mirror of
https://github.com/XTLS/Xray-core.git
synced 2025-08-23 18:16:50 +08:00
Compare commits
185 Commits
Author | SHA1 | Date | |
---|---|---|---|
![]() |
a149c78a4c | ||
![]() |
b0886027f5 | ||
![]() |
7033f7cf5f | ||
![]() |
ffc2f7c4e2 | ||
![]() |
ab927d2cca | ||
![]() |
0c0d878456 | ||
![]() |
24b637cd5e | ||
![]() |
f2cb13a8ec | ||
![]() |
dbcbb519e3 | ||
![]() |
8a5bf06925 | ||
![]() |
b0b2aaa70c | ||
![]() |
d111a046c0 | ||
![]() |
eaf30aa14a | ||
![]() |
42d158bd85 | ||
![]() |
00bcd40c34 | ||
![]() |
1adfc2720a | ||
![]() |
0f79126379 | ||
![]() |
7246001029 | ||
![]() |
5e6eff5ffa | ||
![]() |
1dca3cb3dd | ||
![]() |
28d17ac17f | ||
![]() |
e6019a89c9 | ||
![]() |
3213e5dd81 | ||
![]() |
c950edede2 | ||
![]() |
64892fb2c3 | ||
![]() |
0403e6ddc3 | ||
![]() |
d9d239750b | ||
![]() |
73e10f0f6f | ||
![]() |
7a9e72b133 | ||
![]() |
66b58e6076 | ||
![]() |
17cdeac57f | ||
![]() |
e4bf620795 | ||
![]() |
31c7141fef | ||
![]() |
57b9006d26 | ||
![]() |
d9d04a230f | ||
![]() |
3dc9fba20d | ||
![]() |
d45298a10d | ||
![]() |
6e8581f5dc | ||
![]() |
86a8fb5d84 | ||
![]() |
3531b95d82 | ||
![]() |
b977899926 | ||
![]() |
2220411644 | ||
![]() |
3b8618b379 | ||
![]() |
e8a8465220 | ||
![]() |
1f92b948c0 | ||
![]() |
53b99efe78 | ||
![]() |
1e3d739a5b | ||
![]() |
7b7084f825 | ||
![]() |
bf94fb53ca | ||
![]() |
1d13a8da49 | ||
![]() |
f65c21337c | ||
![]() |
4bf8b6d89c | ||
![]() |
95a68a6d73 | ||
![]() |
7f2fad73d4 | ||
![]() |
3ed14c2fcd | ||
![]() |
b63049f404 | ||
![]() |
a9e11075d1 | ||
![]() |
e564d9ef7e | ||
![]() |
6c936e2fd3 | ||
![]() |
b2d8168284 | ||
![]() |
e0910ab4d9 | ||
![]() |
d46af8b5d4 | ||
![]() |
0470381fe2 | ||
![]() |
b0e7ad9663 | ||
![]() |
4e63c22197 | ||
![]() |
36961ed882 | ||
![]() |
de54d4b08f | ||
![]() |
32713bcc0e | ||
![]() |
9dec65e367 | ||
![]() |
3fe85449a9 | ||
![]() |
e0526c27b3 | ||
![]() |
a0a32ee00d | ||
![]() |
60b06877bf | ||
![]() |
9adce5a6c4 | ||
![]() |
100edc370b | ||
![]() |
819717d278 | ||
![]() |
fcc9d97074 | ||
![]() |
439c91d509 | ||
![]() |
924fe16077 | ||
![]() |
3de5af0611 | ||
![]() |
d7cd71b741 | ||
![]() |
f50eff5ebb | ||
![]() |
db32ce6fd9 | ||
![]() |
ad1807dd99 | ||
![]() |
e1a5392beb | ||
![]() |
24f564b401 | ||
![]() |
54af48a1ae | ||
![]() |
055fb51ed9 | ||
![]() |
6380abca73 | ||
![]() |
1dae2c5636 | ||
![]() |
e9ea658852 | ||
![]() |
d67cf3d598 | ||
![]() |
ca633fc8c5 | ||
![]() |
c345d4818e | ||
![]() |
7fb1f65354 | ||
![]() |
4b97edae74 | ||
![]() |
8aabbeefe1 | ||
![]() |
48fab4d398 | ||
![]() |
8b9c0ae593 | ||
![]() |
347d9735da | ||
![]() |
9aa49be703 | ||
![]() |
fed8610d3f | ||
![]() |
d22c2d034c | ||
![]() |
4c10a9eb4e | ||
![]() |
4ff1ff1d7d | ||
![]() |
573b7807c0 | ||
![]() |
81d993158f | ||
![]() |
df39991bb3 | ||
![]() |
1b87264c53 | ||
![]() |
96d7156eba | ||
![]() |
d170416219 | ||
![]() |
8ca8a7126b | ||
![]() |
1174ff3090 | ||
![]() |
523c416bb5 | ||
![]() |
c13b8ec9bb | ||
![]() |
4cd343f2d5 | ||
![]() |
d032a8deb7 | ||
![]() |
303fd6e261 | ||
![]() |
c880b916ee | ||
![]() |
ceff4185dc | ||
![]() |
59c7c4897c | ||
![]() |
8ffc430351 | ||
![]() |
7da97635b2 | ||
![]() |
ba41513967 | ||
![]() |
5bc1bf30ae | ||
![]() |
5aa053a65f | ||
![]() |
0b4858d016 | ||
![]() |
7f5e34c857 | ||
![]() |
b60cf02603 | ||
![]() |
ae98dc75cf | ||
![]() |
8ff43519fd | ||
![]() |
33755d6e90 | ||
![]() |
99863aa2ac | ||
![]() |
8eed8a0824 | ||
![]() |
88f6537540 | ||
![]() |
f0efc0cfde | ||
![]() |
f13ac3cb55 | ||
![]() |
638e8384b6 | ||
![]() |
d85162ea44 | ||
![]() |
11a851f957 | ||
![]() |
822afb0cc8 | ||
![]() |
157918859f | ||
![]() |
40271c09a0 | ||
![]() |
96adf3fbca | ||
![]() |
e254424c43 | ||
![]() |
ee15cc253f | ||
![]() |
43eb5d1b25 | ||
![]() |
700966508f | ||
![]() |
7427a55ef1 | ||
![]() |
fb0e517158 | ||
![]() |
d5aeb6c545 | ||
![]() |
161e18299c | ||
![]() |
be9421fedf | ||
![]() |
8fc2d3b61f | ||
![]() |
9d4038427d | ||
![]() |
38ec9208d8 | ||
![]() |
7df135a5c4 | ||
![]() |
c41a1a56fe | ||
![]() |
310a938511 | ||
![]() |
2da07e0f8a | ||
![]() |
13ad3fddf6 | ||
![]() |
6bcac6cb10 | ||
![]() |
0203190a98 | ||
![]() |
a78db47571 | ||
![]() |
ffd8fd1d8a | ||
![]() |
3d7e86efba | ||
![]() |
6f25191822 | ||
![]() |
85619b5a29 | ||
![]() |
f073456ac0 | ||
![]() |
09f9d03fb6 | ||
![]() |
8f8f7dd66f | ||
![]() |
4140ed7ab0 | ||
![]() |
f390047b37 | ||
![]() |
ff9bb2d8df | ||
![]() |
38faac5ffc | ||
![]() |
88dfed931b | ||
![]() |
19ce0e99a5 | ||
![]() |
fe445f8e1a | ||
![]() |
6a5618bc54 | ||
![]() |
ed0e9b12dc | ||
![]() |
dab978749c | ||
![]() |
45f44c401a | ||
![]() |
2e942e0303 | ||
![]() |
decb012f9d | ||
![]() |
574446f942 |
33
.github/build/friendly-filenames.json
vendored
Normal file
33
.github/build/friendly-filenames.json
vendored
Normal file
@@ -0,0 +1,33 @@
|
|||||||
|
{
|
||||||
|
"android-arm64": { "friendlyName": "android-arm64-v8a" },
|
||||||
|
"darwin-amd64": { "friendlyName": "macos-64" },
|
||||||
|
"darwin-arm64": { "friendlyName": "macos-arm64-v8a" },
|
||||||
|
"dragonfly-amd64": { "friendlyName": "dragonfly-64" },
|
||||||
|
"freebsd-386": { "friendlyName": "freebsd-32" },
|
||||||
|
"freebsd-amd64": { "friendlyName": "freebsd-64" },
|
||||||
|
"freebsd-arm64": { "friendlyName": "freebsd-arm64-v8a" },
|
||||||
|
"freebsd-arm7": { "friendlyName": "freebsd-arm32-v7a" },
|
||||||
|
"linux-386": { "friendlyName": "linux-32" },
|
||||||
|
"linux-amd64": { "friendlyName": "linux-64" },
|
||||||
|
"linux-arm5": { "friendlyName": "linux-arm32-v5" },
|
||||||
|
"linux-arm64": { "friendlyName": "linux-arm64-v8a" },
|
||||||
|
"linux-arm6": { "friendlyName": "linux-arm32-v6" },
|
||||||
|
"linux-arm7": { "friendlyName": "linux-arm32-v7a" },
|
||||||
|
"linux-mips64le": { "friendlyName": "linux-mips64le" },
|
||||||
|
"linux-mips64": { "friendlyName": "linux-mips64" },
|
||||||
|
"linux-mipslesoftfloat": { "friendlyName": "linux-mips32le-softfloat" },
|
||||||
|
"linux-mipsle": { "friendlyName": "linux-mips32le" },
|
||||||
|
"linux-mipssoftfloat": { "friendlyName": "linux-mips32-softfloat" },
|
||||||
|
"linux-mips": { "friendlyName": "linux-mips32" },
|
||||||
|
"linux-ppc64le": { "friendlyName": "linux-ppc64le" },
|
||||||
|
"linux-ppc64": { "friendlyName": "linux-ppc64" },
|
||||||
|
"linux-riscv64": { "friendlyName": "linux-riscv64" },
|
||||||
|
"linux-s390x": { "friendlyName": "linux-s390x" },
|
||||||
|
"openbsd-386": { "friendlyName": "openbsd-32" },
|
||||||
|
"openbsd-amd64": { "friendlyName": "openbsd-64" },
|
||||||
|
"openbsd-arm64": { "friendlyName": "openbsd-arm64-v8a" },
|
||||||
|
"openbsd-arm7": { "friendlyName": "openbsd-arm32-v7a" },
|
||||||
|
"windows-386": { "friendlyName": "windows-32" },
|
||||||
|
"windows-amd64": { "friendlyName": "windows-64" },
|
||||||
|
"windows-arm7": { "friendlyName": "windows-arm32-v7a" }
|
||||||
|
}
|
204
.github/workflows/release.yml
vendored
Normal file
204
.github/workflows/release.yml
vendored
Normal file
@@ -0,0 +1,204 @@
|
|||||||
|
name: Build and Release
|
||||||
|
|
||||||
|
on:
|
||||||
|
workflow_dispatch:
|
||||||
|
release:
|
||||||
|
types: [published]
|
||||||
|
push:
|
||||||
|
branches:
|
||||||
|
- main
|
||||||
|
paths:
|
||||||
|
- "**/*.go"
|
||||||
|
- "go.mod"
|
||||||
|
- "go.sum"
|
||||||
|
- ".github/workflows/*.yml"
|
||||||
|
pull_request:
|
||||||
|
types: [opened, synchronize, reopened]
|
||||||
|
paths:
|
||||||
|
- "**/*.go"
|
||||||
|
- "go.mod"
|
||||||
|
- "go.sum"
|
||||||
|
- ".github/workflows/*.yml"
|
||||||
|
jobs:
|
||||||
|
build:
|
||||||
|
strategy:
|
||||||
|
matrix:
|
||||||
|
# Include amd64 on all platforms.
|
||||||
|
goos: [windows, freebsd, openbsd, linux, dragonfly, darwin]
|
||||||
|
goarch: [amd64, 386]
|
||||||
|
exclude:
|
||||||
|
# Exclude i386 on darwin and dragonfly.
|
||||||
|
- goarch: 386
|
||||||
|
goos: dragonfly
|
||||||
|
- goarch: 386
|
||||||
|
goos: darwin
|
||||||
|
include:
|
||||||
|
# BEIGIN MacOS ARM64
|
||||||
|
- goos: darwin
|
||||||
|
goarch: arm64
|
||||||
|
# END MacOS ARM64
|
||||||
|
# BEGIN Linux ARM 5 6 7
|
||||||
|
- goos: linux
|
||||||
|
goarch: arm
|
||||||
|
goarm: 7
|
||||||
|
- goos: linux
|
||||||
|
goarch: arm
|
||||||
|
goarm: 6
|
||||||
|
- goos: linux
|
||||||
|
goarch: arm
|
||||||
|
goarm: 5
|
||||||
|
# END Linux ARM 5 6 7
|
||||||
|
# BEGIN Android ARM 8
|
||||||
|
- goos: android
|
||||||
|
goarch: arm64
|
||||||
|
# END Android ARM 8
|
||||||
|
# Windows ARM 7
|
||||||
|
- goos: windows
|
||||||
|
goarch: arm
|
||||||
|
goarm: 7
|
||||||
|
# BEGIN Other architectures
|
||||||
|
# BEGIN riscv64 & ARM64
|
||||||
|
- goos: linux
|
||||||
|
goarch: arm64
|
||||||
|
- goos: linux
|
||||||
|
goarch: riscv64
|
||||||
|
# END riscv64 & ARM64
|
||||||
|
# BEGIN MIPS
|
||||||
|
- goos: linux
|
||||||
|
goarch: mips64
|
||||||
|
- goos: linux
|
||||||
|
goarch: mips64le
|
||||||
|
- goos: linux
|
||||||
|
goarch: mipsle
|
||||||
|
- goos: linux
|
||||||
|
goarch: mips
|
||||||
|
# END MIPS
|
||||||
|
# BEGIN PPC
|
||||||
|
- goos: linux
|
||||||
|
goarch: ppc64
|
||||||
|
- goos: linux
|
||||||
|
goarch: ppc64le
|
||||||
|
# END PPC
|
||||||
|
# BEGIN FreeBSD ARM
|
||||||
|
- goos: freebsd
|
||||||
|
goarch: arm64
|
||||||
|
- goos: freebsd
|
||||||
|
goarch: arm
|
||||||
|
goarm: 7
|
||||||
|
# END FreeBSD ARM
|
||||||
|
# BEGIN S390X
|
||||||
|
- goos: linux
|
||||||
|
goarch: s390x
|
||||||
|
# END S390X
|
||||||
|
# END Other architectures
|
||||||
|
# BEGIN OPENBSD ARM
|
||||||
|
- goos: openbsd
|
||||||
|
goarch: arm64
|
||||||
|
- goos: openbsd
|
||||||
|
goarch: arm
|
||||||
|
goarm: 7
|
||||||
|
# END OPENBSD ARM
|
||||||
|
fail-fast: false
|
||||||
|
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
env:
|
||||||
|
GOOS: ${{ matrix.goos }}
|
||||||
|
GOARCH: ${{ matrix.goarch }}
|
||||||
|
GOARM: ${{ matrix.goarm }}
|
||||||
|
CGO_ENABLED: 0
|
||||||
|
steps:
|
||||||
|
- name: Checkout codebase
|
||||||
|
uses: actions/checkout@v2
|
||||||
|
|
||||||
|
- name: Show workflow information
|
||||||
|
id: get_filename
|
||||||
|
run: |
|
||||||
|
export _NAME=$(jq ".[\"$GOOS-$GOARCH$GOARM$GOMIPS\"].friendlyName" -r < .github/build/friendly-filenames.json)
|
||||||
|
echo "GOOS: $GOOS, GOARCH: $GOARCH, GOARM: $GOARM, GOMIPS: $GOMIPS, RELEASE_NAME: $_NAME"
|
||||||
|
echo "::set-output name=ASSET_NAME::$_NAME"
|
||||||
|
echo "ASSET_NAME=$_NAME" >> $GITHUB_ENV
|
||||||
|
|
||||||
|
- name: Set up Go
|
||||||
|
uses: actions/setup-go@v2
|
||||||
|
with:
|
||||||
|
go-version: ^1.17.1
|
||||||
|
|
||||||
|
- name: Get project dependencies
|
||||||
|
run: go mod download
|
||||||
|
|
||||||
|
- name: Replace Custom to Commit ID
|
||||||
|
if: github.event_name != 'release'
|
||||||
|
run: |
|
||||||
|
ID=$(git rev-parse --short ${{ github.sha }})
|
||||||
|
if [ "${{ github.event_name }}" == 'pull_request' ]
|
||||||
|
then
|
||||||
|
ID=$(git rev-parse --short ${{ github.event.pull_request.head.sha }})
|
||||||
|
fi
|
||||||
|
sed -i '/build/ s/Custom/'$ID'/' ./core/core.go
|
||||||
|
|
||||||
|
- name: Build Xray
|
||||||
|
run: |
|
||||||
|
mkdir -p build_assets
|
||||||
|
go build -v -o build_assets/xray -trimpath -ldflags "-s -w -buildid=" ./main
|
||||||
|
|
||||||
|
- name: Build Mips softfloat Xray
|
||||||
|
if: matrix.goarch == 'mips' || matrix.goarch == 'mipsle'
|
||||||
|
run: |
|
||||||
|
GOMIPS=softfloat go build -v -o build_assets/xray_softfloat -trimpath -ldflags "-s -w -buildid=" ./main
|
||||||
|
|
||||||
|
- name: Rename Windows Xray
|
||||||
|
if: matrix.goos == 'windows'
|
||||||
|
run: |
|
||||||
|
cd ./build_assets || exit 1
|
||||||
|
mv xray xray.exe
|
||||||
|
|
||||||
|
- name: Prepare to release
|
||||||
|
run: |
|
||||||
|
cp ${GITHUB_WORKSPACE}/README.md ./build_assets/README.md
|
||||||
|
cp ${GITHUB_WORKSPACE}/LICENSE ./build_assets/LICENSE
|
||||||
|
LIST=('geoip geoip geoip' 'domain-list-community dlc geosite')
|
||||||
|
for i in "${LIST[@]}"
|
||||||
|
do
|
||||||
|
INFO=($(echo $i | awk 'BEGIN{FS=" ";OFS=" "} {print $1,$2,$3}'))
|
||||||
|
LASTEST_TAG="$(curl -sL "https://api.github.com/repos/v2fly/${INFO[0]}/releases" | jq -r ".[0].tag_name" || echo "latest")"
|
||||||
|
FILE_NAME="${INFO[2]}.dat"
|
||||||
|
echo -e "Downloading ${FILE_NAME}..."
|
||||||
|
curl -L "https://github.com/v2fly/${INFO[0]}/releases/download/${LASTEST_TAG}/${INFO[1]}.dat" -o ./build_assets/${FILE_NAME}
|
||||||
|
echo -e "Verifying HASH key..."
|
||||||
|
HASH="$(curl -sL "https://github.com/v2fly/${INFO[0]}/releases/download/${LASTEST_TAG}/${INFO[1]}.dat.sha256sum" | awk -F ' ' '{print $1}')"
|
||||||
|
[ "$(sha256sum "./build_assets/${FILE_NAME}" | awk -F ' ' '{print $1}')" == "${HASH}" ] || { echo -e "The HASH key of ${FILE_NAME} does not match cloud one."; exit 1; }
|
||||||
|
done
|
||||||
|
|
||||||
|
- name: Create ZIP archive
|
||||||
|
shell: bash
|
||||||
|
run: |
|
||||||
|
pushd build_assets || exit 1
|
||||||
|
touch -mt $(date +%Y01010000) *
|
||||||
|
zip -9vr ../Xray-$ASSET_NAME.zip .
|
||||||
|
popd || exit 1
|
||||||
|
FILE=./Xray-$ASSET_NAME.zip
|
||||||
|
DGST=$FILE.dgst
|
||||||
|
for METHOD in {"md5","sha1","sha256","sha512"}
|
||||||
|
do
|
||||||
|
openssl dgst -$METHOD $FILE | sed 's/([^)]*)//g' >>$DGST
|
||||||
|
done
|
||||||
|
|
||||||
|
- name: Change the name
|
||||||
|
run: |
|
||||||
|
mv build_assets Xray-$ASSET_NAME
|
||||||
|
|
||||||
|
- name: Upload files to Artifacts
|
||||||
|
uses: actions/upload-artifact@v2
|
||||||
|
with:
|
||||||
|
name: Xray-${{ steps.get_filename.outputs.ASSET_NAME }}
|
||||||
|
path: |
|
||||||
|
./Xray-${{ steps.get_filename.outputs.ASSET_NAME }}/*
|
||||||
|
|
||||||
|
- name: Upload binaries to release
|
||||||
|
uses: svenstaro/upload-release-action@v2
|
||||||
|
if: github.event_name == 'release'
|
||||||
|
with:
|
||||||
|
repo_token: ${{ secrets.GITHUB_TOKEN }}
|
||||||
|
file: ./Xray-${{ steps.get_filename.outputs.ASSET_NAME }}.zip*
|
||||||
|
tag: ${{ github.ref }}
|
||||||
|
file_glob: true
|
48
.github/workflows/test.yml
vendored
Normal file
48
.github/workflows/test.yml
vendored
Normal file
@@ -0,0 +1,48 @@
|
|||||||
|
name: Test
|
||||||
|
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
branches:
|
||||||
|
- main
|
||||||
|
paths:
|
||||||
|
- "**/*.go"
|
||||||
|
- "go.mod"
|
||||||
|
- "go.sum"
|
||||||
|
- ".github/workflows/*.yml"
|
||||||
|
pull_request:
|
||||||
|
types: [opened, synchronize, reopened]
|
||||||
|
paths:
|
||||||
|
- "**/*.go"
|
||||||
|
- "go.mod"
|
||||||
|
- "go.sum"
|
||||||
|
- ".github/workflows/*.yml"
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
test:
|
||||||
|
runs-on: ${{ matrix.os }}
|
||||||
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
|
matrix:
|
||||||
|
os: [windows-latest, ubuntu-latest, macos-latest]
|
||||||
|
steps:
|
||||||
|
- name: Set up Go
|
||||||
|
uses: actions/setup-go@v2
|
||||||
|
with:
|
||||||
|
go-version: ^1.17.1
|
||||||
|
- name: Checkout codebase
|
||||||
|
uses: actions/checkout@v2
|
||||||
|
|
||||||
|
- name: Prepare geo*dat
|
||||||
|
if: ${{ matrix.os != 'windows-latest' }}
|
||||||
|
run: |
|
||||||
|
mkdir resources
|
||||||
|
wget -O ./resources/geoip.dat https://github.com/v2fly/geoip/releases/latest/download/geoip.dat
|
||||||
|
wget -O ./resources/geosite.dat https://github.com/v2fly/domain-list-community/releases/latest/download/dlc.dat
|
||||||
|
- name: Prepare geo*dat for Windows
|
||||||
|
if: ${{ matrix.os == 'windows-latest' }}
|
||||||
|
run: |
|
||||||
|
mkdir resources
|
||||||
|
Invoke-WebRequest -Uri "https://github.com/v2fly/geoip/releases/latest/download/geoip.dat" -OutFile "./resources/geoip.dat"
|
||||||
|
Invoke-WebRequest -Uri "https://github.com/v2fly/domain-list-community/releases/latest/download/dlc.dat" -OutFile "./resources/geosite.dat"
|
||||||
|
- name: Test
|
||||||
|
run: go test -timeout 1h -v ./...
|
17
README.md
17
README.md
@@ -17,9 +17,15 @@
|
|||||||
- One Click
|
- One Click
|
||||||
- [ProxySU](https://github.com/proxysu/ProxySU)
|
- [ProxySU](https://github.com/proxysu/ProxySU)
|
||||||
- [v2ray-agent](https://github.com/mack-a/v2ray-agent)
|
- [v2ray-agent](https://github.com/mack-a/v2ray-agent)
|
||||||
|
- [Xray-yes](https://github.com/jiuqi9997/Xray-yes)
|
||||||
|
- [Xray_onekey](https://github.com/wulabing/Xray_onekey)
|
||||||
- Magisk
|
- Magisk
|
||||||
- [Xray4Magisk](https://github.com/CerteKim/Xray4Magisk)
|
- [Xray4Magisk](https://github.com/CerteKim/Xray4Magisk)
|
||||||
- [Xray_For_Magisk](https://github.com/E7KMbb/Xray_For_Magisk)
|
- [Xray_For_Magisk](https://github.com/E7KMbb/Xray_For_Magisk)
|
||||||
|
- Homebrew
|
||||||
|
- `brew install xray`
|
||||||
|
- [(Tap) Repository 0](https://github.com/N4FA/homebrew-xray)
|
||||||
|
- [(Tap) Repository 1](https://github.com/xiruizhao/homebrew-xray)
|
||||||
|
|
||||||
## Usage
|
## Usage
|
||||||
|
|
||||||
@@ -29,12 +35,21 @@
|
|||||||
|
|
||||||
- OpenWrt
|
- OpenWrt
|
||||||
- [PassWall](https://github.com/xiaorouji/openwrt-passwall)
|
- [PassWall](https://github.com/xiaorouji/openwrt-passwall)
|
||||||
|
- [Hello World](https://github.com/jerrykuku/luci-app-vssr)
|
||||||
|
- [ShadowSocksR Plus+](https://github.com/fw876/helloworld)
|
||||||
|
- [luci-app-xray](https://github.com/yichya/luci-app-xray) ([openwrt-xray](https://github.com/yichya/openwrt-xray))
|
||||||
- Windows
|
- Windows
|
||||||
- [v2rayN](https://github.com/2dust/v2rayN)
|
- [v2rayN](https://github.com/2dust/v2rayN)
|
||||||
|
- [Qv2ray](https://github.com/Qv2ray/Qv2ray) (This project had been archived and currently inactive)
|
||||||
|
- [Netch (NetFilter & TUN/TAP)](https://github.com/NetchX/Netch)
|
||||||
- Android
|
- Android
|
||||||
- [v2rayNG](https://github.com/2dust/v2rayNG)
|
- [v2rayNG](https://github.com/2dust/v2rayNG)
|
||||||
- iOS / Mac
|
- [AnXray](https://github.com/XTLS/AnXray)
|
||||||
|
- [Kitsunebi](https://github.com/rurirei/Kitsunebi/tree/release_xtls)
|
||||||
|
- iOS & macOS (with M1 chip)
|
||||||
- [Shadowrocket](https://apps.apple.com/app/shadowrocket/id932747118)
|
- [Shadowrocket](https://apps.apple.com/app/shadowrocket/id932747118)
|
||||||
|
- macOS (Intel chip & M1 chip)
|
||||||
|
- [Qv2ray](https://github.com/Qv2ray/Qv2ray) (This project had been archived and currently inactive)
|
||||||
|
|
||||||
## Credits
|
## Credits
|
||||||
|
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/commander/config.proto
|
// source: app/commander/config.proto
|
||||||
|
|
||||||
package commander
|
package commander
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
serial "github.com/xtls/xray-core/common/serial"
|
serial "github.com/xtls/xray-core/common/serial"
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
@@ -22,10 +21,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
// Config is the settings for Commander.
|
// Config is the settings for Commander.
|
||||||
type Config struct {
|
type Config struct {
|
||||||
state protoimpl.MessageState
|
state protoimpl.MessageState
|
||||||
|
@@ -6,6 +6,7 @@ import (
|
|||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
|
"github.com/xtls/xray-core/common/net/cnc"
|
||||||
"github.com/xtls/xray-core/common/signal/done"
|
"github.com/xtls/xray-core/common/signal/done"
|
||||||
"github.com/xtls/xray-core/transport"
|
"github.com/xtls/xray-core/transport"
|
||||||
)
|
)
|
||||||
@@ -79,7 +80,7 @@ func (co *Outbound) Dispatch(ctx context.Context, link *transport.Link) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
closeSignal := done.New()
|
closeSignal := done.New()
|
||||||
c := net.NewConnection(net.ConnectionInputMulti(link.Writer), net.ConnectionOutputMulti(link.Reader), net.ConnectionOnClose(closeSignal))
|
c := cnc.NewConnection(cnc.ConnectionInputMulti(link.Writer), cnc.ConnectionOutputMulti(link.Reader), cnc.ConnectionOnClose(closeSignal))
|
||||||
co.listener.add(c)
|
co.listener.add(c)
|
||||||
co.access.RUnlock()
|
co.access.RUnlock()
|
||||||
<-closeSignal.Wait()
|
<-closeSignal.Wait()
|
||||||
|
@@ -3,9 +3,10 @@ package commander
|
|||||||
import (
|
import (
|
||||||
"context"
|
"context"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
|
||||||
"google.golang.org/grpc"
|
"google.golang.org/grpc"
|
||||||
"google.golang.org/grpc/reflection"
|
"google.golang.org/grpc/reflection"
|
||||||
|
|
||||||
|
"github.com/xtls/xray-core/common"
|
||||||
)
|
)
|
||||||
|
|
||||||
// Service is a Commander service.
|
// Service is a Commander service.
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/dispatcher/config.proto
|
// source: app/dispatcher/config.proto
|
||||||
|
|
||||||
package dispatcher
|
package dispatcher
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
reflect "reflect"
|
reflect "reflect"
|
||||||
@@ -21,10 +20,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
type SessionConfig struct {
|
type SessionConfig struct {
|
||||||
state protoimpl.MessageState
|
state protoimpl.MessageState
|
||||||
sizeCache protoimpl.SizeCache
|
sizeCache protoimpl.SizeCache
|
||||||
|
@@ -15,6 +15,7 @@ import (
|
|||||||
"github.com/xtls/xray-core/common/protocol"
|
"github.com/xtls/xray-core/common/protocol"
|
||||||
"github.com/xtls/xray-core/common/session"
|
"github.com/xtls/xray-core/common/session"
|
||||||
"github.com/xtls/xray-core/core"
|
"github.com/xtls/xray-core/core"
|
||||||
|
"github.com/xtls/xray-core/features/dns"
|
||||||
"github.com/xtls/xray-core/features/outbound"
|
"github.com/xtls/xray-core/features/outbound"
|
||||||
"github.com/xtls/xray-core/features/policy"
|
"github.com/xtls/xray-core/features/policy"
|
||||||
"github.com/xtls/xray-core/features/routing"
|
"github.com/xtls/xray-core/features/routing"
|
||||||
@@ -175,12 +176,32 @@ func (d *DefaultDispatcher) getLink(ctx context.Context) (*transport.Link, *tran
|
|||||||
return inboundLink, outboundLink
|
return inboundLink, outboundLink
|
||||||
}
|
}
|
||||||
|
|
||||||
func shouldOverride(result SniffResult, domainOverride []string) bool {
|
func shouldOverride(ctx context.Context, result SniffResult, request session.SniffingRequest, destination net.Destination) bool {
|
||||||
for _, p := range domainOverride {
|
domain := result.Domain()
|
||||||
if strings.HasPrefix(result.Protocol(), p) {
|
for _, d := range request.ExcludeForDomain {
|
||||||
|
if strings.ToLower(domain) == d {
|
||||||
|
return false
|
||||||
|
}
|
||||||
|
}
|
||||||
|
var fakeDNSEngine dns.FakeDNSEngine
|
||||||
|
core.RequireFeatures(ctx, func(fdns dns.FakeDNSEngine) {
|
||||||
|
fakeDNSEngine = fdns
|
||||||
|
})
|
||||||
|
protocolString := result.Protocol()
|
||||||
|
if resComp, ok := result.(SnifferResultComposite); ok {
|
||||||
|
protocolString = resComp.ProtocolForDomainResult()
|
||||||
|
}
|
||||||
|
for _, p := range request.OverrideDestinationForProtocol {
|
||||||
|
if strings.HasPrefix(protocolString, p) {
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
if fakeDNSEngine != nil && protocolString != "bittorrent" && p == "fakedns" &&
|
||||||
|
destination.Address.Family().IsIP() && fakeDNSEngine.GetFakeIPRange().Contains(destination.Address.IP()) {
|
||||||
|
newError("Using sniffer ", protocolString, " since the fake DNS missed").WriteToLog(session.ExportIDToError(ctx))
|
||||||
return true
|
return true
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
return false
|
return false
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -201,19 +222,33 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
|
|||||||
ctx = session.ContextWithContent(ctx, content)
|
ctx = session.ContextWithContent(ctx, content)
|
||||||
}
|
}
|
||||||
sniffingRequest := content.SniffingRequest
|
sniffingRequest := content.SniffingRequest
|
||||||
if destination.Network != net.Network_TCP || !sniffingRequest.Enabled {
|
switch {
|
||||||
|
case !sniffingRequest.Enabled:
|
||||||
go d.routedDispatch(ctx, outbound, destination)
|
go d.routedDispatch(ctx, outbound, destination)
|
||||||
} else {
|
case destination.Network != net.Network_TCP:
|
||||||
|
// Only metadata sniff will be used for non tcp connection
|
||||||
|
result, err := sniffer(ctx, nil, true)
|
||||||
|
if err == nil {
|
||||||
|
content.Protocol = result.Protocol()
|
||||||
|
if shouldOverride(ctx, result, sniffingRequest, destination) {
|
||||||
|
domain := result.Domain()
|
||||||
|
newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
|
||||||
|
destination.Address = net.ParseAddress(domain)
|
||||||
|
ob.Target = destination
|
||||||
|
}
|
||||||
|
}
|
||||||
|
go d.routedDispatch(ctx, outbound, destination)
|
||||||
|
default:
|
||||||
go func() {
|
go func() {
|
||||||
cReader := &cachedReader{
|
cReader := &cachedReader{
|
||||||
reader: outbound.Reader.(*pipe.Reader),
|
reader: outbound.Reader.(*pipe.Reader),
|
||||||
}
|
}
|
||||||
outbound.Reader = cReader
|
outbound.Reader = cReader
|
||||||
result, err := sniffer(ctx, cReader)
|
result, err := sniffer(ctx, cReader, sniffingRequest.MetadataOnly)
|
||||||
if err == nil {
|
if err == nil {
|
||||||
content.Protocol = result.Protocol()
|
content.Protocol = result.Protocol()
|
||||||
}
|
}
|
||||||
if err == nil && shouldOverride(result, sniffingRequest.OverrideDestinationForProtocol) {
|
if err == nil && shouldOverride(ctx, result, sniffingRequest, destination) {
|
||||||
domain := result.Domain()
|
domain := result.Domain()
|
||||||
newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
|
newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
|
||||||
destination.Address = net.ParseAddress(domain)
|
destination.Address = net.ParseAddress(domain)
|
||||||
@@ -225,34 +260,50 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
|
|||||||
return inbound, nil
|
return inbound, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func sniffer(ctx context.Context, cReader *cachedReader) (SniffResult, error) {
|
func sniffer(ctx context.Context, cReader *cachedReader, metadataOnly bool) (SniffResult, error) {
|
||||||
payload := buf.New()
|
payload := buf.New()
|
||||||
defer payload.Release()
|
defer payload.Release()
|
||||||
|
|
||||||
sniffer := NewSniffer()
|
sniffer := NewSniffer(ctx)
|
||||||
totalAttempt := 0
|
|
||||||
for {
|
|
||||||
select {
|
|
||||||
case <-ctx.Done():
|
|
||||||
return nil, ctx.Err()
|
|
||||||
default:
|
|
||||||
totalAttempt++
|
|
||||||
if totalAttempt > 2 {
|
|
||||||
return nil, errSniffingTimeout
|
|
||||||
}
|
|
||||||
|
|
||||||
cReader.Cache(payload)
|
metaresult, metadataErr := sniffer.SniffMetadata(ctx)
|
||||||
if !payload.IsEmpty() {
|
|
||||||
result, err := sniffer.Sniff(payload.Bytes())
|
if metadataOnly {
|
||||||
if err != common.ErrNoClue {
|
return metaresult, metadataErr
|
||||||
return result, err
|
}
|
||||||
|
|
||||||
|
contentResult, contentErr := func() (SniffResult, error) {
|
||||||
|
totalAttempt := 0
|
||||||
|
for {
|
||||||
|
select {
|
||||||
|
case <-ctx.Done():
|
||||||
|
return nil, ctx.Err()
|
||||||
|
default:
|
||||||
|
totalAttempt++
|
||||||
|
if totalAttempt > 2 {
|
||||||
|
return nil, errSniffingTimeout
|
||||||
|
}
|
||||||
|
|
||||||
|
cReader.Cache(payload)
|
||||||
|
if !payload.IsEmpty() {
|
||||||
|
result, err := sniffer.Sniff(ctx, payload.Bytes())
|
||||||
|
if err != common.ErrNoClue {
|
||||||
|
return result, err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if payload.IsFull() {
|
||||||
|
return nil, errUnknownContent
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if payload.IsFull() {
|
|
||||||
return nil, errUnknownContent
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
}()
|
||||||
|
if contentErr != nil && metadataErr == nil {
|
||||||
|
return metaresult, nil
|
||||||
}
|
}
|
||||||
|
if contentErr == nil && metadataErr == nil {
|
||||||
|
return CompositeResult(metaresult, contentResult), nil
|
||||||
|
}
|
||||||
|
return contentResult, contentErr
|
||||||
}
|
}
|
||||||
|
|
||||||
func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.Link, destination net.Destination) {
|
func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.Link, destination net.Destination) {
|
||||||
@@ -263,14 +314,18 @@ func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.
|
|||||||
skipRoutePick = content.SkipRoutePick
|
skipRoutePick = content.SkipRoutePick
|
||||||
}
|
}
|
||||||
|
|
||||||
|
routingLink := routing_session.AsRoutingContext(ctx)
|
||||||
|
inTag := routingLink.GetInboundTag()
|
||||||
|
isPickRoute := false
|
||||||
if d.router != nil && !skipRoutePick {
|
if d.router != nil && !skipRoutePick {
|
||||||
if route, err := d.router.PickRoute(routing_session.AsRoutingContext(ctx)); err == nil {
|
if route, err := d.router.PickRoute(routingLink); err == nil {
|
||||||
tag := route.GetOutboundTag()
|
outTag := route.GetOutboundTag()
|
||||||
if h := d.ohm.GetHandler(tag); h != nil {
|
isPickRoute = true
|
||||||
newError("taking detour [", tag, "] for [", destination, "]").WriteToLog(session.ExportIDToError(ctx))
|
if h := d.ohm.GetHandler(outTag); h != nil {
|
||||||
|
newError("taking detour [", outTag, "] for [", destination, "]").WriteToLog(session.ExportIDToError(ctx))
|
||||||
handler = h
|
handler = h
|
||||||
} else {
|
} else {
|
||||||
newError("non existing tag: ", tag).AtWarning().WriteToLog(session.ExportIDToError(ctx))
|
newError("non existing outTag: ", outTag).AtWarning().WriteToLog(session.ExportIDToError(ctx))
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
newError("default route for ", destination).WriteToLog(session.ExportIDToError(ctx))
|
newError("default route for ", destination).WriteToLog(session.ExportIDToError(ctx))
|
||||||
@@ -290,7 +345,19 @@ func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.
|
|||||||
|
|
||||||
if accessMessage := log.AccessMessageFromContext(ctx); accessMessage != nil {
|
if accessMessage := log.AccessMessageFromContext(ctx); accessMessage != nil {
|
||||||
if tag := handler.Tag(); tag != "" {
|
if tag := handler.Tag(); tag != "" {
|
||||||
accessMessage.Detour = tag
|
if isPickRoute {
|
||||||
|
if inTag != "" {
|
||||||
|
accessMessage.Detour = inTag + " -> " + tag
|
||||||
|
} else {
|
||||||
|
accessMessage.Detour = tag
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
if inTag != "" {
|
||||||
|
accessMessage.Detour = inTag + " >> " + tag
|
||||||
|
} else {
|
||||||
|
accessMessage.Detour = tag
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
log.Record(accessMessage)
|
log.Record(accessMessage)
|
||||||
}
|
}
|
||||||
|
49
app/dispatcher/fakednssniffer.go
Normal file
49
app/dispatcher/fakednssniffer.go
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
package dispatcher
|
||||||
|
|
||||||
|
import (
|
||||||
|
"context"
|
||||||
|
|
||||||
|
"github.com/xtls/xray-core/common"
|
||||||
|
"github.com/xtls/xray-core/common/net"
|
||||||
|
"github.com/xtls/xray-core/common/session"
|
||||||
|
"github.com/xtls/xray-core/core"
|
||||||
|
"github.com/xtls/xray-core/features/dns"
|
||||||
|
)
|
||||||
|
|
||||||
|
// newFakeDNSSniffer Create a Fake DNS metadata sniffer
|
||||||
|
func newFakeDNSSniffer(ctx context.Context) (protocolSnifferWithMetadata, error) {
|
||||||
|
var fakeDNSEngine dns.FakeDNSEngine
|
||||||
|
err := core.RequireFeatures(ctx, func(fdns dns.FakeDNSEngine) {
|
||||||
|
fakeDNSEngine = fdns
|
||||||
|
})
|
||||||
|
if err != nil {
|
||||||
|
return protocolSnifferWithMetadata{}, err
|
||||||
|
}
|
||||||
|
if fakeDNSEngine == nil {
|
||||||
|
errNotInit := newError("FakeDNSEngine is not initialized, but such a sniffer is used").AtError()
|
||||||
|
return protocolSnifferWithMetadata{}, errNotInit
|
||||||
|
}
|
||||||
|
return protocolSnifferWithMetadata{protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
|
||||||
|
Target := session.OutboundFromContext(ctx).Target
|
||||||
|
if Target.Network == net.Network_TCP || Target.Network == net.Network_UDP {
|
||||||
|
domainFromFakeDNS := fakeDNSEngine.GetDomainFromFakeDNS(Target.Address)
|
||||||
|
if domainFromFakeDNS != "" {
|
||||||
|
newError("fake dns got domain: ", domainFromFakeDNS, " for ip: ", Target.Address.String()).WriteToLog(session.ExportIDToError(ctx))
|
||||||
|
return &fakeDNSSniffResult{domainName: domainFromFakeDNS}, nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil, common.ErrNoClue
|
||||||
|
}, metadataSniffer: true}, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
type fakeDNSSniffResult struct {
|
||||||
|
domainName string
|
||||||
|
}
|
||||||
|
|
||||||
|
func (fakeDNSSniffResult) Protocol() string {
|
||||||
|
return "fakedns"
|
||||||
|
}
|
||||||
|
|
||||||
|
func (f fakeDNSSniffResult) Domain() string {
|
||||||
|
return f.domainName
|
||||||
|
}
|
@@ -1,6 +1,8 @@
|
|||||||
package dispatcher
|
package dispatcher
|
||||||
|
|
||||||
import (
|
import (
|
||||||
|
"context"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/protocol/bittorrent"
|
"github.com/xtls/xray-core/common/protocol/bittorrent"
|
||||||
"github.com/xtls/xray-core/common/protocol/http"
|
"github.com/xtls/xray-core/common/protocol/http"
|
||||||
@@ -12,30 +14,46 @@ type SniffResult interface {
|
|||||||
Domain() string
|
Domain() string
|
||||||
}
|
}
|
||||||
|
|
||||||
type protocolSniffer func([]byte) (SniffResult, error)
|
type protocolSniffer func(context.Context, []byte) (SniffResult, error)
|
||||||
|
|
||||||
type Sniffer struct {
|
type protocolSnifferWithMetadata struct {
|
||||||
sniffer []protocolSniffer
|
protocolSniffer protocolSniffer
|
||||||
|
// A Metadata sniffer will be invoked on connection establishment only, with nil body,
|
||||||
|
// for both TCP and UDP connections
|
||||||
|
// It will not be shown as a traffic type for routing unless there is no other successful sniffing.
|
||||||
|
metadataSniffer bool
|
||||||
}
|
}
|
||||||
|
|
||||||
func NewSniffer() *Sniffer {
|
type Sniffer struct {
|
||||||
return &Sniffer{
|
sniffer []protocolSnifferWithMetadata
|
||||||
sniffer: []protocolSniffer{
|
}
|
||||||
func(b []byte) (SniffResult, error) { return http.SniffHTTP(b) },
|
|
||||||
func(b []byte) (SniffResult, error) { return tls.SniffTLS(b) },
|
func NewSniffer(ctx context.Context) *Sniffer {
|
||||||
func(b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) },
|
ret := &Sniffer{
|
||||||
|
sniffer: []protocolSnifferWithMetadata{
|
||||||
|
{func(c context.Context, b []byte) (SniffResult, error) { return http.SniffHTTP(b) }, false},
|
||||||
|
{func(c context.Context, b []byte) (SniffResult, error) { return tls.SniffTLS(b) }, false},
|
||||||
|
{func(c context.Context, b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) }, false},
|
||||||
},
|
},
|
||||||
}
|
}
|
||||||
|
if sniffer, err := newFakeDNSSniffer(ctx); err == nil {
|
||||||
|
ret.sniffer = append(ret.sniffer, sniffer)
|
||||||
|
}
|
||||||
|
return ret
|
||||||
}
|
}
|
||||||
|
|
||||||
var errUnknownContent = newError("unknown content")
|
var errUnknownContent = newError("unknown content")
|
||||||
|
|
||||||
func (s *Sniffer) Sniff(payload []byte) (SniffResult, error) {
|
func (s *Sniffer) Sniff(c context.Context, payload []byte) (SniffResult, error) {
|
||||||
var pendingSniffer []protocolSniffer
|
var pendingSniffer []protocolSnifferWithMetadata
|
||||||
for _, s := range s.sniffer {
|
for _, si := range s.sniffer {
|
||||||
result, err := s(payload)
|
s := si.protocolSniffer
|
||||||
|
if si.metadataSniffer {
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
result, err := s(c, payload)
|
||||||
if err == common.ErrNoClue {
|
if err == common.ErrNoClue {
|
||||||
pendingSniffer = append(pendingSniffer, s)
|
pendingSniffer = append(pendingSniffer, si)
|
||||||
continue
|
continue
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -51,3 +69,55 @@ func (s *Sniffer) Sniff(payload []byte) (SniffResult, error) {
|
|||||||
|
|
||||||
return nil, errUnknownContent
|
return nil, errUnknownContent
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func (s *Sniffer) SniffMetadata(c context.Context) (SniffResult, error) {
|
||||||
|
var pendingSniffer []protocolSnifferWithMetadata
|
||||||
|
for _, si := range s.sniffer {
|
||||||
|
s := si.protocolSniffer
|
||||||
|
if !si.metadataSniffer {
|
||||||
|
pendingSniffer = append(pendingSniffer, si)
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
result, err := s(c, nil)
|
||||||
|
if err == common.ErrNoClue {
|
||||||
|
pendingSniffer = append(pendingSniffer, si)
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
|
||||||
|
if err == nil && result != nil {
|
||||||
|
return result, nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if len(pendingSniffer) > 0 {
|
||||||
|
s.sniffer = pendingSniffer
|
||||||
|
return nil, common.ErrNoClue
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil, errUnknownContent
|
||||||
|
}
|
||||||
|
|
||||||
|
func CompositeResult(domainResult SniffResult, protocolResult SniffResult) SniffResult {
|
||||||
|
return &compositeResult{domainResult: domainResult, protocolResult: protocolResult}
|
||||||
|
}
|
||||||
|
|
||||||
|
type compositeResult struct {
|
||||||
|
domainResult SniffResult
|
||||||
|
protocolResult SniffResult
|
||||||
|
}
|
||||||
|
|
||||||
|
func (c compositeResult) Protocol() string {
|
||||||
|
return c.protocolResult.Protocol()
|
||||||
|
}
|
||||||
|
|
||||||
|
func (c compositeResult) Domain() string {
|
||||||
|
return c.domainResult.Domain()
|
||||||
|
}
|
||||||
|
|
||||||
|
func (c compositeResult) ProtocolForDomainResult() string {
|
||||||
|
return c.domainResult.Protocol()
|
||||||
|
}
|
||||||
|
|
||||||
|
type SnifferResultComposite interface {
|
||||||
|
ProtocolForDomainResult() string
|
||||||
|
}
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/dns/config.proto
|
// source: app/dns/config.proto
|
||||||
|
|
||||||
package dns
|
package dns
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
router "github.com/xtls/xray-core/app/router"
|
router "github.com/xtls/xray-core/app/router"
|
||||||
net "github.com/xtls/xray-core/common/net"
|
net "github.com/xtls/xray-core/common/net"
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
@@ -23,10 +22,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
type DomainMatchingType int32
|
type DomainMatchingType int32
|
||||||
|
|
||||||
const (
|
const (
|
||||||
@@ -473,7 +468,7 @@ var file_app_dns_config_proto_rawDesc = []byte{
|
|||||||
0x0c, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x12, 0x0a,
|
0x0c, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x12, 0x0a,
|
||||||
0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x72, 0x75, 0x6c,
|
0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x72, 0x75, 0x6c,
|
||||||
0x65, 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52,
|
0x65, 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52,
|
||||||
0x04, 0x73, 0x69, 0x7a, 0x65, 0x22, 0x9f, 0x04, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
0x04, 0x73, 0x69, 0x7a, 0x65, 0x22, 0xa5, 0x04, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
||||||
0x12, 0x3f, 0x0a, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x18,
|
0x12, 0x3f, 0x0a, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x18,
|
||||||
0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
|
0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
|
||||||
0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64, 0x70, 0x6f, 0x69, 0x6e, 0x74,
|
0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64, 0x70, 0x6f, 0x69, 0x6e, 0x74,
|
||||||
@@ -507,16 +502,17 @@ var file_app_dns_config_proto_rawDesc = []byte{
|
|||||||
0x12, 0x0e, 0x0a, 0x02, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x70,
|
0x12, 0x0e, 0x0a, 0x02, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x70,
|
||||||
0x12, 0x25, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61,
|
0x12, 0x25, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61,
|
||||||
0x69, 0x6e, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65,
|
0x69, 0x6e, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65,
|
||||||
0x64, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x2a, 0x45, 0x0a, 0x12, 0x44, 0x6f, 0x6d, 0x61, 0x69,
|
0x64, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4a, 0x04, 0x08, 0x07, 0x10, 0x08, 0x2a, 0x45, 0x0a,
|
||||||
0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08, 0x0a,
|
0x12, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54,
|
||||||
0x04, 0x46, 0x75, 0x6c, 0x6c, 0x10, 0x00, 0x12, 0x0d, 0x0a, 0x09, 0x53, 0x75, 0x62, 0x64, 0x6f,
|
0x79, 0x70, 0x65, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x75, 0x6c, 0x6c, 0x10, 0x00, 0x12, 0x0d, 0x0a,
|
||||||
0x6d, 0x61, 0x69, 0x6e, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07, 0x4b, 0x65, 0x79, 0x77, 0x6f, 0x72,
|
0x09, 0x53, 0x75, 0x62, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07,
|
||||||
0x64, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x52, 0x65, 0x67, 0x65, 0x78, 0x10, 0x03, 0x42, 0x46,
|
0x4b, 0x65, 0x79, 0x77, 0x6f, 0x72, 0x64, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x52, 0x65, 0x67,
|
||||||
0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64,
|
0x65, 0x78, 0x10, 0x03, 0x42, 0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79,
|
||||||
0x6e, 0x73, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d,
|
0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68,
|
||||||
0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f,
|
0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79,
|
||||||
0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41,
|
0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0xaa, 0x02, 0x0c,
|
||||||
0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72,
|
||||||
|
0x6f, 0x74, 0x6f, 0x33,
|
||||||
}
|
}
|
||||||
|
|
||||||
var (
|
var (
|
||||||
|
@@ -68,4 +68,6 @@ message Config {
|
|||||||
|
|
||||||
// Tag is the inbound tag of DNS client.
|
// Tag is the inbound tag of DNS client.
|
||||||
string tag = 6;
|
string tag = 6;
|
||||||
|
|
||||||
|
reserved 7;
|
||||||
}
|
}
|
||||||
|
@@ -2,18 +2,20 @@ package dns
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"encoding/binary"
|
"encoding/binary"
|
||||||
|
"strings"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
|
"golang.org/x/net/dns/dnsmessage"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/errors"
|
"github.com/xtls/xray-core/common/errors"
|
||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||||
"golang.org/x/net/dns/dnsmessage"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
// Fqdn normalize domain make sure it ends with '.'
|
// Fqdn normalize domain make sure it ends with '.'
|
||||||
func Fqdn(domain string) string {
|
func Fqdn(domain string) string {
|
||||||
if len(domain) > 0 && domain[len(domain)-1] == '.' {
|
if len(domain) > 0 && strings.HasSuffix(domain, ".") {
|
||||||
return domain
|
return domain
|
||||||
}
|
}
|
||||||
return domain + "."
|
return domain + "."
|
||||||
@@ -112,7 +114,7 @@ func genEDNS0Options(clientIP net.IP) *dnsmessage.Resource {
|
|||||||
return opt
|
return opt
|
||||||
}
|
}
|
||||||
|
|
||||||
func buildReqMsgs(domain string, option IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
|
func buildReqMsgs(domain string, option dns_feature.IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
|
||||||
qA := dnsmessage.Question{
|
qA := dnsmessage.Question{
|
||||||
Name: dnsmessage.MustNewName(domain),
|
Name: dnsmessage.MustNewName(domain),
|
||||||
Type: dnsmessage.TypeA,
|
Type: dnsmessage.TypeA,
|
||||||
|
@@ -7,9 +7,11 @@ import (
|
|||||||
|
|
||||||
"github.com/google/go-cmp/cmp"
|
"github.com/google/go-cmp/cmp"
|
||||||
"github.com/miekg/dns"
|
"github.com/miekg/dns"
|
||||||
|
"golang.org/x/net/dns/dnsmessage"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
"golang.org/x/net/dns/dnsmessage"
|
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||||
)
|
)
|
||||||
|
|
||||||
func Test_parseResponse(t *testing.T) {
|
func Test_parseResponse(t *testing.T) {
|
||||||
@@ -92,7 +94,7 @@ func Test_buildReqMsgs(t *testing.T) {
|
|||||||
}
|
}
|
||||||
type args struct {
|
type args struct {
|
||||||
domain string
|
domain string
|
||||||
option IPOption
|
option dns_feature.IPOption
|
||||||
reqOpts *dnsmessage.Resource
|
reqOpts *dnsmessage.Resource
|
||||||
}
|
}
|
||||||
tests := []struct {
|
tests := []struct {
|
||||||
@@ -100,10 +102,26 @@ func Test_buildReqMsgs(t *testing.T) {
|
|||||||
args args
|
args args
|
||||||
want int
|
want int
|
||||||
}{
|
}{
|
||||||
{"dual stack", args{"test.com", IPOption{true, true}, nil}, 2},
|
{"dual stack", args{"test.com", dns_feature.IPOption{
|
||||||
{"ipv4 only", args{"test.com", IPOption{true, false}, nil}, 1},
|
IPv4Enable: true,
|
||||||
{"ipv6 only", args{"test.com", IPOption{false, true}, nil}, 1},
|
IPv6Enable: true,
|
||||||
{"none/error", args{"test.com", IPOption{false, false}, nil}, 0},
|
FakeEnable: false,
|
||||||
|
}, nil}, 2},
|
||||||
|
{"ipv4 only", args{"test.com", dns_feature.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: false,
|
||||||
|
FakeEnable: false,
|
||||||
|
}, nil}, 1},
|
||||||
|
{"ipv6 only", args{"test.com", dns_feature.IPOption{
|
||||||
|
IPv4Enable: false,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
}, nil}, 1},
|
||||||
|
{"none/error", args{"test.com", dns_feature.IPOption{
|
||||||
|
IPv4Enable: false,
|
||||||
|
IPv6Enable: false,
|
||||||
|
FakeEnable: false,
|
||||||
|
}, nil}, 0},
|
||||||
}
|
}
|
||||||
for _, tt := range tests {
|
for _, tt := range tests {
|
||||||
t.Run(tt.name, func(t *testing.T) {
|
t.Run(tt.name, func(t *testing.T) {
|
||||||
|
@@ -12,8 +12,12 @@ import (
|
|||||||
"sync/atomic"
|
"sync/atomic"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
|
"golang.org/x/net/dns/dnsmessage"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
|
"github.com/xtls/xray-core/common/log"
|
||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
|
"github.com/xtls/xray-core/common/net/cnc"
|
||||||
"github.com/xtls/xray-core/common/protocol/dns"
|
"github.com/xtls/xray-core/common/protocol/dns"
|
||||||
"github.com/xtls/xray-core/common/session"
|
"github.com/xtls/xray-core/common/session"
|
||||||
"github.com/xtls/xray-core/common/signal/pubsub"
|
"github.com/xtls/xray-core/common/signal/pubsub"
|
||||||
@@ -21,13 +25,13 @@ import (
|
|||||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||||
"github.com/xtls/xray-core/features/routing"
|
"github.com/xtls/xray-core/features/routing"
|
||||||
"github.com/xtls/xray-core/transport/internet"
|
"github.com/xtls/xray-core/transport/internet"
|
||||||
"golang.org/x/net/dns/dnsmessage"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
// DoHNameServer implemented DNS over HTTPS (RFC8484) Wire Format,
|
// DoHNameServer implemented DNS over HTTPS (RFC8484) Wire Format,
|
||||||
// which is compatible with traditional dns over udp(RFC1035),
|
// which is compatible with traditional dns over udp(RFC1035),
|
||||||
// thus most of the DOH implementation is copied from udpns.go
|
// thus most of the DOH implementation is copied from udpns.go
|
||||||
type DoHNameServer struct {
|
type DoHNameServer struct {
|
||||||
|
dispatcher routing.Dispatcher
|
||||||
sync.RWMutex
|
sync.RWMutex
|
||||||
ips map[string]record
|
ips map[string]record
|
||||||
pub *pubsub.Service
|
pub *pubsub.Service
|
||||||
@@ -44,40 +48,59 @@ func NewDoHNameServer(url *url.URL, dispatcher routing.Dispatcher, clientIP net.
|
|||||||
newError("DNS: created Remote DOH client for ", url.String()).AtInfo().WriteToLog()
|
newError("DNS: created Remote DOH client for ", url.String()).AtInfo().WriteToLog()
|
||||||
s := baseDOHNameServer(url, "DOH", clientIP)
|
s := baseDOHNameServer(url, "DOH", clientIP)
|
||||||
|
|
||||||
// Dispatched connection will be closed (interrupted) after each request
|
s.dispatcher = dispatcher
|
||||||
// This makes DOH inefficient without a keep-alived connection
|
|
||||||
// See: core/app/proxyman/outbound/handler.go:113
|
|
||||||
// Using mux (https request wrapped in a stream layer) improves the situation.
|
|
||||||
// Recommend to use NewDoHLocalNameServer (DOHL:) if xray instance is running on
|
|
||||||
// a normal network eg. the server side of xray
|
|
||||||
tr := &http.Transport{
|
tr := &http.Transport{
|
||||||
MaxIdleConns: 30,
|
MaxIdleConns: 30,
|
||||||
IdleConnTimeout: 90 * time.Second,
|
IdleConnTimeout: 90 * time.Second,
|
||||||
TLSHandshakeTimeout: 30 * time.Second,
|
TLSHandshakeTimeout: 30 * time.Second,
|
||||||
ForceAttemptHTTP2: true,
|
ForceAttemptHTTP2: true,
|
||||||
DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
|
DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
|
||||||
|
dispatcherCtx := context.Background()
|
||||||
|
|
||||||
dest, err := net.ParseDestination(network + ":" + addr)
|
dest, err := net.ParseDestination(network + ":" + addr)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return nil, err
|
return nil, err
|
||||||
}
|
}
|
||||||
|
|
||||||
link, err := dispatcher.Dispatch(ctx, dest)
|
dispatcherCtx = session.ContextWithContent(dispatcherCtx, session.ContentFromContext(ctx))
|
||||||
|
dispatcherCtx = session.ContextWithInbound(dispatcherCtx, session.InboundFromContext(ctx))
|
||||||
|
dispatcherCtx = log.ContextWithAccessMessage(dispatcherCtx, &log.AccessMessage{
|
||||||
|
From: "DoH",
|
||||||
|
To: s.dohURL,
|
||||||
|
Status: log.AccessAccepted,
|
||||||
|
Reason: "",
|
||||||
|
})
|
||||||
|
|
||||||
|
link, err := s.dispatcher.Dispatch(dispatcherCtx, dest)
|
||||||
|
select {
|
||||||
|
case <-ctx.Done():
|
||||||
|
return nil, ctx.Err()
|
||||||
|
default:
|
||||||
|
|
||||||
|
}
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return nil, err
|
return nil, err
|
||||||
}
|
}
|
||||||
return net.NewConnection(
|
|
||||||
net.ConnectionInputMulti(link.Writer),
|
cc := common.ChainedClosable{}
|
||||||
net.ConnectionOutputMulti(link.Reader),
|
if cw, ok := link.Writer.(common.Closable); ok {
|
||||||
|
cc = append(cc, cw)
|
||||||
|
}
|
||||||
|
if cr, ok := link.Reader.(common.Closable); ok {
|
||||||
|
cc = append(cc, cr)
|
||||||
|
}
|
||||||
|
return cnc.NewConnection(
|
||||||
|
cnc.ConnectionInputMulti(link.Writer),
|
||||||
|
cnc.ConnectionOutputMulti(link.Reader),
|
||||||
|
cnc.ConnectionOnClose(cc),
|
||||||
), nil
|
), nil
|
||||||
},
|
},
|
||||||
}
|
}
|
||||||
|
s.httpClient = &http.Client{
|
||||||
dispatchedClient := &http.Client{
|
Timeout: time.Second * 180,
|
||||||
Transport: tr,
|
Transport: tr,
|
||||||
Timeout: 60 * time.Second,
|
|
||||||
}
|
}
|
||||||
|
|
||||||
s.httpClient = dispatchedClient
|
|
||||||
return s, nil
|
return s, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -94,6 +117,12 @@ func NewDoHLocalNameServer(url *url.URL, clientIP net.IP) *DoHNameServer {
|
|||||||
return nil, err
|
return nil, err
|
||||||
}
|
}
|
||||||
conn, err := internet.DialSystem(ctx, dest, nil)
|
conn, err := internet.DialSystem(ctx, dest, nil)
|
||||||
|
log.Record(&log.AccessMessage{
|
||||||
|
From: "DoH",
|
||||||
|
To: s.dohURL,
|
||||||
|
Status: log.AccessAccepted,
|
||||||
|
Detour: "local",
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return nil, err
|
return nil, err
|
||||||
}
|
}
|
||||||
@@ -207,9 +236,14 @@ func (s *DoHNameServer) newReqID() uint16 {
|
|||||||
return uint16(atomic.AddUint32(&s.reqID, 1))
|
return uint16(atomic.AddUint32(&s.reqID, 1))
|
||||||
}
|
}
|
||||||
|
|
||||||
func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPOption) {
|
func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option dns_feature.IPOption) {
|
||||||
newError(s.name, " querying: ", domain).AtInfo().WriteToLog(session.ExportIDToError(ctx))
|
newError(s.name, " querying: ", domain).AtInfo().WriteToLog(session.ExportIDToError(ctx))
|
||||||
|
|
||||||
|
if s.name+"." == "DOH//"+domain {
|
||||||
|
newError(s.name, " tries to resolve itself! Use IP or set \"hosts\" instead.").AtError().WriteToLog(session.ExportIDToError(ctx))
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
|
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
|
||||||
|
|
||||||
var deadline time.Time
|
var deadline time.Time
|
||||||
@@ -231,12 +265,12 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPO
|
|||||||
}
|
}
|
||||||
|
|
||||||
dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
|
dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
|
||||||
Protocol: "https",
|
Protocol: "https",
|
||||||
SkipRoutePick: true,
|
//SkipRoutePick: true,
|
||||||
})
|
})
|
||||||
|
|
||||||
// forced to use mux for DOH
|
// forced to use mux for DOH
|
||||||
dnsCtx = session.ContextWithMuxPrefered(dnsCtx, true)
|
// dnsCtx = session.ContextWithMuxPrefered(dnsCtx, true)
|
||||||
|
|
||||||
var cancel context.CancelFunc
|
var cancel context.CancelFunc
|
||||||
dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
|
dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
|
||||||
@@ -244,17 +278,17 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPO
|
|||||||
|
|
||||||
b, err := dns.PackMessage(r.msg)
|
b, err := dns.PackMessage(r.msg)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
newError("failed to pack dns query").Base(err).AtError().WriteToLog()
|
newError("failed to pack dns query for ", domain).Base(err).AtError().WriteToLog()
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
resp, err := s.dohHTTPSContext(dnsCtx, b.Bytes())
|
resp, err := s.dohHTTPSContext(dnsCtx, b.Bytes())
|
||||||
if err != nil {
|
if err != nil {
|
||||||
newError("failed to retrieve response").Base(err).AtError().WriteToLog()
|
newError("failed to retrieve response for ", domain).Base(err).AtError().WriteToLog()
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
rec, err := parseResponse(resp)
|
rec, err := parseResponse(resp)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
newError("failed to handle DOH response").Base(err).AtError().WriteToLog()
|
newError("failed to handle DOH response for ", domain).Base(err).AtError().WriteToLog()
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
s.updateIP(r, rec)
|
s.updateIP(r, rec)
|
||||||
@@ -272,7 +306,9 @@ func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte,
|
|||||||
req.Header.Add("Accept", "application/dns-message")
|
req.Header.Add("Accept", "application/dns-message")
|
||||||
req.Header.Add("Content-Type", "application/dns-message")
|
req.Header.Add("Content-Type", "application/dns-message")
|
||||||
|
|
||||||
resp, err := s.httpClient.Do(req.WithContext(ctx))
|
hc := s.httpClient
|
||||||
|
|
||||||
|
resp, err := hc.Do(req.WithContext(ctx))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return nil, err
|
return nil, err
|
||||||
}
|
}
|
||||||
@@ -286,7 +322,7 @@ func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte,
|
|||||||
return ioutil.ReadAll(resp.Body)
|
return ioutil.ReadAll(resp.Body)
|
||||||
}
|
}
|
||||||
|
|
||||||
func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.IP, error) {
|
func (s *DoHNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
|
||||||
s.RLock()
|
s.RLock()
|
||||||
record, found := s.ips[domain]
|
record, found := s.ips[domain]
|
||||||
s.RUnlock()
|
s.RUnlock()
|
||||||
@@ -329,12 +365,13 @@ func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.
|
|||||||
}
|
}
|
||||||
|
|
||||||
// QueryIP is called from dns.Server->queryIPTimeout
|
// QueryIP is called from dns.Server->queryIPTimeout
|
||||||
func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
|
func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, error) { // nolint: dupl
|
||||||
fqdn := Fqdn(domain)
|
fqdn := Fqdn(domain)
|
||||||
|
|
||||||
ips, err := s.findIPsForDomain(fqdn, option)
|
ips, err := s.findIPsForDomain(fqdn, option)
|
||||||
if err != errRecordNotFound {
|
if err != errRecordNotFound {
|
||||||
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
|
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
|
||||||
|
log.Record(&log.DNSLog{s.name, domain, ips, log.DNSCacheHit, 0, err})
|
||||||
return ips, err
|
return ips, err
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -365,10 +402,12 @@ func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option IPOpt
|
|||||||
close(done)
|
close(done)
|
||||||
}()
|
}()
|
||||||
s.sendQuery(ctx, fqdn, option)
|
s.sendQuery(ctx, fqdn, option)
|
||||||
|
start := time.Now()
|
||||||
|
|
||||||
for {
|
for {
|
||||||
ips, err := s.findIPsForDomain(fqdn, option)
|
ips, err := s.findIPsForDomain(fqdn, option)
|
||||||
if err != errRecordNotFound {
|
if err != errRecordNotFound {
|
||||||
|
log.Record(&log.DNSLog{s.name, domain, ips, log.DNSQueried, time.Since(start), err})
|
||||||
return ips, err
|
return ips, err
|
||||||
}
|
}
|
||||||
|
|
||||||
|
9
app/dns/fakedns/errors.generated.go
Normal file
9
app/dns/fakedns/errors.generated.go
Normal file
@@ -0,0 +1,9 @@
|
|||||||
|
package fakedns
|
||||||
|
|
||||||
|
import "github.com/xtls/xray-core/common/errors"
|
||||||
|
|
||||||
|
type errPathObjHolder struct{}
|
||||||
|
|
||||||
|
func newError(values ...interface{}) *errors.Error {
|
||||||
|
return errors.New(values...).WithPathObj(errPathObjHolder{})
|
||||||
|
}
|
134
app/dns/fakedns/fake.go
Normal file
134
app/dns/fakedns/fake.go
Normal file
@@ -0,0 +1,134 @@
|
|||||||
|
package fakedns
|
||||||
|
|
||||||
|
import (
|
||||||
|
"context"
|
||||||
|
"math"
|
||||||
|
"math/big"
|
||||||
|
gonet "net"
|
||||||
|
"time"
|
||||||
|
|
||||||
|
"github.com/xtls/xray-core/common"
|
||||||
|
"github.com/xtls/xray-core/common/cache"
|
||||||
|
"github.com/xtls/xray-core/common/net"
|
||||||
|
"github.com/xtls/xray-core/features/dns"
|
||||||
|
)
|
||||||
|
|
||||||
|
type Holder struct {
|
||||||
|
domainToIP cache.Lru
|
||||||
|
ipRange *gonet.IPNet
|
||||||
|
|
||||||
|
config *FakeDnsPool
|
||||||
|
}
|
||||||
|
|
||||||
|
func (*Holder) Type() interface{} {
|
||||||
|
return (*dns.FakeDNSEngine)(nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (fkdns *Holder) Start() error {
|
||||||
|
return fkdns.initializeFromConfig()
|
||||||
|
}
|
||||||
|
|
||||||
|
func (fkdns *Holder) Close() error {
|
||||||
|
fkdns.domainToIP = nil
|
||||||
|
fkdns.ipRange = nil
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func NewFakeDNSHolder() (*Holder, error) {
|
||||||
|
var fkdns *Holder
|
||||||
|
var err error
|
||||||
|
|
||||||
|
if fkdns, err = NewFakeDNSHolderConfigOnly(nil); err != nil {
|
||||||
|
return nil, newError("Unable to create Fake Dns Engine").Base(err).AtError()
|
||||||
|
}
|
||||||
|
err = fkdns.initialize(dns.FakeIPPool, 65535)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return fkdns, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func NewFakeDNSHolderConfigOnly(conf *FakeDnsPool) (*Holder, error) {
|
||||||
|
return &Holder{nil, nil, conf}, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (fkdns *Holder) initializeFromConfig() error {
|
||||||
|
return fkdns.initialize(fkdns.config.IpPool, int(fkdns.config.LruSize))
|
||||||
|
}
|
||||||
|
|
||||||
|
func (fkdns *Holder) initialize(ipPoolCidr string, lruSize int) error {
|
||||||
|
var ipRange *gonet.IPNet
|
||||||
|
var err error
|
||||||
|
|
||||||
|
if _, ipRange, err = gonet.ParseCIDR(ipPoolCidr); err != nil {
|
||||||
|
return newError("Unable to parse CIDR for Fake DNS IP assignment").Base(err).AtError()
|
||||||
|
}
|
||||||
|
|
||||||
|
ones, bits := ipRange.Mask.Size()
|
||||||
|
rooms := bits - ones
|
||||||
|
if math.Log2(float64(lruSize)) >= float64(rooms) {
|
||||||
|
return newError("LRU size is bigger than subnet size").AtError()
|
||||||
|
}
|
||||||
|
fkdns.domainToIP = cache.NewLru(lruSize)
|
||||||
|
fkdns.ipRange = ipRange
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetFakeIPForDomain check and generate a fake IP for a domain name
|
||||||
|
func (fkdns *Holder) GetFakeIPForDomain(domain string) []net.Address {
|
||||||
|
if v, ok := fkdns.domainToIP.Get(domain); ok {
|
||||||
|
return []net.Address{v.(net.Address)}
|
||||||
|
}
|
||||||
|
var currentTimeMillis = uint64(time.Now().UnixNano() / 1e6)
|
||||||
|
ones, bits := fkdns.ipRange.Mask.Size()
|
||||||
|
rooms := bits - ones
|
||||||
|
if rooms < 64 {
|
||||||
|
currentTimeMillis %= (uint64(1) << rooms)
|
||||||
|
}
|
||||||
|
var bigIntIP = big.NewInt(0).SetBytes(fkdns.ipRange.IP)
|
||||||
|
bigIntIP = bigIntIP.Add(bigIntIP, new(big.Int).SetUint64(currentTimeMillis))
|
||||||
|
var ip net.Address
|
||||||
|
for {
|
||||||
|
ip = net.IPAddress(bigIntIP.Bytes())
|
||||||
|
|
||||||
|
// if we run for a long time, we may go back to beginning and start seeing the IP in use
|
||||||
|
if _, ok := fkdns.domainToIP.PeekKeyFromValue(ip); !ok {
|
||||||
|
break
|
||||||
|
}
|
||||||
|
|
||||||
|
bigIntIP = bigIntIP.Add(bigIntIP, big.NewInt(1))
|
||||||
|
if !fkdns.ipRange.Contains(bigIntIP.Bytes()) {
|
||||||
|
bigIntIP = big.NewInt(0).SetBytes(fkdns.ipRange.IP)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
fkdns.domainToIP.Put(domain, ip)
|
||||||
|
return []net.Address{ip}
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetDomainFromFakeDNS check if an IP is a fake IP and have corresponding domain name
|
||||||
|
func (fkdns *Holder) GetDomainFromFakeDNS(ip net.Address) string {
|
||||||
|
if !ip.Family().IsIP() || !fkdns.ipRange.Contains(ip.IP()) {
|
||||||
|
return ""
|
||||||
|
}
|
||||||
|
if k, ok := fkdns.domainToIP.GetKeyFromValue(ip); ok {
|
||||||
|
return k.(string)
|
||||||
|
}
|
||||||
|
newError("A fake ip request to ", ip, ", however there is no matching domain name in fake DNS").AtInfo().WriteToLog()
|
||||||
|
return ""
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetFakeIPRange return fake IP range from configuration
|
||||||
|
func (fkdns *Holder) GetFakeIPRange() *gonet.IPNet {
|
||||||
|
return fkdns.ipRange
|
||||||
|
}
|
||||||
|
|
||||||
|
func init() {
|
||||||
|
common.Must(common.RegisterConfig((*FakeDnsPool)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
|
||||||
|
var f *Holder
|
||||||
|
var err error
|
||||||
|
if f, err = NewFakeDNSHolderConfigOnly(config.(*FakeDnsPool)); err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return f, nil
|
||||||
|
}))
|
||||||
|
}
|
3
app/dns/fakedns/fakedns.go
Normal file
3
app/dns/fakedns/fakedns.go
Normal file
@@ -0,0 +1,3 @@
|
|||||||
|
package fakedns
|
||||||
|
|
||||||
|
//go:generate go run github.com/xtls/xray-core/common/errors/errorgen
|
158
app/dns/fakedns/fakedns.pb.go
Normal file
158
app/dns/fakedns/fakedns.pb.go
Normal file
@@ -0,0 +1,158 @@
|
|||||||
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
|
// versions:
|
||||||
|
// protoc-gen-go v1.27.1
|
||||||
|
// protoc v3.18.0
|
||||||
|
// source: app/dns/fakedns/fakedns.proto
|
||||||
|
|
||||||
|
package fakedns
|
||||||
|
|
||||||
|
import (
|
||||||
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
|
reflect "reflect"
|
||||||
|
sync "sync"
|
||||||
|
)
|
||||||
|
|
||||||
|
const (
|
||||||
|
// Verify that this generated code is sufficiently up-to-date.
|
||||||
|
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
|
||||||
|
// Verify that runtime/protoimpl is sufficiently up-to-date.
|
||||||
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
|
)
|
||||||
|
|
||||||
|
type FakeDnsPool struct {
|
||||||
|
state protoimpl.MessageState
|
||||||
|
sizeCache protoimpl.SizeCache
|
||||||
|
unknownFields protoimpl.UnknownFields
|
||||||
|
|
||||||
|
IpPool string `protobuf:"bytes,1,opt,name=ip_pool,json=ipPool,proto3" json:"ip_pool,omitempty"` //CIDR of IP pool used as fake DNS IP
|
||||||
|
LruSize int64 `protobuf:"varint,2,opt,name=lruSize,proto3" json:"lruSize,omitempty"` //Size of Pool for remembering relationship between domain name and IP address
|
||||||
|
}
|
||||||
|
|
||||||
|
func (x *FakeDnsPool) Reset() {
|
||||||
|
*x = FakeDnsPool{}
|
||||||
|
if protoimpl.UnsafeEnabled {
|
||||||
|
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
|
||||||
|
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||||
|
ms.StoreMessageInfo(mi)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (x *FakeDnsPool) String() string {
|
||||||
|
return protoimpl.X.MessageStringOf(x)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (*FakeDnsPool) ProtoMessage() {}
|
||||||
|
|
||||||
|
func (x *FakeDnsPool) ProtoReflect() protoreflect.Message {
|
||||||
|
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
|
||||||
|
if protoimpl.UnsafeEnabled && x != nil {
|
||||||
|
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||||
|
if ms.LoadMessageInfo() == nil {
|
||||||
|
ms.StoreMessageInfo(mi)
|
||||||
|
}
|
||||||
|
return ms
|
||||||
|
}
|
||||||
|
return mi.MessageOf(x)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Deprecated: Use FakeDnsPool.ProtoReflect.Descriptor instead.
|
||||||
|
func (*FakeDnsPool) Descriptor() ([]byte, []int) {
|
||||||
|
return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{0}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (x *FakeDnsPool) GetIpPool() string {
|
||||||
|
if x != nil {
|
||||||
|
return x.IpPool
|
||||||
|
}
|
||||||
|
return ""
|
||||||
|
}
|
||||||
|
|
||||||
|
func (x *FakeDnsPool) GetLruSize() int64 {
|
||||||
|
if x != nil {
|
||||||
|
return x.LruSize
|
||||||
|
}
|
||||||
|
return 0
|
||||||
|
}
|
||||||
|
|
||||||
|
var File_app_dns_fakedns_fakedns_proto protoreflect.FileDescriptor
|
||||||
|
|
||||||
|
var file_app_dns_fakedns_fakedns_proto_rawDesc = []byte{
|
||||||
|
0x0a, 0x1d, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e,
|
||||||
|
0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12,
|
||||||
|
0x14, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61,
|
||||||
|
0x6b, 0x65, 0x64, 0x6e, 0x73, 0x22, 0x40, 0x0a, 0x0b, 0x46, 0x61, 0x6b, 0x65, 0x44, 0x6e, 0x73,
|
||||||
|
0x50, 0x6f, 0x6f, 0x6c, 0x12, 0x17, 0x0a, 0x07, 0x69, 0x70, 0x5f, 0x70, 0x6f, 0x6f, 0x6c, 0x18,
|
||||||
|
0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x69, 0x70, 0x50, 0x6f, 0x6f, 0x6c, 0x12, 0x18, 0x0a,
|
||||||
|
0x07, 0x6c, 0x72, 0x75, 0x53, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x07,
|
||||||
|
0x6c, 0x72, 0x75, 0x53, 0x69, 0x7a, 0x65, 0x42, 0x5e, 0x0a, 0x18, 0x63, 0x6f, 0x6d, 0x2e, 0x78,
|
||||||
|
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61, 0x6b, 0x65,
|
||||||
|
0x64, 0x6e, 0x73, 0x50, 0x01, 0x5a, 0x29, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f,
|
||||||
|
0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65,
|
||||||
|
0x2f, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73,
|
||||||
|
0xaa, 0x02, 0x14, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x2e,
|
||||||
|
0x46, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||||
|
}
|
||||||
|
|
||||||
|
var (
|
||||||
|
file_app_dns_fakedns_fakedns_proto_rawDescOnce sync.Once
|
||||||
|
file_app_dns_fakedns_fakedns_proto_rawDescData = file_app_dns_fakedns_fakedns_proto_rawDesc
|
||||||
|
)
|
||||||
|
|
||||||
|
func file_app_dns_fakedns_fakedns_proto_rawDescGZIP() []byte {
|
||||||
|
file_app_dns_fakedns_fakedns_proto_rawDescOnce.Do(func() {
|
||||||
|
file_app_dns_fakedns_fakedns_proto_rawDescData = protoimpl.X.CompressGZIP(file_app_dns_fakedns_fakedns_proto_rawDescData)
|
||||||
|
})
|
||||||
|
return file_app_dns_fakedns_fakedns_proto_rawDescData
|
||||||
|
}
|
||||||
|
|
||||||
|
var file_app_dns_fakedns_fakedns_proto_msgTypes = make([]protoimpl.MessageInfo, 1)
|
||||||
|
var file_app_dns_fakedns_fakedns_proto_goTypes = []interface{}{
|
||||||
|
(*FakeDnsPool)(nil), // 0: xray.app.dns.fakedns.FakeDnsPool
|
||||||
|
}
|
||||||
|
var file_app_dns_fakedns_fakedns_proto_depIdxs = []int32{
|
||||||
|
0, // [0:0] is the sub-list for method output_type
|
||||||
|
0, // [0:0] is the sub-list for method input_type
|
||||||
|
0, // [0:0] is the sub-list for extension type_name
|
||||||
|
0, // [0:0] is the sub-list for extension extendee
|
||||||
|
0, // [0:0] is the sub-list for field type_name
|
||||||
|
}
|
||||||
|
|
||||||
|
func init() { file_app_dns_fakedns_fakedns_proto_init() }
|
||||||
|
func file_app_dns_fakedns_fakedns_proto_init() {
|
||||||
|
if File_app_dns_fakedns_fakedns_proto != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
if !protoimpl.UnsafeEnabled {
|
||||||
|
file_app_dns_fakedns_fakedns_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
|
||||||
|
switch v := v.(*FakeDnsPool); i {
|
||||||
|
case 0:
|
||||||
|
return &v.state
|
||||||
|
case 1:
|
||||||
|
return &v.sizeCache
|
||||||
|
case 2:
|
||||||
|
return &v.unknownFields
|
||||||
|
default:
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
type x struct{}
|
||||||
|
out := protoimpl.TypeBuilder{
|
||||||
|
File: protoimpl.DescBuilder{
|
||||||
|
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
|
||||||
|
RawDescriptor: file_app_dns_fakedns_fakedns_proto_rawDesc,
|
||||||
|
NumEnums: 0,
|
||||||
|
NumMessages: 1,
|
||||||
|
NumExtensions: 0,
|
||||||
|
NumServices: 0,
|
||||||
|
},
|
||||||
|
GoTypes: file_app_dns_fakedns_fakedns_proto_goTypes,
|
||||||
|
DependencyIndexes: file_app_dns_fakedns_fakedns_proto_depIdxs,
|
||||||
|
MessageInfos: file_app_dns_fakedns_fakedns_proto_msgTypes,
|
||||||
|
}.Build()
|
||||||
|
File_app_dns_fakedns_fakedns_proto = out.File
|
||||||
|
file_app_dns_fakedns_fakedns_proto_rawDesc = nil
|
||||||
|
file_app_dns_fakedns_fakedns_proto_goTypes = nil
|
||||||
|
file_app_dns_fakedns_fakedns_proto_depIdxs = nil
|
||||||
|
}
|
12
app/dns/fakedns/fakedns.proto
Normal file
12
app/dns/fakedns/fakedns.proto
Normal file
@@ -0,0 +1,12 @@
|
|||||||
|
syntax = "proto3";
|
||||||
|
|
||||||
|
package xray.app.dns.fakedns;
|
||||||
|
option csharp_namespace = "Xray.App.Dns.Fakedns";
|
||||||
|
option go_package = "github.com/xtls/xray-core/app/dns/fakedns";
|
||||||
|
option java_package = "com.xray.app.dns.fakedns";
|
||||||
|
option java_multiple_files = true;
|
||||||
|
|
||||||
|
message FakeDnsPool{
|
||||||
|
string ip_pool = 1; //CIDR of IP pool used as fake DNS IP
|
||||||
|
int64 lruSize = 2; //Size of Pool for remembering relationship between domain name and IP address
|
||||||
|
}
|
105
app/dns/fakedns/fakedns_test.go
Normal file
105
app/dns/fakedns/fakedns_test.go
Normal file
@@ -0,0 +1,105 @@
|
|||||||
|
package fakedns
|
||||||
|
|
||||||
|
import (
|
||||||
|
"testing"
|
||||||
|
|
||||||
|
"github.com/stretchr/testify/assert"
|
||||||
|
|
||||||
|
"github.com/xtls/xray-core/common"
|
||||||
|
"github.com/xtls/xray-core/common/net"
|
||||||
|
"github.com/xtls/xray-core/common/uuid"
|
||||||
|
"github.com/xtls/xray-core/features/dns"
|
||||||
|
)
|
||||||
|
|
||||||
|
var (
|
||||||
|
ipPrefix = "198.18."
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestNewFakeDnsHolder(_ *testing.T) {
|
||||||
|
_, err := NewFakeDNSHolder()
|
||||||
|
common.Must(err)
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestFakeDnsHolderCreateMapping(t *testing.T) {
|
||||||
|
fkdns, err := NewFakeDNSHolder()
|
||||||
|
common.Must(err)
|
||||||
|
|
||||||
|
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||||
|
assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestFakeDnsHolderCreateMappingMany(t *testing.T) {
|
||||||
|
fkdns, err := NewFakeDNSHolder()
|
||||||
|
common.Must(err)
|
||||||
|
|
||||||
|
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||||
|
assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
|
||||||
|
|
||||||
|
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
|
||||||
|
assert.Equal(t, ipPrefix, addr2[0].IP().String()[0:len(ipPrefix)])
|
||||||
|
assert.NotEqual(t, addr[0].IP().String(), addr2[0].IP().String())
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestFakeDnsHolderCreateMappingManyAndResolve(t *testing.T) {
|
||||||
|
fkdns, err := NewFakeDNSHolder()
|
||||||
|
common.Must(err)
|
||||||
|
|
||||||
|
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||||
|
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
|
||||||
|
|
||||||
|
{
|
||||||
|
result := fkdns.GetDomainFromFakeDNS(addr[0])
|
||||||
|
assert.Equal(t, "fakednstest.example.com", result)
|
||||||
|
}
|
||||||
|
|
||||||
|
{
|
||||||
|
result := fkdns.GetDomainFromFakeDNS(addr2[0])
|
||||||
|
assert.Equal(t, "fakednstest2.example.com", result)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestFakeDnsHolderCreateMappingManySingleDomain(t *testing.T) {
|
||||||
|
fkdns, err := NewFakeDNSHolder()
|
||||||
|
common.Must(err)
|
||||||
|
|
||||||
|
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||||
|
addr2 := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||||
|
assert.Equal(t, addr[0].IP().String(), addr2[0].IP().String())
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestFakeDnsHolderCreateMappingAndRollOver(t *testing.T) {
|
||||||
|
fkdns, err := NewFakeDNSHolderConfigOnly(&FakeDnsPool{
|
||||||
|
IpPool: dns.FakeIPPool,
|
||||||
|
LruSize: 256,
|
||||||
|
})
|
||||||
|
common.Must(err)
|
||||||
|
|
||||||
|
err = fkdns.Start()
|
||||||
|
|
||||||
|
common.Must(err)
|
||||||
|
|
||||||
|
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||||
|
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
|
||||||
|
|
||||||
|
for i := 0; i <= 8192; i++ {
|
||||||
|
{
|
||||||
|
result := fkdns.GetDomainFromFakeDNS(addr[0])
|
||||||
|
assert.Equal(t, "fakednstest.example.com", result)
|
||||||
|
}
|
||||||
|
|
||||||
|
{
|
||||||
|
result := fkdns.GetDomainFromFakeDNS(addr2[0])
|
||||||
|
assert.Equal(t, "fakednstest2.example.com", result)
|
||||||
|
}
|
||||||
|
|
||||||
|
{
|
||||||
|
uuid := uuid.New()
|
||||||
|
domain := uuid.String() + ".fakednstest.example.com"
|
||||||
|
tempAddr := fkdns.GetFakeIPForDomain(domain)
|
||||||
|
rsaddr := tempAddr[0].IP().String()
|
||||||
|
|
||||||
|
result := fkdns.GetDomainFromFakeDNS(net.ParseAddress(rsaddr))
|
||||||
|
assert.Equal(t, domain, result)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
@@ -5,6 +5,7 @@ import (
|
|||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
"github.com/xtls/xray-core/common/strmatcher"
|
"github.com/xtls/xray-core/common/strmatcher"
|
||||||
"github.com/xtls/xray-core/features"
|
"github.com/xtls/xray-core/features"
|
||||||
|
"github.com/xtls/xray-core/features/dns"
|
||||||
)
|
)
|
||||||
|
|
||||||
// StaticHosts represents static domain-ip mapping in DNS server.
|
// StaticHosts represents static domain-ip mapping in DNS server.
|
||||||
@@ -92,7 +93,7 @@ func NewStaticHosts(hosts []*Config_HostMapping, legacy map[string]*net.IPOrDoma
|
|||||||
return sh, nil
|
return sh, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func filterIP(ips []net.Address, option IPOption) []net.Address {
|
func filterIP(ips []net.Address, option dns.IPOption) []net.Address {
|
||||||
filtered := make([]net.Address, 0, len(ips))
|
filtered := make([]net.Address, 0, len(ips))
|
||||||
for _, ip := range ips {
|
for _, ip := range ips {
|
||||||
if (ip.Family().IsIPv4() && option.IPv4Enable) || (ip.Family().IsIPv6() && option.IPv6Enable) {
|
if (ip.Family().IsIPv4() && option.IPv4Enable) || (ip.Family().IsIPv6() && option.IPv6Enable) {
|
||||||
@@ -106,7 +107,7 @@ func filterIP(ips []net.Address, option IPOption) []net.Address {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// LookupIP returns IP address for the given domain, if exists in this StaticHosts.
|
// LookupIP returns IP address for the given domain, if exists in this StaticHosts.
|
||||||
func (h *StaticHosts) LookupIP(domain string, option IPOption) []net.Address {
|
func (h *StaticHosts) LookupIP(domain string, option dns.IPOption) []net.Address {
|
||||||
indices := h.matchers.Match(domain)
|
indices := h.matchers.Match(domain)
|
||||||
if len(indices) == 0 {
|
if len(indices) == 0 {
|
||||||
return nil
|
return nil
|
||||||
|
@@ -8,6 +8,7 @@ import (
|
|||||||
. "github.com/xtls/xray-core/app/dns"
|
. "github.com/xtls/xray-core/app/dns"
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
|
"github.com/xtls/xray-core/features/dns"
|
||||||
)
|
)
|
||||||
|
|
||||||
func TestStaticHosts(t *testing.T) {
|
func TestStaticHosts(t *testing.T) {
|
||||||
@@ -39,7 +40,7 @@ func TestStaticHosts(t *testing.T) {
|
|||||||
common.Must(err)
|
common.Must(err)
|
||||||
|
|
||||||
{
|
{
|
||||||
ips := hosts.LookupIP("example.com", IPOption{
|
ips := hosts.LookupIP("example.com", dns.IPOption{
|
||||||
IPv4Enable: true,
|
IPv4Enable: true,
|
||||||
IPv6Enable: true,
|
IPv6Enable: true,
|
||||||
})
|
})
|
||||||
@@ -52,7 +53,7 @@ func TestStaticHosts(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{
|
{
|
||||||
ips := hosts.LookupIP("www.example.cn", IPOption{
|
ips := hosts.LookupIP("www.example.cn", dns.IPOption{
|
||||||
IPv4Enable: true,
|
IPv4Enable: true,
|
||||||
IPv6Enable: true,
|
IPv6Enable: true,
|
||||||
})
|
})
|
||||||
@@ -65,7 +66,7 @@ func TestStaticHosts(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{
|
{
|
||||||
ips := hosts.LookupIP("baidu.com", IPOption{
|
ips := hosts.LookupIP("baidu.com", dns.IPOption{
|
||||||
IPv4Enable: false,
|
IPv4Enable: false,
|
||||||
IPv6Enable: true,
|
IPv6Enable: true,
|
||||||
})
|
})
|
||||||
|
@@ -4,39 +4,26 @@ import (
|
|||||||
"context"
|
"context"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
|
"github.com/xtls/xray-core/features/dns"
|
||||||
"github.com/xtls/xray-core/features/dns/localdns"
|
"github.com/xtls/xray-core/features/dns/localdns"
|
||||||
)
|
)
|
||||||
|
|
||||||
// IPOption is an object for IP query options.
|
|
||||||
type IPOption struct {
|
|
||||||
IPv4Enable bool
|
|
||||||
IPv6Enable bool
|
|
||||||
}
|
|
||||||
|
|
||||||
// Client is the interface for DNS client.
|
// Client is the interface for DNS client.
|
||||||
type Client interface {
|
type Client interface {
|
||||||
// Name of the Client.
|
// Name of the Client.
|
||||||
Name() string
|
Name() string
|
||||||
|
|
||||||
// QueryIP sends IP queries to its configured server.
|
// QueryIP sends IP queries to its configured server.
|
||||||
QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error)
|
QueryIP(ctx context.Context, domain string, option dns.IPOption) ([]net.IP, error)
|
||||||
}
|
}
|
||||||
|
|
||||||
type LocalNameServer struct {
|
type LocalNameServer struct {
|
||||||
client *localdns.Client
|
client *localdns.Client
|
||||||
}
|
}
|
||||||
|
|
||||||
func (s *LocalNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
|
func (s *LocalNameServer) QueryIP(_ context.Context, domain string, option dns.IPOption) ([]net.IP, error) {
|
||||||
if option.IPv4Enable && option.IPv6Enable {
|
if option.IPv4Enable || option.IPv6Enable {
|
||||||
return s.client.LookupIP(domain)
|
return s.client.LookupIP(domain, option)
|
||||||
}
|
|
||||||
|
|
||||||
if option.IPv4Enable {
|
|
||||||
return s.client.LookupIPv4(domain)
|
|
||||||
}
|
|
||||||
|
|
||||||
if option.IPv6Enable {
|
|
||||||
return s.client.LookupIPv6(domain)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil, newError("neither IPv4 nor IPv6 is enabled")
|
return nil, newError("neither IPv4 nor IPv6 is enabled")
|
||||||
|
41
app/dns/nameserver_fakedns.go
Normal file
41
app/dns/nameserver_fakedns.go
Normal file
@@ -0,0 +1,41 @@
|
|||||||
|
package dns
|
||||||
|
|
||||||
|
import (
|
||||||
|
"context"
|
||||||
|
|
||||||
|
"github.com/xtls/xray-core/common/net"
|
||||||
|
"github.com/xtls/xray-core/core"
|
||||||
|
"github.com/xtls/xray-core/features/dns"
|
||||||
|
)
|
||||||
|
|
||||||
|
type FakeDNSServer struct {
|
||||||
|
fakeDNSEngine dns.FakeDNSEngine
|
||||||
|
}
|
||||||
|
|
||||||
|
func NewFakeDNSServer() *FakeDNSServer {
|
||||||
|
return &FakeDNSServer{}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (FakeDNSServer) Name() string {
|
||||||
|
return "FakeDNS"
|
||||||
|
}
|
||||||
|
|
||||||
|
func (f *FakeDNSServer) QueryIP(ctx context.Context, domain string, _ dns.IPOption) ([]net.IP, error) {
|
||||||
|
if f.fakeDNSEngine == nil {
|
||||||
|
if err := core.RequireFeatures(ctx, func(fd dns.FakeDNSEngine) {
|
||||||
|
f.fakeDNSEngine = fd
|
||||||
|
}); err != nil {
|
||||||
|
return nil, newError("Unable to locate a fake DNS Engine").Base(err).AtError()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
ips := f.fakeDNSEngine.GetFakeIPForDomain(domain)
|
||||||
|
|
||||||
|
netIP := toNetIP(ips)
|
||||||
|
if netIP == nil {
|
||||||
|
return nil, newError("Unable to convert IP to net ip").AtError()
|
||||||
|
}
|
||||||
|
|
||||||
|
newError(f.Name(), " got answer: ", domain, " -> ", ips).AtInfo().WriteToLog()
|
||||||
|
|
||||||
|
return netIP, nil
|
||||||
|
}
|
@@ -7,14 +7,16 @@ import (
|
|||||||
|
|
||||||
. "github.com/xtls/xray-core/app/dns"
|
. "github.com/xtls/xray-core/app/dns"
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
|
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||||
)
|
)
|
||||||
|
|
||||||
func TestLocalNameServer(t *testing.T) {
|
func TestLocalNameServer(t *testing.T) {
|
||||||
s := NewLocalNameServer()
|
s := NewLocalNameServer()
|
||||||
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
|
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
|
||||||
ips, err := s.QueryIP(ctx, "google.com", IPOption{
|
ips, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
|
||||||
IPv4Enable: true,
|
IPv4Enable: true,
|
||||||
IPv6Enable: true,
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
})
|
})
|
||||||
cancel()
|
cancel()
|
||||||
common.Must(err)
|
common.Must(err)
|
||||||
|
@@ -29,7 +29,8 @@ type Server struct {
|
|||||||
sync.Mutex
|
sync.Mutex
|
||||||
hosts *StaticHosts
|
hosts *StaticHosts
|
||||||
clientIP net.IP
|
clientIP net.IP
|
||||||
clients []Client // clientIdx -> Client
|
clients []Client // clientIdx -> Client
|
||||||
|
ctx context.Context
|
||||||
ipIndexMap []*MultiGeoIPMatcher // clientIdx -> *MultiGeoIPMatcher
|
ipIndexMap []*MultiGeoIPMatcher // clientIdx -> *MultiGeoIPMatcher
|
||||||
domainRules [][]string // clientIdx -> domainRuleIdx -> DomainRule
|
domainRules [][]string // clientIdx -> domainRuleIdx -> DomainRule
|
||||||
domainMatcher strmatcher.IndexMatcher
|
domainMatcher strmatcher.IndexMatcher
|
||||||
@@ -74,6 +75,7 @@ func generateRandomTag() string {
|
|||||||
func New(ctx context.Context, config *Config) (*Server, error) {
|
func New(ctx context.Context, config *Config) (*Server, error) {
|
||||||
server := &Server{
|
server := &Server{
|
||||||
clients: make([]Client, 0, len(config.NameServers)+len(config.NameServer)),
|
clients: make([]Client, 0, len(config.NameServers)+len(config.NameServer)),
|
||||||
|
ctx: ctx,
|
||||||
tag: config.Tag,
|
tag: config.Tag,
|
||||||
}
|
}
|
||||||
if server.tag == "" {
|
if server.tag == "" {
|
||||||
@@ -143,6 +145,9 @@ func New(ctx context.Context, config *Config) (*Server, error) {
|
|||||||
server.clients[idx] = c
|
server.clients[idx] = c
|
||||||
}))
|
}))
|
||||||
|
|
||||||
|
case address.Family().IsDomain() && address.Domain() == "fakedns":
|
||||||
|
server.clients = append(server.clients, NewFakeDNSServer())
|
||||||
|
|
||||||
default:
|
default:
|
||||||
// UDP classic DNS mode
|
// UDP classic DNS mode
|
||||||
dest := endpoint.AsDestination()
|
dest := endpoint.AsDestination()
|
||||||
@@ -294,13 +299,14 @@ func (s *Server) Match(idx int, client Client, domain string, ips []net.IP) ([]n
|
|||||||
return newIps, nil
|
return newIps, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func (s *Server) queryIPTimeout(idx int, client Client, domain string, option IPOption) ([]net.IP, error) {
|
func (s *Server) queryIPTimeout(idx int, client Client, domain string, option dns.IPOption) ([]net.IP, error) {
|
||||||
ctx, cancel := context.WithTimeout(context.Background(), time.Second*4)
|
ctx, cancel := context.WithTimeout(s.ctx, time.Second*4)
|
||||||
if len(s.tag) > 0 {
|
if len(s.tag) > 0 {
|
||||||
ctx = session.ContextWithInbound(ctx, &session.Inbound{
|
ctx = session.ContextWithInbound(ctx, &session.Inbound{
|
||||||
Tag: s.tag,
|
Tag: s.tag,
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
ips, err := client.QueryIP(ctx, domain, option)
|
ips, err := client.QueryIP(ctx, domain, option)
|
||||||
cancel()
|
cancel()
|
||||||
|
|
||||||
@@ -312,31 +318,7 @@ func (s *Server) queryIPTimeout(idx int, client Client, domain string, option IP
|
|||||||
return ips, err
|
return ips, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// LookupIP implements dns.Client.
|
func (s *Server) lookupStatic(domain string, option dns.IPOption, depth int32) []net.Address {
|
||||||
func (s *Server) LookupIP(domain string) ([]net.IP, error) {
|
|
||||||
return s.lookupIPInternal(domain, IPOption{
|
|
||||||
IPv4Enable: true,
|
|
||||||
IPv6Enable: true,
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
// LookupIPv4 implements dns.IPv4Lookup.
|
|
||||||
func (s *Server) LookupIPv4(domain string) ([]net.IP, error) {
|
|
||||||
return s.lookupIPInternal(domain, IPOption{
|
|
||||||
IPv4Enable: true,
|
|
||||||
IPv6Enable: false,
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
// LookupIPv6 implements dns.IPv6Lookup.
|
|
||||||
func (s *Server) LookupIPv6(domain string) ([]net.IP, error) {
|
|
||||||
return s.lookupIPInternal(domain, IPOption{
|
|
||||||
IPv4Enable: false,
|
|
||||||
IPv6Enable: true,
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
func (s *Server) lookupStatic(domain string, option IPOption, depth int32) []net.Address {
|
|
||||||
ips := s.hosts.LookupIP(domain, option)
|
ips := s.hosts.LookupIP(domain, option)
|
||||||
if ips == nil {
|
if ips == nil {
|
||||||
return nil
|
return nil
|
||||||
@@ -360,13 +342,14 @@ func toNetIP(ips []net.Address) []net.IP {
|
|||||||
return netips
|
return netips
|
||||||
}
|
}
|
||||||
|
|
||||||
func (s *Server) lookupIPInternal(domain string, option IPOption) ([]net.IP, error) {
|
// LookupIP implements dns.Client.
|
||||||
|
func (s *Server) LookupIP(domain string, option dns.IPOption) ([]net.IP, error) {
|
||||||
if domain == "" {
|
if domain == "" {
|
||||||
return nil, newError("empty domain name")
|
return nil, newError("empty domain name")
|
||||||
}
|
}
|
||||||
|
|
||||||
// normalize the FQDN form query
|
// normalize the FQDN form query
|
||||||
if domain[len(domain)-1] == '.' {
|
if strings.HasSuffix(domain, ".") {
|
||||||
domain = domain[:len(domain)-1]
|
domain = domain[:len(domain)-1]
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -403,6 +386,10 @@ func (s *Server) lookupIPInternal(domain string, option IPOption) ([]net.IP, err
|
|||||||
for _, idx := range indices {
|
for _, idx := range indices {
|
||||||
clientIdx := int(s.matcherInfos[idx].clientIdx)
|
clientIdx := int(s.matcherInfos[idx].clientIdx)
|
||||||
matchedClient = s.clients[clientIdx]
|
matchedClient = s.clients[clientIdx]
|
||||||
|
if !option.FakeEnable && strings.EqualFold(matchedClient.Name(), "FakeDNS") {
|
||||||
|
newError("skip DNS resolution for domain ", domain, " at server ", matchedClient.Name()).AtDebug().WriteToLog()
|
||||||
|
continue
|
||||||
|
}
|
||||||
ips, err := s.queryIPTimeout(clientIdx, matchedClient, domain, option)
|
ips, err := s.queryIPTimeout(clientIdx, matchedClient, domain, option)
|
||||||
if len(ips) > 0 {
|
if len(ips) > 0 {
|
||||||
return ips, nil
|
return ips, nil
|
||||||
@@ -422,7 +409,10 @@ func (s *Server) lookupIPInternal(domain string, option IPOption) ([]net.IP, err
|
|||||||
newError("domain ", domain, " at server ", client.Name(), " idx:", idx, " already lookup failed, just ignore").AtDebug().WriteToLog()
|
newError("domain ", domain, " at server ", client.Name(), " idx:", idx, " already lookup failed, just ignore").AtDebug().WriteToLog()
|
||||||
continue
|
continue
|
||||||
}
|
}
|
||||||
|
if !option.FakeEnable && strings.EqualFold(client.Name(), "FakeDNS") {
|
||||||
|
newError("skip DNS resolution for domain ", domain, " at server ", client.Name()).AtDebug().WriteToLog()
|
||||||
|
continue
|
||||||
|
}
|
||||||
ips, err := s.queryIPTimeout(idx, client, domain, option)
|
ips, err := s.queryIPTimeout(idx, client, domain, option)
|
||||||
if len(ips) > 0 {
|
if len(ips) > 0 {
|
||||||
return ips, nil
|
return ips, nil
|
||||||
|
@@ -154,7 +154,11 @@ func TestUDPServerSubnet(t *testing.T) {
|
|||||||
|
|
||||||
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
||||||
|
|
||||||
ips, err := client.LookupIP("google.com")
|
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -209,7 +213,11 @@ func TestUDPServer(t *testing.T) {
|
|||||||
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
||||||
|
|
||||||
{
|
{
|
||||||
ips, err := client.LookupIP("google.com")
|
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -220,7 +228,11 @@ func TestUDPServer(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{
|
{
|
||||||
ips, err := client.LookupIP("facebook.com")
|
ips, err := client.LookupIP("facebook.com", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -231,7 +243,11 @@ func TestUDPServer(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{
|
{
|
||||||
_, err := client.LookupIP("notexist.google.com")
|
_, err := client.LookupIP("notexist.google.com", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err == nil {
|
if err == nil {
|
||||||
t.Fatal("nil error")
|
t.Fatal("nil error")
|
||||||
}
|
}
|
||||||
@@ -241,8 +257,11 @@ func TestUDPServer(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{
|
{
|
||||||
clientv6 := client.(feature_dns.IPv6Lookup)
|
ips, err := client.LookupIP("ipv4only.google.com", feature_dns.IPOption{
|
||||||
ips, err := clientv6.LookupIPv6("ipv4only.google.com")
|
IPv4Enable: false,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != feature_dns.ErrEmptyResponse {
|
if err != feature_dns.ErrEmptyResponse {
|
||||||
t.Fatal("error: ", err)
|
t.Fatal("error: ", err)
|
||||||
}
|
}
|
||||||
@@ -254,7 +273,11 @@ func TestUDPServer(t *testing.T) {
|
|||||||
dnsServer.Shutdown()
|
dnsServer.Shutdown()
|
||||||
|
|
||||||
{
|
{
|
||||||
ips, err := client.LookupIP("google.com")
|
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -331,7 +354,11 @@ func TestPrioritizedDomain(t *testing.T) {
|
|||||||
startTime := time.Now()
|
startTime := time.Now()
|
||||||
|
|
||||||
{
|
{
|
||||||
ips, err := client.LookupIP("google.com")
|
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -390,10 +417,12 @@ func TestUDPServerIPv6(t *testing.T) {
|
|||||||
common.Must(err)
|
common.Must(err)
|
||||||
|
|
||||||
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
||||||
client6 := client.(feature_dns.IPv6Lookup)
|
|
||||||
|
|
||||||
{
|
{
|
||||||
ips, err := client6.LookupIPv6("ipv6.google.com")
|
ips, err := client.LookupIP("ipv6.google.com", feature_dns.IPOption{
|
||||||
|
IPv4Enable: false,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -456,7 +485,11 @@ func TestStaticHostDomain(t *testing.T) {
|
|||||||
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
||||||
|
|
||||||
{
|
{
|
||||||
ips, err := client.LookupIP("example.com")
|
ips, err := client.LookupIP("example.com", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -563,7 +596,11 @@ func TestIPMatch(t *testing.T) {
|
|||||||
startTime := time.Now()
|
startTime := time.Now()
|
||||||
|
|
||||||
{
|
{
|
||||||
ips, err := client.LookupIP("google.com")
|
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -682,7 +719,11 @@ func TestLocalDomain(t *testing.T) {
|
|||||||
startTime := time.Now()
|
startTime := time.Now()
|
||||||
|
|
||||||
{ // Will match dotless:
|
{ // Will match dotless:
|
||||||
ips, err := client.LookupIP("hostname")
|
ips, err := client.LookupIP("hostname", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -693,7 +734,11 @@ func TestLocalDomain(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{ // Will match domain:local
|
{ // Will match domain:local
|
||||||
ips, err := client.LookupIP("hostname.local")
|
ips, err := client.LookupIP("hostname.local", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -704,7 +749,11 @@ func TestLocalDomain(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{ // Will match static ip
|
{ // Will match static ip
|
||||||
ips, err := client.LookupIP("hostnamestatic")
|
ips, err := client.LookupIP("hostnamestatic", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -715,7 +764,11 @@ func TestLocalDomain(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{ // Will match domain replacing
|
{ // Will match domain replacing
|
||||||
ips, err := client.LookupIP("hostnamealias")
|
ips, err := client.LookupIP("hostnamealias", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -726,7 +779,11 @@ func TestLocalDomain(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{ // Will match dotless:localhost, but not expectIPs: 127.0.0.2, 127.0.0.3, then matches at dotless:
|
{ // Will match dotless:localhost, but not expectIPs: 127.0.0.2, 127.0.0.3, then matches at dotless:
|
||||||
ips, err := client.LookupIP("localhost")
|
ips, err := client.LookupIP("localhost", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -737,7 +794,11 @@ func TestLocalDomain(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
|
{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
|
||||||
ips, err := client.LookupIP("localhost-a")
|
ips, err := client.LookupIP("localhost-a", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -748,7 +809,11 @@ func TestLocalDomain(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
|
{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
|
||||||
ips, err := client.LookupIP("localhost-b")
|
ips, err := client.LookupIP("localhost-b", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -759,7 +824,11 @@ func TestLocalDomain(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{ // Will match dotless:
|
{ // Will match dotless:
|
||||||
ips, err := client.LookupIP("Mijia Cloud")
|
ips, err := client.LookupIP("Mijia Cloud", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -921,7 +990,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
|
|||||||
startTime := time.Now()
|
startTime := time.Now()
|
||||||
|
|
||||||
{ // Will match server 1,2 and server 1 returns expected ip
|
{ // Will match server 1,2 and server 1 returns expected ip
|
||||||
ips, err := client.LookupIP("google.com")
|
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -932,8 +1005,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{ // Will match server 1,2 and server 1 returns unexpected ip, then server 2 returns expected one
|
{ // Will match server 1,2 and server 1 returns unexpected ip, then server 2 returns expected one
|
||||||
clientv4 := client.(feature_dns.IPv4Lookup)
|
ips, err := client.LookupIP("ipv6.google.com", feature_dns.IPOption{
|
||||||
ips, err := clientv4.LookupIPv4("ipv6.google.com")
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: false,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -944,7 +1020,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{ // Will match server 3,1,2 and server 3 returns expected one
|
{ // Will match server 3,1,2 and server 3 returns expected one
|
||||||
ips, err := client.LookupIP("api.google.com")
|
ips, err := client.LookupIP("api.google.com", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
@@ -955,7 +1035,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
{ // Will match server 4,3,1,2 and server 4 returns expected one
|
{ // Will match server 4,3,1,2 and server 4 returns expected one
|
||||||
ips, err := client.LookupIP("v2.api.google.com")
|
ips, err := client.LookupIP("v2.api.google.com", feature_dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatal("unexpected error: ", err)
|
t.Fatal("unexpected error: ", err)
|
||||||
}
|
}
|
||||||
|
@@ -7,7 +7,10 @@ import (
|
|||||||
"sync/atomic"
|
"sync/atomic"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
|
"golang.org/x/net/dns/dnsmessage"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
|
"github.com/xtls/xray-core/common/log"
|
||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
"github.com/xtls/xray-core/common/protocol/dns"
|
"github.com/xtls/xray-core/common/protocol/dns"
|
||||||
udp_proto "github.com/xtls/xray-core/common/protocol/udp"
|
udp_proto "github.com/xtls/xray-core/common/protocol/udp"
|
||||||
@@ -17,7 +20,6 @@ import (
|
|||||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||||
"github.com/xtls/xray-core/features/routing"
|
"github.com/xtls/xray-core/features/routing"
|
||||||
"github.com/xtls/xray-core/transport/internet/udp"
|
"github.com/xtls/xray-core/transport/internet/udp"
|
||||||
"golang.org/x/net/dns/dnsmessage"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
type ClassicNameServer struct {
|
type ClassicNameServer struct {
|
||||||
@@ -52,7 +54,7 @@ func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher
|
|||||||
Execute: s.Cleanup,
|
Execute: s.Cleanup,
|
||||||
}
|
}
|
||||||
s.udpServer = udp.NewDispatcher(dispatcher, s.HandleResponse)
|
s.udpServer = udp.NewDispatcher(dispatcher, s.HandleResponse)
|
||||||
newError("DNS: created udp client inited for ", address.NetAddr()).AtInfo().WriteToLog()
|
newError("DNS: created UDP client initialized for ", address.NetAddr()).AtInfo().WriteToLog()
|
||||||
return s
|
return s
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -178,7 +180,7 @@ func (s *ClassicNameServer) addPendingRequest(req *dnsRequest) {
|
|||||||
s.requests[id] = *req
|
s.requests[id] = *req
|
||||||
}
|
}
|
||||||
|
|
||||||
func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option IPOption) {
|
func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option dns_feature.IPOption) {
|
||||||
newError(s.name, " querying DNS for: ", domain).AtDebug().WriteToLog(session.ExportIDToError(ctx))
|
newError(s.name, " querying DNS for: ", domain).AtDebug().WriteToLog(session.ExportIDToError(ctx))
|
||||||
|
|
||||||
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
|
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
|
||||||
@@ -190,14 +192,21 @@ func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option
|
|||||||
if inbound := session.InboundFromContext(ctx); inbound != nil {
|
if inbound := session.InboundFromContext(ctx); inbound != nil {
|
||||||
udpCtx = session.ContextWithInbound(udpCtx, inbound)
|
udpCtx = session.ContextWithInbound(udpCtx, inbound)
|
||||||
}
|
}
|
||||||
|
|
||||||
udpCtx = session.ContextWithContent(udpCtx, &session.Content{
|
udpCtx = session.ContextWithContent(udpCtx, &session.Content{
|
||||||
Protocol: "dns",
|
Protocol: "dns",
|
||||||
})
|
})
|
||||||
|
udpCtx = log.ContextWithAccessMessage(udpCtx, &log.AccessMessage{
|
||||||
|
From: "DNS",
|
||||||
|
To: s.address,
|
||||||
|
Status: log.AccessAccepted,
|
||||||
|
Reason: "",
|
||||||
|
})
|
||||||
s.udpServer.Dispatch(udpCtx, s.address, b)
|
s.udpServer.Dispatch(udpCtx, s.address, b)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
func (s *ClassicNameServer) findIPsForDomain(domain string, option IPOption) ([]net.IP, error) {
|
func (s *ClassicNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
|
||||||
s.RLock()
|
s.RLock()
|
||||||
record, found := s.ips[domain]
|
record, found := s.ips[domain]
|
||||||
s.RUnlock()
|
s.RUnlock()
|
||||||
@@ -235,12 +244,14 @@ func (s *ClassicNameServer) findIPsForDomain(domain string, option IPOption) ([]
|
|||||||
return nil, dns_feature.ErrEmptyResponse
|
return nil, dns_feature.ErrEmptyResponse
|
||||||
}
|
}
|
||||||
|
|
||||||
func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
|
// QueryIP implements Server.
|
||||||
|
func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, error) {
|
||||||
fqdn := Fqdn(domain)
|
fqdn := Fqdn(domain)
|
||||||
|
|
||||||
ips, err := s.findIPsForDomain(fqdn, option)
|
ips, err := s.findIPsForDomain(fqdn, option)
|
||||||
if err != errRecordNotFound {
|
if err != errRecordNotFound {
|
||||||
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
|
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
|
||||||
|
log.Record(&log.DNSLog{s.name, domain, ips, log.DNSCacheHit, 0, err})
|
||||||
return ips, err
|
return ips, err
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -271,10 +282,12 @@ func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option I
|
|||||||
close(done)
|
close(done)
|
||||||
}()
|
}()
|
||||||
s.sendQuery(ctx, fqdn, option)
|
s.sendQuery(ctx, fqdn, option)
|
||||||
|
start := time.Now()
|
||||||
|
|
||||||
for {
|
for {
|
||||||
ips, err := s.findIPsForDomain(fqdn, option)
|
ips, err := s.findIPsForDomain(fqdn, option)
|
||||||
if err != errRecordNotFound {
|
if err != errRecordNotFound {
|
||||||
|
log.Record(&log.DNSLog{s.name, domain, ips, log.DNSQueried, time.Since(start), err})
|
||||||
return ips, err
|
return ips, err
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -44,7 +44,7 @@ func (s *service) Register(server *grpc.Server) {
|
|||||||
RegisterLoggerServiceServer(server, ls)
|
RegisterLoggerServiceServer(server, ls)
|
||||||
|
|
||||||
// For compatibility purposes
|
// For compatibility purposes
|
||||||
vCoreDesc := _LoggerService_serviceDesc
|
vCoreDesc := LoggerService_ServiceDesc
|
||||||
vCoreDesc.ServiceName = "v2ray.core.app.log.command.LoggerService"
|
vCoreDesc.ServiceName = "v2ray.core.app.log.command.LoggerService"
|
||||||
server.RegisterService(&vCoreDesc, ls)
|
server.RegisterService(&vCoreDesc, ls)
|
||||||
}
|
}
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/log/command/config.proto
|
// source: app/log/command/config.proto
|
||||||
|
|
||||||
package command
|
package command
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
reflect "reflect"
|
reflect "reflect"
|
||||||
@@ -21,10 +20,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
type Config struct {
|
type Config struct {
|
||||||
state protoimpl.MessageState
|
state protoimpl.MessageState
|
||||||
sizeCache protoimpl.SizeCache
|
sizeCache protoimpl.SizeCache
|
||||||
|
@@ -11,6 +11,7 @@ import (
|
|||||||
|
|
||||||
// This is a compile-time assertion to ensure that this generated file
|
// This is a compile-time assertion to ensure that this generated file
|
||||||
// is compatible with the grpc package it is being compiled against.
|
// is compatible with the grpc package it is being compiled against.
|
||||||
|
// Requires gRPC-Go v1.32.0 or later.
|
||||||
const _ = grpc.SupportPackageIsVersion7
|
const _ = grpc.SupportPackageIsVersion7
|
||||||
|
|
||||||
// LoggerServiceClient is the client API for LoggerService service.
|
// LoggerServiceClient is the client API for LoggerService service.
|
||||||
@@ -62,7 +63,7 @@ type UnsafeLoggerServiceServer interface {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func RegisterLoggerServiceServer(s grpc.ServiceRegistrar, srv LoggerServiceServer) {
|
func RegisterLoggerServiceServer(s grpc.ServiceRegistrar, srv LoggerServiceServer) {
|
||||||
s.RegisterService(&_LoggerService_serviceDesc, srv)
|
s.RegisterService(&LoggerService_ServiceDesc, srv)
|
||||||
}
|
}
|
||||||
|
|
||||||
func _LoggerService_RestartLogger_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
|
func _LoggerService_RestartLogger_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
|
||||||
@@ -83,7 +84,10 @@ func _LoggerService_RestartLogger_Handler(srv interface{}, ctx context.Context,
|
|||||||
return interceptor(ctx, in, info, handler)
|
return interceptor(ctx, in, info, handler)
|
||||||
}
|
}
|
||||||
|
|
||||||
var _LoggerService_serviceDesc = grpc.ServiceDesc{
|
// LoggerService_ServiceDesc is the grpc.ServiceDesc for LoggerService service.
|
||||||
|
// It's only intended for direct use with grpc.RegisterService,
|
||||||
|
// and not to be introspected or modified (even as a copy)
|
||||||
|
var LoggerService_ServiceDesc = grpc.ServiceDesc{
|
||||||
ServiceName: "xray.app.log.command.LoggerService",
|
ServiceName: "xray.app.log.command.LoggerService",
|
||||||
HandlerType: (*LoggerServiceServer)(nil),
|
HandlerType: (*LoggerServiceServer)(nil),
|
||||||
Methods: []grpc.MethodDesc{
|
Methods: []grpc.MethodDesc{
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/log/config.proto
|
// source: app/log/config.proto
|
||||||
|
|
||||||
package log
|
package log
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
log "github.com/xtls/xray-core/common/log"
|
log "github.com/xtls/xray-core/common/log"
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
@@ -22,10 +21,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
type LogType int32
|
type LogType int32
|
||||||
|
|
||||||
const (
|
const (
|
||||||
@@ -88,6 +83,7 @@ type Config struct {
|
|||||||
ErrorLogPath string `protobuf:"bytes,3,opt,name=error_log_path,json=errorLogPath,proto3" json:"error_log_path,omitempty"`
|
ErrorLogPath string `protobuf:"bytes,3,opt,name=error_log_path,json=errorLogPath,proto3" json:"error_log_path,omitempty"`
|
||||||
AccessLogType LogType `protobuf:"varint,4,opt,name=access_log_type,json=accessLogType,proto3,enum=xray.app.log.LogType" json:"access_log_type,omitempty"`
|
AccessLogType LogType `protobuf:"varint,4,opt,name=access_log_type,json=accessLogType,proto3,enum=xray.app.log.LogType" json:"access_log_type,omitempty"`
|
||||||
AccessLogPath string `protobuf:"bytes,5,opt,name=access_log_path,json=accessLogPath,proto3" json:"access_log_path,omitempty"`
|
AccessLogPath string `protobuf:"bytes,5,opt,name=access_log_path,json=accessLogPath,proto3" json:"access_log_path,omitempty"`
|
||||||
|
EnableDnsLog bool `protobuf:"varint,6,opt,name=enable_dns_log,json=enableDnsLog,proto3" json:"enable_dns_log,omitempty"`
|
||||||
}
|
}
|
||||||
|
|
||||||
func (x *Config) Reset() {
|
func (x *Config) Reset() {
|
||||||
@@ -133,7 +129,7 @@ func (x *Config) GetErrorLogLevel() log.Severity {
|
|||||||
if x != nil {
|
if x != nil {
|
||||||
return x.ErrorLogLevel
|
return x.ErrorLogLevel
|
||||||
}
|
}
|
||||||
return log.Severity_Unknown
|
return log.Severity(0)
|
||||||
}
|
}
|
||||||
|
|
||||||
func (x *Config) GetErrorLogPath() string {
|
func (x *Config) GetErrorLogPath() string {
|
||||||
@@ -157,13 +153,20 @@ func (x *Config) GetAccessLogPath() string {
|
|||||||
return ""
|
return ""
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func (x *Config) GetEnableDnsLog() bool {
|
||||||
|
if x != nil {
|
||||||
|
return x.EnableDnsLog
|
||||||
|
}
|
||||||
|
return false
|
||||||
|
}
|
||||||
|
|
||||||
var File_app_log_config_proto protoreflect.FileDescriptor
|
var File_app_log_config_proto protoreflect.FileDescriptor
|
||||||
|
|
||||||
var file_app_log_config_proto_rawDesc = []byte{
|
var file_app_log_config_proto_rawDesc = []byte{
|
||||||
0x0a, 0x14, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0x2f, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
0x0a, 0x14, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0x2f, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
||||||
0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x0c, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
|
0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x0c, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
|
||||||
0x2e, 0x6c, 0x6f, 0x67, 0x1a, 0x14, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2f, 0x6c, 0x6f, 0x67,
|
0x2e, 0x6c, 0x6f, 0x67, 0x1a, 0x14, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2f, 0x6c, 0x6f, 0x67,
|
||||||
0x2f, 0x6c, 0x6f, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0x95, 0x02, 0x0a, 0x06, 0x43,
|
0x2f, 0x6c, 0x6f, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xbb, 0x02, 0x0a, 0x06, 0x43,
|
||||||
0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x3b, 0x0a, 0x0e, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x5f, 0x6c,
|
0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x3b, 0x0a, 0x0e, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x5f, 0x6c,
|
||||||
0x6f, 0x67, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x15, 0x2e,
|
0x6f, 0x67, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x15, 0x2e,
|
||||||
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x2e, 0x4c, 0x6f, 0x67,
|
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x2e, 0x4c, 0x6f, 0x67,
|
||||||
@@ -181,15 +184,17 @@ var file_app_log_config_proto_rawDesc = []byte{
|
|||||||
0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x26, 0x0a, 0x0f, 0x61, 0x63,
|
0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x26, 0x0a, 0x0f, 0x61, 0x63,
|
||||||
0x63, 0x65, 0x73, 0x73, 0x5f, 0x6c, 0x6f, 0x67, 0x5f, 0x70, 0x61, 0x74, 0x68, 0x18, 0x05, 0x20,
|
0x63, 0x65, 0x73, 0x73, 0x5f, 0x6c, 0x6f, 0x67, 0x5f, 0x70, 0x61, 0x74, 0x68, 0x18, 0x05, 0x20,
|
||||||
0x01, 0x28, 0x09, 0x52, 0x0d, 0x61, 0x63, 0x63, 0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x50, 0x61,
|
0x01, 0x28, 0x09, 0x52, 0x0d, 0x61, 0x63, 0x63, 0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x50, 0x61,
|
||||||
0x74, 0x68, 0x2a, 0x35, 0x0a, 0x07, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08, 0x0a,
|
0x74, 0x68, 0x12, 0x24, 0x0a, 0x0e, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x5f, 0x64, 0x6e, 0x73,
|
||||||
0x04, 0x4e, 0x6f, 0x6e, 0x65, 0x10, 0x00, 0x12, 0x0b, 0x0a, 0x07, 0x43, 0x6f, 0x6e, 0x73, 0x6f,
|
0x5f, 0x6c, 0x6f, 0x67, 0x18, 0x06, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x65, 0x6e, 0x61, 0x62,
|
||||||
0x6c, 0x65, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x69, 0x6c, 0x65, 0x10, 0x02, 0x12, 0x09,
|
0x6c, 0x65, 0x44, 0x6e, 0x73, 0x4c, 0x6f, 0x67, 0x2a, 0x35, 0x0a, 0x07, 0x4c, 0x6f, 0x67, 0x54,
|
||||||
0x0a, 0x05, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x10, 0x03, 0x42, 0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d,
|
0x79, 0x70, 0x65, 0x12, 0x08, 0x0a, 0x04, 0x4e, 0x6f, 0x6e, 0x65, 0x10, 0x00, 0x12, 0x0b, 0x0a,
|
||||||
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x50, 0x01, 0x5a,
|
0x07, 0x43, 0x6f, 0x6e, 0x73, 0x6f, 0x6c, 0x65, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x69,
|
||||||
0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73,
|
0x6c, 0x65, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x10, 0x03, 0x42,
|
||||||
0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6c,
|
0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e,
|
||||||
0x6f, 0x67, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x4c, 0x6f,
|
0x6c, 0x6f, 0x67, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f,
|
||||||
0x67, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65,
|
||||||
|
0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e,
|
||||||
|
0x41, 0x70, 0x70, 0x2e, 0x4c, 0x6f, 0x67, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||||
}
|
}
|
||||||
|
|
||||||
var (
|
var (
|
||||||
|
@@ -22,4 +22,5 @@ message Config {
|
|||||||
|
|
||||||
LogType access_log_type = 4;
|
LogType access_log_type = 4;
|
||||||
string access_log_path = 5;
|
string access_log_path = 5;
|
||||||
|
bool enable_dns_log = 6;
|
||||||
}
|
}
|
||||||
|
@@ -17,6 +17,7 @@ type Instance struct {
|
|||||||
accessLogger log.Handler
|
accessLogger log.Handler
|
||||||
errorLogger log.Handler
|
errorLogger log.Handler
|
||||||
active bool
|
active bool
|
||||||
|
dns bool
|
||||||
}
|
}
|
||||||
|
|
||||||
// New creates a new log.Instance based on the given config.
|
// New creates a new log.Instance based on the given config.
|
||||||
@@ -24,6 +25,7 @@ func New(ctx context.Context, config *Config) (*Instance, error) {
|
|||||||
g := &Instance{
|
g := &Instance{
|
||||||
config: config,
|
config: config,
|
||||||
active: false,
|
active: false,
|
||||||
|
dns: config.EnableDnsLog,
|
||||||
}
|
}
|
||||||
log.RegisterHandler(g)
|
log.RegisterHandler(g)
|
||||||
|
|
||||||
@@ -103,6 +105,10 @@ func (g *Instance) Handle(msg log.Message) {
|
|||||||
if g.accessLogger != nil {
|
if g.accessLogger != nil {
|
||||||
g.accessLogger.Handle(msg)
|
g.accessLogger.Handle(msg)
|
||||||
}
|
}
|
||||||
|
case *log.DNSLog:
|
||||||
|
if g.dns && g.accessLogger != nil {
|
||||||
|
g.accessLogger.Handle(msg)
|
||||||
|
}
|
||||||
case *log.GeneralMessage:
|
case *log.GeneralMessage:
|
||||||
if g.errorLogger != nil && msg.Severity <= g.config.ErrorLogLevel {
|
if g.errorLogger != nil && msg.Severity <= g.config.ErrorLogLevel {
|
||||||
g.errorLogger.Handle(msg)
|
g.errorLogger.Handle(msg)
|
||||||
|
@@ -5,6 +5,7 @@ import (
|
|||||||
"testing"
|
"testing"
|
||||||
|
|
||||||
"github.com/golang/mock/gomock"
|
"github.com/golang/mock/gomock"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/app/log"
|
"github.com/xtls/xray-core/app/log"
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
clog "github.com/xtls/xray-core/common/log"
|
clog "github.com/xtls/xray-core/common/log"
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/policy/config.proto
|
// source: app/policy/config.proto
|
||||||
|
|
||||||
package policy
|
package policy
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
reflect "reflect"
|
reflect "reflect"
|
||||||
@@ -21,10 +20,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
type Second struct {
|
type Second struct {
|
||||||
state protoimpl.MessageState
|
state protoimpl.MessageState
|
||||||
sizeCache protoimpl.SizeCache
|
sizeCache protoimpl.SizeCache
|
||||||
|
@@ -140,7 +140,7 @@ func (s *service) Register(server *grpc.Server) {
|
|||||||
RegisterHandlerServiceServer(server, hs)
|
RegisterHandlerServiceServer(server, hs)
|
||||||
|
|
||||||
// For compatibility purposes
|
// For compatibility purposes
|
||||||
vCoreDesc := _HandlerService_serviceDesc
|
vCoreDesc := HandlerService_ServiceDesc
|
||||||
vCoreDesc.ServiceName = "v2ray.core.app.proxyman.command.HandlerService"
|
vCoreDesc.ServiceName = "v2ray.core.app.proxyman.command.HandlerService"
|
||||||
server.RegisterService(&vCoreDesc, hs)
|
server.RegisterService(&vCoreDesc, hs)
|
||||||
}
|
}
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/proxyman/command/command.proto
|
// source: app/proxyman/command/command.proto
|
||||||
|
|
||||||
package command
|
package command
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
protocol "github.com/xtls/xray-core/common/protocol"
|
protocol "github.com/xtls/xray-core/common/protocol"
|
||||||
serial "github.com/xtls/xray-core/common/serial"
|
serial "github.com/xtls/xray-core/common/serial"
|
||||||
core "github.com/xtls/xray-core/core"
|
core "github.com/xtls/xray-core/core"
|
||||||
@@ -24,10 +23,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
type AddUserOperation struct {
|
type AddUserOperation struct {
|
||||||
state protoimpl.MessageState
|
state protoimpl.MessageState
|
||||||
sizeCache protoimpl.SizeCache
|
sizeCache protoimpl.SizeCache
|
||||||
|
@@ -11,6 +11,7 @@ import (
|
|||||||
|
|
||||||
// This is a compile-time assertion to ensure that this generated file
|
// This is a compile-time assertion to ensure that this generated file
|
||||||
// is compatible with the grpc package it is being compiled against.
|
// is compatible with the grpc package it is being compiled against.
|
||||||
|
// Requires gRPC-Go v1.32.0 or later.
|
||||||
const _ = grpc.SupportPackageIsVersion7
|
const _ = grpc.SupportPackageIsVersion7
|
||||||
|
|
||||||
// HandlerServiceClient is the client API for HandlerService service.
|
// HandlerServiceClient is the client API for HandlerService service.
|
||||||
@@ -132,7 +133,7 @@ type UnsafeHandlerServiceServer interface {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func RegisterHandlerServiceServer(s grpc.ServiceRegistrar, srv HandlerServiceServer) {
|
func RegisterHandlerServiceServer(s grpc.ServiceRegistrar, srv HandlerServiceServer) {
|
||||||
s.RegisterService(&_HandlerService_serviceDesc, srv)
|
s.RegisterService(&HandlerService_ServiceDesc, srv)
|
||||||
}
|
}
|
||||||
|
|
||||||
func _HandlerService_AddInbound_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
|
func _HandlerService_AddInbound_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
|
||||||
@@ -243,7 +244,10 @@ func _HandlerService_AlterOutbound_Handler(srv interface{}, ctx context.Context,
|
|||||||
return interceptor(ctx, in, info, handler)
|
return interceptor(ctx, in, info, handler)
|
||||||
}
|
}
|
||||||
|
|
||||||
var _HandlerService_serviceDesc = grpc.ServiceDesc{
|
// HandlerService_ServiceDesc is the grpc.ServiceDesc for HandlerService service.
|
||||||
|
// It's only intended for direct use with grpc.RegisterService,
|
||||||
|
// and not to be introspected or modified (even as a copy)
|
||||||
|
var HandlerService_ServiceDesc = grpc.ServiceDesc{
|
||||||
ServiceName: "xray.app.proxyman.command.HandlerService",
|
ServiceName: "xray.app.proxyman.command.HandlerService",
|
||||||
HandlerType: (*HandlerServiceServer)(nil),
|
HandlerType: (*HandlerServiceServer)(nil),
|
||||||
Methods: []grpc.MethodDesc{
|
Methods: []grpc.MethodDesc{
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/proxyman/config.proto
|
// source: app/proxyman/config.proto
|
||||||
|
|
||||||
package proxyman
|
package proxyman
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
net "github.com/xtls/xray-core/common/net"
|
net "github.com/xtls/xray-core/common/net"
|
||||||
serial "github.com/xtls/xray-core/common/serial"
|
serial "github.com/xtls/xray-core/common/serial"
|
||||||
internet "github.com/xtls/xray-core/transport/internet"
|
internet "github.com/xtls/xray-core/transport/internet"
|
||||||
@@ -24,10 +23,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
type KnownProtocols int32
|
type KnownProtocols int32
|
||||||
|
|
||||||
const (
|
const (
|
||||||
@@ -239,8 +234,12 @@ type SniffingConfig struct {
|
|||||||
// Whether or not to enable content sniffing on an inbound connection.
|
// Whether or not to enable content sniffing on an inbound connection.
|
||||||
Enabled bool `protobuf:"varint,1,opt,name=enabled,proto3" json:"enabled,omitempty"`
|
Enabled bool `protobuf:"varint,1,opt,name=enabled,proto3" json:"enabled,omitempty"`
|
||||||
// Override target destination if sniff'ed protocol is in the given list.
|
// Override target destination if sniff'ed protocol is in the given list.
|
||||||
// Supported values are "http", "tls".
|
// Supported values are "http", "tls", "fakedns".
|
||||||
DestinationOverride []string `protobuf:"bytes,2,rep,name=destination_override,json=destinationOverride,proto3" json:"destination_override,omitempty"`
|
DestinationOverride []string `protobuf:"bytes,2,rep,name=destination_override,json=destinationOverride,proto3" json:"destination_override,omitempty"`
|
||||||
|
DomainsExcluded []string `protobuf:"bytes,3,rep,name=domains_excluded,json=domainsExcluded,proto3" json:"domains_excluded,omitempty"`
|
||||||
|
// Whether should only try to sniff metadata without waiting for client input.
|
||||||
|
// Can be used to support SMTP like protocol where server send the first message.
|
||||||
|
MetadataOnly bool `protobuf:"varint,4,opt,name=metadata_only,json=metadataOnly,proto3" json:"metadata_only,omitempty"`
|
||||||
}
|
}
|
||||||
|
|
||||||
func (x *SniffingConfig) Reset() {
|
func (x *SniffingConfig) Reset() {
|
||||||
@@ -289,6 +288,20 @@ func (x *SniffingConfig) GetDestinationOverride() []string {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func (x *SniffingConfig) GetDomainsExcluded() []string {
|
||||||
|
if x != nil {
|
||||||
|
return x.DomainsExcluded
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (x *SniffingConfig) GetMetadataOnly() bool {
|
||||||
|
if x != nil {
|
||||||
|
return x.MetadataOnly
|
||||||
|
}
|
||||||
|
return false
|
||||||
|
}
|
||||||
|
|
||||||
type ReceiverConfig struct {
|
type ReceiverConfig struct {
|
||||||
state protoimpl.MessageState
|
state protoimpl.MessageState
|
||||||
sizeCache protoimpl.SizeCache
|
sizeCache protoimpl.SizeCache
|
||||||
@@ -756,92 +769,97 @@ var file_app_proxyman_config_proto_rawDesc = []byte{
|
|||||||
0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x22, 0x2c, 0x0a, 0x04, 0x54, 0x79, 0x70, 0x65, 0x12,
|
0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x22, 0x2c, 0x0a, 0x04, 0x54, 0x79, 0x70, 0x65, 0x12,
|
||||||
0x0a, 0x0a, 0x06, 0x41, 0x6c, 0x77, 0x61, 0x79, 0x73, 0x10, 0x00, 0x12, 0x0a, 0x0a, 0x06, 0x52,
|
0x0a, 0x0a, 0x06, 0x41, 0x6c, 0x77, 0x61, 0x79, 0x73, 0x10, 0x00, 0x12, 0x0a, 0x0a, 0x06, 0x52,
|
||||||
0x61, 0x6e, 0x64, 0x6f, 0x6d, 0x10, 0x01, 0x12, 0x0c, 0x0a, 0x08, 0x45, 0x78, 0x74, 0x65, 0x72,
|
0x61, 0x6e, 0x64, 0x6f, 0x6d, 0x10, 0x01, 0x12, 0x0c, 0x0a, 0x08, 0x45, 0x78, 0x74, 0x65, 0x72,
|
||||||
0x6e, 0x61, 0x6c, 0x10, 0x02, 0x22, 0x5d, 0x0a, 0x0e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e,
|
0x6e, 0x61, 0x6c, 0x10, 0x02, 0x22, 0xad, 0x01, 0x0a, 0x0e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69,
|
||||||
0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c,
|
0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62,
|
||||||
0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65,
|
0x6c, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c,
|
||||||
0x64, 0x12, 0x31, 0x0a, 0x14, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e,
|
0x65, 0x64, 0x12, 0x31, 0x0a, 0x14, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f,
|
||||||
0x5f, 0x6f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09, 0x52,
|
0x6e, 0x5f, 0x6f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09,
|
||||||
0x13, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x4f, 0x76, 0x65, 0x72,
|
0x52, 0x13, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x4f, 0x76, 0x65,
|
||||||
0x72, 0x69, 0x64, 0x65, 0x22, 0x90, 0x04, 0x0a, 0x0e, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65,
|
0x72, 0x72, 0x69, 0x64, 0x65, 0x12, 0x29, 0x0a, 0x10, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x73,
|
||||||
0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x39, 0x0a, 0x0a, 0x70, 0x6f, 0x72, 0x74, 0x5f,
|
0x5f, 0x65, 0x78, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x64, 0x18, 0x03, 0x20, 0x03, 0x28, 0x09, 0x52,
|
||||||
0x72, 0x61, 0x6e, 0x67, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x78, 0x72,
|
0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x73, 0x45, 0x78, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x64,
|
||||||
0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f,
|
0x12, 0x23, 0x0a, 0x0d, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x6f, 0x6e, 0x6c,
|
||||||
0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x52, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e,
|
0x79, 0x18, 0x04, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74,
|
||||||
0x67, 0x65, 0x12, 0x33, 0x0a, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x18, 0x02, 0x20, 0x01,
|
0x61, 0x4f, 0x6e, 0x6c, 0x79, 0x22, 0x90, 0x04, 0x0a, 0x0e, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76,
|
||||||
0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e,
|
0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x39, 0x0a, 0x0a, 0x70, 0x6f, 0x72, 0x74,
|
||||||
0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52,
|
0x5f, 0x72, 0x61, 0x6e, 0x67, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x78,
|
||||||
0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x12, 0x56, 0x0a, 0x13, 0x61, 0x6c, 0x6c, 0x6f, 0x63,
|
0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50,
|
||||||
0x61, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x03,
|
0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x52, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x52, 0x61,
|
||||||
0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e,
|
0x6e, 0x67, 0x65, 0x12, 0x33, 0x0a, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x18, 0x02, 0x20,
|
||||||
0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74,
|
0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f,
|
||||||
0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x12, 0x61, 0x6c, 0x6c,
|
0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
|
||||||
0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12,
|
0x52, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x12, 0x56, 0x0a, 0x13, 0x61, 0x6c, 0x6c, 0x6f,
|
||||||
0x4e, 0x0a, 0x0f, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e,
|
0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18,
|
||||||
0x67, 0x73, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
|
0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
|
||||||
0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e,
|
0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61,
|
||||||
0x65, 0x74, 0x2e, 0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52,
|
0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x12, 0x61, 0x6c,
|
||||||
0x0e, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12,
|
0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
|
||||||
0x40, 0x0a, 0x1c, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x5f, 0x6f, 0x72, 0x69, 0x67, 0x69,
|
0x12, 0x4e, 0x0a, 0x0f, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69,
|
||||||
0x6e, 0x61, 0x6c, 0x5f, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18,
|
0x6e, 0x67, 0x73, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79,
|
||||||
0x05, 0x20, 0x01, 0x28, 0x08, 0x52, 0x1a, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x4f, 0x72,
|
0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72,
|
||||||
0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x44, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f,
|
0x6e, 0x65, 0x74, 0x2e, 0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
||||||
0x6e, 0x12, 0x4e, 0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6f, 0x76, 0x65, 0x72,
|
0x52, 0x0e, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
|
||||||
0x72, 0x69, 0x64, 0x65, 0x18, 0x07, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61,
|
0x12, 0x40, 0x0a, 0x1c, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x5f, 0x6f, 0x72, 0x69, 0x67,
|
||||||
0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4b,
|
0x69, 0x6e, 0x61, 0x6c, 0x5f, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e,
|
||||||
0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x42, 0x02, 0x18,
|
0x18, 0x05, 0x20, 0x01, 0x28, 0x08, 0x52, 0x1a, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x4f,
|
||||||
0x01, 0x52, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64,
|
0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x44, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69,
|
||||||
0x65, 0x12, 0x4e, 0x0a, 0x11, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x5f, 0x73, 0x65,
|
0x6f, 0x6e, 0x12, 0x4e, 0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6f, 0x76, 0x65,
|
||||||
0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x21, 0x2e, 0x78,
|
0x72, 0x72, 0x69, 0x64, 0x65, 0x18, 0x07, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x21, 0x2e, 0x78, 0x72,
|
||||||
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e,
|
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e,
|
||||||
0x2e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52,
|
0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x42, 0x02,
|
||||||
0x10, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67,
|
0x18, 0x01, 0x52, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4f, 0x76, 0x65, 0x72, 0x72, 0x69,
|
||||||
0x73, 0x4a, 0x04, 0x08, 0x06, 0x10, 0x07, 0x22, 0xc0, 0x01, 0x0a, 0x14, 0x49, 0x6e, 0x62, 0x6f,
|
0x64, 0x65, 0x12, 0x4e, 0x0a, 0x11, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x5f, 0x73,
|
||||||
0x75, 0x6e, 0x64, 0x48, 0x61, 0x6e, 0x64, 0x6c, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x21, 0x2e,
|
||||||
0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74,
|
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61,
|
||||||
0x61, 0x67, 0x12, 0x4d, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x5f, 0x73,
|
0x6e, 0x2e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
||||||
0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e,
|
0x52, 0x10, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e,
|
||||||
0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69,
|
0x67, 0x73, 0x4a, 0x04, 0x08, 0x06, 0x10, 0x07, 0x22, 0xc0, 0x01, 0x0a, 0x14, 0x49, 0x6e, 0x62,
|
||||||
0x61, 0x6c, 0x2e, 0x54, 0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52,
|
0x6f, 0x75, 0x6e, 0x64, 0x48, 0x61, 0x6e, 0x64, 0x6c, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69,
|
||||||
0x10, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67,
|
0x67, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03,
|
||||||
0x73, 0x12, 0x47, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69,
|
0x74, 0x61, 0x67, 0x12, 0x4d, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x5f,
|
||||||
0x6e, 0x67, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79,
|
0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20,
|
||||||
0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e, 0x54,
|
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72,
|
||||||
0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0d, 0x70, 0x72, 0x6f,
|
0x69, 0x61, 0x6c, 0x2e, 0x54, 0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65,
|
||||||
0x78, 0x79, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x10, 0x0a, 0x0e, 0x4f, 0x75,
|
0x52, 0x10, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e,
|
||||||
0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x22, 0xb0, 0x02, 0x0a,
|
0x67, 0x73, 0x12, 0x47, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74,
|
||||||
0x0c, 0x53, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x2d, 0x0a,
|
0x69, 0x6e, 0x67, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61,
|
||||||
0x03, 0x76, 0x69, 0x61, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61,
|
0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e,
|
||||||
0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f,
|
0x54, 0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0d, 0x70, 0x72,
|
||||||
0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x03, 0x76, 0x69, 0x61, 0x12, 0x4e, 0x0a, 0x0f,
|
0x6f, 0x78, 0x79, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x10, 0x0a, 0x0e, 0x4f,
|
||||||
0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18,
|
0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x22, 0xb0, 0x02,
|
||||||
0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61,
|
0x0a, 0x0c, 0x53, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x2d,
|
||||||
|
0x0a, 0x03, 0x76, 0x69, 0x61, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72,
|
||||||
|
0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50,
|
||||||
|
0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x03, 0x76, 0x69, 0x61, 0x12, 0x4e, 0x0a,
|
||||||
|
0x0f, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
|
||||||
|
0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72,
|
||||||
|
0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74,
|
||||||
|
0x2e, 0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73,
|
||||||
|
0x74, 0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x4b, 0x0a,
|
||||||
|
0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18,
|
||||||
|
0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x24, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61,
|
||||||
0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e,
|
0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e,
|
||||||
0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74,
|
0x50, 0x72, 0x6f, 0x78, 0x79, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0d, 0x70, 0x72, 0x6f,
|
||||||
0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x4b, 0x0a, 0x0e,
|
0x78, 0x79, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x54, 0x0a, 0x12, 0x6d, 0x75,
|
||||||
0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x03,
|
0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
|
||||||
0x20, 0x01, 0x28, 0x0b, 0x32, 0x24, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e,
|
0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
|
||||||
0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x50,
|
0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4d, 0x75, 0x6c, 0x74, 0x69,
|
||||||
0x72, 0x6f, 0x78, 0x79, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78,
|
0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x11, 0x6d,
|
||||||
0x79, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x54, 0x0a, 0x12, 0x6d, 0x75, 0x6c,
|
0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
|
||||||
0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18,
|
0x22, 0x50, 0x0a, 0x12, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67,
|
||||||
0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
|
0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65,
|
||||||
0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70,
|
0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64,
|
||||||
0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x11, 0x6d, 0x75,
|
0x12, 0x20, 0x0a, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x18,
|
||||||
0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22,
|
0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e,
|
||||||
0x50, 0x0a, 0x12, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43,
|
0x63, 0x79, 0x2a, 0x23, 0x0a, 0x0e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f,
|
||||||
0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64,
|
0x63, 0x6f, 0x6c, 0x73, 0x12, 0x08, 0x0a, 0x04, 0x48, 0x54, 0x54, 0x50, 0x10, 0x00, 0x12, 0x07,
|
||||||
0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x12,
|
0x0a, 0x03, 0x54, 0x4c, 0x53, 0x10, 0x01, 0x42, 0x55, 0x0a, 0x15, 0x63, 0x6f, 0x6d, 0x2e, 0x78,
|
||||||
0x20, 0x0a, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x18, 0x02,
|
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e,
|
||||||
0x20, 0x01, 0x28, 0x0d, 0x52, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63,
|
0x50, 0x01, 0x5a, 0x26, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78,
|
||||||
0x79, 0x2a, 0x23, 0x0a, 0x0e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63,
|
0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70,
|
||||||
0x6f, 0x6c, 0x73, 0x12, 0x08, 0x0a, 0x04, 0x48, 0x54, 0x54, 0x50, 0x10, 0x00, 0x12, 0x07, 0x0a,
|
0x70, 0x2f, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0xaa, 0x02, 0x11, 0x58, 0x72, 0x61,
|
||||||
0x03, 0x54, 0x4c, 0x53, 0x10, 0x01, 0x42, 0x55, 0x0a, 0x15, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72,
|
0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x62, 0x06,
|
||||||
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x50,
|
0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||||
0x01, 0x5a, 0x26, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74,
|
|
||||||
0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70,
|
|
||||||
0x2f, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0xaa, 0x02, 0x11, 0x58, 0x72, 0x61, 0x79,
|
|
||||||
0x2e, 0x41, 0x70, 0x70, 0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x62, 0x06, 0x70,
|
|
||||||
0x72, 0x6f, 0x74, 0x6f, 0x33,
|
|
||||||
}
|
}
|
||||||
|
|
||||||
var (
|
var (
|
||||||
|
@@ -54,8 +54,13 @@ message SniffingConfig {
|
|||||||
bool enabled = 1;
|
bool enabled = 1;
|
||||||
|
|
||||||
// Override target destination if sniff'ed protocol is in the given list.
|
// Override target destination if sniff'ed protocol is in the given list.
|
||||||
// Supported values are "http", "tls".
|
// Supported values are "http", "tls", "fakedns".
|
||||||
repeated string destination_override = 2;
|
repeated string destination_override = 2;
|
||||||
|
repeated string domains_excluded = 3;
|
||||||
|
|
||||||
|
// Whether should only try to sniff metadata without waiting for client input.
|
||||||
|
// Can be used to support SMTP like protocol where server send the first message.
|
||||||
|
bool metadata_only = 4;
|
||||||
}
|
}
|
||||||
|
|
||||||
message ReceiverConfig {
|
message ReceiverConfig {
|
||||||
|
@@ -133,9 +133,11 @@ func NewAlwaysOnInboundHandler(ctx context.Context, tag string, receiverConfig *
|
|||||||
address: address,
|
address: address,
|
||||||
port: net.Port(port),
|
port: net.Port(port),
|
||||||
dispatcher: h.mux,
|
dispatcher: h.mux,
|
||||||
|
sniffingConfig: receiverConfig.GetEffectiveSniffingSettings(),
|
||||||
uplinkCounter: uplinkCounter,
|
uplinkCounter: uplinkCounter,
|
||||||
downlinkCounter: downlinkCounter,
|
downlinkCounter: downlinkCounter,
|
||||||
stream: mss,
|
stream: mss,
|
||||||
|
ctx: ctx,
|
||||||
}
|
}
|
||||||
h.workers = append(h.workers, worker)
|
h.workers = append(h.workers, worker)
|
||||||
}
|
}
|
||||||
|
@@ -153,9 +153,11 @@ func (h *DynamicInboundHandler) refresh() error {
|
|||||||
address: address,
|
address: address,
|
||||||
port: port,
|
port: port,
|
||||||
dispatcher: h.mux,
|
dispatcher: h.mux,
|
||||||
|
sniffingConfig: h.receiverConfig.GetEffectiveSniffingSettings(),
|
||||||
uplinkCounter: uplinkCounter,
|
uplinkCounter: uplinkCounter,
|
||||||
downlinkCounter: downlinkCounter,
|
downlinkCounter: downlinkCounter,
|
||||||
stream: h.streamSettings,
|
stream: h.streamSettings,
|
||||||
|
ctx: h.ctx,
|
||||||
}
|
}
|
||||||
if err := worker.Start(); err != nil {
|
if err := worker.Start(); err != nil {
|
||||||
newError("failed to create UDP worker").Base(err).AtWarning().WriteToLog()
|
newError("failed to create UDP worker").Base(err).AtWarning().WriteToLog()
|
||||||
|
@@ -42,6 +42,9 @@ func (m *Manager) AddHandler(ctx context.Context, handler inbound.Handler) error
|
|||||||
|
|
||||||
tag := handler.Tag()
|
tag := handler.Tag()
|
||||||
if len(tag) > 0 {
|
if len(tag) > 0 {
|
||||||
|
if _, found := m.taggedHandlers[tag]; found {
|
||||||
|
return newError("existing tag found: " + tag)
|
||||||
|
}
|
||||||
m.taggedHandlers[tag] = handler
|
m.taggedHandlers[tag] = handler
|
||||||
} else {
|
} else {
|
||||||
m.untaggedHandler = append(m.untaggedHandler, handler)
|
m.untaggedHandler = append(m.untaggedHandler, handler)
|
||||||
|
@@ -6,6 +6,8 @@ import (
|
|||||||
"sync/atomic"
|
"sync/atomic"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
|
"github.com/xtls/xray-core/transport/internet/stat"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/app/proxyman"
|
"github.com/xtls/xray-core/app/proxyman"
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/buf"
|
"github.com/xtls/xray-core/common/buf"
|
||||||
@@ -54,7 +56,7 @@ func getTProxyType(s *internet.MemoryStreamConfig) internet.SocketConfig_TProxyM
|
|||||||
return s.SocketSettings.Tproxy
|
return s.SocketSettings.Tproxy
|
||||||
}
|
}
|
||||||
|
|
||||||
func (w *tcpWorker) callback(conn internet.Connection) {
|
func (w *tcpWorker) callback(conn stat.Connection) {
|
||||||
ctx, cancel := context.WithCancel(w.ctx)
|
ctx, cancel := context.WithCancel(w.ctx)
|
||||||
sid := session.NewID()
|
sid := session.NewID()
|
||||||
ctx = session.ContextWithID(ctx, sid)
|
ctx = session.ContextWithID(ctx, sid)
|
||||||
@@ -80,7 +82,7 @@ func (w *tcpWorker) callback(conn internet.Connection) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if w.uplinkCounter != nil || w.downlinkCounter != nil {
|
if w.uplinkCounter != nil || w.downlinkCounter != nil {
|
||||||
conn = &internet.StatCouterConnection{
|
conn = &stat.CounterConnection{
|
||||||
Connection: conn,
|
Connection: conn,
|
||||||
ReadCounter: w.uplinkCounter,
|
ReadCounter: w.uplinkCounter,
|
||||||
WriteCounter: w.downlinkCounter,
|
WriteCounter: w.downlinkCounter,
|
||||||
@@ -97,6 +99,8 @@ func (w *tcpWorker) callback(conn internet.Connection) {
|
|||||||
if w.sniffingConfig != nil {
|
if w.sniffingConfig != nil {
|
||||||
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
|
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
|
||||||
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
|
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
|
||||||
|
content.SniffingRequest.ExcludeForDomain = w.sniffingConfig.DomainsExcluded
|
||||||
|
content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
|
||||||
}
|
}
|
||||||
ctx = session.ContextWithContent(ctx, content)
|
ctx = session.ContextWithContent(ctx, content)
|
||||||
|
|
||||||
@@ -115,7 +119,7 @@ func (w *tcpWorker) Proxy() proxy.Inbound {
|
|||||||
|
|
||||||
func (w *tcpWorker) Start() error {
|
func (w *tcpWorker) Start() error {
|
||||||
ctx := context.Background()
|
ctx := context.Background()
|
||||||
hub, err := internet.ListenTCP(ctx, w.address, w.port, w.stream, func(conn internet.Connection) {
|
hub, err := internet.ListenTCP(ctx, w.address, w.port, w.stream, func(conn stat.Connection) {
|
||||||
go w.callback(conn)
|
go w.callback(conn)
|
||||||
})
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
@@ -234,11 +238,15 @@ type udpWorker struct {
|
|||||||
tag string
|
tag string
|
||||||
stream *internet.MemoryStreamConfig
|
stream *internet.MemoryStreamConfig
|
||||||
dispatcher routing.Dispatcher
|
dispatcher routing.Dispatcher
|
||||||
|
sniffingConfig *proxyman.SniffingConfig
|
||||||
uplinkCounter stats.Counter
|
uplinkCounter stats.Counter
|
||||||
downlinkCounter stats.Counter
|
downlinkCounter stats.Counter
|
||||||
|
|
||||||
checker *task.Periodic
|
checker *task.Periodic
|
||||||
activeConn map[connID]*udpConn
|
activeConn map[connID]*udpConn
|
||||||
|
|
||||||
|
ctx context.Context
|
||||||
|
cone bool
|
||||||
}
|
}
|
||||||
|
|
||||||
func (w *udpWorker) getConnection(id connID) (*udpConn, bool) {
|
func (w *udpWorker) getConnection(id connID) (*udpConn, bool) {
|
||||||
@@ -279,7 +287,10 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
|
|||||||
src: source,
|
src: source,
|
||||||
}
|
}
|
||||||
if originalDest.IsValid() {
|
if originalDest.IsValid() {
|
||||||
id.dest = originalDest
|
if !w.cone {
|
||||||
|
id.dest = originalDest
|
||||||
|
}
|
||||||
|
b.UDP = &originalDest
|
||||||
}
|
}
|
||||||
conn, existing := w.getConnection(id)
|
conn, existing := w.getConnection(id)
|
||||||
|
|
||||||
@@ -290,7 +301,7 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
|
|||||||
common.Must(w.checker.Start())
|
common.Must(w.checker.Start())
|
||||||
|
|
||||||
go func() {
|
go func() {
|
||||||
ctx := context.Background()
|
ctx := w.ctx
|
||||||
sid := session.NewID()
|
sid := session.NewID()
|
||||||
ctx = session.ContextWithID(ctx, sid)
|
ctx = session.ContextWithID(ctx, sid)
|
||||||
|
|
||||||
@@ -304,6 +315,13 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
|
|||||||
Gateway: net.UDPDestination(w.address, w.port),
|
Gateway: net.UDPDestination(w.address, w.port),
|
||||||
Tag: w.tag,
|
Tag: w.tag,
|
||||||
})
|
})
|
||||||
|
content := new(session.Content)
|
||||||
|
if w.sniffingConfig != nil {
|
||||||
|
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
|
||||||
|
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
|
||||||
|
content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
|
||||||
|
}
|
||||||
|
ctx = session.ContextWithContent(ctx, content)
|
||||||
if err := w.proxy.Process(ctx, net.Network_UDP, conn, w.dispatcher); err != nil {
|
if err := w.proxy.Process(ctx, net.Network_UDP, conn, w.dispatcher); err != nil {
|
||||||
newError("connection ends").Base(err).WriteToLog(session.ExportIDToError(ctx))
|
newError("connection ends").Base(err).WriteToLog(session.ExportIDToError(ctx))
|
||||||
}
|
}
|
||||||
@@ -336,7 +354,7 @@ func (w *udpWorker) clean() error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
for addr, conn := range w.activeConn {
|
for addr, conn := range w.activeConn {
|
||||||
if nowSec-atomic.LoadInt64(&conn.lastActivityTime) > 8 { // TODO Timeout too small
|
if nowSec-atomic.LoadInt64(&conn.lastActivityTime) > 300 {
|
||||||
delete(w.activeConn, addr)
|
delete(w.activeConn, addr)
|
||||||
conn.Close()
|
conn.Close()
|
||||||
}
|
}
|
||||||
@@ -357,8 +375,10 @@ func (w *udpWorker) Start() error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
|
w.cone = w.ctx.Value("cone").(bool)
|
||||||
|
|
||||||
w.checker = &task.Periodic{
|
w.checker = &task.Periodic{
|
||||||
Interval: time.Second * 16,
|
Interval: time.Minute,
|
||||||
Execute: w.clean,
|
Execute: w.clean,
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -418,13 +438,13 @@ type dsWorker struct {
|
|||||||
ctx context.Context
|
ctx context.Context
|
||||||
}
|
}
|
||||||
|
|
||||||
func (w *dsWorker) callback(conn internet.Connection) {
|
func (w *dsWorker) callback(conn stat.Connection) {
|
||||||
ctx, cancel := context.WithCancel(w.ctx)
|
ctx, cancel := context.WithCancel(w.ctx)
|
||||||
sid := session.NewID()
|
sid := session.NewID()
|
||||||
ctx = session.ContextWithID(ctx, sid)
|
ctx = session.ContextWithID(ctx, sid)
|
||||||
|
|
||||||
if w.uplinkCounter != nil || w.downlinkCounter != nil {
|
if w.uplinkCounter != nil || w.downlinkCounter != nil {
|
||||||
conn = &internet.StatCouterConnection{
|
conn = &stat.CounterConnection{
|
||||||
Connection: conn,
|
Connection: conn,
|
||||||
ReadCounter: w.uplinkCounter,
|
ReadCounter: w.uplinkCounter,
|
||||||
WriteCounter: w.downlinkCounter,
|
WriteCounter: w.downlinkCounter,
|
||||||
@@ -441,6 +461,8 @@ func (w *dsWorker) callback(conn internet.Connection) {
|
|||||||
if w.sniffingConfig != nil {
|
if w.sniffingConfig != nil {
|
||||||
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
|
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
|
||||||
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
|
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
|
||||||
|
content.SniffingRequest.ExcludeForDomain = w.sniffingConfig.DomainsExcluded
|
||||||
|
content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
|
||||||
}
|
}
|
||||||
ctx = session.ContextWithContent(ctx, content)
|
ctx = session.ContextWithContent(ctx, content)
|
||||||
|
|
||||||
@@ -462,7 +484,7 @@ func (w *dsWorker) Port() net.Port {
|
|||||||
}
|
}
|
||||||
func (w *dsWorker) Start() error {
|
func (w *dsWorker) Start() error {
|
||||||
ctx := context.Background()
|
ctx := context.Background()
|
||||||
hub, err := internet.ListenUnix(ctx, w.address, w.stream, func(conn internet.Connection) {
|
hub, err := internet.ListenUnix(ctx, w.address, w.stream, func(conn stat.Connection) {
|
||||||
go w.callback(conn)
|
go w.callback(conn)
|
||||||
})
|
})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@@ -3,10 +3,13 @@ package outbound
|
|||||||
import (
|
import (
|
||||||
"context"
|
"context"
|
||||||
|
|
||||||
|
"github.com/xtls/xray-core/transport/internet/stat"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/app/proxyman"
|
"github.com/xtls/xray-core/app/proxyman"
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/mux"
|
"github.com/xtls/xray-core/common/mux"
|
||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
|
"github.com/xtls/xray-core/common/net/cnc"
|
||||||
"github.com/xtls/xray-core/common/session"
|
"github.com/xtls/xray-core/common/session"
|
||||||
"github.com/xtls/xray-core/core"
|
"github.com/xtls/xray-core/core"
|
||||||
"github.com/xtls/xray-core/features/outbound"
|
"github.com/xtls/xray-core/features/outbound"
|
||||||
@@ -157,7 +160,7 @@ func (h *Handler) Address() net.Address {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Dial implements internet.Dialer.
|
// Dial implements internet.Dialer.
|
||||||
func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Connection, error) {
|
func (h *Handler) Dial(ctx context.Context, dest net.Destination) (stat.Connection, error) {
|
||||||
if h.senderSettings != nil {
|
if h.senderSettings != nil {
|
||||||
if h.senderSettings.ProxySettings.HasTag() {
|
if h.senderSettings.ProxySettings.HasTag() {
|
||||||
tag := h.senderSettings.ProxySettings.Tag
|
tag := h.senderSettings.ProxySettings.Tag
|
||||||
@@ -173,7 +176,7 @@ func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Conn
|
|||||||
downlinkReader, downlinkWriter := pipe.New(opts...)
|
downlinkReader, downlinkWriter := pipe.New(opts...)
|
||||||
|
|
||||||
go handler.Dispatch(ctx, &transport.Link{Reader: uplinkReader, Writer: downlinkWriter})
|
go handler.Dispatch(ctx, &transport.Link{Reader: uplinkReader, Writer: downlinkWriter})
|
||||||
conn := net.NewConnection(net.ConnectionInputMulti(uplinkWriter), net.ConnectionOutputMulti(downlinkReader))
|
conn := cnc.NewConnection(cnc.ConnectionInputMulti(uplinkWriter), cnc.ConnectionOutputMulti(downlinkReader))
|
||||||
|
|
||||||
if config := tls.ConfigFromStreamSettings(h.streamSettings); config != nil {
|
if config := tls.ConfigFromStreamSettings(h.streamSettings); config != nil {
|
||||||
tlsConfig := config.GetTLSConfig(tls.WithDestination(dest))
|
tlsConfig := config.GetTLSConfig(tls.WithDestination(dest))
|
||||||
@@ -200,9 +203,9 @@ func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Conn
|
|||||||
return h.getStatCouterConnection(conn), err
|
return h.getStatCouterConnection(conn), err
|
||||||
}
|
}
|
||||||
|
|
||||||
func (h *Handler) getStatCouterConnection(conn internet.Connection) internet.Connection {
|
func (h *Handler) getStatCouterConnection(conn stat.Connection) stat.Connection {
|
||||||
if h.uplinkCounter != nil || h.downlinkCounter != nil {
|
if h.uplinkCounter != nil || h.downlinkCounter != nil {
|
||||||
return &internet.StatCouterConnection{
|
return &stat.CounterConnection{
|
||||||
Connection: conn,
|
Connection: conn,
|
||||||
ReadCounter: h.downlinkCounter,
|
ReadCounter: h.downlinkCounter,
|
||||||
WriteCounter: h.uplinkCounter,
|
WriteCounter: h.uplinkCounter,
|
||||||
|
@@ -4,6 +4,8 @@ import (
|
|||||||
"context"
|
"context"
|
||||||
"testing"
|
"testing"
|
||||||
|
|
||||||
|
"github.com/xtls/xray-core/transport/internet/stat"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/app/policy"
|
"github.com/xtls/xray-core/app/policy"
|
||||||
. "github.com/xtls/xray-core/app/proxyman/outbound"
|
. "github.com/xtls/xray-core/app/proxyman/outbound"
|
||||||
"github.com/xtls/xray-core/app/stats"
|
"github.com/xtls/xray-core/app/stats"
|
||||||
@@ -12,7 +14,6 @@ import (
|
|||||||
core "github.com/xtls/xray-core/core"
|
core "github.com/xtls/xray-core/core"
|
||||||
"github.com/xtls/xray-core/features/outbound"
|
"github.com/xtls/xray-core/features/outbound"
|
||||||
"github.com/xtls/xray-core/proxy/freedom"
|
"github.com/xtls/xray-core/proxy/freedom"
|
||||||
"github.com/xtls/xray-core/transport/internet"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
func TestInterfaces(t *testing.T) {
|
func TestInterfaces(t *testing.T) {
|
||||||
@@ -44,9 +45,9 @@ func TestOutboundWithoutStatCounter(t *testing.T) {
|
|||||||
ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
|
ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
|
||||||
})
|
})
|
||||||
conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
|
conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
|
||||||
_, ok := conn.(*internet.StatCouterConnection)
|
_, ok := conn.(*stat.CounterConnection)
|
||||||
if ok {
|
if ok {
|
||||||
t.Errorf("Expected conn to not be StatCouterConnection")
|
t.Errorf("Expected conn to not be CounterConnection")
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -73,8 +74,8 @@ func TestOutboundWithStatCounter(t *testing.T) {
|
|||||||
ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
|
ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
|
||||||
})
|
})
|
||||||
conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
|
conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
|
||||||
_, ok := conn.(*internet.StatCouterConnection)
|
_, ok := conn.(*stat.CounterConnection)
|
||||||
if !ok {
|
if !ok {
|
||||||
t.Errorf("Expected conn to be StatCouterConnection")
|
t.Errorf("Expected conn to be CounterConnection")
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@@ -109,6 +109,9 @@ func (m *Manager) AddHandler(ctx context.Context, handler outbound.Handler) erro
|
|||||||
|
|
||||||
tag := handler.Tag()
|
tag := handler.Tag()
|
||||||
if len(tag) > 0 {
|
if len(tag) > 0 {
|
||||||
|
if _, found := m.taggedHandler[tag]; found {
|
||||||
|
return newError("existing tag found: " + tag)
|
||||||
|
}
|
||||||
m.taggedHandler[tag] = handler
|
m.taggedHandler[tag] = handler
|
||||||
} else {
|
} else {
|
||||||
m.untaggedHandlers = append(m.untaggedHandlers, handler)
|
m.untaggedHandlers = append(m.untaggedHandlers, handler)
|
||||||
|
@@ -5,6 +5,7 @@ import (
|
|||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/golang/protobuf/proto"
|
"github.com/golang/protobuf/proto"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common/mux"
|
"github.com/xtls/xray-core/common/mux"
|
||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
"github.com/xtls/xray-core/common/session"
|
"github.com/xtls/xray-core/common/session"
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/reverse/config.proto
|
// source: app/reverse/config.proto
|
||||||
|
|
||||||
package reverse
|
package reverse
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
reflect "reflect"
|
reflect "reflect"
|
||||||
@@ -21,10 +20,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
type Control_State int32
|
type Control_State int32
|
||||||
|
|
||||||
const (
|
const (
|
||||||
|
@@ -6,6 +6,7 @@ import (
|
|||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/golang/protobuf/proto"
|
"github.com/golang/protobuf/proto"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/buf"
|
"github.com/xtls/xray-core/common/buf"
|
||||||
"github.com/xtls/xray-core/common/mux"
|
"github.com/xtls/xray-core/common/mux"
|
||||||
@@ -157,6 +158,9 @@ func (p *StaticMuxPicker) PickAvailable() (*mux.ClientWorker, error) {
|
|||||||
if w.draining {
|
if w.draining {
|
||||||
continue
|
continue
|
||||||
}
|
}
|
||||||
|
if w.client.Closed() {
|
||||||
|
continue
|
||||||
|
}
|
||||||
if w.client.ActiveConnections() < minConn {
|
if w.client.ActiveConnections() < minConn {
|
||||||
minConn = w.client.ActiveConnections()
|
minConn = w.client.ActiveConnections()
|
||||||
minIdx = i
|
minIdx = i
|
||||||
|
@@ -85,7 +85,7 @@ func (s *service) Register(server *grpc.Server) {
|
|||||||
RegisterRoutingServiceServer(server, rs)
|
RegisterRoutingServiceServer(server, rs)
|
||||||
|
|
||||||
// For compatibility purposes
|
// For compatibility purposes
|
||||||
vCoreDesc := _RoutingService_serviceDesc
|
vCoreDesc := RoutingService_ServiceDesc
|
||||||
vCoreDesc.ServiceName = "v2ray.core.app.router.command.RoutingService"
|
vCoreDesc.ServiceName = "v2ray.core.app.router.command.RoutingService"
|
||||||
server.RegisterService(&vCoreDesc, rs)
|
server.RegisterService(&vCoreDesc, rs)
|
||||||
}))
|
}))
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/router/command/command.proto
|
// source: app/router/command/command.proto
|
||||||
|
|
||||||
package command
|
package command
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
net "github.com/xtls/xray-core/common/net"
|
net "github.com/xtls/xray-core/common/net"
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
@@ -22,10 +21,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
// RoutingContext is the context with information relative to routing process.
|
// RoutingContext is the context with information relative to routing process.
|
||||||
// It conforms to the structure of xray.features.routing.Context and
|
// It conforms to the structure of xray.features.routing.Context and
|
||||||
// xray.features.routing.Route.
|
// xray.features.routing.Route.
|
||||||
@@ -91,7 +86,7 @@ func (x *RoutingContext) GetNetwork() net.Network {
|
|||||||
if x != nil {
|
if x != nil {
|
||||||
return x.Network
|
return x.Network
|
||||||
}
|
}
|
||||||
return net.Network_Unknown
|
return net.Network(0)
|
||||||
}
|
}
|
||||||
|
|
||||||
func (x *RoutingContext) GetSourceIPs() [][]byte {
|
func (x *RoutingContext) GetSourceIPs() [][]byte {
|
||||||
|
@@ -11,6 +11,7 @@ import (
|
|||||||
|
|
||||||
// This is a compile-time assertion to ensure that this generated file
|
// This is a compile-time assertion to ensure that this generated file
|
||||||
// is compatible with the grpc package it is being compiled against.
|
// is compatible with the grpc package it is being compiled against.
|
||||||
|
// Requires gRPC-Go v1.32.0 or later.
|
||||||
const _ = grpc.SupportPackageIsVersion7
|
const _ = grpc.SupportPackageIsVersion7
|
||||||
|
|
||||||
// RoutingServiceClient is the client API for RoutingService service.
|
// RoutingServiceClient is the client API for RoutingService service.
|
||||||
@@ -30,7 +31,7 @@ func NewRoutingServiceClient(cc grpc.ClientConnInterface) RoutingServiceClient {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func (c *routingServiceClient) SubscribeRoutingStats(ctx context.Context, in *SubscribeRoutingStatsRequest, opts ...grpc.CallOption) (RoutingService_SubscribeRoutingStatsClient, error) {
|
func (c *routingServiceClient) SubscribeRoutingStats(ctx context.Context, in *SubscribeRoutingStatsRequest, opts ...grpc.CallOption) (RoutingService_SubscribeRoutingStatsClient, error) {
|
||||||
stream, err := c.cc.NewStream(ctx, &_RoutingService_serviceDesc.Streams[0], "/xray.app.router.command.RoutingService/SubscribeRoutingStats", opts...)
|
stream, err := c.cc.NewStream(ctx, &RoutingService_ServiceDesc.Streams[0], "/xray.app.router.command.RoutingService/SubscribeRoutingStats", opts...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return nil, err
|
return nil, err
|
||||||
}
|
}
|
||||||
@@ -99,7 +100,7 @@ type UnsafeRoutingServiceServer interface {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func RegisterRoutingServiceServer(s grpc.ServiceRegistrar, srv RoutingServiceServer) {
|
func RegisterRoutingServiceServer(s grpc.ServiceRegistrar, srv RoutingServiceServer) {
|
||||||
s.RegisterService(&_RoutingService_serviceDesc, srv)
|
s.RegisterService(&RoutingService_ServiceDesc, srv)
|
||||||
}
|
}
|
||||||
|
|
||||||
func _RoutingService_SubscribeRoutingStats_Handler(srv interface{}, stream grpc.ServerStream) error {
|
func _RoutingService_SubscribeRoutingStats_Handler(srv interface{}, stream grpc.ServerStream) error {
|
||||||
@@ -141,7 +142,10 @@ func _RoutingService_TestRoute_Handler(srv interface{}, ctx context.Context, dec
|
|||||||
return interceptor(ctx, in, info, handler)
|
return interceptor(ctx, in, info, handler)
|
||||||
}
|
}
|
||||||
|
|
||||||
var _RoutingService_serviceDesc = grpc.ServiceDesc{
|
// RoutingService_ServiceDesc is the grpc.ServiceDesc for RoutingService service.
|
||||||
|
// It's only intended for direct use with grpc.RegisterService,
|
||||||
|
// and not to be introspected or modified (even as a copy)
|
||||||
|
var RoutingService_ServiceDesc = grpc.ServiceDesc{
|
||||||
ServiceName: "xray.app.router.command.RoutingService",
|
ServiceName: "xray.app.router.command.RoutingService",
|
||||||
HandlerType: (*RoutingServiceServer)(nil),
|
HandlerType: (*RoutingServiceServer)(nil),
|
||||||
Methods: []grpc.MethodDesc{
|
Methods: []grpc.MethodDesc{
|
||||||
|
@@ -8,6 +8,9 @@ import (
|
|||||||
"github.com/golang/mock/gomock"
|
"github.com/golang/mock/gomock"
|
||||||
"github.com/google/go-cmp/cmp"
|
"github.com/google/go-cmp/cmp"
|
||||||
"github.com/google/go-cmp/cmp/cmpopts"
|
"github.com/google/go-cmp/cmp/cmpopts"
|
||||||
|
"google.golang.org/grpc"
|
||||||
|
"google.golang.org/grpc/test/bufconn"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/app/router"
|
"github.com/xtls/xray-core/app/router"
|
||||||
. "github.com/xtls/xray-core/app/router/command"
|
. "github.com/xtls/xray-core/app/router/command"
|
||||||
"github.com/xtls/xray-core/app/stats"
|
"github.com/xtls/xray-core/app/stats"
|
||||||
@@ -15,8 +18,6 @@ import (
|
|||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
"github.com/xtls/xray-core/features/routing"
|
"github.com/xtls/xray-core/features/routing"
|
||||||
"github.com/xtls/xray-core/testing/mocks"
|
"github.com/xtls/xray-core/testing/mocks"
|
||||||
"google.golang.org/grpc"
|
|
||||||
"google.golang.org/grpc/test/bufconn"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
func TestServiceSubscribeRoutingStats(t *testing.T) {
|
func TestServiceSubscribeRoutingStats(t *testing.T) {
|
||||||
|
@@ -66,6 +66,24 @@ type DomainMatcher struct {
|
|||||||
matchers strmatcher.IndexMatcher
|
matchers strmatcher.IndexMatcher
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func NewMphMatcherGroup(domains []*Domain) (*DomainMatcher, error) {
|
||||||
|
g := strmatcher.NewMphMatcherGroup()
|
||||||
|
for _, d := range domains {
|
||||||
|
matcherType, f := matcherTypeMap[d.Type]
|
||||||
|
if !f {
|
||||||
|
return nil, newError("unsupported domain type", d.Type)
|
||||||
|
}
|
||||||
|
_, err := g.AddPattern(d.Value, matcherType)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
g.Build()
|
||||||
|
return &DomainMatcher{
|
||||||
|
matchers: g,
|
||||||
|
}, nil
|
||||||
|
}
|
||||||
|
|
||||||
func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
|
func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
|
||||||
g := new(strmatcher.MatcherGroup)
|
g := new(strmatcher.MatcherGroup)
|
||||||
for _, d := range domains {
|
for _, d := range domains {
|
||||||
@@ -82,7 +100,7 @@ func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func (m *DomainMatcher) ApplyDomain(domain string) bool {
|
func (m *DomainMatcher) ApplyDomain(domain string) bool {
|
||||||
return len(m.matchers.Match(domain)) > 0
|
return len(m.matchers.Match(strings.ToLower(domain))) > 0
|
||||||
}
|
}
|
||||||
|
|
||||||
// Apply implements Condition.
|
// Apply implements Condition.
|
||||||
|
@@ -6,6 +6,7 @@ import (
|
|||||||
"testing"
|
"testing"
|
||||||
|
|
||||||
"github.com/golang/protobuf/proto"
|
"github.com/golang/protobuf/proto"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/app/router"
|
"github.com/xtls/xray-core/app/router"
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
@@ -18,10 +19,10 @@ func init() {
|
|||||||
common.Must(err)
|
common.Must(err)
|
||||||
|
|
||||||
if _, err := os.Stat(platform.GetAssetLocation("geoip.dat")); err != nil && os.IsNotExist(err) {
|
if _, err := os.Stat(platform.GetAssetLocation("geoip.dat")); err != nil && os.IsNotExist(err) {
|
||||||
common.Must(filesystem.CopyFile(platform.GetAssetLocation("geoip.dat"), filepath.Join(wd, "..", "..", "release", "config", "geoip.dat")))
|
common.Must(filesystem.CopyFile(platform.GetAssetLocation("geoip.dat"), filepath.Join(wd, "..", "..", "resources", "geoip.dat")))
|
||||||
}
|
}
|
||||||
if _, err := os.Stat(platform.GetAssetLocation("geosite.dat")); err != nil && os.IsNotExist(err) {
|
if _, err := os.Stat(platform.GetAssetLocation("geosite.dat")); err != nil && os.IsNotExist(err) {
|
||||||
common.Must(filesystem.CopyFile(platform.GetAssetLocation("geosite.dat"), filepath.Join(wd, "..", "..", "release", "config", "geosite.dat")))
|
common.Must(filesystem.CopyFile(platform.GetAssetLocation("geosite.dat"), filepath.Join(wd, "..", "..", "resources", "geosite.dat")))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -359,6 +359,9 @@ func TestChinaSites(t *testing.T) {
|
|||||||
matcher, err := NewDomainMatcher(domains)
|
matcher, err := NewDomainMatcher(domains)
|
||||||
common.Must(err)
|
common.Must(err)
|
||||||
|
|
||||||
|
acMatcher, err := NewMphMatcherGroup(domains)
|
||||||
|
common.Must(err)
|
||||||
|
|
||||||
type TestCase struct {
|
type TestCase struct {
|
||||||
Domain string
|
Domain string
|
||||||
Output bool
|
Output bool
|
||||||
@@ -387,9 +390,96 @@ func TestChinaSites(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
for _, testCase := range testCases {
|
for _, testCase := range testCases {
|
||||||
r := matcher.ApplyDomain(testCase.Domain)
|
r1 := matcher.ApplyDomain(testCase.Domain)
|
||||||
if r != testCase.Output {
|
r2 := acMatcher.ApplyDomain(testCase.Domain)
|
||||||
t.Error("expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r)
|
if r1 != testCase.Output {
|
||||||
|
t.Error("DomainMatcher expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r1)
|
||||||
|
} else if r2 != testCase.Output {
|
||||||
|
t.Error("ACDomainMatcher expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r2)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func BenchmarkMphDomainMatcher(b *testing.B) {
|
||||||
|
domains, err := loadGeoSite("CN")
|
||||||
|
common.Must(err)
|
||||||
|
|
||||||
|
matcher, err := NewMphMatcherGroup(domains)
|
||||||
|
common.Must(err)
|
||||||
|
|
||||||
|
type TestCase struct {
|
||||||
|
Domain string
|
||||||
|
Output bool
|
||||||
|
}
|
||||||
|
testCases := []TestCase{
|
||||||
|
{
|
||||||
|
Domain: "163.com",
|
||||||
|
Output: true,
|
||||||
|
},
|
||||||
|
{
|
||||||
|
Domain: "163.com",
|
||||||
|
Output: true,
|
||||||
|
},
|
||||||
|
{
|
||||||
|
Domain: "164.com",
|
||||||
|
Output: false,
|
||||||
|
},
|
||||||
|
{
|
||||||
|
Domain: "164.com",
|
||||||
|
Output: false,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
for i := 0; i < 1024; i++ {
|
||||||
|
testCases = append(testCases, TestCase{Domain: strconv.Itoa(i) + ".not-exists.com", Output: false})
|
||||||
|
}
|
||||||
|
|
||||||
|
b.ResetTimer()
|
||||||
|
for i := 0; i < b.N; i++ {
|
||||||
|
for _, testCase := range testCases {
|
||||||
|
_ = matcher.ApplyDomain(testCase.Domain)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func BenchmarkDomainMatcher(b *testing.B) {
|
||||||
|
domains, err := loadGeoSite("CN")
|
||||||
|
common.Must(err)
|
||||||
|
|
||||||
|
matcher, err := NewDomainMatcher(domains)
|
||||||
|
common.Must(err)
|
||||||
|
|
||||||
|
type TestCase struct {
|
||||||
|
Domain string
|
||||||
|
Output bool
|
||||||
|
}
|
||||||
|
testCases := []TestCase{
|
||||||
|
{
|
||||||
|
Domain: "163.com",
|
||||||
|
Output: true,
|
||||||
|
},
|
||||||
|
{
|
||||||
|
Domain: "163.com",
|
||||||
|
Output: true,
|
||||||
|
},
|
||||||
|
{
|
||||||
|
Domain: "164.com",
|
||||||
|
Output: false,
|
||||||
|
},
|
||||||
|
{
|
||||||
|
Domain: "164.com",
|
||||||
|
Output: false,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
for i := 0; i < 1024; i++ {
|
||||||
|
testCases = append(testCases, TestCase{Domain: strconv.Itoa(i) + ".not-exists.com", Output: false})
|
||||||
|
}
|
||||||
|
|
||||||
|
b.ResetTimer()
|
||||||
|
for i := 0; i < b.N; i++ {
|
||||||
|
for _, testCase := range testCases {
|
||||||
|
_ = matcher.ApplyDomain(testCase.Domain)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@@ -67,11 +67,24 @@ func (rr *RoutingRule) BuildCondition() (Condition, error) {
|
|||||||
conds := NewConditionChan()
|
conds := NewConditionChan()
|
||||||
|
|
||||||
if len(rr.Domain) > 0 {
|
if len(rr.Domain) > 0 {
|
||||||
matcher, err := NewDomainMatcher(rr.Domain)
|
switch rr.DomainMatcher {
|
||||||
if err != nil {
|
case "linear":
|
||||||
return nil, newError("failed to build domain condition").Base(err)
|
matcher, err := NewDomainMatcher(rr.Domain)
|
||||||
|
if err != nil {
|
||||||
|
return nil, newError("failed to build domain condition").Base(err)
|
||||||
|
}
|
||||||
|
conds.Add(matcher)
|
||||||
|
case "mph", "hybrid":
|
||||||
|
fallthrough
|
||||||
|
default:
|
||||||
|
matcher, err := NewMphMatcherGroup(rr.Domain)
|
||||||
|
if err != nil {
|
||||||
|
return nil, newError("failed to build domain condition with MphDomainMatcher").Base(err)
|
||||||
|
}
|
||||||
|
newError("MphDomainMatcher is enabled for ", len(rr.Domain), " domain rule(s)").AtDebug().WriteToLog()
|
||||||
|
conds.Add(matcher)
|
||||||
}
|
}
|
||||||
conds.Add(matcher)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
if len(rr.UserEmail) > 0 {
|
if len(rr.UserEmail) > 0 {
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/router/config.proto
|
// source: app/router/config.proto
|
||||||
|
|
||||||
package router
|
package router
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
net "github.com/xtls/xray-core/common/net"
|
net "github.com/xtls/xray-core/common/net"
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
@@ -22,10 +21,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
// Type of domain value.
|
// Type of domain value.
|
||||||
type Domain_Type int32
|
type Domain_Type int32
|
||||||
|
|
||||||
@@ -515,6 +510,7 @@ type RoutingRule struct {
|
|||||||
InboundTag []string `protobuf:"bytes,8,rep,name=inbound_tag,json=inboundTag,proto3" json:"inbound_tag,omitempty"`
|
InboundTag []string `protobuf:"bytes,8,rep,name=inbound_tag,json=inboundTag,proto3" json:"inbound_tag,omitempty"`
|
||||||
Protocol []string `protobuf:"bytes,9,rep,name=protocol,proto3" json:"protocol,omitempty"`
|
Protocol []string `protobuf:"bytes,9,rep,name=protocol,proto3" json:"protocol,omitempty"`
|
||||||
Attributes string `protobuf:"bytes,15,opt,name=attributes,proto3" json:"attributes,omitempty"`
|
Attributes string `protobuf:"bytes,15,opt,name=attributes,proto3" json:"attributes,omitempty"`
|
||||||
|
DomainMatcher string `protobuf:"bytes,17,opt,name=domain_matcher,json=domainMatcher,proto3" json:"domain_matcher,omitempty"`
|
||||||
}
|
}
|
||||||
|
|
||||||
func (x *RoutingRule) Reset() {
|
func (x *RoutingRule) Reset() {
|
||||||
@@ -672,6 +668,13 @@ func (x *RoutingRule) GetAttributes() string {
|
|||||||
return ""
|
return ""
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func (x *RoutingRule) GetDomainMatcher() string {
|
||||||
|
if x != nil {
|
||||||
|
return x.DomainMatcher
|
||||||
|
}
|
||||||
|
return ""
|
||||||
|
}
|
||||||
|
|
||||||
type isRoutingRule_TargetTag interface {
|
type isRoutingRule_TargetTag interface {
|
||||||
isRoutingRule_TargetTag()
|
isRoutingRule_TargetTag()
|
||||||
}
|
}
|
||||||
@@ -946,7 +949,7 @@ var file_app_router_config_proto_rawDesc = []byte{
|
|||||||
0x74, 0x12, 0x2e, 0x0a, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b,
|
0x74, 0x12, 0x2e, 0x0a, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b,
|
||||||
0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
|
0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
|
||||||
0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x52, 0x05, 0x65, 0x6e, 0x74, 0x72,
|
0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x52, 0x05, 0x65, 0x6e, 0x74, 0x72,
|
||||||
0x79, 0x22, 0x8e, 0x06, 0x0a, 0x0b, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
|
0x79, 0x22, 0xb5, 0x06, 0x0a, 0x0b, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
|
||||||
0x65, 0x12, 0x12, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00,
|
0x65, 0x12, 0x12, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00,
|
||||||
0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x25, 0x0a, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69,
|
0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x25, 0x0a, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69,
|
||||||
0x6e, 0x67, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x0c, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00, 0x52, 0x0c,
|
0x6e, 0x67, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x0c, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00, 0x52, 0x0c,
|
||||||
@@ -994,36 +997,38 @@ var file_app_router_config_proto_rawDesc = []byte{
|
|||||||
0x6f, 0x63, 0x6f, 0x6c, 0x18, 0x09, 0x20, 0x03, 0x28, 0x09, 0x52, 0x08, 0x70, 0x72, 0x6f, 0x74,
|
0x6f, 0x63, 0x6f, 0x6c, 0x18, 0x09, 0x20, 0x03, 0x28, 0x09, 0x52, 0x08, 0x70, 0x72, 0x6f, 0x74,
|
||||||
0x6f, 0x63, 0x6f, 0x6c, 0x12, 0x1e, 0x0a, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62, 0x75, 0x74,
|
0x6f, 0x63, 0x6f, 0x6c, 0x12, 0x1e, 0x0a, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62, 0x75, 0x74,
|
||||||
0x65, 0x73, 0x18, 0x0f, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62,
|
0x65, 0x73, 0x18, 0x0f, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62,
|
||||||
0x75, 0x74, 0x65, 0x73, 0x42, 0x0c, 0x0a, 0x0a, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74,
|
0x75, 0x74, 0x65, 0x73, 0x12, 0x25, 0x0a, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6d,
|
||||||
0x61, 0x67, 0x22, 0x4e, 0x0a, 0x0d, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52,
|
0x61, 0x74, 0x63, 0x68, 0x65, 0x72, 0x18, 0x11, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x64, 0x6f,
|
||||||
0x75, 0x6c, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09,
|
0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x65, 0x72, 0x42, 0x0c, 0x0a, 0x0a, 0x74,
|
||||||
0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x2b, 0x0a, 0x11, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e,
|
0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74, 0x61, 0x67, 0x22, 0x4e, 0x0a, 0x0d, 0x42, 0x61, 0x6c,
|
||||||
0x64, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09,
|
0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61,
|
||||||
0x52, 0x10, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74,
|
0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x2b, 0x0a, 0x11,
|
||||||
0x6f, 0x72, 0x22, 0x9b, 0x02, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x4f, 0x0a,
|
0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f,
|
||||||
0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
|
0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09, 0x52, 0x10, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e,
|
||||||
0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x26, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
|
0x64, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x22, 0x9b, 0x02, 0x0a, 0x06, 0x43, 0x6f,
|
||||||
0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e,
|
0x6e, 0x66, 0x69, 0x67, 0x12, 0x4f, 0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x73,
|
||||||
0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0e,
|
0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x26, 0x2e,
|
||||||
0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x30,
|
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e,
|
||||||
0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78,
|
0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72,
|
||||||
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x52,
|
0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72,
|
||||||
0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x04, 0x72, 0x75, 0x6c, 0x65,
|
0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x30, 0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x02, 0x20,
|
||||||
0x12, 0x45, 0x0a, 0x0e, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x5f, 0x72, 0x75,
|
0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72,
|
||||||
0x6c, 0x65, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1e, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
|
0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
|
||||||
0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e,
|
0x65, 0x52, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x12, 0x45, 0x0a, 0x0e, 0x62, 0x61, 0x6c, 0x61, 0x6e,
|
||||||
0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63,
|
0x63, 0x69, 0x6e, 0x67, 0x5f, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32,
|
||||||
0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x22, 0x47, 0x0a, 0x0e, 0x44, 0x6f, 0x6d, 0x61, 0x69,
|
0x1e, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65,
|
||||||
0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x08, 0x0a, 0x04, 0x41, 0x73, 0x49,
|
0x72, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52,
|
||||||
0x73, 0x10, 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55, 0x73, 0x65, 0x49, 0x70, 0x10, 0x01, 0x12, 0x10,
|
0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x22, 0x47,
|
||||||
0x0a, 0x0c, 0x49, 0x70, 0x49, 0x66, 0x4e, 0x6f, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x10, 0x02,
|
0x0a, 0x0e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
|
||||||
0x12, 0x0e, 0x0a, 0x0a, 0x49, 0x70, 0x4f, 0x6e, 0x44, 0x65, 0x6d, 0x61, 0x6e, 0x64, 0x10, 0x03,
|
0x12, 0x08, 0x0a, 0x04, 0x41, 0x73, 0x49, 0x73, 0x10, 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55, 0x73,
|
||||||
0x42, 0x4f, 0x0a, 0x13, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
|
0x65, 0x49, 0x70, 0x10, 0x01, 0x12, 0x10, 0x0a, 0x0c, 0x49, 0x70, 0x49, 0x66, 0x4e, 0x6f, 0x6e,
|
||||||
0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x50, 0x01, 0x5a, 0x24, 0x67, 0x69, 0x74, 0x68, 0x75,
|
0x4d, 0x61, 0x74, 0x63, 0x68, 0x10, 0x02, 0x12, 0x0e, 0x0a, 0x0a, 0x49, 0x70, 0x4f, 0x6e, 0x44,
|
||||||
0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d,
|
0x65, 0x6d, 0x61, 0x6e, 0x64, 0x10, 0x03, 0x42, 0x4f, 0x0a, 0x13, 0x63, 0x6f, 0x6d, 0x2e, 0x78,
|
||||||
0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0xaa,
|
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x50, 0x01,
|
||||||
0x02, 0x0f, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x65,
|
0x5a, 0x24, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c,
|
||||||
0x72, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f,
|
||||||
|
0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0xaa, 0x02, 0x0f, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70,
|
||||||
|
0x70, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||||
}
|
}
|
||||||
|
|
||||||
var (
|
var (
|
||||||
|
@@ -119,6 +119,8 @@ message RoutingRule {
|
|||||||
repeated string protocol = 9;
|
repeated string protocol = 9;
|
||||||
|
|
||||||
string attributes = 15;
|
string attributes = 15;
|
||||||
|
|
||||||
|
string domain_matcher = 17;
|
||||||
}
|
}
|
||||||
|
|
||||||
message BalancingRule {
|
message BalancingRule {
|
||||||
|
@@ -5,10 +5,12 @@ import (
|
|||||||
"testing"
|
"testing"
|
||||||
|
|
||||||
"github.com/golang/mock/gomock"
|
"github.com/golang/mock/gomock"
|
||||||
|
|
||||||
. "github.com/xtls/xray-core/app/router"
|
. "github.com/xtls/xray-core/app/router"
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/net"
|
"github.com/xtls/xray-core/common/net"
|
||||||
"github.com/xtls/xray-core/common/session"
|
"github.com/xtls/xray-core/common/session"
|
||||||
|
"github.com/xtls/xray-core/features/dns"
|
||||||
"github.com/xtls/xray-core/features/outbound"
|
"github.com/xtls/xray-core/features/outbound"
|
||||||
routing_session "github.com/xtls/xray-core/features/routing/session"
|
routing_session "github.com/xtls/xray-core/features/routing/session"
|
||||||
"github.com/xtls/xray-core/testing/mocks"
|
"github.com/xtls/xray-core/testing/mocks"
|
||||||
@@ -115,7 +117,11 @@ func TestIPOnDemand(t *testing.T) {
|
|||||||
defer mockCtl.Finish()
|
defer mockCtl.Finish()
|
||||||
|
|
||||||
mockDNS := mocks.NewDNSClient(mockCtl)
|
mockDNS := mocks.NewDNSClient(mockCtl)
|
||||||
mockDNS.EXPECT().LookupIP(gomock.Eq("example.com")).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
|
mockDNS.EXPECT().LookupIP(gomock.Eq("example.com"), dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
}).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
|
||||||
|
|
||||||
r := new(Router)
|
r := new(Router)
|
||||||
common.Must(r.Init(config, mockDNS, nil))
|
common.Must(r.Init(config, mockDNS, nil))
|
||||||
@@ -150,7 +156,11 @@ func TestIPIfNonMatchDomain(t *testing.T) {
|
|||||||
defer mockCtl.Finish()
|
defer mockCtl.Finish()
|
||||||
|
|
||||||
mockDNS := mocks.NewDNSClient(mockCtl)
|
mockDNS := mocks.NewDNSClient(mockCtl)
|
||||||
mockDNS.EXPECT().LookupIP(gomock.Eq("example.com")).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
|
mockDNS.EXPECT().LookupIP(gomock.Eq("example.com"), dns.IPOption{
|
||||||
|
IPv4Enable: true,
|
||||||
|
IPv6Enable: true,
|
||||||
|
FakeEnable: false,
|
||||||
|
}).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
|
||||||
|
|
||||||
r := new(Router)
|
r := new(Router)
|
||||||
common.Must(r.Init(config, mockDNS, nil))
|
common.Must(r.Init(config, mockDNS, nil))
|
||||||
|
@@ -113,7 +113,7 @@ func (s *service) Register(server *grpc.Server) {
|
|||||||
RegisterStatsServiceServer(server, ss)
|
RegisterStatsServiceServer(server, ss)
|
||||||
|
|
||||||
// For compatibility purposes
|
// For compatibility purposes
|
||||||
vCoreDesc := _StatsService_serviceDesc
|
vCoreDesc := StatsService_ServiceDesc
|
||||||
vCoreDesc.ServiceName = "v2ray.core.app.stats.command.StatsService"
|
vCoreDesc.ServiceName = "v2ray.core.app.stats.command.StatsService"
|
||||||
server.RegisterService(&vCoreDesc, ss)
|
server.RegisterService(&vCoreDesc, ss)
|
||||||
}
|
}
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/stats/command/command.proto
|
// source: app/stats/command/command.proto
|
||||||
|
|
||||||
package command
|
package command
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
reflect "reflect"
|
reflect "reflect"
|
||||||
@@ -21,10 +20,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
type GetStatsRequest struct {
|
type GetStatsRequest struct {
|
||||||
state protoimpl.MessageState
|
state protoimpl.MessageState
|
||||||
sizeCache protoimpl.SizeCache
|
sizeCache protoimpl.SizeCache
|
||||||
|
@@ -11,6 +11,7 @@ import (
|
|||||||
|
|
||||||
// This is a compile-time assertion to ensure that this generated file
|
// This is a compile-time assertion to ensure that this generated file
|
||||||
// is compatible with the grpc package it is being compiled against.
|
// is compatible with the grpc package it is being compiled against.
|
||||||
|
// Requires gRPC-Go v1.32.0 or later.
|
||||||
const _ = grpc.SupportPackageIsVersion7
|
const _ = grpc.SupportPackageIsVersion7
|
||||||
|
|
||||||
// StatsServiceClient is the client API for StatsService service.
|
// StatsServiceClient is the client API for StatsService service.
|
||||||
@@ -90,7 +91,7 @@ type UnsafeStatsServiceServer interface {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func RegisterStatsServiceServer(s grpc.ServiceRegistrar, srv StatsServiceServer) {
|
func RegisterStatsServiceServer(s grpc.ServiceRegistrar, srv StatsServiceServer) {
|
||||||
s.RegisterService(&_StatsService_serviceDesc, srv)
|
s.RegisterService(&StatsService_ServiceDesc, srv)
|
||||||
}
|
}
|
||||||
|
|
||||||
func _StatsService_GetStats_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
|
func _StatsService_GetStats_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
|
||||||
@@ -147,7 +148,10 @@ func _StatsService_GetSysStats_Handler(srv interface{}, ctx context.Context, dec
|
|||||||
return interceptor(ctx, in, info, handler)
|
return interceptor(ctx, in, info, handler)
|
||||||
}
|
}
|
||||||
|
|
||||||
var _StatsService_serviceDesc = grpc.ServiceDesc{
|
// StatsService_ServiceDesc is the grpc.ServiceDesc for StatsService service.
|
||||||
|
// It's only intended for direct use with grpc.RegisterService,
|
||||||
|
// and not to be introspected or modified (even as a copy)
|
||||||
|
var StatsService_ServiceDesc = grpc.ServiceDesc{
|
||||||
ServiceName: "xray.app.stats.command.StatsService",
|
ServiceName: "xray.app.stats.command.StatsService",
|
||||||
HandlerType: (*StatsServiceServer)(nil),
|
HandlerType: (*StatsServiceServer)(nil),
|
||||||
Methods: []grpc.MethodDesc{
|
Methods: []grpc.MethodDesc{
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: app/stats/config.proto
|
// source: app/stats/config.proto
|
||||||
|
|
||||||
package stats
|
package stats
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
reflect "reflect"
|
reflect "reflect"
|
||||||
@@ -21,10 +20,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
type Config struct {
|
type Config struct {
|
||||||
state protoimpl.MessageState
|
state protoimpl.MessageState
|
||||||
sizeCache protoimpl.SizeCache
|
sizeCache protoimpl.SizeCache
|
||||||
|
@@ -4,6 +4,7 @@ import (
|
|||||||
"io"
|
"io"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common/bytespool"
|
"github.com/xtls/xray-core/common/bytespool"
|
||||||
|
"github.com/xtls/xray-core/common/net"
|
||||||
)
|
)
|
||||||
|
|
||||||
const (
|
const (
|
||||||
@@ -20,20 +21,51 @@ type Buffer struct {
|
|||||||
v []byte
|
v []byte
|
||||||
start int32
|
start int32
|
||||||
end int32
|
end int32
|
||||||
|
UDP *net.Destination
|
||||||
}
|
}
|
||||||
|
|
||||||
// New creates a Buffer with 0 length and 2K capacity.
|
// New creates a Buffer with 0 length and 8K capacity.
|
||||||
func New() *Buffer {
|
func New() *Buffer {
|
||||||
|
buf := pool.Get().([]byte)
|
||||||
|
if cap(buf) >= Size {
|
||||||
|
buf = buf[:Size]
|
||||||
|
} else {
|
||||||
|
buf = make([]byte, Size)
|
||||||
|
}
|
||||||
|
|
||||||
return &Buffer{
|
return &Buffer{
|
||||||
v: pool.Get().([]byte),
|
v: buf,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func NewExisted(b []byte) *Buffer {
|
||||||
|
if cap(b) < Size {
|
||||||
|
panic("Invalid buffer")
|
||||||
|
}
|
||||||
|
|
||||||
|
oLen := len(b)
|
||||||
|
if oLen < Size {
|
||||||
|
b = b[:Size]
|
||||||
|
}
|
||||||
|
|
||||||
|
return &Buffer{
|
||||||
|
v: b,
|
||||||
|
end: int32(oLen),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// StackNew creates a new Buffer object on stack.
|
// StackNew creates a new Buffer object on stack.
|
||||||
// This method is for buffers that is released in the same function.
|
// This method is for buffers that is released in the same function.
|
||||||
func StackNew() Buffer {
|
func StackNew() Buffer {
|
||||||
|
buf := pool.Get().([]byte)
|
||||||
|
if cap(buf) >= Size {
|
||||||
|
buf = buf[:Size]
|
||||||
|
} else {
|
||||||
|
buf = make([]byte, Size)
|
||||||
|
}
|
||||||
|
|
||||||
return Buffer{
|
return Buffer{
|
||||||
v: pool.Get().([]byte),
|
v: buf,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -46,7 +78,11 @@ func (b *Buffer) Release() {
|
|||||||
p := b.v
|
p := b.v
|
||||||
b.v = nil
|
b.v = nil
|
||||||
b.Clear()
|
b.Clear()
|
||||||
pool.Put(p)
|
|
||||||
|
if cap(p) == Size {
|
||||||
|
pool.Put(p)
|
||||||
|
}
|
||||||
|
b.UDP = nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// Clear clears the content of the buffer, results an empty buffer with
|
// Clear clears the content of the buffer, results an empty buffer with
|
||||||
@@ -107,6 +143,9 @@ func (b *Buffer) BytesTo(to int32) []byte {
|
|||||||
if to < 0 {
|
if to < 0 {
|
||||||
to += b.Len()
|
to += b.Len()
|
||||||
}
|
}
|
||||||
|
if to < 0 {
|
||||||
|
to = 0
|
||||||
|
}
|
||||||
return b.v[b.start : b.start+to]
|
return b.v[b.start : b.start+to]
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -6,6 +6,7 @@ import (
|
|||||||
"testing"
|
"testing"
|
||||||
|
|
||||||
"github.com/google/go-cmp/cmp"
|
"github.com/google/go-cmp/cmp"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
. "github.com/xtls/xray-core/common/buf"
|
. "github.com/xtls/xray-core/common/buf"
|
||||||
)
|
)
|
||||||
|
@@ -6,6 +6,9 @@ import (
|
|||||||
"os"
|
"os"
|
||||||
"syscall"
|
"syscall"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
|
"github.com/xtls/xray-core/features/stats"
|
||||||
|
"github.com/xtls/xray-core/transport/internet/stat"
|
||||||
)
|
)
|
||||||
|
|
||||||
// Reader extends io.Reader with MultiBuffer.
|
// Reader extends io.Reader with MultiBuffer.
|
||||||
@@ -29,9 +32,17 @@ type Writer interface {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// WriteAllBytes ensures all bytes are written into the given writer.
|
// WriteAllBytes ensures all bytes are written into the given writer.
|
||||||
func WriteAllBytes(writer io.Writer, payload []byte) error {
|
func WriteAllBytes(writer io.Writer, payload []byte, c stats.Counter) error {
|
||||||
|
wc := 0
|
||||||
|
defer func() {
|
||||||
|
if c != nil {
|
||||||
|
c.Add(int64(wc))
|
||||||
|
}
|
||||||
|
}()
|
||||||
|
|
||||||
for len(payload) > 0 {
|
for len(payload) > 0 {
|
||||||
n, err := writer.Write(payload)
|
n, err := writer.Write(payload)
|
||||||
|
wc += n
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -65,7 +76,13 @@ func NewReader(reader io.Reader) Reader {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
newError("failed to get sysconn").Base(err).WriteToLog()
|
newError("failed to get sysconn").Base(err).WriteToLog()
|
||||||
} else {
|
} else {
|
||||||
return NewReadVReader(reader, rawConn)
|
var counter stats.Counter
|
||||||
|
|
||||||
|
if statConn, ok := reader.(*stat.CounterConnection); ok {
|
||||||
|
reader = statConn.Connection
|
||||||
|
counter = statConn.ReadCounter
|
||||||
|
}
|
||||||
|
return NewReadVReader(reader, rawConn, counter)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -104,13 +121,24 @@ func NewWriter(writer io.Writer) Writer {
|
|||||||
return mw
|
return mw
|
||||||
}
|
}
|
||||||
|
|
||||||
if isPacketWriter(writer) {
|
var iConn = writer
|
||||||
|
if statConn, ok := writer.(*stat.CounterConnection); ok {
|
||||||
|
iConn = statConn.Connection
|
||||||
|
}
|
||||||
|
|
||||||
|
if isPacketWriter(iConn) {
|
||||||
return &SequentialWriter{
|
return &SequentialWriter{
|
||||||
Writer: writer,
|
Writer: writer,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
var counter stats.Counter
|
||||||
|
|
||||||
|
if statConn, ok := writer.(*stat.CounterConnection); ok {
|
||||||
|
counter = statConn.WriteCounter
|
||||||
|
}
|
||||||
return &BufferToBytesWriter{
|
return &BufferToBytesWriter{
|
||||||
Writer: writer,
|
Writer: iConn,
|
||||||
|
counter: counter,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@@ -9,6 +9,7 @@ import (
|
|||||||
"testing"
|
"testing"
|
||||||
|
|
||||||
"github.com/google/go-cmp/cmp"
|
"github.com/google/go-cmp/cmp"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
. "github.com/xtls/xray-core/common/buf"
|
. "github.com/xtls/xray-core/common/buf"
|
||||||
)
|
)
|
||||||
|
@@ -1,6 +1,5 @@
|
|||||||
// +build !windows
|
//go:build !windows && !wasm && !illumos
|
||||||
// +build !wasm
|
// +build !windows,!wasm,!illumos
|
||||||
// +build !illumos
|
|
||||||
|
|
||||||
package buf
|
package buf
|
||||||
|
|
||||||
|
@@ -1,12 +1,14 @@
|
|||||||
|
//go:build !wasm
|
||||||
// +build !wasm
|
// +build !wasm
|
||||||
|
|
||||||
package buf
|
package buf
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"io"
|
"io"
|
||||||
"runtime"
|
|
||||||
"syscall"
|
"syscall"
|
||||||
|
|
||||||
|
"github.com/xtls/xray-core/features/stats"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common/platform"
|
"github.com/xtls/xray-core/common/platform"
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -54,17 +56,19 @@ type ReadVReader struct {
|
|||||||
rawConn syscall.RawConn
|
rawConn syscall.RawConn
|
||||||
mr multiReader
|
mr multiReader
|
||||||
alloc allocStrategy
|
alloc allocStrategy
|
||||||
|
counter stats.Counter
|
||||||
}
|
}
|
||||||
|
|
||||||
// NewReadVReader creates a new ReadVReader.
|
// NewReadVReader creates a new ReadVReader.
|
||||||
func NewReadVReader(reader io.Reader, rawConn syscall.RawConn) *ReadVReader {
|
func NewReadVReader(reader io.Reader, rawConn syscall.RawConn, counter stats.Counter) *ReadVReader {
|
||||||
return &ReadVReader{
|
return &ReadVReader{
|
||||||
Reader: reader,
|
Reader: reader,
|
||||||
rawConn: rawConn,
|
rawConn: rawConn,
|
||||||
alloc: allocStrategy{
|
alloc: allocStrategy{
|
||||||
current: 1,
|
current: 1,
|
||||||
},
|
},
|
||||||
mr: newMultiReader(),
|
mr: newMultiReader(),
|
||||||
|
counter: counter,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -123,10 +127,16 @@ func (r *ReadVReader) ReadMultiBuffer() (MultiBuffer, error) {
|
|||||||
if b.IsFull() {
|
if b.IsFull() {
|
||||||
r.alloc.Adjust(1)
|
r.alloc.Adjust(1)
|
||||||
}
|
}
|
||||||
|
if r.counter != nil && b != nil {
|
||||||
|
r.counter.Add(int64(b.Len()))
|
||||||
|
}
|
||||||
return MultiBuffer{b}, err
|
return MultiBuffer{b}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
mb, err := r.readMulti()
|
mb, err := r.readMulti()
|
||||||
|
if r.counter != nil && mb != nil {
|
||||||
|
r.counter.Add(int64(mb.Len()))
|
||||||
|
}
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return nil, err
|
return nil, err
|
||||||
}
|
}
|
||||||
@@ -134,17 +144,13 @@ func (r *ReadVReader) ReadMultiBuffer() (MultiBuffer, error) {
|
|||||||
return mb, nil
|
return mb, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
var useReadv = true
|
var useReadv bool
|
||||||
|
|
||||||
func init() {
|
func init() {
|
||||||
const defaultFlagValue = "NOT_DEFINED_AT_ALL"
|
const defaultFlagValue = "NOT_DEFINED_AT_ALL"
|
||||||
value := platform.NewEnvFlag("xray.buf.readv").GetValue(func() string { return defaultFlagValue })
|
value := platform.NewEnvFlag("xray.buf.readv").GetValue(func() string { return defaultFlagValue })
|
||||||
switch value {
|
switch value {
|
||||||
case defaultFlagValue, "auto":
|
case defaultFlagValue, "auto", "enable":
|
||||||
if (runtime.GOARCH == "386" || runtime.GOARCH == "amd64" || runtime.GOARCH == "s390x") && (runtime.GOOS == "linux" || runtime.GOOS == "darwin" || runtime.GOOS == "windows") {
|
|
||||||
useReadv = true
|
|
||||||
}
|
|
||||||
case "enable":
|
|
||||||
useReadv = true
|
useReadv = true
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@@ -1,3 +1,4 @@
|
|||||||
|
//go:build wasm
|
||||||
// +build wasm
|
// +build wasm
|
||||||
|
|
||||||
package buf
|
package buf
|
||||||
|
@@ -1,3 +1,4 @@
|
|||||||
|
//go:build !wasm
|
||||||
// +build !wasm
|
// +build !wasm
|
||||||
|
|
||||||
package buf_test
|
package buf_test
|
||||||
@@ -9,10 +10,11 @@ import (
|
|||||||
|
|
||||||
"github.com/google/go-cmp/cmp"
|
"github.com/google/go-cmp/cmp"
|
||||||
|
|
||||||
|
"golang.org/x/sync/errgroup"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
. "github.com/xtls/xray-core/common/buf"
|
. "github.com/xtls/xray-core/common/buf"
|
||||||
"github.com/xtls/xray-core/testing/servers/tcp"
|
"github.com/xtls/xray-core/testing/servers/tcp"
|
||||||
"golang.org/x/sync/errgroup"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
func TestReadvReader(t *testing.T) {
|
func TestReadvReader(t *testing.T) {
|
||||||
@@ -50,7 +52,7 @@ func TestReadvReader(t *testing.T) {
|
|||||||
rawConn, err := conn.(*net.TCPConn).SyscallConn()
|
rawConn, err := conn.(*net.TCPConn).SyscallConn()
|
||||||
common.Must(err)
|
common.Must(err)
|
||||||
|
|
||||||
reader := NewReadVReader(conn, rawConn)
|
reader := NewReadVReader(conn, rawConn, nil)
|
||||||
var rmb MultiBuffer
|
var rmb MultiBuffer
|
||||||
for {
|
for {
|
||||||
mb, err := reader.ReadMultiBuffer()
|
mb, err := reader.ReadMultiBuffer()
|
||||||
|
@@ -1,3 +1,4 @@
|
|||||||
|
//go:build illumos
|
||||||
// +build illumos
|
// +build illumos
|
||||||
|
|
||||||
package buf
|
package buf
|
||||||
|
@@ -5,6 +5,8 @@ import (
|
|||||||
"net"
|
"net"
|
||||||
"sync"
|
"sync"
|
||||||
|
|
||||||
|
"github.com/xtls/xray-core/features/stats"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/errors"
|
"github.com/xtls/xray-core/common/errors"
|
||||||
)
|
)
|
||||||
@@ -13,7 +15,8 @@ import (
|
|||||||
type BufferToBytesWriter struct {
|
type BufferToBytesWriter struct {
|
||||||
io.Writer
|
io.Writer
|
||||||
|
|
||||||
cache [][]byte
|
counter stats.Counter
|
||||||
|
cache [][]byte
|
||||||
}
|
}
|
||||||
|
|
||||||
// WriteMultiBuffer implements Writer. This method takes ownership of the given buffer.
|
// WriteMultiBuffer implements Writer. This method takes ownership of the given buffer.
|
||||||
@@ -26,7 +29,7 @@ func (w *BufferToBytesWriter) WriteMultiBuffer(mb MultiBuffer) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if len(mb) == 1 {
|
if len(mb) == 1 {
|
||||||
return WriteAllBytes(w.Writer, mb[0].Bytes())
|
return WriteAllBytes(w.Writer, mb[0].Bytes(), w.counter)
|
||||||
}
|
}
|
||||||
|
|
||||||
if cap(w.cache) < len(mb) {
|
if cap(w.cache) < len(mb) {
|
||||||
@@ -45,9 +48,15 @@ func (w *BufferToBytesWriter) WriteMultiBuffer(mb MultiBuffer) error {
|
|||||||
}()
|
}()
|
||||||
|
|
||||||
nb := net.Buffers(bs)
|
nb := net.Buffers(bs)
|
||||||
|
wc := int64(0)
|
||||||
|
defer func() {
|
||||||
|
if w.counter != nil {
|
||||||
|
w.counter.Add(wc)
|
||||||
|
}
|
||||||
|
}()
|
||||||
for size > 0 {
|
for size > 0 {
|
||||||
n, err := nb.WriteTo(w.Writer)
|
n, err := nb.WriteTo(w.Writer)
|
||||||
|
wc += n
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -173,7 +182,7 @@ func (w *BufferedWriter) flushInternal() error {
|
|||||||
w.buffer = nil
|
w.buffer = nil
|
||||||
|
|
||||||
if writer, ok := w.writer.(io.Writer); ok {
|
if writer, ok := w.writer.(io.Writer); ok {
|
||||||
err := WriteAllBytes(writer, b.Bytes())
|
err := WriteAllBytes(writer, b.Bytes(), nil)
|
||||||
b.Release()
|
b.Release()
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
85
common/cache/lru.go
vendored
Normal file
85
common/cache/lru.go
vendored
Normal file
@@ -0,0 +1,85 @@
|
|||||||
|
package cache
|
||||||
|
|
||||||
|
import (
|
||||||
|
"container/list"
|
||||||
|
sync "sync"
|
||||||
|
)
|
||||||
|
|
||||||
|
// Lru simple, fast lru cache implementation
|
||||||
|
type Lru interface {
|
||||||
|
Get(key interface{}) (value interface{}, ok bool)
|
||||||
|
GetKeyFromValue(value interface{}) (key interface{}, ok bool)
|
||||||
|
PeekKeyFromValue(value interface{}) (key interface{}, ok bool) // Peek means check but NOT bring to top
|
||||||
|
Put(key, value interface{})
|
||||||
|
}
|
||||||
|
|
||||||
|
type lru struct {
|
||||||
|
capacity int
|
||||||
|
doubleLinkedlist *list.List
|
||||||
|
keyToElement *sync.Map
|
||||||
|
valueToElement *sync.Map
|
||||||
|
mu *sync.Mutex
|
||||||
|
}
|
||||||
|
|
||||||
|
type lruElement struct {
|
||||||
|
key interface{}
|
||||||
|
value interface{}
|
||||||
|
}
|
||||||
|
|
||||||
|
// NewLru init a lru cache
|
||||||
|
func NewLru(cap int) Lru {
|
||||||
|
return lru{
|
||||||
|
capacity: cap,
|
||||||
|
doubleLinkedlist: list.New(),
|
||||||
|
keyToElement: new(sync.Map),
|
||||||
|
valueToElement: new(sync.Map),
|
||||||
|
mu: new(sync.Mutex),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (l lru) Get(key interface{}) (value interface{}, ok bool) {
|
||||||
|
if v, ok := l.keyToElement.Load(key); ok {
|
||||||
|
element := v.(*list.Element)
|
||||||
|
l.doubleLinkedlist.MoveBefore(element, l.doubleLinkedlist.Front())
|
||||||
|
return element.Value.(lruElement).value, true
|
||||||
|
}
|
||||||
|
return nil, false
|
||||||
|
}
|
||||||
|
|
||||||
|
func (l lru) GetKeyFromValue(value interface{}) (key interface{}, ok bool) {
|
||||||
|
if k, ok := l.valueToElement.Load(value); ok {
|
||||||
|
element := k.(*list.Element)
|
||||||
|
l.doubleLinkedlist.MoveBefore(element, l.doubleLinkedlist.Front())
|
||||||
|
return element.Value.(lruElement).key, true
|
||||||
|
}
|
||||||
|
return nil, false
|
||||||
|
}
|
||||||
|
|
||||||
|
func (l lru) PeekKeyFromValue(value interface{}) (key interface{}, ok bool) {
|
||||||
|
if k, ok := l.valueToElement.Load(value); ok {
|
||||||
|
element := k.(*list.Element)
|
||||||
|
return element.Value.(lruElement).key, true
|
||||||
|
}
|
||||||
|
return nil, false
|
||||||
|
}
|
||||||
|
|
||||||
|
func (l lru) Put(key, value interface{}) {
|
||||||
|
e := lruElement{key, value}
|
||||||
|
if v, ok := l.keyToElement.Load(key); ok {
|
||||||
|
element := v.(*list.Element)
|
||||||
|
element.Value = e
|
||||||
|
l.doubleLinkedlist.MoveBefore(element, l.doubleLinkedlist.Front())
|
||||||
|
} else {
|
||||||
|
l.mu.Lock()
|
||||||
|
element := l.doubleLinkedlist.PushFront(e)
|
||||||
|
l.keyToElement.Store(key, element)
|
||||||
|
l.valueToElement.Store(value, element)
|
||||||
|
if l.doubleLinkedlist.Len() > l.capacity {
|
||||||
|
toBeRemove := l.doubleLinkedlist.Back()
|
||||||
|
l.doubleLinkedlist.Remove(toBeRemove)
|
||||||
|
l.keyToElement.Delete(toBeRemove.Value.(lruElement).key)
|
||||||
|
l.valueToElement.Delete(toBeRemove.Value.(lruElement).value)
|
||||||
|
}
|
||||||
|
l.mu.Unlock()
|
||||||
|
}
|
||||||
|
}
|
86
common/cache/lru_test.go
vendored
Normal file
86
common/cache/lru_test.go
vendored
Normal file
@@ -0,0 +1,86 @@
|
|||||||
|
package cache_test
|
||||||
|
|
||||||
|
import (
|
||||||
|
"testing"
|
||||||
|
|
||||||
|
. "github.com/xtls/xray-core/common/cache"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestLruReplaceValue(t *testing.T) {
|
||||||
|
lru := NewLru(2)
|
||||||
|
lru.Put(2, 6)
|
||||||
|
lru.Put(1, 5)
|
||||||
|
lru.Put(1, 2)
|
||||||
|
v, _ := lru.Get(1)
|
||||||
|
if v != 2 {
|
||||||
|
t.Error("should get 2", v)
|
||||||
|
}
|
||||||
|
v, _ = lru.Get(2)
|
||||||
|
if v != 6 {
|
||||||
|
t.Error("should get 6", v)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestLruRemoveOld(t *testing.T) {
|
||||||
|
lru := NewLru(2)
|
||||||
|
v, ok := lru.Get(2)
|
||||||
|
if ok {
|
||||||
|
t.Error("should get nil", v)
|
||||||
|
}
|
||||||
|
lru.Put(1, 1)
|
||||||
|
lru.Put(2, 2)
|
||||||
|
v, _ = lru.Get(1)
|
||||||
|
if v != 1 {
|
||||||
|
t.Error("should get 1", v)
|
||||||
|
}
|
||||||
|
lru.Put(3, 3)
|
||||||
|
v, ok = lru.Get(2)
|
||||||
|
if ok {
|
||||||
|
t.Error("should get nil", v)
|
||||||
|
}
|
||||||
|
lru.Put(4, 4)
|
||||||
|
v, ok = lru.Get(1)
|
||||||
|
if ok {
|
||||||
|
t.Error("should get nil", v)
|
||||||
|
}
|
||||||
|
v, _ = lru.Get(3)
|
||||||
|
if v != 3 {
|
||||||
|
t.Error("should get 3", v)
|
||||||
|
}
|
||||||
|
v, _ = lru.Get(4)
|
||||||
|
if v != 4 {
|
||||||
|
t.Error("should get 4", v)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestGetKeyFromValue(t *testing.T) {
|
||||||
|
lru := NewLru(2)
|
||||||
|
lru.Put(3, 3)
|
||||||
|
lru.Put(2, 2)
|
||||||
|
lru.GetKeyFromValue(3)
|
||||||
|
lru.Put(1, 1)
|
||||||
|
v, ok := lru.GetKeyFromValue(2)
|
||||||
|
if ok {
|
||||||
|
t.Error("should get nil", v)
|
||||||
|
}
|
||||||
|
v, _ = lru.GetKeyFromValue(3)
|
||||||
|
if v != 3 {
|
||||||
|
t.Error("should get 3", v)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestPeekKeyFromValue(t *testing.T) {
|
||||||
|
lru := NewLru(2)
|
||||||
|
lru.Put(3, 3)
|
||||||
|
lru.Put(2, 2)
|
||||||
|
lru.PeekKeyFromValue(3)
|
||||||
|
lru.Put(1, 1)
|
||||||
|
v, ok := lru.PeekKeyFromValue(3)
|
||||||
|
if ok {
|
||||||
|
t.Error("should get nil", v)
|
||||||
|
}
|
||||||
|
v, _ = lru.PeekKeyFromValue(2)
|
||||||
|
if v != 2 {
|
||||||
|
t.Error("should get 2", v)
|
||||||
|
}
|
||||||
|
}
|
@@ -1,3 +1,4 @@
|
|||||||
|
//go:build generate
|
||||||
// +build generate
|
// +build generate
|
||||||
|
|
||||||
package main
|
package main
|
||||||
|
@@ -50,7 +50,7 @@ func NewCryptionWriter(stream cipher.Stream, writer io.Writer) *CryptionWriter {
|
|||||||
func (w *CryptionWriter) Write(data []byte) (int, error) {
|
func (w *CryptionWriter) Write(data []byte) (int, error) {
|
||||||
w.stream.XORKeyStream(data, data)
|
w.stream.XORKeyStream(data, data)
|
||||||
|
|
||||||
if err := buf.WriteAllBytes(w.writer, data); err != nil {
|
if err := buf.WriteAllBytes(w.writer, data, nil); err != nil {
|
||||||
return 0, err
|
return 0, err
|
||||||
}
|
}
|
||||||
return len(data), nil
|
return len(data), nil
|
||||||
|
@@ -2,11 +2,8 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
"log"
|
|
||||||
"os"
|
"os"
|
||||||
"path/filepath"
|
"path/filepath"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
func main() {
|
func main() {
|
||||||
@@ -20,26 +17,21 @@ func main() {
|
|||||||
pkg = "core"
|
pkg = "core"
|
||||||
}
|
}
|
||||||
|
|
||||||
moduleName, gmnErr := common.GetModuleName(pwd)
|
|
||||||
if gmnErr != nil {
|
|
||||||
fmt.Println("can not get module path", gmnErr)
|
|
||||||
os.Exit(1)
|
|
||||||
}
|
|
||||||
|
|
||||||
file, err := os.OpenFile("errors.generated.go", os.O_WRONLY|os.O_TRUNC|os.O_CREATE, 0644)
|
file, err := os.OpenFile("errors.generated.go", os.O_WRONLY|os.O_TRUNC|os.O_CREATE, 0644)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
log.Fatalf("Failed to generate errors.generated.go: %v", err)
|
fmt.Printf("Failed to generate errors.generated.go: %v", err)
|
||||||
os.Exit(1)
|
os.Exit(1)
|
||||||
}
|
}
|
||||||
defer file.Close()
|
defer file.Close()
|
||||||
|
|
||||||
fmt.Fprintln(file, "package", pkg)
|
fmt.Fprintf(file, `package %s
|
||||||
fmt.Fprintln(file, "")
|
|
||||||
fmt.Fprintln(file, "import \""+moduleName+"/common/errors\"")
|
import "github.com/xtls/xray-core/common/errors"
|
||||||
fmt.Fprintln(file, "")
|
|
||||||
fmt.Fprintln(file, "type errPathObjHolder struct{}")
|
type errPathObjHolder struct{}
|
||||||
fmt.Fprintln(file, "")
|
|
||||||
fmt.Fprintln(file, "func newError(values ...interface{}) *errors.Error {")
|
func newError(values ...interface{}) *errors.Error {
|
||||||
fmt.Fprintln(file, " return errors.New(values...).WithPathObj(errPathObjHolder{})")
|
return errors.New(values...).WithPathObj(errPathObjHolder{})
|
||||||
fmt.Fprintln(file, "}")
|
}
|
||||||
|
`, pkg)
|
||||||
}
|
}
|
||||||
|
@@ -40,10 +40,8 @@ func (err *Error) pkgPath() string {
|
|||||||
return ""
|
return ""
|
||||||
}
|
}
|
||||||
path := reflect.TypeOf(err.pathObj).PkgPath()
|
path := reflect.TypeOf(err.pathObj).PkgPath()
|
||||||
for i := 0; i < len(path); i++ {
|
if len(path) >= trim {
|
||||||
if path[i] == '/' {
|
return path[trim:]
|
||||||
return path[trim:]
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
return path
|
return path
|
||||||
}
|
}
|
||||||
|
@@ -36,19 +36,23 @@ func (m *AccessMessage) String() string {
|
|||||||
builder.WriteString(string(m.Status))
|
builder.WriteString(string(m.Status))
|
||||||
builder.WriteByte(' ')
|
builder.WriteByte(' ')
|
||||||
builder.WriteString(serial.ToString(m.To))
|
builder.WriteString(serial.ToString(m.To))
|
||||||
builder.WriteByte(' ')
|
|
||||||
if len(m.Detour) > 0 {
|
if len(m.Detour) > 0 {
|
||||||
builder.WriteByte('[')
|
builder.WriteString(" [")
|
||||||
builder.WriteString(m.Detour)
|
builder.WriteString(m.Detour)
|
||||||
builder.WriteString("] ")
|
builder.WriteByte(']')
|
||||||
|
}
|
||||||
|
|
||||||
|
if reason := serial.ToString(m.Reason); len(reason) > 0 {
|
||||||
|
builder.WriteString(" ")
|
||||||
|
builder.WriteString(reason)
|
||||||
}
|
}
|
||||||
builder.WriteString(serial.ToString(m.Reason))
|
|
||||||
|
|
||||||
if len(m.Email) > 0 {
|
if len(m.Email) > 0 {
|
||||||
builder.WriteString("email:")
|
builder.WriteString(" email: ")
|
||||||
builder.WriteString(m.Email)
|
builder.WriteString(m.Email)
|
||||||
builder.WriteByte(' ')
|
|
||||||
}
|
}
|
||||||
|
|
||||||
return builder.String()
|
return builder.String()
|
||||||
}
|
}
|
||||||
|
|
||||||
|
59
common/log/dns.go
Normal file
59
common/log/dns.go
Normal file
@@ -0,0 +1,59 @@
|
|||||||
|
package log
|
||||||
|
|
||||||
|
import (
|
||||||
|
"net"
|
||||||
|
"strings"
|
||||||
|
"time"
|
||||||
|
)
|
||||||
|
|
||||||
|
type DNSLog struct {
|
||||||
|
Server string
|
||||||
|
Domain string
|
||||||
|
Result []net.IP
|
||||||
|
Status dnsStatus
|
||||||
|
Elapsed time.Duration
|
||||||
|
Error error
|
||||||
|
}
|
||||||
|
|
||||||
|
func (l *DNSLog) String() string {
|
||||||
|
builder := &strings.Builder{}
|
||||||
|
|
||||||
|
// Server got answer: domain -> [ip1, ip2] 23ms
|
||||||
|
builder.WriteString(l.Server)
|
||||||
|
builder.WriteString(" ")
|
||||||
|
builder.WriteString(string(l.Status))
|
||||||
|
builder.WriteString(" ")
|
||||||
|
builder.WriteString(l.Domain)
|
||||||
|
builder.WriteString(" -> [")
|
||||||
|
builder.WriteString(joinNetIP(l.Result))
|
||||||
|
builder.WriteString("]")
|
||||||
|
|
||||||
|
if l.Elapsed > 0 {
|
||||||
|
builder.WriteString(" ")
|
||||||
|
builder.WriteString(l.Elapsed.String())
|
||||||
|
}
|
||||||
|
if l.Error != nil {
|
||||||
|
builder.WriteString(" <")
|
||||||
|
builder.WriteString(l.Error.Error())
|
||||||
|
builder.WriteString(">")
|
||||||
|
}
|
||||||
|
return builder.String()
|
||||||
|
}
|
||||||
|
|
||||||
|
type dnsStatus string
|
||||||
|
|
||||||
|
var (
|
||||||
|
DNSQueried = dnsStatus("got answer:")
|
||||||
|
DNSCacheHit = dnsStatus("cache HIT:")
|
||||||
|
)
|
||||||
|
|
||||||
|
func joinNetIP(ips []net.IP) string {
|
||||||
|
if len(ips) == 0 {
|
||||||
|
return ""
|
||||||
|
}
|
||||||
|
sips := make([]string, 0, len(ips))
|
||||||
|
for _, ip := range ips {
|
||||||
|
sips = append(sips, ip.String())
|
||||||
|
}
|
||||||
|
return strings.Join(sips, ", ")
|
||||||
|
}
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: common/log/log.proto
|
// source: common/log/log.proto
|
||||||
|
|
||||||
package log
|
package log
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
reflect "reflect"
|
reflect "reflect"
|
||||||
@@ -21,10 +20,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
type Severity int32
|
type Severity int32
|
||||||
|
|
||||||
const (
|
const (
|
||||||
|
@@ -330,7 +330,7 @@ func (m *ClientWorker) handleStatusKeep(meta *FrameMetadata, reader *buf.Buffere
|
|||||||
return buf.Copy(NewStreamReader(reader), buf.Discard)
|
return buf.Copy(NewStreamReader(reader), buf.Discard)
|
||||||
}
|
}
|
||||||
|
|
||||||
rr := s.NewReader(reader)
|
rr := s.NewReader(reader, &meta.Target)
|
||||||
err := buf.Copy(rr, s.output)
|
err := buf.Copy(rr, s.output)
|
||||||
if err != nil && buf.IsWriteError(err) {
|
if err != nil && buf.IsWriteError(err) {
|
||||||
newError("failed to write to downstream. closing session ", s.ID).Base(err).WriteToLog()
|
newError("failed to write to downstream. closing session ", s.ID).Base(err).WriteToLog()
|
||||||
|
@@ -6,6 +6,7 @@ import (
|
|||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/golang/mock/gomock"
|
"github.com/golang/mock/gomock"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/errors"
|
"github.com/xtls/xray-core/common/errors"
|
||||||
"github.com/xtls/xray-core/common/mux"
|
"github.com/xtls/xray-core/common/mux"
|
||||||
|
@@ -81,6 +81,9 @@ func (f FrameMetadata) WriteTo(b *buf.Buffer) error {
|
|||||||
if err := addrParser.WriteAddressPort(b, f.Target.Address, f.Target.Port); err != nil {
|
if err := addrParser.WriteAddressPort(b, f.Target.Address, f.Target.Port); err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
} else if b.UDP != nil {
|
||||||
|
b.WriteByte(byte(TargetNetworkUDP))
|
||||||
|
addrParser.WriteAddressPort(b, b.UDP.Address, b.UDP.Port)
|
||||||
}
|
}
|
||||||
|
|
||||||
len1 := b.Len()
|
len1 := b.Len()
|
||||||
@@ -119,7 +122,7 @@ func (f *FrameMetadata) UnmarshalFromBuffer(b *buf.Buffer) error {
|
|||||||
f.Option = bitmask.Byte(b.Byte(3))
|
f.Option = bitmask.Byte(b.Byte(3))
|
||||||
f.Target.Network = net.Network_Unknown
|
f.Target.Network = net.Network_Unknown
|
||||||
|
|
||||||
if f.SessionStatus == SessionStatusNew {
|
if f.SessionStatus == SessionStatusNew || (f.SessionStatus == SessionStatusKeep && b.Len() != 4) {
|
||||||
if b.Len() < 8 {
|
if b.Len() < 8 {
|
||||||
return newError("insufficient buffer: ", b.Len())
|
return newError("insufficient buffer: ", b.Len())
|
||||||
}
|
}
|
||||||
|
@@ -5,6 +5,7 @@ import (
|
|||||||
|
|
||||||
"github.com/xtls/xray-core/common/buf"
|
"github.com/xtls/xray-core/common/buf"
|
||||||
"github.com/xtls/xray-core/common/crypto"
|
"github.com/xtls/xray-core/common/crypto"
|
||||||
|
"github.com/xtls/xray-core/common/net"
|
||||||
"github.com/xtls/xray-core/common/serial"
|
"github.com/xtls/xray-core/common/serial"
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -12,13 +13,15 @@ import (
|
|||||||
type PacketReader struct {
|
type PacketReader struct {
|
||||||
reader io.Reader
|
reader io.Reader
|
||||||
eof bool
|
eof bool
|
||||||
|
dest *net.Destination
|
||||||
}
|
}
|
||||||
|
|
||||||
// NewPacketReader creates a new PacketReader.
|
// NewPacketReader creates a new PacketReader.
|
||||||
func NewPacketReader(reader io.Reader) *PacketReader {
|
func NewPacketReader(reader io.Reader, dest *net.Destination) *PacketReader {
|
||||||
return &PacketReader{
|
return &PacketReader{
|
||||||
reader: reader,
|
reader: reader,
|
||||||
eof: false,
|
eof: false,
|
||||||
|
dest: dest,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -43,6 +46,9 @@ func (r *PacketReader) ReadMultiBuffer() (buf.MultiBuffer, error) {
|
|||||||
return nil, err
|
return nil, err
|
||||||
}
|
}
|
||||||
r.eof = true
|
r.eof = true
|
||||||
|
if r.dest != nil && r.dest.Network == net.Network_UDP {
|
||||||
|
b.UDP = r.dest
|
||||||
|
}
|
||||||
return buf.MultiBuffer{b}, nil
|
return buf.MultiBuffer{b}, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -145,7 +145,7 @@ func (w *ServerWorker) handleStatusNew(ctx context.Context, meta *FrameMetadata,
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
rr := s.NewReader(reader)
|
rr := s.NewReader(reader, &meta.Target)
|
||||||
if err := buf.Copy(rr, s.output); err != nil {
|
if err := buf.Copy(rr, s.output); err != nil {
|
||||||
buf.Copy(rr, buf.Discard)
|
buf.Copy(rr, buf.Discard)
|
||||||
common.Interrupt(s.input)
|
common.Interrupt(s.input)
|
||||||
@@ -168,7 +168,7 @@ func (w *ServerWorker) handleStatusKeep(meta *FrameMetadata, reader *buf.Buffere
|
|||||||
return buf.Copy(NewStreamReader(reader), buf.Discard)
|
return buf.Copy(NewStreamReader(reader), buf.Discard)
|
||||||
}
|
}
|
||||||
|
|
||||||
rr := s.NewReader(reader)
|
rr := s.NewReader(reader, &meta.Target)
|
||||||
err := buf.Copy(rr, s.output)
|
err := buf.Copy(rr, s.output)
|
||||||
|
|
||||||
if err != nil && buf.IsWriteError(err) {
|
if err != nil && buf.IsWriteError(err) {
|
||||||
|
@@ -5,6 +5,7 @@ import (
|
|||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/buf"
|
"github.com/xtls/xray-core/common/buf"
|
||||||
|
"github.com/xtls/xray-core/common/net"
|
||||||
"github.com/xtls/xray-core/common/protocol"
|
"github.com/xtls/xray-core/common/protocol"
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -152,9 +153,9 @@ func (s *Session) Close() error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// NewReader creates a buf.Reader based on the transfer type of this Session.
|
// NewReader creates a buf.Reader based on the transfer type of this Session.
|
||||||
func (s *Session) NewReader(reader *buf.BufferedReader) buf.Reader {
|
func (s *Session) NewReader(reader *buf.BufferedReader, dest *net.Destination) buf.Reader {
|
||||||
if s.transferType == protocol.TransferTypeStream {
|
if s.transferType == protocol.TransferTypeStream {
|
||||||
return NewStreamReader(reader)
|
return NewStreamReader(reader)
|
||||||
}
|
}
|
||||||
return NewPacketReader(reader)
|
return NewPacketReader(reader, dest)
|
||||||
}
|
}
|
||||||
|
@@ -63,6 +63,9 @@ func (w *Writer) writeMetaOnly() error {
|
|||||||
|
|
||||||
func writeMetaWithFrame(writer buf.Writer, meta FrameMetadata, data buf.MultiBuffer) error {
|
func writeMetaWithFrame(writer buf.Writer, meta FrameMetadata, data buf.MultiBuffer) error {
|
||||||
frame := buf.New()
|
frame := buf.New()
|
||||||
|
if len(data) == 1 {
|
||||||
|
frame.UDP = data[0].UDP
|
||||||
|
}
|
||||||
if err := meta.WriteTo(frame); err != nil {
|
if err := meta.WriteTo(frame); err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: common/net/address.proto
|
// source: common/net/address.proto
|
||||||
|
|
||||||
package net
|
package net
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
reflect "reflect"
|
reflect "reflect"
|
||||||
@@ -21,10 +20,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
// Address of a network host. It may be either an IP address or a domain
|
// Address of a network host. It may be either an IP address or a domain
|
||||||
// address.
|
// address.
|
||||||
type IPOrDomain struct {
|
type IPOrDomain struct {
|
||||||
|
@@ -1,12 +1,12 @@
|
|||||||
package net
|
package cnc
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"io"
|
"io"
|
||||||
"net"
|
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/xtls/xray-core/common"
|
"github.com/xtls/xray-core/common"
|
||||||
"github.com/xtls/xray-core/common/buf"
|
"github.com/xtls/xray-core/common/buf"
|
||||||
|
"github.com/xtls/xray-core/common/net"
|
||||||
"github.com/xtls/xray-core/common/signal/done"
|
"github.com/xtls/xray-core/common/signal/done"
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -88,8 +88,8 @@ type connection struct {
|
|||||||
writer buf.Writer
|
writer buf.Writer
|
||||||
done *done.Instance
|
done *done.Instance
|
||||||
onClose io.Closer
|
onClose io.Closer
|
||||||
local Addr
|
local net.Addr
|
||||||
remote Addr
|
remote net.Addr
|
||||||
}
|
}
|
||||||
|
|
||||||
func (c *connection) Read(b []byte) (int, error) {
|
func (c *connection) Read(b []byte) (int, error) {
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: common/net/destination.proto
|
// source: common/net/destination.proto
|
||||||
|
|
||||||
package net
|
package net
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
reflect "reflect"
|
reflect "reflect"
|
||||||
@@ -21,10 +20,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
// Endpoint of a network connection.
|
// Endpoint of a network connection.
|
||||||
type Endpoint struct {
|
type Endpoint struct {
|
||||||
state protoimpl.MessageState
|
state protoimpl.MessageState
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: common/net/network.proto
|
// source: common/net/network.proto
|
||||||
|
|
||||||
package net
|
package net
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
reflect "reflect"
|
reflect "reflect"
|
||||||
@@ -21,10 +20,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
type Network int32
|
type Network int32
|
||||||
|
|
||||||
const (
|
const (
|
||||||
|
@@ -1,13 +1,12 @@
|
|||||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||||
// versions:
|
// versions:
|
||||||
// protoc-gen-go v1.25.0
|
// protoc-gen-go v1.27.1
|
||||||
// protoc v3.14.0
|
// protoc v3.18.0
|
||||||
// source: common/net/port.proto
|
// source: common/net/port.proto
|
||||||
|
|
||||||
package net
|
package net
|
||||||
|
|
||||||
import (
|
import (
|
||||||
proto "github.com/golang/protobuf/proto"
|
|
||||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||||
reflect "reflect"
|
reflect "reflect"
|
||||||
@@ -21,10 +20,6 @@ const (
|
|||||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||||
)
|
)
|
||||||
|
|
||||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
|
||||||
// of the legacy proto package is being used.
|
|
||||||
const _ = proto.ProtoPackageIsVersion4
|
|
||||||
|
|
||||||
// PortRange represents a range of ports.
|
// PortRange represents a range of ports.
|
||||||
type PortRange struct {
|
type PortRange struct {
|
||||||
state protoimpl.MessageState
|
state protoimpl.MessageState
|
||||||
|
@@ -1,4 +1,4 @@
|
|||||||
package jsonem
|
package ocsp
|
||||||
|
|
||||||
import "github.com/xtls/xray-core/common/errors"
|
import "github.com/xtls/xray-core/common/errors"
|
||||||
|
|
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user