalNameServer(url)
+	common.Must(err)
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	}, false)
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+
+	ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips2, err := s.QueryIP(ctx2, "google.com", net.IP(nil), dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	}, true)
+	cancel()
+	common.Must(err)
+	if r := cmp.Diff(ips2, ips); r != "" {
+		t.Fatal(r)
+	}
+}

app/dns/nameserver_udp.go

@@ -7,7 +7,10 @@ import (
 	"sync/atomic"
 	"time"
 
+	"golang.org/x/net/dns/dnsmessage"
+
 	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/log"
 	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/common/protocol/dns"
 	udp_proto "github.com/xtls/xray-core/common/protocol/udp"
@@ -17,33 +20,32 @@ import (
 	dns_feature "github.com/xtls/xray-core/features/dns"
 	"github.com/xtls/xray-core/features/routing"
 	"github.com/xtls/xray-core/transport/internet/udp"
-	"golang.org/x/net/dns/dnsmessage"
 )
 
+// ClassicNameServer implemented traditional UDP DNS.
 type ClassicNameServer struct {
 	sync.RWMutex
 	name      string
-	address   net.Destination
-	ips       map[string]record
-	requests  map[uint16]dnsRequest
+	address   *net.Destination
+	ips       map[string]*record
+	requests  map[uint16]*dnsRequest
 	pub       *pubsub.Service
 	udpServer *udp.Dispatcher
 	cleanup   *task.Periodic
 	reqID     uint32
-	clientIP  net.IP
 }
 
-func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher, clientIP net.IP) *ClassicNameServer {
+// NewClassicNameServer creates udp server object for remote resolving.
+func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher) *ClassicNameServer {
 	// default to 53 if unspecific
 	if address.Port == 0 {
 		address.Port = net.Port(53)
 	}
 
 	s := &ClassicNameServer{
-		address:  address,
-		ips:      make(map[string]record),
-		requests: make(map[uint16]dnsRequest),
-		clientIP: clientIP,
+		address:  &address,
+		ips:      make(map[string]*record),
+		requests: make(map[uint16]*dnsRequest),
 		pub:      pubsub.NewService(),
 		name:     strings.ToUpper(address.String()),
 	}
@@ -52,14 +54,16 @@ func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher
 		Execute:  s.Cleanup,
 	}
 	s.udpServer = udp.NewDispatcher(dispatcher, s.HandleResponse)
-	newError("DNS: created udp client inited for ", address.NetAddr()).AtInfo().WriteToLog()
+	newError("DNS: created UDP client initialized for ", address.NetAddr()).AtInfo().WriteToLog()
 	return s
 }
 
+// Name implements Server.
 func (s *ClassicNameServer) Name() string {
 	return s.name
 }
 
+// Cleanup clears expired items from cache
 func (s *ClassicNameServer) Cleanup() error {
 	now := time.Now()
 	s.Lock()
@@ -78,6 +82,7 @@ func (s *ClassicNameServer) Cleanup() error {
 		}
 
 		if record.A == nil && record.AAAA == nil {
+			newError(s.name, " cleanup ", domain).AtDebug().WriteToLog()
 			delete(s.ips, domain)
 		} else {
 			s.ips[domain] = record
@@ -85,7 +90,7 @@ func (s *ClassicNameServer) Cleanup() error {
 	}
 
 	if len(s.ips) == 0 {
-		s.ips = make(map[string]record)
+		s.ips = make(map[string]*record)
 	}
 
 	for id, req := range s.requests {
@@ -95,12 +100,13 @@ func (s *ClassicNameServer) Cleanup() error {
 	}
 
 	if len(s.requests) == 0 {
-		s.requests = make(map[uint16]dnsRequest)
+		s.requests = make(map[uint16]*dnsRequest)
 	}
 
 	return nil
 }
 
+// HandleResponse handles udp response packet from remote DNS server.
 func (s *ClassicNameServer) HandleResponse(ctx context.Context, packet *udp_proto.Packet) {
 	ipRec, err := parseResponse(packet.Payload.Bytes())
 	if err != nil {
@@ -132,15 +138,17 @@ func (s *ClassicNameServer) HandleResponse(ctx context.Context, packet *udp_prot
 	elapsed := time.Since(req.start)
 	newError(s.name, " got answer: ", req.domain, " ", req.reqType, " -> ", ipRec.IP, " ", elapsed).AtInfo().WriteToLog()
 	if len(req.domain) > 0 && (rec.A != nil || rec.AAAA != nil) {
-		s.updateIP(req.domain, rec)
+		s.updateIP(req.domain, &rec)
 	}
 }
 
-func (s *ClassicNameServer) updateIP(domain string, newRec record) {
+func (s *ClassicNameServer) updateIP(domain string, newRec *record) {
 	s.Lock()
 
-	newError(s.name, " updating IP records for domain:", domain).AtDebug().WriteToLog()
-	rec := s.ips[domain]
+	rec, found := s.ips[domain]
+	if !found {
+		rec = &record{}
+	}
 
 	updated := false
 	if isNewer(rec.A, newRec.A) {
@@ -153,6 +161,7 @@ func (s *ClassicNameServer) updateIP(domain string, newRec record) {
 	}
 
 	if updated {
+		newError(s.name, " updating IP records for domain:", domain).AtDebug().WriteToLog()
 		s.ips[domain] = rec
 	}
 	if newRec.A != nil {
@@ -175,13 +184,13 @@ func (s *ClassicNameServer) addPendingRequest(req *dnsRequest) {
 
 	id := req.msg.ID
 	req.expire = time.Now().Add(time.Second * 8)
-	s.requests[id] = *req
+	s.requests[id] = req
 }
 
-func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option IPOption) {
+func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption) {
 	newError(s.name, " querying DNS for: ", domain).AtDebug().WriteToLog(session.ExportIDToError(ctx))
 
-	reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
+	reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(clientIP))
 
 	for _, req := range reqs {
 		s.addPendingRequest(req)
@@ -190,14 +199,21 @@ func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option
 		if inbound := session.InboundFromContext(ctx); inbound != nil {
 			udpCtx = session.ContextWithInbound(udpCtx, inbound)
 		}
+
 		udpCtx = session.ContextWithContent(udpCtx, &session.Content{
 			Protocol: "dns",
 		})
-		s.udpServer.Dispatch(udpCtx, s.address, b)
+		udpCtx = log.ContextWithAccessMessage(udpCtx, &log.AccessMessage{
+			From:   "DNS",
+			To:     s.address,
+			Status: log.AccessAccepted,
+			Reason: "",
+		})
+		s.udpServer.Dispatch(udpCtx, *s.address, b)
 	}
 }
 
-func (s *ClassicNameServer) findIPsForDomain(domain string, option IPOption) ([]net.IP, error) {
+func (s *ClassicNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
 	s.RLock()
 	record, found := s.ips[domain]
 	s.RUnlock()
@@ -206,43 +222,49 @@ func (s *ClassicNameServer) findIPsForDomain(domain string, option IPOption) ([]
 		return nil, errRecordNotFound
 	}
 
+	var err4 error
+	var err6 error
 	var ips []net.Address
-	var lastErr error
+	var ip6 []net.Address
+
 	if option.IPv4Enable {
-		a, err := record.A.getIPs()
-		if err != nil {
-			lastErr = err
-		}
-		ips = append(ips, a...)
+		ips, err4 = record.A.getIPs()
 	}
 
 	if option.IPv6Enable {
-		aaaa, err := record.AAAA.getIPs()
-		if err != nil {
-			lastErr = err
-		}
-		ips = append(ips, aaaa...)
+		ip6, err6 = record.AAAA.getIPs()
+		ips = append(ips, ip6...)
 	}
 
 	if len(ips) > 0 {
-		return toNetIP(ips), nil
+		return toNetIP(ips)
 	}
 
-	if lastErr != nil {
-		return nil, lastErr
+	if err4 != nil {
+		return nil, err4
+	}
+
+	if err6 != nil {
+		return nil, err6
 	}
 
 	return nil, dns_feature.ErrEmptyResponse
 }
 
-func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
+// QueryIP implements Server.
+func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption, disableCache bool) ([]net.IP, error) {
 	fqdn := Fqdn(domain)
 
+	if disableCache {
+		newError("DNS cache is disabled. Querying IP for ", domain, " at ", s.name).AtDebug().WriteToLog()
+	} else {
 		ips, err := s.findIPsForDomain(fqdn, option)
 		if err != errRecordNotFound {
 			newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
+			log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSCacheHit, Elapsed: 0, Error: err})
 			return ips, err
 		}
+	}
 
 	// ipv4 and ipv6 belong to different subscription groups
 	var sub4, sub6 *pubsub.Subscriber
@@ -270,11 +292,13 @@ func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option I
 		}
 		close(done)
 	}()
-	s.sendQuery(ctx, fqdn, option)
+	s.sendQuery(ctx, fqdn, clientIP, option)
+	start := time.Now()
 
 	for {
 		ips, err := s.findIPsForDomain(fqdn, option)
 		if err != errRecordNotFound {
+			log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
 			return ips, err
 		}
 

app/dns/server.go

@@ -1,448 +0,0 @@
-package dns
-
-//go:generate go run github.com/xtls/xray-core/common/errors/errorgen
-
-import (
-	"context"
-	"fmt"
-	"log"
-	"net/url"
-	"strings"
-	"sync"
-	"time"
-
-	"github.com/xtls/xray-core/app/router"
-	"github.com/xtls/xray-core/common"
-	"github.com/xtls/xray-core/common/errors"
-	"github.com/xtls/xray-core/common/net"
-	"github.com/xtls/xray-core/common/session"
-	"github.com/xtls/xray-core/common/strmatcher"
-	"github.com/xtls/xray-core/common/uuid"
-	core "github.com/xtls/xray-core/core"
-	"github.com/xtls/xray-core/features"
-	"github.com/xtls/xray-core/features/dns"
-	"github.com/xtls/xray-core/features/routing"
-)
-
-// Server is a DNS rely server.
-type Server struct {
-	sync.Mutex
-	hosts         *StaticHosts
-	clientIP      net.IP
-	clients       []Client             // clientIdx -> Client
-	ipIndexMap    []*MultiGeoIPMatcher // clientIdx -> *MultiGeoIPMatcher
-	domainRules   [][]string           // clientIdx -> domainRuleIdx -> DomainRule
-	domainMatcher strmatcher.IndexMatcher
-	matcherInfos  []DomainMatcherInfo // matcherIdx -> DomainMatcherInfo
-	tag           string
-}
-
-// DomainMatcherInfo contains information attached to index returned by Server.domainMatcher
-type DomainMatcherInfo struct {
-	clientIdx     uint16
-	domainRuleIdx uint16
-}
-
-// MultiGeoIPMatcher for match
-type MultiGeoIPMatcher struct {
-	matchers []*router.GeoIPMatcher
-}
-
-var errExpectedIPNonMatch = errors.New("expectIPs not match")
-
-// Match check ip match
-func (c *MultiGeoIPMatcher) Match(ip net.IP) bool {
-	for _, matcher := range c.matchers {
-		if matcher.Match(ip) {
-			return true
-		}
-	}
-	return false
-}
-
-// HasMatcher check has matcher
-func (c *MultiGeoIPMatcher) HasMatcher() bool {
-	return len(c.matchers) > 0
-}
-
-func generateRandomTag() string {
-	id := uuid.New()
-	return "xray.system." + id.String()
-}
-
-// New creates a new DNS server with given configuration.
-func New(ctx context.Context, config *Config) (*Server, error) {
-	server := &Server{
-		clients: make([]Client, 0, len(config.NameServers)+len(config.NameServer)),
-		tag:     config.Tag,
-	}
-	if server.tag == "" {
-		server.tag = generateRandomTag()
-	}
-	if len(config.ClientIp) > 0 {
-		if len(config.ClientIp) != net.IPv4len && len(config.ClientIp) != net.IPv6len {
-			return nil, newError("unexpected IP length", len(config.ClientIp))
-		}
-		server.clientIP = net.IP(config.ClientIp)
-	}
-
-	hosts, err := NewStaticHosts(config.StaticHosts, config.Hosts)
-	if err != nil {
-		return nil, newError("failed to create hosts").Base(err)
-	}
-	server.hosts = hosts
-
-	addNameServer := func(ns *NameServer) int {
-		endpoint := ns.Address
-		address := endpoint.Address.AsAddress()
-
-		switch {
-		case address.Family().IsDomain() && address.Domain() == "localhost":
-			server.clients = append(server.clients, NewLocalNameServer())
-			// Priotize local domains with specific TLDs or without any dot to local DNS
-			// References:
-			// https://www.iana.org/assignments/special-use-domain-names/special-use-domain-names.xhtml
-			// https://unix.stackexchange.com/questions/92441/whats-the-difference-between-local-home-and-lan
-			localTLDsAndDotlessDomains := []*NameServer_PriorityDomain{
-				{Type: DomainMatchingType_Regex, Domain: "^[^.]+$"}, // This will only match domains without any dot
-				{Type: DomainMatchingType_Subdomain, Domain: "local"},
-				{Type: DomainMatchingType_Subdomain, Domain: "localdomain"},
-				{Type: DomainMatchingType_Subdomain, Domain: "localhost"},
-				{Type: DomainMatchingType_Subdomain, Domain: "lan"},
-				{Type: DomainMatchingType_Subdomain, Domain: "home.arpa"},
-				{Type: DomainMatchingType_Subdomain, Domain: "example"},
-				{Type: DomainMatchingType_Subdomain, Domain: "invalid"},
-				{Type: DomainMatchingType_Subdomain, Domain: "test"},
-			}
-			ns.PrioritizedDomain = append(ns.PrioritizedDomain, localTLDsAndDotlessDomains...)
-
-		case address.Family().IsDomain() && strings.HasPrefix(address.Domain(), "https+local://"):
-			// URI schemed string treated as domain
-			// DOH Local mode
-			u, err := url.Parse(address.Domain())
-			if err != nil {
-				log.Fatalln(newError("DNS config error").Base(err))
-			}
-			server.clients = append(server.clients, NewDoHLocalNameServer(u, server.clientIP))
-
-		case address.Family().IsDomain() && strings.HasPrefix(address.Domain(), "https://"):
-			// DOH Remote mode
-			u, err := url.Parse(address.Domain())
-			if err != nil {
-				log.Fatalln(newError("DNS config error").Base(err))
-			}
-			idx := len(server.clients)
-			server.clients = append(server.clients, nil)
-
-			// need the core dispatcher, register DOHClient at callback
-			common.Must(core.RequireFeatures(ctx, func(d routing.Dispatcher) {
-				c, err := NewDoHNameServer(u, d, server.clientIP)
-				if err != nil {
-					log.Fatalln(newError("DNS config error").Base(err))
-				}
-				server.clients[idx] = c
-			}))
-
-		default:
-			// UDP classic DNS mode
-			dest := endpoint.AsDestination()
-			if dest.Network == net.Network_Unknown {
-				dest.Network = net.Network_UDP
-			}
-			if dest.Network == net.Network_UDP {
-				idx := len(server.clients)
-				server.clients = append(server.clients, nil)
-
-				common.Must(core.RequireFeatures(ctx, func(d routing.Dispatcher) {
-					server.clients[idx] = NewClassicNameServer(dest, d, server.clientIP)
-				}))
-			}
-		}
-		server.ipIndexMap = append(server.ipIndexMap, nil)
-		return len(server.clients) - 1
-	}
-
-	if len(config.NameServers) > 0 {
-		features.PrintDeprecatedFeatureWarning("simple DNS server")
-		for _, destPB := range config.NameServers {
-			addNameServer(&NameServer{Address: destPB})
-		}
-	}
-
-	if len(config.NameServer) > 0 {
-		clientIndices := []int{}
-		domainRuleCount := 0
-		for _, ns := range config.NameServer {
-			idx := addNameServer(ns)
-			clientIndices = append(clientIndices, idx)
-			domainRuleCount += len(ns.PrioritizedDomain)
-		}
-
-		domainRules := make([][]string, len(server.clients))
-		domainMatcher := &strmatcher.MatcherGroup{}
-		matcherInfos := make([]DomainMatcherInfo, domainRuleCount+1) // matcher index starts from 1
-		var geoIPMatcherContainer router.GeoIPMatcherContainer
-		for nidx, ns := range config.NameServer {
-			idx := clientIndices[nidx]
-
-			// Establish domain rule matcher
-			rules := []string{}
-			ruleCurr := 0
-			ruleIter := 0
-			for _, domain := range ns.PrioritizedDomain {
-				matcher, err := toStrMatcher(domain.Type, domain.Domain)
-				if err != nil {
-					return nil, newError("failed to create prioritized domain").Base(err).AtWarning()
-				}
-				midx := domainMatcher.Add(matcher)
-				if midx >= uint32(len(matcherInfos)) { // This rarely happens according to current matcher's implementation
-					newError("expanding domain matcher info array to size ", midx, " when adding ", matcher).AtDebug().WriteToLog()
-					matcherInfos = append(matcherInfos, make([]DomainMatcherInfo, midx-uint32(len(matcherInfos))+1)...)
-				}
-				info := &matcherInfos[midx]
-				info.clientIdx = uint16(idx)
-				if ruleCurr < len(ns.OriginalRules) {
-					info.domainRuleIdx = uint16(ruleCurr)
-					rule := ns.OriginalRules[ruleCurr]
-					if ruleCurr >= len(rules) {
-						rules = append(rules, rule.Rule)
-					}
-					ruleIter++
-					if ruleIter >= int(rule.Size) {
-						ruleIter = 0
-						ruleCurr++
-					}
-				} else { // No original rule, generate one according to current domain matcher (majorly for compatibility with tests)
-					info.domainRuleIdx = uint16(len(rules))
-					rules = append(rules, matcher.String())
-				}
-			}
-			domainRules[idx] = rules
-
-			// only add to ipIndexMap if GeoIP is configured
-			if len(ns.Geoip) > 0 {
-				var matchers []*router.GeoIPMatcher
-				for _, geoip := range ns.Geoip {
-					matcher, err := geoIPMatcherContainer.Add(geoip)
-					if err != nil {
-						return nil, newError("failed to create ip matcher").Base(err).AtWarning()
-					}
-					matchers = append(matchers, matcher)
-				}
-				matcher := &MultiGeoIPMatcher{matchers: matchers}
-				server.ipIndexMap[idx] = matcher
-			}
-		}
-		server.domainRules = domainRules
-		server.domainMatcher = domainMatcher
-		server.matcherInfos = matcherInfos
-	}
-
-	if len(server.clients) == 0 {
-		server.clients = append(server.clients, NewLocalNameServer())
-		server.ipIndexMap = append(server.ipIndexMap, nil)
-	}
-
-	return server, nil
-}
-
-// Type implements common.HasType.
-func (*Server) Type() interface{} {
-	return dns.ClientType()
-}
-
-// Start implements common.Runnable.
-func (s *Server) Start() error {
-	return nil
-}
-
-// Close implements common.Closable.
-func (s *Server) Close() error {
-	return nil
-}
-
-func (s *Server) IsOwnLink(ctx context.Context) bool {
-	inbound := session.InboundFromContext(ctx)
-	return inbound != nil && inbound.Tag == s.tag
-}
-
-// Match check dns ip match geoip
-func (s *Server) Match(idx int, client Client, domain string, ips []net.IP) ([]net.IP, error) {
-	var matcher *MultiGeoIPMatcher
-	if idx < len(s.ipIndexMap) {
-		matcher = s.ipIndexMap[idx]
-	}
-	if matcher == nil {
-		return ips, nil
-	}
-
-	if !matcher.HasMatcher() {
-		newError("domain ", domain, " server has no valid matcher: ", client.Name(), " idx:", idx).AtDebug().WriteToLog()
-		return ips, nil
-	}
-
-	newIps := []net.IP{}
-	for _, ip := range ips {
-		if matcher.Match(ip) {
-			newIps = append(newIps, ip)
-		}
-	}
-	if len(newIps) == 0 {
-		return nil, errExpectedIPNonMatch
-	}
-	newError("domain ", domain, " expectIPs ", newIps, " matched at server ", client.Name(), " idx:", idx).AtDebug().WriteToLog()
-	return newIps, nil
-}
-
-func (s *Server) queryIPTimeout(idx int, client Client, domain string, option IPOption) ([]net.IP, error) {
-	ctx, cancel := context.WithTimeout(context.Background(), time.Second*4)
-	if len(s.tag) > 0 {
-		ctx = session.ContextWithInbound(ctx, &session.Inbound{
-			Tag: s.tag,
-		})
-	}
-	ips, err := client.QueryIP(ctx, domain, option)
-	cancel()
-
-	if err != nil {
-		return ips, err
-	}
-
-	ips, err = s.Match(idx, client, domain, ips)
-	return ips, err
-}
-
-// LookupIP implements dns.Client.
-func (s *Server) LookupIP(domain string) ([]net.IP, error) {
-	return s.lookupIPInternal(domain, IPOption{
-		IPv4Enable: true,
-		IPv6Enable: true,
-	})
-}
-
-// LookupIPv4 implements dns.IPv4Lookup.
-func (s *Server) LookupIPv4(domain string) ([]net.IP, error) {
-	return s.lookupIPInternal(domain, IPOption{
-		IPv4Enable: true,
-		IPv6Enable: false,
-	})
-}
-
-// LookupIPv6 implements dns.IPv6Lookup.
-func (s *Server) LookupIPv6(domain string) ([]net.IP, error) {
-	return s.lookupIPInternal(domain, IPOption{
-		IPv4Enable: false,
-		IPv6Enable: true,
-	})
-}
-
-func (s *Server) lookupStatic(domain string, option IPOption, depth int32) []net.Address {
-	ips := s.hosts.LookupIP(domain, option)
-	if ips == nil {
-		return nil
-	}
-	if ips[0].Family().IsDomain() && depth < 5 {
-		if newIPs := s.lookupStatic(ips[0].Domain(), option, depth+1); newIPs != nil {
-			return newIPs
-		}
-	}
-	return ips
-}
-
-func toNetIP(ips []net.Address) []net.IP {
-	if len(ips) == 0 {
-		return nil
-	}
-	netips := make([]net.IP, 0, len(ips))
-	for _, ip := range ips {
-		netips = append(netips, ip.IP())
-	}
-	return netips
-}
-
-func (s *Server) lookupIPInternal(domain string, option IPOption) ([]net.IP, error) {
-	if domain == "" {
-		return nil, newError("empty domain name")
-	}
-	domain = strings.ToLower(domain)
-
-	// normalize the FQDN form query
-	if domain[len(domain)-1] == '.' {
-		domain = domain[:len(domain)-1]
-	}
-
-	ips := s.lookupStatic(domain, option, 0)
-	if ips != nil && ips[0].Family().IsIP() {
-		newError("returning ", len(ips), " IPs for domain ", domain).WriteToLog()
-		return toNetIP(ips), nil
-	}
-
-	if ips != nil && ips[0].Family().IsDomain() {
-		newdomain := ips[0].Domain()
-		newError("domain replaced: ", domain, " -> ", newdomain).WriteToLog()
-		domain = newdomain
-	}
-
-	var lastErr error
-	var matchedClient Client
-	if s.domainMatcher != nil {
-		indices := s.domainMatcher.Match(domain)
-		domainRules := []string{}
-		matchingDNS := []string{}
-		for _, idx := range indices {
-			info := s.matcherInfos[idx]
-			rule := s.domainRules[info.clientIdx][info.domainRuleIdx]
-			domainRules = append(domainRules, fmt.Sprintf("%s(DNS idx:%d)", rule, info.clientIdx))
-			matchingDNS = append(matchingDNS, s.clients[info.clientIdx].Name())
-		}
-		if len(domainRules) > 0 {
-			newError("domain ", domain, " matches following rules: ", domainRules).AtDebug().WriteToLog()
-		}
-		if len(matchingDNS) > 0 {
-			newError("domain ", domain, " uses following DNS first: ", matchingDNS).AtDebug().WriteToLog()
-		}
-		for _, idx := range indices {
-			clientIdx := int(s.matcherInfos[idx].clientIdx)
-			matchedClient = s.clients[clientIdx]
-			ips, err := s.queryIPTimeout(clientIdx, matchedClient, domain, option)
-			if len(ips) > 0 {
-				return ips, nil
-			}
-			if err == dns.ErrEmptyResponse {
-				return nil, err
-			}
-			if err != nil {
-				newError("failed to lookup ip for domain ", domain, " at server ", matchedClient.Name()).Base(err).WriteToLog()
-				lastErr = err
-			}
-		}
-	}
-
-	for idx, client := range s.clients {
-		if client == matchedClient {
-			newError("domain ", domain, " at server ", client.Name(), " idx:", idx, " already lookup failed, just ignore").AtDebug().WriteToLog()
-			continue
-		}
-
-		ips, err := s.queryIPTimeout(idx, client, domain, option)
-		if len(ips) > 0 {
-			return ips, nil
-		}
-
-		if err != nil {
-			newError("failed to lookup ip for domain ", domain, " at server ", client.Name()).Base(err).WriteToLog()
-			lastErr = err
-		}
-		if err != context.Canceled && err != context.DeadlineExceeded && err != errExpectedIPNonMatch {
-			return nil, err
-		}
-	}
-
-	return nil, newError("returning nil for domain ", domain).Base(lastErr)
-}
-
-func init() {
-	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
-		return New(ctx, config.(*Config))
-	}))
-}

app/log/command/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/log/command/config.proto
 
 package command
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type Config struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache

app/log/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/log/config.proto
 
 package log
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	log "github.com/xtls/xray-core/common/log"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
@@ -22,10 +21,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type LogType int32
 
 const (
@@ -88,6 +83,7 @@ type Config struct {
 	ErrorLogPath  string       `protobuf:"bytes,3,opt,name=error_log_path,json=errorLogPath,proto3" json:"error_log_path,omitempty"`
 	AccessLogType LogType      `protobuf:"varint,4,opt,name=access_log_type,json=accessLogType,proto3,enum=xray.app.log.LogType" json:"access_log_type,omitempty"`
 	AccessLogPath string       `protobuf:"bytes,5,opt,name=access_log_path,json=accessLogPath,proto3" json:"access_log_path,omitempty"`
+	EnableDnsLog  bool         `protobuf:"varint,6,opt,name=enable_dns_log,json=enableDnsLog,proto3" json:"enable_dns_log,omitempty"`
 }
 
 func (x *Config) Reset() {
@@ -133,7 +129,7 @@ func (x *Config) GetErrorLogLevel() log.Severity {
 	if x != nil {
 		return x.ErrorLogLevel
 	}
-	return log.Severity_Unknown
+	return log.Severity(0)
 }
 
 func (x *Config) GetErrorLogPath() string {
@@ -157,13 +153,20 @@ func (x *Config) GetAccessLogPath() string {
 	return ""
 }
 
+func (x *Config) GetEnableDnsLog() bool {
+	if x != nil {
+		return x.EnableDnsLog
+	}
+	return false
+}
+
 var File_app_log_config_proto protoreflect.FileDescriptor
 
 var file_app_log_config_proto_rawDesc = []byte{
 	0x0a, 0x14, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0x2f, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x67,
 	0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x0c, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
 	0x2e, 0x6c, 0x6f, 0x67, 0x1a, 0x14, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2f, 0x6c, 0x6f, 0x67,
-	0x2f, 0x6c, 0x6f, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0x95, 0x02, 0x0a, 0x06, 0x43,
+	0x2f, 0x6c, 0x6f, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xbb, 0x02, 0x0a, 0x06, 0x43,
 	0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x3b, 0x0a, 0x0e, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x5f, 0x6c,
 	0x6f, 0x67, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x15, 0x2e,
 	0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x2e, 0x4c, 0x6f, 0x67,
@@ -181,15 +184,17 @@ var file_app_log_config_proto_rawDesc = []byte{
 	0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x26, 0x0a, 0x0f, 0x61, 0x63,
 	0x63, 0x65, 0x73, 0x73, 0x5f, 0x6c, 0x6f, 0x67, 0x5f, 0x70, 0x61, 0x74, 0x68, 0x18, 0x05, 0x20,
 	0x01, 0x28, 0x09, 0x52, 0x0d, 0x61, 0x63, 0x63, 0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x50, 0x61,
-	0x74, 0x68, 0x2a, 0x35, 0x0a, 0x07, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08, 0x0a,
-	0x04, 0x4e, 0x6f, 0x6e, 0x65, 0x10, 0x00, 0x12, 0x0b, 0x0a, 0x07, 0x43, 0x6f, 0x6e, 0x73, 0x6f,
-	0x6c, 0x65, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x69, 0x6c, 0x65, 0x10, 0x02, 0x12, 0x09,
-	0x0a, 0x05, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x10, 0x03, 0x42, 0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d,
-	0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x50, 0x01, 0x5a,
-	0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73,
-	0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6c,
-	0x6f, 0x67, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x4c, 0x6f,
-	0x67, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
+	0x74, 0x68, 0x12, 0x24, 0x0a, 0x0e, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x5f, 0x64, 0x6e, 0x73,
+	0x5f, 0x6c, 0x6f, 0x67, 0x18, 0x06, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x65, 0x6e, 0x61, 0x62,
+	0x6c, 0x65, 0x44, 0x6e, 0x73, 0x4c, 0x6f, 0x67, 0x2a, 0x35, 0x0a, 0x07, 0x4c, 0x6f, 0x67, 0x54,
+	0x79, 0x70, 0x65, 0x12, 0x08, 0x0a, 0x04, 0x4e, 0x6f, 0x6e, 0x65, 0x10, 0x00, 0x12, 0x0b, 0x0a,
+	0x07, 0x43, 0x6f, 0x6e, 0x73, 0x6f, 0x6c, 0x65, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x69,
+	0x6c, 0x65, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x10, 0x03, 0x42,
+	0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e,
+	0x6c, 0x6f, 0x67, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f,
+	0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65,
+	0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e,
+	0x41, 0x70, 0x70, 0x2e, 0x4c, 0x6f, 0x67, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
 }
 
 var (

app/log/config.proto

@@ -22,4 +22,5 @@ message Config {
 
   LogType access_log_type = 4;
   string access_log_path = 5;
+  bool enable_dns_log = 6;
 }

app/log/log.go

@@ -17,6 +17,7 @@ type Instance struct {
 	accessLogger log.Handler
 	errorLogger  log.Handler
 	active       bool
+	dns          bool
 }
 
 // New creates a new log.Instance based on the given config.
@@ -24,6 +25,7 @@ func New(ctx context.Context, config *Config) (*Instance, error) {
 	g := &Instance{
 		config: config,
 		active: false,
+		dns:    config.EnableDnsLog,
 	}
 	log.RegisterHandler(g)
 
@@ -103,6 +105,10 @@ func (g *Instance) Handle(msg log.Message) {
 		if g.accessLogger != nil {
 			g.accessLogger.Handle(msg)
 		}
+	case *log.DNSLog:
+		if g.dns && g.accessLogger != nil {
+			g.accessLogger.Handle(msg)
+		}
 	case *log.GeneralMessage:
 		if g.errorLogger != nil && msg.Severity <= g.config.ErrorLogLevel {
 			g.errorLogger.Handle(msg)

app/log/log_creator.go

@@ -11,9 +11,7 @@ type HandlerCreatorOptions struct {
 
 type HandlerCreator func(LogType, HandlerCreatorOptions) (log.Handler, error)
 
-var (
-	handlerCreatorMap = make(map[LogType]HandlerCreator)
-)
+var handlerCreatorMap = make(map[LogType]HandlerCreator)
 
 func RegisterHandlerCreator(logType LogType, f HandlerCreator) error {
 	if f == nil {

app/log/log_test.go

@@ -5,6 +5,7 @@ import (
 	"testing"
 
 	"github.com/golang/mock/gomock"
+
 	"github.com/xtls/xray-core/app/log"
 	"github.com/xtls/xray-core/common"
 	clog "github.com/xtls/xray-core/common/log"

app/policy/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/policy/config.proto
 
 package policy
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type Second struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache

app/proxyman/command/command.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/proxyman/command/command.proto
 
 package command
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protocol "github.com/xtls/xray-core/common/protocol"
 	serial "github.com/xtls/xray-core/common/serial"
 	core "github.com/xtls/xray-core/core"
@@ -24,10 +23,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type AddUserOperation struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache

app/proxyman/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/proxyman/config.proto
 
 package proxyman
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	net "github.com/xtls/xray-core/common/net"
 	serial "github.com/xtls/xray-core/common/serial"
 	internet "github.com/xtls/xray-core/transport/internet"
@@ -24,10 +23,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type KnownProtocols int32
 
 const (
@@ -239,9 +234,12 @@ type SniffingConfig struct {
 	// Whether or not to enable content sniffing on an inbound connection.
 	Enabled bool `protobuf:"varint,1,opt,name=enabled,proto3" json:"enabled,omitempty"`
 	// Override target destination if sniff'ed protocol is in the given list.
-	// Supported values are "http", "tls".
+	// Supported values are "http", "tls", "fakedns".
 	DestinationOverride []string `protobuf:"bytes,2,rep,name=destination_override,json=destinationOverride,proto3" json:"destination_override,omitempty"`
 	DomainsExcluded     []string `protobuf:"bytes,3,rep,name=domains_excluded,json=domainsExcluded,proto3" json:"domains_excluded,omitempty"`
+	// Whether should only try to sniff metadata without waiting for client input.
+	// Can be used to support SMTP like protocol where server send the first message.
+	MetadataOnly bool `protobuf:"varint,4,opt,name=metadata_only,json=metadataOnly,proto3" json:"metadata_only,omitempty"`
 }
 
 func (x *SniffingConfig) Reset() {
@@ -297,6 +295,13 @@ func (x *SniffingConfig) GetDomainsExcluded() []string {
 	return nil
 }
 
+func (x *SniffingConfig) GetMetadataOnly() bool {
+	if x != nil {
+		return x.MetadataOnly
+	}
+	return false
+}
+
 type ReceiverConfig struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache
@@ -764,7 +769,7 @@ var file_app_proxyman_config_proto_rawDesc = []byte{
 	0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x22, 0x2c, 0x0a, 0x04, 0x54, 0x79, 0x70, 0x65, 0x12,
 	0x0a, 0x0a, 0x06, 0x41, 0x6c, 0x77, 0x61, 0x79, 0x73, 0x10, 0x00, 0x12, 0x0a, 0x0a, 0x06, 0x52,
 	0x61, 0x6e, 0x64, 0x6f, 0x6d, 0x10, 0x01, 0x12, 0x0c, 0x0a, 0x08, 0x45, 0x78, 0x74, 0x65, 0x72,
-	0x6e, 0x61, 0x6c, 0x10, 0x02, 0x22, 0x88, 0x01, 0x0a, 0x0e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69,
+	0x6e, 0x61, 0x6c, 0x10, 0x02, 0x22, 0xad, 0x01, 0x0a, 0x0e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69,
 	0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62,
 	0x6c, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c,
 	0x65, 0x64, 0x12, 0x31, 0x0a, 0x14, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f,
@@ -773,86 +778,88 @@ var file_app_proxyman_config_proto_rawDesc = []byte{
 	0x72, 0x72, 0x69, 0x64, 0x65, 0x12, 0x29, 0x0a, 0x10, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x73,
 	0x5f, 0x65, 0x78, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x64, 0x18, 0x03, 0x20, 0x03, 0x28, 0x09, 0x52,
 	0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x73, 0x45, 0x78, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x64,
-	0x22, 0x90, 0x04, 0x0a, 0x0e, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x43, 0x6f, 0x6e,
-	0x66, 0x69, 0x67, 0x12, 0x39, 0x0a, 0x0a, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x72, 0x61, 0x6e, 0x67,
-	0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63,
-	0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f, 0x72, 0x74, 0x52, 0x61,
-	0x6e, 0x67, 0x65, 0x52, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x12, 0x33,
-	0x0a, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b,
-	0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74,
-	0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x06, 0x6c, 0x69, 0x73,
-	0x74, 0x65, 0x6e, 0x12, 0x56, 0x0a, 0x13, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f,
-	0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b,
-	0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78,
-	0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x53,
-	0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x12, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74,
-	0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x4e, 0x0a, 0x0f, 0x73,
-	0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x04,
-	0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e,
-	0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x53,
-	0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74, 0x72,
-	0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x40, 0x0a, 0x1c, 0x72,
-	0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x5f, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x5f,
-	0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x05, 0x20, 0x01, 0x28,
-	0x08, 0x52, 0x1a, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e,
-	0x61, 0x6c, 0x44, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x4e, 0x0a,
-	0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65,
-	0x18, 0x07, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
-	0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e,
-	0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0e, 0x64,
-	0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65, 0x12, 0x4e, 0x0a,
-	0x11, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e,
-	0x67, 0x73, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
-	0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x53, 0x6e, 0x69,
-	0x66, 0x66, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x10, 0x73, 0x6e, 0x69,
-	0x66, 0x66, 0x69, 0x6e, 0x67, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x4a, 0x04, 0x08,
-	0x06, 0x10, 0x07, 0x22, 0xc0, 0x01, 0x0a, 0x14, 0x49, 0x6e, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x48,
-	0x61, 0x6e, 0x64, 0x6c, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x10, 0x0a, 0x03,
-	0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x4d,
-	0x0a, 0x11, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69,
-	0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79,
-	0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e, 0x54,
-	0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x10, 0x72, 0x65, 0x63,
-	0x65, 0x69, 0x76, 0x65, 0x72, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x47, 0x0a,
+	0x12, 0x23, 0x0a, 0x0d, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x6f, 0x6e, 0x6c,
+	0x79, 0x18, 0x04, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74,
+	0x61, 0x4f, 0x6e, 0x6c, 0x79, 0x22, 0x90, 0x04, 0x0a, 0x0e, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76,
+	0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x39, 0x0a, 0x0a, 0x70, 0x6f, 0x72, 0x74,
+	0x5f, 0x72, 0x61, 0x6e, 0x67, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x78,
+	0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50,
+	0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x52, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x52, 0x61,
+	0x6e, 0x67, 0x65, 0x12, 0x33, 0x0a, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x18, 0x02, 0x20,
+	0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f,
+	0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
+	0x52, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x12, 0x56, 0x0a, 0x13, 0x61, 0x6c, 0x6c, 0x6f,
+	0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18,
+	0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
+	0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61,
+	0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x12, 0x61, 0x6c,
+	0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
+	0x12, 0x4e, 0x0a, 0x0f, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69,
+	0x6e, 0x67, 0x73, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79,
+	0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72,
+	0x6e, 0x65, 0x74, 0x2e, 0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
+	0x52, 0x0e, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
+	0x12, 0x40, 0x0a, 0x1c, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x5f, 0x6f, 0x72, 0x69, 0x67,
+	0x69, 0x6e, 0x61, 0x6c, 0x5f, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e,
+	0x18, 0x05, 0x20, 0x01, 0x28, 0x08, 0x52, 0x1a, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x4f,
+	0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x44, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69,
+	0x6f, 0x6e, 0x12, 0x4e, 0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6f, 0x76, 0x65,
+	0x72, 0x72, 0x69, 0x64, 0x65, 0x18, 0x07, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x21, 0x2e, 0x78, 0x72,
+	0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e,
+	0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x42, 0x02,
+	0x18, 0x01, 0x52, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4f, 0x76, 0x65, 0x72, 0x72, 0x69,
+	0x64, 0x65, 0x12, 0x4e, 0x0a, 0x11, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x5f, 0x73,
+	0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x21, 0x2e,
+	0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61,
+	0x6e, 0x2e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
+	0x52, 0x10, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e,
+	0x67, 0x73, 0x4a, 0x04, 0x08, 0x06, 0x10, 0x07, 0x22, 0xc0, 0x01, 0x0a, 0x14, 0x49, 0x6e, 0x62,
+	0x6f, 0x75, 0x6e, 0x64, 0x48, 0x61, 0x6e, 0x64, 0x6c, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69,
+	0x67, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03,
+	0x74, 0x61, 0x67, 0x12, 0x4d, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x5f,
+	0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20,
+	0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72,
+	0x69, 0x61, 0x6c, 0x2e, 0x54, 0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65,
+	0x52, 0x10, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e,
+	0x67, 0x73, 0x12, 0x47, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74,
+	0x69, 0x6e, 0x67, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61,
+	0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e,
+	0x54, 0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0d, 0x70, 0x72,
+	0x6f, 0x78, 0x79, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x10, 0x0a, 0x0e, 0x4f,
+	0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x22, 0xb0, 0x02,
+	0x0a, 0x0c, 0x53, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x2d,
+	0x0a, 0x03, 0x76, 0x69, 0x61, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72,
+	0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50,
+	0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x03, 0x76, 0x69, 0x61, 0x12, 0x4e, 0x0a,
+	0x0f, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
+	0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72,
+	0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74,
+	0x2e, 0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73,
+	0x74, 0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x4b, 0x0a,
 	0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18,
-	0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
-	0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e, 0x54, 0x79, 0x70, 0x65, 0x64,
-	0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x53, 0x65,
-	0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x10, 0x0a, 0x0e, 0x4f, 0x75, 0x74, 0x62, 0x6f, 0x75,
-	0x6e, 0x64, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x22, 0xb0, 0x02, 0x0a, 0x0c, 0x53, 0x65, 0x6e,
-	0x64, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x2d, 0x0a, 0x03, 0x76, 0x69, 0x61,
-	0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f,
-	0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d,
-	0x61, 0x69, 0x6e, 0x52, 0x03, 0x76, 0x69, 0x61, 0x12, 0x4e, 0x0a, 0x0f, 0x73, 0x74, 0x72, 0x65,
-	0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28,
-	0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f,
-	0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x53, 0x74, 0x72, 0x65,
-	0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d,
-	0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x4b, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78,
-	0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b,
-	0x32, 0x24, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72,
-	0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79,
-	0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x53, 0x65, 0x74,
-	0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x54, 0x0a, 0x12, 0x6d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c,
-	0x65, 0x78, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x04, 0x20, 0x01, 0x28,
-	0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f,
-	0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69,
-	0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x11, 0x6d, 0x75, 0x6c, 0x74, 0x69, 0x70,
-	0x6c, 0x65, 0x78, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x50, 0x0a, 0x12, 0x4d,
-	0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69,
-	0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01,
-	0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x12, 0x20, 0x0a, 0x0b, 0x63,
-	0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d,
-	0x52, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x2a, 0x23, 0x0a,
-	0x0e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x12,
-	0x08, 0x0a, 0x04, 0x48, 0x54, 0x54, 0x50, 0x10, 0x00, 0x12, 0x07, 0x0a, 0x03, 0x54, 0x4c, 0x53,
-	0x10, 0x01, 0x42, 0x55, 0x0a, 0x15, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61,
-	0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x50, 0x01, 0x5a, 0x26, 0x67,
-	0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78,
-	0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x70, 0x72, 0x6f,
-	0x78, 0x79, 0x6d, 0x61, 0x6e, 0xaa, 0x02, 0x11, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70,
-	0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f,
-	0x33,
+	0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x24, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61,
+	0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e,
+	0x50, 0x72, 0x6f, 0x78, 0x79, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0d, 0x70, 0x72, 0x6f,
+	0x78, 0x79, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x54, 0x0a, 0x12, 0x6d, 0x75,
+	0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
+	0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
+	0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4d, 0x75, 0x6c, 0x74, 0x69,
+	0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x11, 0x6d,
+	0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
+	0x22, 0x50, 0x0a, 0x12, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67,
+	0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65,
+	0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64,
+	0x12, 0x20, 0x0a, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x18,
+	0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e,
+	0x63, 0x79, 0x2a, 0x23, 0x0a, 0x0e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f,
+	0x63, 0x6f, 0x6c, 0x73, 0x12, 0x08, 0x0a, 0x04, 0x48, 0x54, 0x54, 0x50, 0x10, 0x00, 0x12, 0x07,
+	0x0a, 0x03, 0x54, 0x4c, 0x53, 0x10, 0x01, 0x42, 0x55, 0x0a, 0x15, 0x63, 0x6f, 0x6d, 0x2e, 0x78,
+	0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e,
+	0x50, 0x01, 0x5a, 0x26, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78,
+	0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70,
+	0x70, 0x2f, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0xaa, 0x02, 0x11, 0x58, 0x72, 0x61,
+	0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x62, 0x06,
+	0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
 }
 
 var (

app/proxyman/config.proto

@@ -54,9 +54,13 @@ message SniffingConfig {
   bool enabled = 1;
 
   // Override target destination if sniff'ed protocol is in the given list.
-  // Supported values are "http", "tls".
+  // Supported values are "http", "tls", "fakedns".
   repeated string destination_override = 2;
   repeated string domains_excluded = 3;
+  
+  // Whether should only try to sniff metadata without waiting for client input.
+  // Can be used to support SMTP like protocol where server send the first message.
+  bool metadata_only = 4;
 }
 
 message ReceiverConfig {

app/proxyman/inbound/always.go

@@ -133,6 +133,7 @@ func NewAlwaysOnInboundHandler(ctx context.Context, tag string, receiverConfig *
 					address:         address,
 					port:            net.Port(port),
 					dispatcher:      h.mux,
+					sniffingConfig:  receiverConfig.GetEffectiveSniffingSettings(),
 					uplinkCounter:   uplinkCounter,
 					downlinkCounter: downlinkCounter,
 					stream:          mss,

app/proxyman/inbound/dynamic.go

@@ -153,6 +153,7 @@ func (h *DynamicInboundHandler) refresh() error {
 				address:         address,
 				port:            port,
 				dispatcher:      h.mux,
+				sniffingConfig:  h.receiverConfig.GetEffectiveSniffingSettings(),
 				uplinkCounter:   uplinkCounter,
 				downlinkCounter: downlinkCounter,
 				stream:          h.streamSettings,

app/proxyman/inbound/inbound.go

@@ -42,6 +42,9 @@ func (m *Manager) AddHandler(ctx context.Context, handler inbound.Handler) error
 
 	tag := handler.Tag()
 	if len(tag) > 0 {
+		if _, found := m.taggedHandlers[tag]; found {
+			return newError("existing tag found: " + tag)
+		}
 		m.taggedHandlers[tag] = handler
 	} else {
 		m.untaggedHandler = append(m.untaggedHandler, handler)

app/proxyman/inbound/worker.go

@@ -6,6 +6,8 @@ import (
 	"sync/atomic"
 	"time"
 
+	"github.com/xtls/xray-core/transport/internet/stat"
+
 	"github.com/xtls/xray-core/app/proxyman"
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/buf"
@@ -54,7 +56,7 @@ func getTProxyType(s *internet.MemoryStreamConfig) internet.SocketConfig_TProxyM
 	return s.SocketSettings.Tproxy
 }
 
-func (w *tcpWorker) callback(conn internet.Connection) {
+func (w *tcpWorker) callback(conn stat.Connection) {
 	ctx, cancel := context.WithCancel(w.ctx)
 	sid := session.NewID()
 	ctx = session.ContextWithID(ctx, sid)
@@ -80,7 +82,7 @@ func (w *tcpWorker) callback(conn internet.Connection) {
 	}
 
 	if w.uplinkCounter != nil || w.downlinkCounter != nil {
-		conn = &internet.StatCouterConnection{
+		conn = &stat.CounterConnection{
 			Connection:   conn,
 			ReadCounter:  w.uplinkCounter,
 			WriteCounter: w.downlinkCounter,
@@ -98,6 +100,7 @@ func (w *tcpWorker) callback(conn internet.Connection) {
 		content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
 		content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
 		content.SniffingRequest.ExcludeForDomain = w.sniffingConfig.DomainsExcluded
+		content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
 	}
 	ctx = session.ContextWithContent(ctx, content)
 
@@ -116,7 +119,7 @@ func (w *tcpWorker) Proxy() proxy.Inbound {
 
 func (w *tcpWorker) Start() error {
 	ctx := context.Background()
-	hub, err := internet.ListenTCP(ctx, w.address, w.port, w.stream, func(conn internet.Connection) {
+	hub, err := internet.ListenTCP(ctx, w.address, w.port, w.stream, func(conn stat.Connection) {
 		go w.callback(conn)
 	})
 	if err != nil {
@@ -235,6 +238,7 @@ type udpWorker struct {
 	tag             string
 	stream          *internet.MemoryStreamConfig
 	dispatcher      routing.Dispatcher
+	sniffingConfig  *proxyman.SniffingConfig
 	uplinkCounter   stats.Counter
 	downlinkCounter stats.Counter
 
@@ -297,7 +301,7 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
 		common.Must(w.checker.Start())
 
 		go func() {
-			ctx := context.Background()
+			ctx := w.ctx
 			sid := session.NewID()
 			ctx = session.ContextWithID(ctx, sid)
 
@@ -311,6 +315,13 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
 				Gateway: net.UDPDestination(w.address, w.port),
 				Tag:     w.tag,
 			})
+			content := new(session.Content)
+			if w.sniffingConfig != nil {
+				content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
+				content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
+				content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
+			}
+			ctx = session.ContextWithContent(ctx, content)
 			if err := w.proxy.Process(ctx, net.Network_UDP, conn, w.dispatcher); err != nil {
 				newError("connection ends").Base(err).WriteToLog(session.ExportIDToError(ctx))
 			}
@@ -427,13 +438,13 @@ type dsWorker struct {
 	ctx context.Context
 }
 
-func (w *dsWorker) callback(conn internet.Connection) {
+func (w *dsWorker) callback(conn stat.Connection) {
 	ctx, cancel := context.WithCancel(w.ctx)
 	sid := session.NewID()
 	ctx = session.ContextWithID(ctx, sid)
 
 	if w.uplinkCounter != nil || w.downlinkCounter != nil {
-		conn = &internet.StatCouterConnection{
+		conn = &stat.CounterConnection{
 			Connection:   conn,
 			ReadCounter:  w.uplinkCounter,
 			WriteCounter: w.downlinkCounter,
@@ -451,6 +462,7 @@ func (w *dsWorker) callback(conn internet.Connection) {
 		content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
 		content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
 		content.SniffingRequest.ExcludeForDomain = w.sniffingConfig.DomainsExcluded
+		content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
 	}
 	ctx = session.ContextWithContent(ctx, content)
 
@@ -470,9 +482,10 @@ func (w *dsWorker) Proxy() proxy.Inbound {
 func (w *dsWorker) Port() net.Port {
 	return net.Port(0)
 }
+
 func (w *dsWorker) Start() error {
 	ctx := context.Background()
-	hub, err := internet.ListenUnix(ctx, w.address, w.stream, func(conn internet.Connection) {
+	hub, err := internet.ListenUnix(ctx, w.address, w.stream, func(conn stat.Connection) {
 		go w.callback(conn)
 	})
 	if err != nil {

app/proxyman/outbound/handler.go

@@ -3,6 +3,8 @@ package outbound
 import (
 	"context"
 
+	"github.com/xtls/xray-core/transport/internet/stat"
+
 	"github.com/xtls/xray-core/app/proxyman"
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/mux"
@@ -158,7 +160,7 @@ func (h *Handler) Address() net.Address {
 }
 
 // Dial implements internet.Dialer.
-func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Connection, error) {
+func (h *Handler) Dial(ctx context.Context, dest net.Destination) (stat.Connection, error) {
 	if h.senderSettings != nil {
 		if h.senderSettings.ProxySettings.HasTag() {
 			tag := h.senderSettings.ProxySettings.Tag
@@ -201,9 +203,9 @@ func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Conn
 	return h.getStatCouterConnection(conn), err
 }
 
-func (h *Handler) getStatCouterConnection(conn internet.Connection) internet.Connection {
+func (h *Handler) getStatCouterConnection(conn stat.Connection) stat.Connection {
 	if h.uplinkCounter != nil || h.downlinkCounter != nil {
-		return &internet.StatCouterConnection{
+		return &stat.CounterConnection{
 			Connection:   conn,
 			ReadCounter:  h.downlinkCounter,
 			WriteCounter: h.uplinkCounter,

app/proxyman/outbound/handler_test.go

@@ -4,6 +4,8 @@ import (
 	"context"
 	"testing"
 
+	"github.com/xtls/xray-core/transport/internet/stat"
+
 	"github.com/xtls/xray-core/app/policy"
 	. "github.com/xtls/xray-core/app/proxyman/outbound"
 	"github.com/xtls/xray-core/app/stats"
@@ -12,7 +14,6 @@ import (
 	core "github.com/xtls/xray-core/core"
 	"github.com/xtls/xray-core/features/outbound"
 	"github.com/xtls/xray-core/proxy/freedom"
-	"github.com/xtls/xray-core/transport/internet"
 )
 
 func TestInterfaces(t *testing.T) {
@@ -44,9 +45,9 @@ func TestOutboundWithoutStatCounter(t *testing.T) {
 		ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
 	})
 	conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
-	_, ok := conn.(*internet.StatCouterConnection)
+	_, ok := conn.(*stat.CounterConnection)
 	if ok {
-		t.Errorf("Expected conn to not be StatCouterConnection")
+		t.Errorf("Expected conn to not be CounterConnection")
 	}
 }
 
@@ -73,8 +74,8 @@ func TestOutboundWithStatCounter(t *testing.T) {
 		ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
 	})
 	conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
-	_, ok := conn.(*internet.StatCouterConnection)
+	_, ok := conn.(*stat.CounterConnection)
 	if !ok {
-		t.Errorf("Expected conn to be StatCouterConnection")
+		t.Errorf("Expected conn to be CounterConnection")
 	}
 }

app/proxyman/outbound/outbound.go

@@ -109,6 +109,9 @@ func (m *Manager) AddHandler(ctx context.Context, handler outbound.Handler) erro
 
 	tag := handler.Tag()
 	if len(tag) > 0 {
+		if _, found := m.taggedHandler[tag]; found {
+			return newError("existing tag found: " + tag)
+		}
 		m.taggedHandler[tag] = handler
 	} else {
 		m.untaggedHandlers = append(m.untaggedHandlers, handler)

app/reverse/bridge.go

@@ -5,6 +5,7 @@ import (
 	"time"
 
 	"github.com/golang/protobuf/proto"
+
 	"github.com/xtls/xray-core/common/mux"
 	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/common/session"

app/reverse/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/reverse/config.proto
 
 package reverse
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type Control_State int32
 
 const (

app/reverse/portal.go

@@ -6,6 +6,7 @@ import (
 	"time"
 
 	"github.com/golang/protobuf/proto"
+
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/buf"
 	"github.com/xtls/xray-core/common/mux"
@@ -157,6 +158,9 @@ func (p *StaticMuxPicker) PickAvailable() (*mux.ClientWorker, error) {
 		if w.draining {
 			continue
 		}
+		if w.client.Closed() {
+			continue
+		}
 		if w.client.ActiveConnections() < minConn {
 			minConn = w.client.ActiveConnections()
 			minIdx = i

app/router/balancing.go

@@ -9,8 +9,7 @@ type BalancingStrategy interface {
 	PickOutbound([]string) string
 }
 
-type RandomStrategy struct {
-}
+type RandomStrategy struct{}
 
 func (s *RandomStrategy) PickOutbound(tags []string) string {
 	n := len(tags)

app/router/command/command.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/router/command/command.proto
 
 package command
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	net "github.com/xtls/xray-core/common/net"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
@@ -22,10 +21,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 // RoutingContext is the context with information relative to routing process.
 // It conforms to the structure of xray.features.routing.Context and
 // xray.features.routing.Route.
@@ -91,7 +86,7 @@ func (x *RoutingContext) GetNetwork() net.Network {
 	if x != nil {
 		return x.Network
 	}
-	return net.Network_Unknown
+	return net.Network(0)
 }
 
 func (x *RoutingContext) GetSourceIPs() [][]byte {

app/router/command/command_test.go

@@ -8,6 +8,9 @@ import (
 	"github.com/golang/mock/gomock"
 	"github.com/google/go-cmp/cmp"
 	"github.com/google/go-cmp/cmp/cmpopts"
+	"google.golang.org/grpc"
+	"google.golang.org/grpc/test/bufconn"
+
 	"github.com/xtls/xray-core/app/router"
 	. "github.com/xtls/xray-core/app/router/command"
 	"github.com/xtls/xray-core/app/stats"
@@ -15,8 +18,6 @@ import (
 	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/features/routing"
 	"github.com/xtls/xray-core/testing/mocks"
-	"google.golang.org/grpc"
-	"google.golang.org/grpc/test/bufconn"
 )
 
 func TestServiceSubscribeRoutingStats(t *testing.T) {
@@ -44,7 +45,6 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
 		{SourceIPs: [][]byte{{127, 0, 0, 1}}, Attributes: map[string]string{"attr": "value"}, OutboundTag: "out"},
 	}
 	errCh := make(chan error)
-	nextPub := make(chan struct{})
 
 	// Server goroutine
 	go func() {
@@ -76,13 +76,6 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
 		if err := publishTestCases(); err != nil {
 			errCh <- err
 		}
-
-		// Wait for next round of publishing
-		<-nextPub
-
-		if err := publishTestCases(); err != nil {
-			errCh <- err
-		}
 	}()
 
 	// Client goroutine
@@ -144,6 +137,92 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
 			return nil
 		}
 
+		if err := testRetrievingAllFields(); err != nil {
+			errCh <- err
+		}
+		errCh <- nil // Client passed all tests successfully
+	}()
+
+	// Wait for goroutines to complete
+	select {
+	case <-time.After(2 * time.Second):
+		t.Fatal("Test timeout after 2s")
+	case err := <-errCh:
+		if err != nil {
+			t.Fatal(err)
+		}
+	}
+}
+
+func TestServiceSubscribeSubsetOfFields(t *testing.T) {
+	c := stats.NewChannel(&stats.ChannelConfig{
+		SubscriberLimit: 1,
+		BufferSize:      0,
+		Blocking:        true,
+	})
+	common.Must(c.Start())
+	defer c.Close()
+
+	lis := bufconn.Listen(1024 * 1024)
+	bufDialer := func(context.Context, string) (net.Conn, error) {
+		return lis.Dial()
+	}
+
+	testCases := []*RoutingContext{
+		{InboundTag: "in", OutboundTag: "out"},
+		{TargetIPs: [][]byte{{1, 2, 3, 4}}, TargetPort: 8080, OutboundTag: "out"},
+		{TargetDomain: "example.com", TargetPort: 443, OutboundTag: "out"},
+		{SourcePort: 9999, TargetPort: 9999, OutboundTag: "out"},
+		{Network: net.Network_UDP, OutboundGroupTags: []string{"outergroup", "innergroup"}, OutboundTag: "out"},
+		{Protocol: "bittorrent", OutboundTag: "blocked"},
+		{User: "example@example.com", OutboundTag: "out"},
+		{SourceIPs: [][]byte{{127, 0, 0, 1}}, Attributes: map[string]string{"attr": "value"}, OutboundTag: "out"},
+	}
+	errCh := make(chan error)
+
+	// Server goroutine
+	go func() {
+		server := grpc.NewServer()
+		RegisterRoutingServiceServer(server, NewRoutingServer(nil, c))
+		errCh <- server.Serve(lis)
+	}()
+
+	// Publisher goroutine
+	go func() {
+		publishTestCases := func() error {
+			ctx, cancel := context.WithTimeout(context.Background(), time.Second)
+			defer cancel()
+			for { // Wait until there's one subscriber in routing stats channel
+				if len(c.Subscribers()) > 0 {
+					break
+				}
+				if ctx.Err() != nil {
+					return ctx.Err()
+				}
+			}
+			for _, tc := range testCases {
+				c.Publish(context.Background(), AsRoutingRoute(tc))
+				time.Sleep(time.Millisecond)
+			}
+			return nil
+		}
+
+		if err := publishTestCases(); err != nil {
+			errCh <- err
+		}
+	}()
+
+	// Client goroutine
+	go func() {
+		defer lis.Close()
+		conn, err := grpc.DialContext(context.Background(), "bufnet", grpc.WithContextDialer(bufDialer), grpc.WithInsecure())
+		if err != nil {
+			errCh <- err
+			return
+		}
+		defer conn.Close()
+		client := NewRoutingServiceClient(conn)
+
 		// Test retrieving only a subset of fields
 		testRetrievingSubsetOfFields := func() error {
 			streamCtx, streamClose := context.WithCancel(context.Background())
@@ -155,9 +234,6 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
 				return err
 			}
 
-			// Send nextPub signal to start next round of publishing
-			close(nextPub)
-
 			for _, tc := range testCases {
 				msg, err := stream.Recv()
 				if err != nil {
@@ -179,10 +255,6 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
 
 			return nil
 		}
-
-		if err := testRetrievingAllFields(); err != nil {
-			errCh <- err
-		}
 		if err := testRetrievingSubsetOfFields(); err != nil {
 			errCh <- err
 		}

app/router/command/config.go

@@ -28,6 +28,13 @@ func (c routingContext) GetTargetPort() net.Port {
 	return net.Port(c.RoutingContext.GetTargetPort())
 }
 
+// GetSkipDNSResolve is a mock implementation here to match the interface,
+// SkipDNSResolve is set from dns module, no use if coming from a protobuf object?
+// TODO: please confirm @Vigilans
+func (c routingContext) GetSkipDNSResolve() bool {
+	return false
+}
+
 // AsRoutingContext converts a protobuf RoutingContext into an implementation of routing.Context.
 func AsRoutingContext(r *RoutingContext) routing.Context {
 	return routingContext{r}

app/router/condition.go

@@ -66,6 +66,24 @@ type DomainMatcher struct {
 	matchers strmatcher.IndexMatcher
 }
 
+func NewMphMatcherGroup(domains []*Domain) (*DomainMatcher, error) {
+	g := strmatcher.NewMphMatcherGroup()
+	for _, d := range domains {
+		matcherType, f := matcherTypeMap[d.Type]
+		if !f {
+			return nil, newError("unsupported domain type", d.Type)
+		}
+		_, err := g.AddPattern(d.Value, matcherType)
+		if err != nil {
+			return nil, err
+		}
+	}
+	g.Build()
+	return &DomainMatcher{
+		matchers: g,
+	}, nil
+}
+
 func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
 	g := new(strmatcher.MatcherGroup)
 	for _, d := range domains {
@@ -82,7 +100,7 @@ func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
 }
 
 func (m *DomainMatcher) ApplyDomain(domain string) bool {
-	return len(m.matchers.Match(domain)) > 0
+	return len(m.matchers.Match(strings.ToLower(domain))) > 0
 }
 
 // Apply implements Condition.
@@ -91,7 +109,7 @@ func (m *DomainMatcher) Apply(ctx routing.Context) bool {
 	if len(domain) == 0 {
 		return false
 	}
-	return m.ApplyDomain(strings.ToLower(domain))
+	return m.ApplyDomain(domain)
 }
 
 type MultiGeoIPMatcher struct {

app/router/condition_geoip.go

@@ -186,6 +186,4 @@ func (c *GeoIPMatcherContainer) Add(geoip *GeoIP) (*GeoIPMatcher, error) {
 	return m, nil
 }
 
-var (
-	globalGeoIPContainer GeoIPMatcherContainer
-)
+var globalGeoIPContainer GeoIPMatcherContainer

app/router/condition_geoip_test.go

@@ -6,6 +6,7 @@ import (
 	"testing"
 
 	"github.com/golang/protobuf/proto"
+
 	"github.com/xtls/xray-core/app/router"
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/net"
@@ -88,7 +89,8 @@ func TestGeoIPMatcher(t *testing.T) {
 		{
 			Input:  "192.0.1.0",
 			Output: false,
-		}, {
+		},
+		{
 			Input:  "0.1.0.0",
 			Output: true,
 		},

app/router/condition_test.go

@@ -359,6 +359,9 @@ func TestChinaSites(t *testing.T) {
 	matcher, err := NewDomainMatcher(domains)
 	common.Must(err)
 
+	acMatcher, err := NewMphMatcherGroup(domains)
+	common.Must(err)
+
 	type TestCase struct {
 		Domain string
 		Output bool
@@ -387,9 +390,96 @@ func TestChinaSites(t *testing.T) {
 	}
 
 	for _, testCase := range testCases {
-		r := matcher.ApplyDomain(testCase.Domain)
-		if r != testCase.Output {
-			t.Error("expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r)
+		r1 := matcher.ApplyDomain(testCase.Domain)
+		r2 := acMatcher.ApplyDomain(testCase.Domain)
+		if r1 != testCase.Output {
+			t.Error("DomainMatcher expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r1)
+		} else if r2 != testCase.Output {
+			t.Error("ACDomainMatcher expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r2)
+		}
+	}
+}
+
+func BenchmarkMphDomainMatcher(b *testing.B) {
+	domains, err := loadGeoSite("CN")
+	common.Must(err)
+
+	matcher, err := NewMphMatcherGroup(domains)
+	common.Must(err)
+
+	type TestCase struct {
+		Domain string
+		Output bool
+	}
+	testCases := []TestCase{
+		{
+			Domain: "163.com",
+			Output: true,
+		},
+		{
+			Domain: "163.com",
+			Output: true,
+		},
+		{
+			Domain: "164.com",
+			Output: false,
+		},
+		{
+			Domain: "164.com",
+			Output: false,
+		},
+	}
+
+	for i := 0; i < 1024; i++ {
+		testCases = append(testCases, TestCase{Domain: strconv.Itoa(i) + ".not-exists.com", Output: false})
+	}
+
+	b.ResetTimer()
+	for i := 0; i < b.N; i++ {
+		for _, testCase := range testCases {
+			_ = matcher.ApplyDomain(testCase.Domain)
+		}
+	}
+}
+
+func BenchmarkDomainMatcher(b *testing.B) {
+	domains, err := loadGeoSite("CN")
+	common.Must(err)
+
+	matcher, err := NewDomainMatcher(domains)
+	common.Must(err)
+
+	type TestCase struct {
+		Domain string
+		Output bool
+	}
+	testCases := []TestCase{
+		{
+			Domain: "163.com",
+			Output: true,
+		},
+		{
+			Domain: "163.com",
+			Output: true,
+		},
+		{
+			Domain: "164.com",
+			Output: false,
+		},
+		{
+			Domain: "164.com",
+			Output: false,
+		},
+	}
+
+	for i := 0; i < 1024; i++ {
+		testCases = append(testCases, TestCase{Domain: strconv.Itoa(i) + ".not-exists.com", Output: false})
+	}
+
+	b.ResetTimer()
+	for i := 0; i < b.N; i++ {
+		for _, testCase := range testCases {
+			_ = matcher.ApplyDomain(testCase.Domain)
 		}
 	}
 }

app/router/config.go

@@ -67,11 +67,23 @@ func (rr *RoutingRule) BuildCondition() (Condition, error) {
 	conds := NewConditionChan()
 
 	if len(rr.Domain) > 0 {
+		switch rr.DomainMatcher {
+		case "linear":
 			matcher, err := NewDomainMatcher(rr.Domain)
 			if err != nil {
 				return nil, newError("failed to build domain condition").Base(err)
 			}
 			conds.Add(matcher)
+		case "mph", "hybrid":
+			fallthrough
+		default:
+			matcher, err := NewMphMatcherGroup(rr.Domain)
+			if err != nil {
+				return nil, newError("failed to build domain condition with MphDomainMatcher").Base(err)
+			}
+			newError("MphDomainMatcher is enabled for ", len(rr.Domain), " domain rule(s)").AtDebug().WriteToLog()
+			conds.Add(matcher)
+		}
 	}
 
 	if len(rr.UserEmail) > 0 {

app/router/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/router/config.proto
 
 package router
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	net "github.com/xtls/xray-core/common/net"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
@@ -22,10 +21,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 // Type of domain value.
 type Domain_Type int32
 
@@ -515,6 +510,7 @@ type RoutingRule struct {
 	InboundTag     []string      `protobuf:"bytes,8,rep,name=inbound_tag,json=inboundTag,proto3" json:"inbound_tag,omitempty"`
 	Protocol       []string      `protobuf:"bytes,9,rep,name=protocol,proto3" json:"protocol,omitempty"`
 	Attributes     string        `protobuf:"bytes,15,opt,name=attributes,proto3" json:"attributes,omitempty"`
+	DomainMatcher  string        `protobuf:"bytes,17,opt,name=domain_matcher,json=domainMatcher,proto3" json:"domain_matcher,omitempty"`
 }
 
 func (x *RoutingRule) Reset() {
@@ -672,6 +668,13 @@ func (x *RoutingRule) GetAttributes() string {
 	return ""
 }
 
+func (x *RoutingRule) GetDomainMatcher() string {
+	if x != nil {
+		return x.DomainMatcher
+	}
+	return ""
+}
+
 type isRoutingRule_TargetTag interface {
 	isRoutingRule_TargetTag()
 }
@@ -946,7 +949,7 @@ var file_app_router_config_proto_rawDesc = []byte{
 	0x74, 0x12, 0x2e, 0x0a, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b,
 	0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
 	0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x52, 0x05, 0x65, 0x6e, 0x74, 0x72,
-	0x79, 0x22, 0x8e, 0x06, 0x0a, 0x0b, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
+	0x79, 0x22, 0xb5, 0x06, 0x0a, 0x0b, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
 	0x65, 0x12, 0x12, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00,
 	0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x25, 0x0a, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69,
 	0x6e, 0x67, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x0c, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00, 0x52, 0x0c,
@@ -994,36 +997,38 @@ var file_app_router_config_proto_rawDesc = []byte{
 	0x6f, 0x63, 0x6f, 0x6c, 0x18, 0x09, 0x20, 0x03, 0x28, 0x09, 0x52, 0x08, 0x70, 0x72, 0x6f, 0x74,
 	0x6f, 0x63, 0x6f, 0x6c, 0x12, 0x1e, 0x0a, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62, 0x75, 0x74,
 	0x65, 0x73, 0x18, 0x0f, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62,
-	0x75, 0x74, 0x65, 0x73, 0x42, 0x0c, 0x0a, 0x0a, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74,
-	0x61, 0x67, 0x22, 0x4e, 0x0a, 0x0d, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52,
-	0x75, 0x6c, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09,
-	0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x2b, 0x0a, 0x11, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e,
-	0x64, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09,
-	0x52, 0x10, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74,
-	0x6f, 0x72, 0x22, 0x9b, 0x02, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x4f, 0x0a,
-	0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
-	0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x26, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
-	0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e,
-	0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0e,
-	0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x30,
-	0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78,
-	0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x52,
-	0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x04, 0x72, 0x75, 0x6c, 0x65,
-	0x12, 0x45, 0x0a, 0x0e, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x5f, 0x72, 0x75,
-	0x6c, 0x65, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1e, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
-	0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e,
-	0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63,
-	0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x22, 0x47, 0x0a, 0x0e, 0x44, 0x6f, 0x6d, 0x61, 0x69,
-	0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x08, 0x0a, 0x04, 0x41, 0x73, 0x49,
-	0x73, 0x10, 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55, 0x73, 0x65, 0x49, 0x70, 0x10, 0x01, 0x12, 0x10,
-	0x0a, 0x0c, 0x49, 0x70, 0x49, 0x66, 0x4e, 0x6f, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x10, 0x02,
-	0x12, 0x0e, 0x0a, 0x0a, 0x49, 0x70, 0x4f, 0x6e, 0x44, 0x65, 0x6d, 0x61, 0x6e, 0x64, 0x10, 0x03,
-	0x42, 0x4f, 0x0a, 0x13, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
-	0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x50, 0x01, 0x5a, 0x24, 0x67, 0x69, 0x74, 0x68, 0x75,
-	0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d,
-	0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0xaa,
-	0x02, 0x0f, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x65,
-	0x72, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
+	0x75, 0x74, 0x65, 0x73, 0x12, 0x25, 0x0a, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6d,
+	0x61, 0x74, 0x63, 0x68, 0x65, 0x72, 0x18, 0x11, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x64, 0x6f,
+	0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x65, 0x72, 0x42, 0x0c, 0x0a, 0x0a, 0x74,
+	0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74, 0x61, 0x67, 0x22, 0x4e, 0x0a, 0x0d, 0x42, 0x61, 0x6c,
+	0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61,
+	0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x2b, 0x0a, 0x11,
+	0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f,
+	0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09, 0x52, 0x10, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e,
+	0x64, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x22, 0x9b, 0x02, 0x0a, 0x06, 0x43, 0x6f,
+	0x6e, 0x66, 0x69, 0x67, 0x12, 0x4f, 0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x73,
+	0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x26, 0x2e,
+	0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e,
+	0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72,
+	0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72,
+	0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x30, 0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x02, 0x20,
+	0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72,
+	0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
+	0x65, 0x52, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x12, 0x45, 0x0a, 0x0e, 0x62, 0x61, 0x6c, 0x61, 0x6e,
+	0x63, 0x69, 0x6e, 0x67, 0x5f, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32,
+	0x1e, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65,
+	0x72, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52,
+	0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x22, 0x47,
+	0x0a, 0x0e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
+	0x12, 0x08, 0x0a, 0x04, 0x41, 0x73, 0x49, 0x73, 0x10, 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55, 0x73,
+	0x65, 0x49, 0x70, 0x10, 0x01, 0x12, 0x10, 0x0a, 0x0c, 0x49, 0x70, 0x49, 0x66, 0x4e, 0x6f, 0x6e,
+	0x4d, 0x61, 0x74, 0x63, 0x68, 0x10, 0x02, 0x12, 0x0e, 0x0a, 0x0a, 0x49, 0x70, 0x4f, 0x6e, 0x44,
+	0x65, 0x6d, 0x61, 0x6e, 0x64, 0x10, 0x03, 0x42, 0x4f, 0x0a, 0x13, 0x63, 0x6f, 0x6d, 0x2e, 0x78,
+	0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x50, 0x01,
+	0x5a, 0x24, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c,
+	0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f,
+	0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0xaa, 0x02, 0x0f, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70,
+	0x70, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
 }
 
 var (

app/router/config.proto

@@ -119,6 +119,8 @@ message RoutingRule {
   repeated string protocol = 9;
 
   string attributes = 15;
+
+  string domain_matcher = 17;
 }
 
 message BalancingRule {

app/router/router.go

@@ -80,7 +80,12 @@ func (r *Router) PickRoute(ctx routing.Context) (routing.Route, error) {
 }
 
 func (r *Router) pickRouteInternal(ctx routing.Context) (*Rule, routing.Context, error) {
-	if r.domainStrategy == Config_IpOnDemand {
+	// SkipDNSResolve is set from DNS module.
+	// the DOH remote server maybe a domain name,
+	// this prevents cycle resolving dead loop
+	skipDNSResolve := ctx.GetSkipDNSResolve()
+
+	if r.domainStrategy == Config_IpOnDemand && !skipDNSResolve {
 		ctx = routing_dns.ContextWithDNSClient(ctx, r.dns)
 	}
 
@@ -90,7 +95,7 @@ func (r *Router) pickRouteInternal(ctx routing.Context) (*Rule, routing.Context,
 		}
 	}
 
-	if r.domainStrategy != Config_IpIfNonMatch || len(ctx.GetTargetDomain()) == 0 {
+	if r.domainStrategy != Config_IpIfNonMatch || len(ctx.GetTargetDomain()) == 0 || skipDNSResolve {
 		return nil, ctx, common.ErrNoClue
 	}
 

app/router/router_test.go

@@ -4,7 +4,10 @@ import (
 	"context"
 	"testing"
 
+	"github.com/xtls/xray-core/features/dns"
+
 	"github.com/golang/mock/gomock"
+
 	. "github.com/xtls/xray-core/app/router"
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/net"
@@ -115,7 +118,11 @@ func TestIPOnDemand(t *testing.T) {
 	defer mockCtl.Finish()
 
 	mockDNS := mocks.NewDNSClient(mockCtl)
-	mockDNS.EXPECT().LookupIP(gomock.Eq("example.com")).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
+	mockDNS.EXPECT().LookupIP(gomock.Eq("example.com"), dns.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+		FakeEnable: false,
+	}).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
 
 	r := new(Router)
 	common.Must(r.Init(config, mockDNS, nil))
@@ -150,7 +157,11 @@ func TestIPIfNonMatchDomain(t *testing.T) {
 	defer mockCtl.Finish()
 
 	mockDNS := mocks.NewDNSClient(mockCtl)
-	mockDNS.EXPECT().LookupIP(gomock.Eq("example.com")).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
+	mockDNS.EXPECT().LookupIP(gomock.Eq("example.com"), dns.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+		FakeEnable: false,
+	}).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
 
 	r := new(Router)
 	common.Must(r.Init(config, mockDNS, nil))

app/stats/command/command.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/stats/command/command.proto
 
 package command
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type GetStatsRequest struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache

app/stats/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: app/stats/config.proto
 
 package stats
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type Config struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache

common/buf/buffer.go

@@ -24,18 +24,48 @@ type Buffer struct {
 	UDP   *net.Destination
 }
 
-// New creates a Buffer with 0 length and 2K capacity.
+// New creates a Buffer with 0 length and 8K capacity.
 func New() *Buffer {
+	buf := pool.Get().([]byte)
+	if cap(buf) >= Size {
+		buf = buf[:Size]
+	} else {
+		buf = make([]byte, Size)
+	}
+
 	return &Buffer{
-		v: pool.Get().([]byte),
+		v: buf,
+	}
+}
+
+func NewExisted(b []byte) *Buffer {
+	if cap(b) < Size {
+		panic("Invalid buffer")
+	}
+
+	oLen := len(b)
+	if oLen < Size {
+		b = b[:Size]
+	}
+
+	return &Buffer{
+		v:   b,
+		end: int32(oLen),
 	}
 }
 
 // StackNew creates a new Buffer object on stack.
 // This method is for buffers that is released in the same function.
 func StackNew() Buffer {
+	buf := pool.Get().([]byte)
+	if cap(buf) >= Size {
+		buf = buf[:Size]
+	} else {
+		buf = make([]byte, Size)
+	}
+
 	return Buffer{
-		v: pool.Get().([]byte),
+		v: buf,
 	}
 }
 
@@ -48,7 +78,10 @@ func (b *Buffer) Release() {
 	p := b.v
 	b.v = nil
 	b.Clear()
+
+	if cap(p) == Size {
 		pool.Put(p)
+	}
 	b.UDP = nil
 }
 

common/buf/buffer_test.go

@@ -6,6 +6,7 @@ import (
 	"testing"
 
 	"github.com/google/go-cmp/cmp"
+
 	"github.com/xtls/xray-core/common"
 	. "github.com/xtls/xray-core/common/buf"
 )
@@ -77,6 +78,7 @@ func TestBufferByte(t *testing.T) {
 		buffer.Release()
 	}
 }
+
 func TestBufferResize(t *testing.T) {
 	buffer := New()
 	defer buffer.Release()

common/buf/io.go

@@ -6,6 +6,9 @@ import (
 	"os"
 	"syscall"
 	"time"
+
+	"github.com/xtls/xray-core/features/stats"
+	"github.com/xtls/xray-core/transport/internet/stat"
 )
 
 // Reader extends io.Reader with MultiBuffer.
@@ -29,9 +32,17 @@ type Writer interface {
 }
 
 // WriteAllBytes ensures all bytes are written into the given writer.
-func WriteAllBytes(writer io.Writer, payload []byte) error {
+func WriteAllBytes(writer io.Writer, payload []byte, c stats.Counter) error {
+	wc := 0
+	defer func() {
+		if c != nil {
+			c.Add(int64(wc))
+		}
+	}()
+
 	for len(payload) > 0 {
 		n, err := writer.Write(payload)
+		wc += n
 		if err != nil {
 			return err
 		}
@@ -65,7 +76,13 @@ func NewReader(reader io.Reader) Reader {
 			if err != nil {
 				newError("failed to get sysconn").Base(err).WriteToLog()
 			} else {
-				return NewReadVReader(reader, rawConn)
+				var counter stats.Counter
+
+				if statConn, ok := reader.(*stat.CounterConnection); ok {
+					reader = statConn.Connection
+					counter = statConn.ReadCounter
+				}
+				return NewReadVReader(reader, rawConn, counter)
 			}
 		}
 	}
@@ -104,13 +121,24 @@ func NewWriter(writer io.Writer) Writer {
 		return mw
 	}
 
-	if isPacketWriter(writer) {
+	iConn := writer
+	if statConn, ok := writer.(*stat.CounterConnection); ok {
+		iConn = statConn.Connection
+	}
+
+	if isPacketWriter(iConn) {
 		return &SequentialWriter{
 			Writer: writer,
 		}
 	}
 
+	var counter stats.Counter
+
+	if statConn, ok := writer.(*stat.CounterConnection); ok {
+		counter = statConn.WriteCounter
+	}
 	return &BufferToBytesWriter{
-		Writer: writer,
+		Writer:  iConn,
+		counter: counter,
 	}
 }

common/buf/multi_buffer_test.go

@@ -4,11 +4,11 @@ import (
 	"bytes"
 	"crypto/rand"
 	"io"
-	"io/ioutil"
 	"os"
 	"testing"
 
 	"github.com/google/go-cmp/cmp"
+
 	"github.com/xtls/xray-core/common"
 	. "github.com/xtls/xray-core/common/buf"
 )
@@ -119,7 +119,7 @@ func TestMultiBufferReadAllToByte(t *testing.T) {
 		common.Must(err)
 		f.Close()
 
-		cnt, err := ioutil.ReadFile(dat)
+		cnt, err := os.ReadFile(dat)
 		common.Must(err)
 
 		if d := cmp.Diff(buf2, cnt); d != "" {

common/buf/readv_posix.go

@@ -1,6 +1,5 @@
-// +build !windows
-// +build !wasm
-// +build !illumos
+//go:build !windows && !wasm && !illumos
+// +build !windows,!wasm,!illumos
 
 package buf
 

common/buf/readv_reader.go

@@ -1,12 +1,14 @@
+//go:build !wasm
 // +build !wasm
 
 package buf
 
 import (
 	"io"
-	"runtime"
 	"syscall"
 
+	"github.com/xtls/xray-core/features/stats"
+
 	"github.com/xtls/xray-core/common/platform"
 )
 
@@ -54,10 +56,11 @@ type ReadVReader struct {
 	rawConn syscall.RawConn
 	mr      multiReader
 	alloc   allocStrategy
+	counter stats.Counter
 }
 
 // NewReadVReader creates a new ReadVReader.
-func NewReadVReader(reader io.Reader, rawConn syscall.RawConn) *ReadVReader {
+func NewReadVReader(reader io.Reader, rawConn syscall.RawConn, counter stats.Counter) *ReadVReader {
 	return &ReadVReader{
 		Reader:  reader,
 		rawConn: rawConn,
@@ -65,6 +68,7 @@ func NewReadVReader(reader io.Reader, rawConn syscall.RawConn) *ReadVReader {
 			current: 1,
 		},
 		mr:      newMultiReader(),
+		counter: counter,
 	}
 }
 
@@ -123,10 +127,16 @@ func (r *ReadVReader) ReadMultiBuffer() (MultiBuffer, error) {
 		if b.IsFull() {
 			r.alloc.Adjust(1)
 		}
+		if r.counter != nil && b != nil {
+			r.counter.Add(int64(b.Len()))
+		}
 		return MultiBuffer{b}, err
 	}
 
 	mb, err := r.readMulti()
+	if r.counter != nil && mb != nil {
+		r.counter.Add(int64(mb.Len()))
+	}
 	if err != nil {
 		return nil, err
 	}
@@ -134,17 +144,13 @@ func (r *ReadVReader) ReadMultiBuffer() (MultiBuffer, error) {
 	return mb, nil
 }
 
-var useReadv = true
+var useReadv bool
 
 func init() {
 	const defaultFlagValue = "NOT_DEFINED_AT_ALL"
 	value := platform.NewEnvFlag("xray.buf.readv").GetValue(func() string { return defaultFlagValue })
 	switch value {
-	case defaultFlagValue, "auto":
-		if (runtime.GOARCH == "386" || runtime.GOARCH == "amd64" || runtime.GOARCH == "s390x") && (runtime.GOOS == "linux" || runtime.GOOS == "darwin" || runtime.GOOS == "windows") {
-			useReadv = true
-		}
-	case "enable":
+	case defaultFlagValue, "auto", "enable":
 		useReadv = true
 	}
 }

common/buf/readv_reader_wasm.go

@@ -1,3 +1,4 @@
+//go:build wasm
 // +build wasm
 
 package buf

common/buf/readv_test.go

@@ -1,3 +1,4 @@
+//go:build !wasm
 // +build !wasm
 
 package buf_test
@@ -9,10 +10,11 @@ import (
 
 	"github.com/google/go-cmp/cmp"
 
+	"golang.org/x/sync/errgroup"
+
 	"github.com/xtls/xray-core/common"
 	. "github.com/xtls/xray-core/common/buf"
 	"github.com/xtls/xray-core/testing/servers/tcp"
-	"golang.org/x/sync/errgroup"
 )
 
 func TestReadvReader(t *testing.T) {
@@ -50,7 +52,7 @@ func TestReadvReader(t *testing.T) {
 	rawConn, err := conn.(*net.TCPConn).SyscallConn()
 	common.Must(err)
 
-	reader := NewReadVReader(conn, rawConn)
+	reader := NewReadVReader(conn, rawConn, nil)
 	var rmb MultiBuffer
 	for {
 		mb, err := reader.ReadMultiBuffer()

common/buf/readv_unix.go

@@ -1,3 +1,4 @@
+//go:build illumos
 // +build illumos
 
 package buf

common/buf/writer.go

@@ -5,6 +5,8 @@ import (
 	"net"
 	"sync"
 
+	"github.com/xtls/xray-core/features/stats"
+
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/errors"
 )
@@ -13,6 +15,7 @@ import (
 type BufferToBytesWriter struct {
 	io.Writer
 
+	counter stats.Counter
 	cache   [][]byte
 }
 
@@ -26,7 +29,7 @@ func (w *BufferToBytesWriter) WriteMultiBuffer(mb MultiBuffer) error {
 	}
 
 	if len(mb) == 1 {
-		return WriteAllBytes(w.Writer, mb[0].Bytes())
+		return WriteAllBytes(w.Writer, mb[0].Bytes(), w.counter)
 	}
 
 	if cap(w.cache) < len(mb) {
@@ -45,9 +48,15 @@ func (w *BufferToBytesWriter) WriteMultiBuffer(mb MultiBuffer) error {
 	}()
 
 	nb := net.Buffers(bs)
-
+	wc := int64(0)
+	defer func() {
+		if w.counter != nil {
+			w.counter.Add(wc)
+		}
+	}()
 	for size > 0 {
 		n, err := nb.WriteTo(w.Writer)
+		wc += n
 		if err != nil {
 			return err
 		}
@@ -173,7 +182,7 @@ func (w *BufferedWriter) flushInternal() error {
 	w.buffer = nil
 
 	if writer, ok := w.writer.(io.Writer); ok {
-		err := WriteAllBytes(writer, b.Bytes())
+		err := WriteAllBytes(writer, b.Bytes(), nil)
 		b.Release()
 		return err
 	}

common/cache/lru.go

@@ -0,0 +1,89 @@
+package cache
+
+import (
+	"container/list"
+	"sync"
+)
+
+// Lru simple, fast lru cache implementation
+type Lru interface {
+	Get(key interface{}) (value interface{}, ok bool)
+	GetKeyFromValue(value interface{}) (key interface{}, ok bool)
+	PeekKeyFromValue(value interface{}) (key interface{}, ok bool) // Peek means check but NOT bring to top
+	Put(key, value interface{})
+}
+
+type lru struct {
+	capacity         int
+	doubleLinkedlist *list.List
+	keyToElement     *sync.Map
+	valueToElement   *sync.Map
+	mu               *sync.Mutex
+}
+
+type lruElement struct {
+	key   interface{}
+	value interface{}
+}
+
+// NewLru init a lru cache
+func NewLru(cap int) Lru {
+	return &lru{
+		capacity:         cap,
+		doubleLinkedlist: list.New(),
+		keyToElement:     new(sync.Map),
+		valueToElement:   new(sync.Map),
+		mu:               new(sync.Mutex),
+	}
+}
+
+func (l *lru) Get(key interface{}) (value interface{}, ok bool) {
+	l.mu.Lock()
+	defer l.mu.Unlock()
+	if v, ok := l.keyToElement.Load(key); ok {
+		element := v.(*list.Element)
+		l.doubleLinkedlist.MoveToFront(element)
+		return element.Value.(*lruElement).value, true
+	}
+	return nil, false
+}
+
+func (l *lru) GetKeyFromValue(value interface{}) (key interface{}, ok bool) {
+	l.mu.Lock()
+	defer l.mu.Unlock()
+	if k, ok := l.valueToElement.Load(value); ok {
+		element := k.(*list.Element)
+		l.doubleLinkedlist.MoveToFront(element)
+		return element.Value.(*lruElement).key, true
+	}
+	return nil, false
+}
+
+func (l *lru) PeekKeyFromValue(value interface{}) (key interface{}, ok bool) {
+	if k, ok := l.valueToElement.Load(value); ok {
+		element := k.(*list.Element)
+		return element.Value.(*lruElement).key, true
+	}
+	return nil, false
+}
+
+func (l *lru) Put(key, value interface{}) {
+	l.mu.Lock()
+	e := &lruElement{key, value}
+	if v, ok := l.keyToElement.Load(key); ok {
+		element := v.(*list.Element)
+		element.Value = e
+		l.doubleLinkedlist.MoveToFront(element)
+	} else {
+		element := l.doubleLinkedlist.PushFront(e)
+		l.keyToElement.Store(key, element)
+		l.valueToElement.Store(value, element)
+		if l.doubleLinkedlist.Len() > l.capacity {
+			toBeRemove := l.doubleLinkedlist.Back()
+			l.doubleLinkedlist.Remove(toBeRemove)
+			l.keyToElement.Delete(toBeRemove.Value.(*lruElement).key)
+			l.valueToElement.Delete(toBeRemove.Value.(*lruElement).value)
+		}
+	}
+	l.mu.Unlock()
+}

common/cache/lru_test.go

@@ -0,0 +1,86 @@
+package cache_test
+
+import (
+	"testing"
+
+	. "github.com/xtls/xray-core/common/cache"
+)
+
+func TestLruReplaceValue(t *testing.T) {
+	lru := NewLru(2)
+	lru.Put(2, 6)
+	lru.Put(1, 5)
+	lru.Put(1, 2)
+	v, _ := lru.Get(1)
+	if v != 2 {
+		t.Error("should get 2", v)
+	}
+	v, _ = lru.Get(2)
+	if v != 6 {
+		t.Error("should get 6", v)
+	}
+}
+
+func TestLruRemoveOld(t *testing.T) {
+	lru := NewLru(2)
+	v, ok := lru.Get(2)
+	if ok {
+		t.Error("should get nil", v)
+	}
+	lru.Put(1, 1)
+	lru.Put(2, 2)
+	v, _ = lru.Get(1)
+	if v != 1 {
+		t.Error("should get 1", v)
+	}
+	lru.Put(3, 3)
+	v, ok = lru.Get(2)
+	if ok {
+		t.Error("should get nil", v)
+	}
+	lru.Put(4, 4)
+	v, ok = lru.Get(1)
+	if ok {
+		t.Error("should get nil", v)
+	}
+	v, _ = lru.Get(3)
+	if v != 3 {
+		t.Error("should get 3", v)
+	}
+	v, _ = lru.Get(4)
+	if v != 4 {
+		t.Error("should get 4", v)
+	}
+}
+
+func TestGetKeyFromValue(t *testing.T) {
+	lru := NewLru(2)
+	lru.Put(3, 3)
+	lru.Put(2, 2)
+	lru.GetKeyFromValue(3)
+	lru.Put(1, 1)
+	v, ok := lru.GetKeyFromValue(2)
+	if ok {
+		t.Error("should get nil", v)
+	}
+	v, _ = lru.GetKeyFromValue(3)
+	if v != 3 {
+		t.Error("should get 3", v)
+	}
+}
+
+func TestPeekKeyFromValue(t *testing.T) {
+	lru := NewLru(2)
+	lru.Put(3, 3)
+	lru.Put(2, 2)
+	lru.PeekKeyFromValue(3)
+	lru.Put(1, 1)
+	v, ok := lru.PeekKeyFromValue(3)
+	if ok {
+		t.Error("should get nil", v)
+	}
+	v, _ = lru.PeekKeyFromValue(2)
+	if v != 2 {
+		t.Error("should get 2", v)
+	}
+}

common/common.go

@@ -5,7 +5,6 @@ package common
 import (
 	"fmt"
 	"go/build"
-	"io/ioutil"
 	"os"
 	"path/filepath"
 	"strings"
@@ -15,10 +14,8 @@ import (
 
 //go:generate go run github.com/xtls/xray-core/common/errors/errorgen
 
-var (
-	// ErrNoClue is for the situation that existing information is not enough to make a decision. For example, Router may return this error when there is no suitable route.
-	ErrNoClue = errors.New("not enough information for making a decision")
-)
+// ErrNoClue is for the situation that existing information is not enough to make a decision. For example, Router may return this error when there is no suitable route.
+var ErrNoClue = errors.New("not enough information for making a decision")
 
 // Must panics if err is not nil.
 func Must(err error) {
@@ -69,7 +66,7 @@ func GetRuntimeEnv(key string) (string, error) {
 	}
 	var data []byte
 	var runtimeEnv string
-	data, readErr := ioutil.ReadFile(file)
+	data, readErr := os.ReadFile(file)
 	if readErr != nil {
 		return "", readErr
 	}
@@ -131,7 +128,7 @@ func GetModuleName(pathToProjectRoot string) (string, error) {
 	for {
 		if idx := strings.LastIndex(loopPath, string(filepath.Separator)); idx >= 0 {
 			gomodPath := filepath.Join(loopPath, "go.mod")
-			gomodBytes, err := ioutil.ReadFile(gomodPath)
+			gomodBytes, err := os.ReadFile(gomodPath)
 			if err != nil {
 				loopPath = loopPath[:idx]
 				continue

common/crypto/auth.go

@@ -290,7 +290,6 @@ func (w *AuthenticationWriter) writeStream(mb buf.MultiBuffer) error {
 		mb = nb
 
 		eb, err := w.seal(rawBytes[:nBytes])
-
 		if err != nil {
 			buf.ReleaseMulti(mb2Write)
 			return err

common/crypto/chacha20_test.go

@@ -18,7 +18,7 @@ func mustDecodeHex(s string) []byte {
 }
 
 func TestChaCha20Stream(t *testing.T) {
-	var cases = []struct {
+	cases := []struct {
 		key    []byte
 		iv     []byte
 		output []byte

common/crypto/internal/chacha_core.generated.go

@@ -3,7 +3,7 @@ package internal
 import "encoding/binary"
 
 func ChaCha20Block(s *[16]uint32, out []byte, rounds int) {
-	var x0, x1, x2, x3, x4, x5, x6, x7, x8, x9, x10, x11, x12, x13, x14, x15 = s[0], s[1], s[2], s[3], s[4], s[5], s[6], s[7], s[8], s[9], s[10], s[11], s[12], s[13], s[14], s[15]
+	x0, x1, x2, x3, x4, x5, x6, x7, x8, x9, x10, x11, x12, x13, x14, x15 := s[0], s[1], s[2], s[3], s[4], s[5], s[6], s[7], s[8], s[9], s[10], s[11], s[12], s[13], s[14], s[15]
 	for i := 0; i < rounds; i += 2 {
 		var x uint32
 

common/crypto/internal/chacha_core_gen.go

@@ -1,3 +1,4 @@
+//go:build generate
 // +build generate
 
 package main
@@ -55,7 +56,7 @@ func ChaCha20Block(s *[16]uint32, out []byte, rounds int) {
 }
 
 func main() {
-	file, err := os.OpenFile("chacha_core.generated.go", os.O_WRONLY|os.O_TRUNC|os.O_CREATE, 0644)
+	file, err := os.OpenFile("chacha_core.generated.go", os.O_WRONLY|os.O_TRUNC|os.O_CREATE, 0o644)
 	if err != nil {
 		log.Fatalf("Failed to generate chacha_core.go: %v", err)
 	}

common/crypto/io.go

@@ -27,9 +27,7 @@ func (r *CryptionReader) Read(data []byte) (int, error) {
 	return nBytes, err
 }
 
-var (
-	_ buf.Writer = (*CryptionWriter)(nil)
-)
+var _ buf.Writer = (*CryptionWriter)(nil)
 
 type CryptionWriter struct {
 	stream    cipher.Stream
@@ -50,7 +48,7 @@ func NewCryptionWriter(stream cipher.Stream, writer io.Writer) *CryptionWriter {
 func (w *CryptionWriter) Write(data []byte) (int, error) {
 	w.stream.XORKeyStream(data, data)
 
-	if err := buf.WriteAllBytes(w.writer, data); err != nil {
+	if err := buf.WriteAllBytes(w.writer, data, nil); err != nil {
 		return 0, err
 	}
 	return len(data), nil

common/errors/errorgen/main.go

@@ -2,11 +2,8 @@ package main
 
 import (
 	"fmt"
-	"log"
 	"os"
 	"path/filepath"
-
-	"github.com/xtls/xray-core/common"
 )
 
 func main() {
@@ -20,26 +17,21 @@ func main() {
 		pkg = "core"
 	}
 
-	moduleName, gmnErr := common.GetModuleName(pwd)
-	if gmnErr != nil {
-		fmt.Println("can not get module path", gmnErr)
-		os.Exit(1)
-	}
-
-	file, err := os.OpenFile("errors.generated.go", os.O_WRONLY|os.O_TRUNC|os.O_CREATE, 0644)
+	file, err := os.OpenFile("errors.generated.go", os.O_WRONLY|os.O_TRUNC|os.O_CREATE, 0o644)
 	if err != nil {
-		log.Fatalf("Failed to generate errors.generated.go: %v", err)
+		fmt.Printf("Failed to generate errors.generated.go: %v", err)
 		os.Exit(1)
 	}
 	defer file.Close()
 
-	fmt.Fprintln(file, "package", pkg)
-	fmt.Fprintln(file, "")
-	fmt.Fprintln(file, "import \""+moduleName+"/common/errors\"")
-	fmt.Fprintln(file, "")
-	fmt.Fprintln(file, "type errPathObjHolder struct{}")
-	fmt.Fprintln(file, "")
-	fmt.Fprintln(file, "func newError(values ...interface{}) *errors.Error {")
-	fmt.Fprintln(file, "	return errors.New(values...).WithPathObj(errPathObjHolder{})")
-	fmt.Fprintln(file, "}")
+	fmt.Fprintf(file, `package %s
+
+import "github.com/xtls/xray-core/common/errors"
+
+type errPathObjHolder struct{}
+
+func newError(values ...interface{}) *errors.Error {
+	return errors.New(values...).WithPathObj(errPathObjHolder{})
+}
+`, pkg)
 }

common/errors/errors.go

@@ -40,11 +40,9 @@ func (err *Error) pkgPath() string {
 		return ""
 	}
 	path := reflect.TypeOf(err.pathObj).PkgPath()
-	for i := 0; i < len(path); i++ {
-		if path[i] == '/' {
+	if len(path) >= trim {
 		return path[trim:]
 	}
-	}
 	return path
 }
 

common/log/dns.go

@@ -0,0 +1,59 @@
+package log
+
+import (
+	"net"
+	"strings"
+	"time"
+)
+
+type DNSLog struct {
+	Server  string
+	Domain  string
+	Result  []net.IP
+	Status  dnsStatus
+	Elapsed time.Duration
+	Error   error
+}
+
+func (l *DNSLog) String() string {
+	builder := &strings.Builder{}
+
+	// Server got answer: domain -> [ip1, ip2] 23ms
+	builder.WriteString(l.Server)
+	builder.WriteString(" ")
+	builder.WriteString(string(l.Status))
+	builder.WriteString(" ")
+	builder.WriteString(l.Domain)
+	builder.WriteString(" -> [")
+	builder.WriteString(joinNetIP(l.Result))
+	builder.WriteString("]")
+
+	if l.Elapsed > 0 {
+		builder.WriteString(" ")
+		builder.WriteString(l.Elapsed.String())
+	}
+	if l.Error != nil {
+		builder.WriteString(" <")
+		builder.WriteString(l.Error.Error())
+		builder.WriteString(">")
+	}
+	return builder.String()
+}
+
+type dnsStatus string
+
+var (
+	DNSQueried  = dnsStatus("got answer:")
+	DNSCacheHit = dnsStatus("cache HIT:")
+)
+
+func joinNetIP(ips []net.IP) string {
+	if len(ips) == 0 {
+		return ""
+	}
+	sips := make([]string, 0, len(ips))
+	for _, ip := range ips {
+		sips = append(sips, ip.String())
+	}
+	return strings.Join(sips, ", ")
+}

common/log/log.go

@@ -32,9 +32,7 @@ func Record(msg Message) {
 	logHandler.Handle(msg)
 }
 
-var (
-	logHandler syncHandler
-)
+var logHandler syncHandler
 
 // RegisterHandler register a new handler as current log handler. Previous registered handler will be discarded.
 func RegisterHandler(handler Handler) {

common/log/log.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
-// 	protoc        v3.14.0
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
 // source: common/log/log.proto
 
 package log
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type Severity int32
 
 const (

common/log/logger.go

@@ -130,13 +130,13 @@ func CreateStderrLogWriter() WriterCreator {
 
 // CreateFileLogWriter returns a LogWriterCreator that creates LogWriter for the given file.
 func CreateFileLogWriter(path string) (WriterCreator, error) {
-	file, err := os.OpenFile(path, os.O_APPEND|os.O_WRONLY|os.O_CREATE, 0600)
+	file, err := os.OpenFile(path, os.O_APPEND|os.O_WRONLY|os.O_CREATE, 0o600)
 	if err != nil {
 		return nil, err
 	}
 	file.Close()
 	return func() Writer {
-		file, err := os.OpenFile(path, os.O_APPEND|os.O_WRONLY|os.O_CREATE, 0600)
+		file, err := os.OpenFile(path, os.O_APPEND|os.O_WRONLY|os.O_CREATE, 0o600)
 		if err != nil {
 			return nil
 		}

common/log/logger_test.go

@@ -1,7 +1,6 @@
 package log_test
 
 import (
-	"io/ioutil"
 	"os"
 	"strings"
 	"testing"
@@ -13,7 +12,7 @@ import (
 )
 
 func TestFileLogger(t *testing.T) {
-	f, err := ioutil.TempFile("", "vtest")
+	f, err := os.CreateTemp("", "vtest")
 	common.Must(err)
 	path := f.Name()
 	common.Must(f.Close())

common/mux/client.go

@@ -142,7 +142,6 @@ func (f *DialingWorkerFactory) Create() (*ClientWorker, error) {
 		Reader: downlinkReader,
 		Writer: upLinkWriter,
 	}, f.Strategy)
-
 	if err != nil {
 		return nil, err
 	}
@@ -175,8 +174,10 @@ type ClientWorker struct {
 	strategy       ClientStrategy
 }
 
-var muxCoolAddress = net.DomainAddress("v1.mux.cool")
-var muxCoolPort = net.Port(9527)
+var (
+	muxCoolAddress = net.DomainAddress("v1.mux.cool")
+	muxCoolPort    = net.Port(9527)
+)
 
 // NewClientWorker creates a new mux.Client.
 func NewClientWorker(stream transport.Link, s ClientStrategy) (*ClientWorker, error) {
@@ -330,7 +331,7 @@ func (m *ClientWorker) handleStatusKeep(meta *FrameMetadata, reader *buf.Buffere
 		return buf.Copy(NewStreamReader(reader), buf.Discard)
 	}
 
-	rr := s.NewReader(reader)
+	rr := s.NewReader(reader, &meta.Target)
 	err := buf.Copy(rr, s.output)
 	if err != nil && buf.IsWriteError(err) {
 		newError("failed to write to downstream. closing session ", s.ID).Base(err).WriteToLog()

common/mux/client_test.go

@@ -6,6 +6,7 @@ import (
 	"time"
 
 	"github.com/golang/mock/gomock"
+
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/errors"
 	"github.com/xtls/xray-core/common/mux"