v1.4.5

Co-authored-by: JimhHan <50871214+JimhHan@users.noreply.github.com>

.github/build/friendly-filenames.json

@@ -0,0 +1,33 @@
+{
+  "android-arm64": { "friendlyName": "android-arm64-v8a" },
+  "darwin-amd64": { "friendlyName": "macos-64" },
+  "darwin-arm64": { "friendlyName": "macos-arm64-v8a" },
+  "dragonfly-amd64": { "friendlyName": "dragonfly-64" },
+  "freebsd-386": { "friendlyName": "freebsd-32" },
+  "freebsd-amd64": { "friendlyName": "freebsd-64" },
+  "freebsd-arm64": { "friendlyName": "freebsd-arm64-v8a" },
+  "freebsd-arm7": { "friendlyName": "freebsd-arm32-v7a" },
+  "linux-386": { "friendlyName": "linux-32" },
+  "linux-amd64": { "friendlyName": "linux-64" },
+  "linux-arm5": { "friendlyName": "linux-arm32-v5" },
+  "linux-arm64": { "friendlyName": "linux-arm64-v8a" },
+  "linux-arm6": { "friendlyName": "linux-arm32-v6" },
+  "linux-arm7": { "friendlyName": "linux-arm32-v7a" },
+  "linux-mips64le": { "friendlyName": "linux-mips64le" },
+  "linux-mips64": { "friendlyName": "linux-mips64" },
+  "linux-mipslesoftfloat": { "friendlyName": "linux-mips32le-softfloat" },
+  "linux-mipsle": { "friendlyName": "linux-mips32le" },
+  "linux-mipssoftfloat": { "friendlyName": "linux-mips32-softfloat" },
+  "linux-mips": { "friendlyName": "linux-mips32" },
+  "linux-ppc64le": { "friendlyName": "linux-ppc64le" },
+  "linux-ppc64": { "friendlyName": "linux-ppc64" },
+  "linux-riscv64": { "friendlyName": "linux-riscv64" },
+  "linux-s390x": { "friendlyName": "linux-s390x" },
+  "openbsd-386": { "friendlyName": "openbsd-32" },
+  "openbsd-amd64": { "friendlyName": "openbsd-64" },
+  "openbsd-arm64": { "friendlyName": "openbsd-arm64-v8a" },
+  "openbsd-arm7": { "friendlyName": "openbsd-arm32-v7a" },
+  "windows-386": { "friendlyName": "windows-32" },
+  "windows-amd64": { "friendlyName": "windows-64" },
+  "windows-arm7": { "friendlyName": "windows-arm32-v7a" }
+}

.github/workflows/release.yml

@@ -0,0 +1,204 @@
+name: Build and Release
+
+on:
+  workflow_dispatch:
+  release:
+    types: [published]
+  push:
+    branches:
+      - main
+    paths:
+      - "**/*.go"
+      - "go.mod"
+      - "go.sum"
+      - ".github/workflows/*.yml"
+  pull_request:
+    types: [opened, synchronize, reopened]
+    paths:
+      - "**/*.go"
+      - "go.mod"
+      - "go.sum"
+      - ".github/workflows/*.yml"
+jobs:
+  build:
+    strategy:
+      matrix:
+        # Include amd64 on all platforms.
+        goos: [windows, freebsd, openbsd, linux, dragonfly, darwin]
+        goarch: [amd64, 386]
+        exclude:
+          # Exclude i386 on darwin and dragonfly.
+          - goarch: 386
+            goos: dragonfly
+          - goarch: 386
+            goos: darwin
+        include:
+          # BEIGIN MacOS ARM64
+          - goos: darwin
+            goarch: arm64
+          # END MacOS ARM64
+          # BEGIN Linux ARM 5 6 7
+          - goos: linux
+            goarch: arm
+            goarm: 7
+          - goos: linux
+            goarch: arm
+            goarm: 6
+          - goos: linux
+            goarch: arm
+            goarm: 5
+          # END Linux ARM 5 6 7
+          # BEGIN Android ARM 8
+          - goos: android
+            goarch: arm64
+          # END Android ARM 8
+          # Windows ARM 7
+          - goos: windows
+            goarch: arm
+            goarm: 7
+          # BEGIN Other architectures
+          # BEGIN riscv64 & ARM64
+          - goos: linux
+            goarch: arm64
+          - goos: linux
+            goarch: riscv64
+          # END riscv64 & ARM64
+          # BEGIN MIPS
+          - goos: linux
+            goarch: mips64
+          - goos: linux
+            goarch: mips64le
+          - goos: linux
+            goarch: mipsle
+          - goos: linux
+            goarch: mips
+          # END MIPS
+          # BEGIN PPC
+          - goos: linux
+            goarch: ppc64
+          - goos: linux
+            goarch: ppc64le
+          # END PPC
+          # BEGIN FreeBSD ARM
+          - goos: freebsd
+            goarch: arm64
+          - goos: freebsd
+            goarch: arm
+            goarm: 7
+          # END FreeBSD ARM
+          # BEGIN S390X
+          - goos: linux
+            goarch: s390x
+          # END S390X
+          # END Other architectures
+          # BEGIN OPENBSD ARM
+          - goos: openbsd
+            goarch: arm64
+          - goos: openbsd
+            goarch: arm
+            goarm: 7
+          # END OPENBSD ARM
+      fail-fast: false
+
+    runs-on: ubuntu-latest
+    env:
+      GOOS: ${{ matrix.goos }}
+      GOARCH: ${{ matrix.goarch }}
+      GOARM: ${{ matrix.goarm }}
+      CGO_ENABLED: 0
+    steps:
+      - name: Checkout codebase
+        uses: actions/checkout@v2
+
+      - name: Show workflow information 
+        id: get_filename
+        run: |
+          export _NAME=$(jq ".[\"$GOOS-$GOARCH$GOARM$GOMIPS\"].friendlyName" -r < .github/build/friendly-filenames.json)
+          echo "GOOS: $GOOS, GOARCH: $GOARCH, GOARM: $GOARM, GOMIPS: $GOMIPS, RELEASE_NAME: $_NAME"
+          echo "::set-output name=ASSET_NAME::$_NAME"
+          echo "ASSET_NAME=$_NAME" >> $GITHUB_ENV
+
+      - name: Set up Go
+        uses: actions/setup-go@v2
+        with:
+          go-version: ^1.17.1
+
+      - name: Get project dependencies
+        run: go mod download
+      
+      - name: Replace Custom to Commit ID
+        if: github.event_name != 'release'
+        run: |
+          ID=$(git rev-parse --short ${{ github.sha }})
+          if [ "${{ github.event_name }}" == 'pull_request' ]
+          then
+            ID=$(git rev-parse --short ${{ github.event.pull_request.head.sha }})
+          fi
+          sed -i '/build/ s/Custom/'$ID'/' ./core/core.go
+ 
+      - name: Build Xray
+        run: |
+          mkdir -p build_assets
+          go build -v -o build_assets/xray -trimpath -ldflags "-s -w -buildid=" ./main
+    
+      - name: Build Mips softfloat Xray
+        if: matrix.goarch == 'mips' || matrix.goarch == 'mipsle'
+        run: |
+          GOMIPS=softfloat go build -v -o build_assets/xray_softfloat -trimpath -ldflags "-s -w -buildid=" ./main
+
+      - name: Rename Windows Xray
+        if: matrix.goos == 'windows'
+        run: |
+          cd ./build_assets || exit 1
+          mv xray xray.exe
+
+      - name: Prepare to release
+        run: |
+          cp ${GITHUB_WORKSPACE}/README.md ./build_assets/README.md
+          cp ${GITHUB_WORKSPACE}/LICENSE ./build_assets/LICENSE
+          LIST=('geoip geoip geoip' 'domain-list-community dlc geosite')
+          for i in "${LIST[@]}"
+          do
+            INFO=($(echo $i | awk 'BEGIN{FS=" ";OFS=" "} {print $1,$2,$3}'))
+            LASTEST_TAG="$(curl -sL "https://api.github.com/repos/v2fly/${INFO[0]}/releases" | jq -r ".[0].tag_name" || echo "latest")"
+            FILE_NAME="${INFO[2]}.dat"
+            echo -e "Downloading ${FILE_NAME}..."
+            curl -L "https://github.com/v2fly/${INFO[0]}/releases/download/${LASTEST_TAG}/${INFO[1]}.dat" -o ./build_assets/${FILE_NAME}
+            echo -e "Verifying HASH key..."
+            HASH="$(curl -sL "https://github.com/v2fly/${INFO[0]}/releases/download/${LASTEST_TAG}/${INFO[1]}.dat.sha256sum" | awk -F ' ' '{print $1}')"
+            [ "$(sha256sum "./build_assets/${FILE_NAME}" | awk -F ' ' '{print $1}')" == "${HASH}" ] || { echo -e "The HASH key of ${FILE_NAME} does not match cloud one."; exit 1; }
+          done
+
+      - name: Create ZIP archive
+        shell: bash
+        run: |
+          pushd build_assets || exit 1
+          touch -mt $(date +%Y01010000) *
+          zip -9vr ../Xray-$ASSET_NAME.zip .
+          popd || exit 1
+          FILE=./Xray-$ASSET_NAME.zip
+          DGST=$FILE.dgst
+          for METHOD in {"md5","sha1","sha256","sha512"}
+          do
+            openssl dgst -$METHOD $FILE | sed 's/([^)]*)//g' >>$DGST
+          done
+
+      - name: Change the name
+        run: |
+          mv build_assets Xray-$ASSET_NAME
+
+      - name: Upload files to Artifacts
+        uses: actions/upload-artifact@v2
+        with:
+          name: Xray-${{ steps.get_filename.outputs.ASSET_NAME }}
+          path: |
+            ./Xray-${{ steps.get_filename.outputs.ASSET_NAME }}/*
+
+      - name: Upload binaries to release
+        uses: svenstaro/upload-release-action@v2
+        if: github.event_name == 'release'
+        with:
+          repo_token: ${{ secrets.GITHUB_TOKEN }}
+          file: ./Xray-${{ steps.get_filename.outputs.ASSET_NAME }}.zip*
+          tag: ${{ github.ref }}
+          file_glob: true

.github/workflows/test.yml

@@ -0,0 +1,48 @@
+name: Test
+
+on:
+  push:
+    branches:
+      - main
+    paths:
+      - "**/*.go"
+      - "go.mod"
+      - "go.sum"
+      - ".github/workflows/*.yml"
+  pull_request:
+    types: [opened, synchronize, reopened]
+    paths:
+      - "**/*.go"
+      - "go.mod"
+      - "go.sum"
+      - ".github/workflows/*.yml"
+
+jobs:
+  test:
+    runs-on: ${{ matrix.os }}
+    strategy:
+      fail-fast: false
+      matrix:
+        os: [windows-latest, ubuntu-latest, macos-latest]
+    steps:
+      - name: Set up Go
+        uses: actions/setup-go@v2
+        with:
+          go-version: ^1.17.1
+      - name: Checkout codebase
+        uses: actions/checkout@v2
+
+      - name: Prepare geo*dat
+        if: ${{ matrix.os != 'windows-latest' }}
+        run: |
+          mkdir resources
+          wget -O ./resources/geoip.dat https://github.com/v2fly/geoip/releases/latest/download/geoip.dat
+          wget -O ./resources/geosite.dat https://github.com/v2fly/domain-list-community/releases/latest/download/dlc.dat
+      - name: Prepare geo*dat for Windows
+        if: ${{ matrix.os == 'windows-latest' }}
+        run: |
+          mkdir resources
+          Invoke-WebRequest -Uri "https://github.com/v2fly/geoip/releases/latest/download/geoip.dat" -OutFile "./resources/geoip.dat"
+          Invoke-WebRequest -Uri "https://github.com/v2fly/domain-list-community/releases/latest/download/dlc.dat" -OutFile "./resources/geosite.dat"
+      - name: Test
+        run: go test -timeout 1h -v ./...

README.md

@@ -17,9 +17,15 @@
 - One Click
   - [ProxySU](https://github.com/proxysu/ProxySU)
   - [v2ray-agent](https://github.com/mack-a/v2ray-agent)
+  - [Xray-yes](https://github.com/jiuqi9997/Xray-yes)
+  - [Xray_onekey](https://github.com/wulabing/Xray_onekey)
 - Magisk
   - [Xray4Magisk](https://github.com/CerteKim/Xray4Magisk)
   - [Xray_For_Magisk](https://github.com/E7KMbb/Xray_For_Magisk)
+- Homebrew
+  - `brew install xray`
+  - [(Tap) Repository 0](https://github.com/N4FA/homebrew-xray)
+  - [(Tap) Repository 1](https://github.com/xiruizhao/homebrew-xray)
 
 ## Usage
 
@@ -29,12 +35,21 @@
 
 - OpenWrt
   - [PassWall](https://github.com/xiaorouji/openwrt-passwall)
+  - [Hello World](https://github.com/jerrykuku/luci-app-vssr)
+  - [ShadowSocksR Plus+](https://github.com/fw876/helloworld)
+  - [luci-app-xray](https://github.com/yichya/luci-app-xray) ([openwrt-xray](https://github.com/yichya/openwrt-xray))
 - Windows
   - [v2rayN](https://github.com/2dust/v2rayN)
+  - [Qv2ray](https://github.com/Qv2ray/Qv2ray)  (This project had been archived and currently inactive)
+  - [Netch (NetFilter & TUN/TAP)](https://github.com/NetchX/Netch)
 - Android
   - [v2rayNG](https://github.com/2dust/v2rayNG)
-- iOS / Mac
+  - [AnXray](https://github.com/XTLS/AnXray)
+  - [Kitsunebi](https://github.com/rurirei/Kitsunebi/tree/release_xtls)
+- iOS & macOS (with M1 chip)
   - [Shadowrocket](https://apps.apple.com/app/shadowrocket/id932747118)
+- macOS (Intel chip & M1 chip)
+  - [Qv2ray](https://github.com/Qv2ray/Qv2ray) (This project had been archived and currently inactive)
 
 ## Credits
 

app/commander/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/commander/config.proto
 
 package commander
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	serial "github.com/xtls/xray-core/common/serial"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
@@ -22,10 +21,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 // Config is the settings for Commander.
 type Config struct {
 	state         protoimpl.MessageState

app/commander/outbound.go

@@ -6,6 +6,7 @@ import (
 
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/net/cnc"
 	"github.com/xtls/xray-core/common/signal/done"
 	"github.com/xtls/xray-core/transport"
 )
@@ -79,7 +80,7 @@ func (co *Outbound) Dispatch(ctx context.Context, link *transport.Link) {
 	}
 
 	closeSignal := done.New()
-	c := net.NewConnection(net.ConnectionInputMulti(link.Writer), net.ConnectionOutputMulti(link.Reader), net.ConnectionOnClose(closeSignal))
+	c := cnc.NewConnection(cnc.ConnectionInputMulti(link.Writer), cnc.ConnectionOutputMulti(link.Reader), cnc.ConnectionOnClose(closeSignal))
 	co.listener.add(c)
 	co.access.RUnlock()
 	<-closeSignal.Wait()

app/commander/service.go

@@ -3,9 +3,10 @@ package commander
 import (
 	"context"
 
-	"github.com/xtls/xray-core/common"
 	"google.golang.org/grpc"
 	"google.golang.org/grpc/reflection"
+
+	"github.com/xtls/xray-core/common"
 )
 
 // Service is a Commander service.

app/dispatcher/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/dispatcher/config.proto
 
 package dispatcher
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type SessionConfig struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache

app/dispatcher/default.go

@@ -15,6 +15,7 @@ import (
 	"github.com/xtls/xray-core/common/protocol"
 	"github.com/xtls/xray-core/common/session"
 	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/dns"
 	"github.com/xtls/xray-core/features/outbound"
 	"github.com/xtls/xray-core/features/policy"
 	"github.com/xtls/xray-core/features/routing"
@@ -175,12 +176,32 @@ func (d *DefaultDispatcher) getLink(ctx context.Context) (*transport.Link, *tran
 	return inboundLink, outboundLink
 }
 
-func shouldOverride(result SniffResult, domainOverride []string) bool {
+func shouldOverride(ctx context.Context, result SniffResult, request session.SniffingRequest, destination net.Destination) bool {
-	for _, p := range domainOverride {
+	domain := result.Domain()
-		if strings.HasPrefix(result.Protocol(), p) {
+	for _, d := range request.ExcludeForDomain {
+		if strings.ToLower(domain) == d {
+			return false
+		}
+	}
+	var fakeDNSEngine dns.FakeDNSEngine
+	core.RequireFeatures(ctx, func(fdns dns.FakeDNSEngine) {
+		fakeDNSEngine = fdns
+	})
+	protocolString := result.Protocol()
+	if resComp, ok := result.(SnifferResultComposite); ok {
+		protocolString = resComp.ProtocolForDomainResult()
+	}
+	for _, p := range request.OverrideDestinationForProtocol {
+		if strings.HasPrefix(protocolString, p) {
+			return true
+		}
+		if fakeDNSEngine != nil && protocolString != "bittorrent" && p == "fakedns" &&
+			destination.Address.Family().IsIP() && fakeDNSEngine.GetFakeIPRange().Contains(destination.Address.IP()) {
+			newError("Using sniffer ", protocolString, " since the fake DNS missed").WriteToLog(session.ExportIDToError(ctx))
 			return true
 		}
 	}
+
 	return false
 }
 
@@ -201,19 +222,33 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
 		ctx = session.ContextWithContent(ctx, content)
 	}
 	sniffingRequest := content.SniffingRequest
-	if destination.Network != net.Network_TCP || !sniffingRequest.Enabled {
+	switch {
+	case !sniffingRequest.Enabled:
 		go d.routedDispatch(ctx, outbound, destination)
-	} else {
+	case destination.Network != net.Network_TCP:
+		// Only metadata sniff will be used for non tcp connection
+		result, err := sniffer(ctx, nil, true)
+		if err == nil {
+			content.Protocol = result.Protocol()
+			if shouldOverride(ctx, result, sniffingRequest, destination) {
+				domain := result.Domain()
+				newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
+				destination.Address = net.ParseAddress(domain)
+				ob.Target = destination
+			}
+		}
+		go d.routedDispatch(ctx, outbound, destination)
+	default:
 		go func() {
 			cReader := &cachedReader{
 				reader: outbound.Reader.(*pipe.Reader),
 			}
 			outbound.Reader = cReader
-			result, err := sniffer(ctx, cReader)
+			result, err := sniffer(ctx, cReader, sniffingRequest.MetadataOnly)
 			if err == nil {
 				content.Protocol = result.Protocol()
 			}
-			if err == nil && shouldOverride(result, sniffingRequest.OverrideDestinationForProtocol) {
+			if err == nil && shouldOverride(ctx, result, sniffingRequest, destination) {
 				domain := result.Domain()
 				newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
 				destination.Address = net.ParseAddress(domain)
@@ -225,11 +260,19 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
 	return inbound, nil
 }
 
-func sniffer(ctx context.Context, cReader *cachedReader) (SniffResult, error) {
+func sniffer(ctx context.Context, cReader *cachedReader, metadataOnly bool) (SniffResult, error) {
 	payload := buf.New()
 	defer payload.Release()
 
-	sniffer := NewSniffer()
+	sniffer := NewSniffer(ctx)
+
+	metaresult, metadataErr := sniffer.SniffMetadata(ctx)
+
+	if metadataOnly {
+		return metaresult, metadataErr
+	}
+
+	contentResult, contentErr := func() (SniffResult, error) {
 		totalAttempt := 0
 		for {
 			select {
@@ -243,7 +286,7 @@ func sniffer(ctx context.Context, cReader *cachedReader) (SniffResult, error) {
 
 				cReader.Cache(payload)
 				if !payload.IsEmpty() {
-				result, err := sniffer.Sniff(payload.Bytes())
+					result, err := sniffer.Sniff(ctx, payload.Bytes())
 					if err != common.ErrNoClue {
 						return result, err
 					}
@@ -253,6 +296,14 @@ func sniffer(ctx context.Context, cReader *cachedReader) (SniffResult, error) {
 				}
 			}
 		}
+	}()
+	if contentErr != nil && metadataErr == nil {
+		return metaresult, nil
+	}
+	if contentErr == nil && metadataErr == nil {
+		return CompositeResult(metaresult, contentResult), nil
+	}
+	return contentResult, contentErr
 }
 
 func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.Link, destination net.Destination) {
@@ -263,14 +314,18 @@ func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.
 		skipRoutePick = content.SkipRoutePick
 	}
 
+	routingLink := routing_session.AsRoutingContext(ctx)
+	inTag := routingLink.GetInboundTag()
+	isPickRoute := false
 	if d.router != nil && !skipRoutePick {
-		if route, err := d.router.PickRoute(routing_session.AsRoutingContext(ctx)); err == nil {
+		if route, err := d.router.PickRoute(routingLink); err == nil {
-			tag := route.GetOutboundTag()
+			outTag := route.GetOutboundTag()
-			if h := d.ohm.GetHandler(tag); h != nil {
+			isPickRoute = true
-				newError("taking detour [", tag, "] for [", destination, "]").WriteToLog(session.ExportIDToError(ctx))
+			if h := d.ohm.GetHandler(outTag); h != nil {
+				newError("taking detour [", outTag, "] for [", destination, "]").WriteToLog(session.ExportIDToError(ctx))
 				handler = h
 			} else {
-				newError("non existing tag: ", tag).AtWarning().WriteToLog(session.ExportIDToError(ctx))
+				newError("non existing outTag: ", outTag).AtWarning().WriteToLog(session.ExportIDToError(ctx))
 			}
 		} else {
 			newError("default route for ", destination).WriteToLog(session.ExportIDToError(ctx))
@@ -290,8 +345,20 @@ func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.
 
 	if accessMessage := log.AccessMessageFromContext(ctx); accessMessage != nil {
 		if tag := handler.Tag(); tag != "" {
+			if isPickRoute {
+				if inTag != "" {
+					accessMessage.Detour = inTag + " -> " + tag
+				} else {
 					accessMessage.Detour = tag
 				}
+			} else {
+				if inTag != "" {
+					accessMessage.Detour = inTag + " >> " + tag
+				} else {
+					accessMessage.Detour = tag
+				}
+			}
+		}
 		log.Record(accessMessage)
 	}
 

app/dispatcher/fakednssniffer.go

@@ -0,0 +1,49 @@
+package dispatcher
+
+import (
+	"context"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+// newFakeDNSSniffer Create a Fake DNS metadata sniffer
+func newFakeDNSSniffer(ctx context.Context) (protocolSnifferWithMetadata, error) {
+	var fakeDNSEngine dns.FakeDNSEngine
+	err := core.RequireFeatures(ctx, func(fdns dns.FakeDNSEngine) {
+		fakeDNSEngine = fdns
+	})
+	if err != nil {
+		return protocolSnifferWithMetadata{}, err
+	}
+	if fakeDNSEngine == nil {
+		errNotInit := newError("FakeDNSEngine is not initialized, but such a sniffer is used").AtError()
+		return protocolSnifferWithMetadata{}, errNotInit
+	}
+	return protocolSnifferWithMetadata{protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
+		Target := session.OutboundFromContext(ctx).Target
+		if Target.Network == net.Network_TCP || Target.Network == net.Network_UDP {
+			domainFromFakeDNS := fakeDNSEngine.GetDomainFromFakeDNS(Target.Address)
+			if domainFromFakeDNS != "" {
+				newError("fake dns got domain: ", domainFromFakeDNS, " for ip: ", Target.Address.String()).WriteToLog(session.ExportIDToError(ctx))
+				return &fakeDNSSniffResult{domainName: domainFromFakeDNS}, nil
+			}
+		}
+		return nil, common.ErrNoClue
+	}, metadataSniffer: true}, nil
+}
+
+type fakeDNSSniffResult struct {
+	domainName string
+}
+
+func (fakeDNSSniffResult) Protocol() string {
+	return "fakedns"
+}
+
+func (f fakeDNSSniffResult) Domain() string {
+	return f.domainName
+}

app/dispatcher/sniffer.go

@@ -1,6 +1,8 @@
 package dispatcher
 
 import (
+	"context"
+
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/protocol/bittorrent"
 	"github.com/xtls/xray-core/common/protocol/http"
@@ -12,30 +14,46 @@ type SniffResult interface {
 	Domain() string
 }
 
-type protocolSniffer func([]byte) (SniffResult, error)
+type protocolSniffer func(context.Context, []byte) (SniffResult, error)
 
-type Sniffer struct {
+type protocolSnifferWithMetadata struct {
-	sniffer []protocolSniffer
+	protocolSniffer protocolSniffer
+	// A Metadata sniffer will be invoked on connection establishment only, with nil body,
+	// for both TCP and UDP connections
+	// It will not be shown as a traffic type for routing unless there is no other successful sniffing.
+	metadataSniffer bool
 }
 
-func NewSniffer() *Sniffer {
+type Sniffer struct {
-	return &Sniffer{
+	sniffer []protocolSnifferWithMetadata
-		sniffer: []protocolSniffer{
+}
-			func(b []byte) (SniffResult, error) { return http.SniffHTTP(b) },
+
-			func(b []byte) (SniffResult, error) { return tls.SniffTLS(b) },
+func NewSniffer(ctx context.Context) *Sniffer {
-			func(b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) },
+	ret := &Sniffer{
+		sniffer: []protocolSnifferWithMetadata{
+			{func(c context.Context, b []byte) (SniffResult, error) { return http.SniffHTTP(b) }, false},
+			{func(c context.Context, b []byte) (SniffResult, error) { return tls.SniffTLS(b) }, false},
+			{func(c context.Context, b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) }, false},
 		},
 	}
+	if sniffer, err := newFakeDNSSniffer(ctx); err == nil {
+		ret.sniffer = append(ret.sniffer, sniffer)
+	}
+	return ret
 }
 
 var errUnknownContent = newError("unknown content")
 
-func (s *Sniffer) Sniff(payload []byte) (SniffResult, error) {
+func (s *Sniffer) Sniff(c context.Context, payload []byte) (SniffResult, error) {
-	var pendingSniffer []protocolSniffer
+	var pendingSniffer []protocolSnifferWithMetadata
-	for _, s := range s.sniffer {
+	for _, si := range s.sniffer {
-		result, err := s(payload)
+		s := si.protocolSniffer
+		if si.metadataSniffer {
+			continue
+		}
+		result, err := s(c, payload)
 		if err == common.ErrNoClue {
-			pendingSniffer = append(pendingSniffer, s)
+			pendingSniffer = append(pendingSniffer, si)
 			continue
 		}
 
@@ -51,3 +69,55 @@ func (s *Sniffer) Sniff(payload []byte) (SniffResult, error) {
 
 	return nil, errUnknownContent
 }
+
+func (s *Sniffer) SniffMetadata(c context.Context) (SniffResult, error) {
+	var pendingSniffer []protocolSnifferWithMetadata
+	for _, si := range s.sniffer {
+		s := si.protocolSniffer
+		if !si.metadataSniffer {
+			pendingSniffer = append(pendingSniffer, si)
+			continue
+		}
+		result, err := s(c, nil)
+		if err == common.ErrNoClue {
+			pendingSniffer = append(pendingSniffer, si)
+			continue
+		}
+
+		if err == nil && result != nil {
+			return result, nil
+		}
+	}
+
+	if len(pendingSniffer) > 0 {
+		s.sniffer = pendingSniffer
+		return nil, common.ErrNoClue
+	}
+
+	return nil, errUnknownContent
+}
+
+func CompositeResult(domainResult SniffResult, protocolResult SniffResult) SniffResult {
+	return &compositeResult{domainResult: domainResult, protocolResult: protocolResult}
+}
+
+type compositeResult struct {
+	domainResult   SniffResult
+	protocolResult SniffResult
+}
+
+func (c compositeResult) Protocol() string {
+	return c.protocolResult.Protocol()
+}
+
+func (c compositeResult) Domain() string {
+	return c.domainResult.Domain()
+}
+
+func (c compositeResult) ProtocolForDomainResult() string {
+	return c.domainResult.Protocol()
+}
+
+type SnifferResultComposite interface {
+	ProtocolForDomainResult() string
+}

app/dns/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/dns/config.proto
 
 package dns
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	router "github.com/xtls/xray-core/app/router"
 	net "github.com/xtls/xray-core/common/net"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
@@ -23,10 +22,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type DomainMatchingType int32
 
 const (
@@ -473,7 +468,7 @@ var file_app_dns_config_proto_rawDesc = []byte{
 	0x0c, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x12, 0x0a,
 	0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x72, 0x75, 0x6c,
 	0x65, 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52,
-	0x04, 0x73, 0x69, 0x7a, 0x65, 0x22, 0x9f, 0x04, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
+	0x04, 0x73, 0x69, 0x7a, 0x65, 0x22, 0xa5, 0x04, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
 	0x12, 0x3f, 0x0a, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x18,
 	0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
 	0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64, 0x70, 0x6f, 0x69, 0x6e, 0x74,
@@ -507,16 +502,17 @@ var file_app_dns_config_proto_rawDesc = []byte{
 	0x12, 0x0e, 0x0a, 0x02, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x70,
 	0x12, 0x25, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61,
 	0x69, 0x6e, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65,
-	0x64, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x2a, 0x45, 0x0a, 0x12, 0x44, 0x6f, 0x6d, 0x61, 0x69,
+	0x64, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4a, 0x04, 0x08, 0x07, 0x10, 0x08, 0x2a, 0x45, 0x0a,
-	0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08, 0x0a,
+	0x12, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54,
-	0x04, 0x46, 0x75, 0x6c, 0x6c, 0x10, 0x00, 0x12, 0x0d, 0x0a, 0x09, 0x53, 0x75, 0x62, 0x64, 0x6f,
+	0x79, 0x70, 0x65, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x75, 0x6c, 0x6c, 0x10, 0x00, 0x12, 0x0d, 0x0a,
-	0x6d, 0x61, 0x69, 0x6e, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07, 0x4b, 0x65, 0x79, 0x77, 0x6f, 0x72,
+	0x09, 0x53, 0x75, 0x62, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07,
-	0x64, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x52, 0x65, 0x67, 0x65, 0x78, 0x10, 0x03, 0x42, 0x46,
+	0x4b, 0x65, 0x79, 0x77, 0x6f, 0x72, 0x64, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x52, 0x65, 0x67,
-	0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64,
+	0x65, 0x78, 0x10, 0x03, 0x42, 0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79,
-	0x6e, 0x73, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d,
+	0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68,
-	0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f,
+	0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79,
-	0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41,
+	0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0xaa, 0x02, 0x0c,
-	0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
+	0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72,
+	0x6f, 0x74, 0x6f, 0x33,
 }
 
 var (

app/dns/config.proto

@@ -68,4 +68,6 @@ message Config {
 
   // Tag is the inbound tag of DNS client.
   string tag = 6;
+
+  reserved 7;
 }

app/dns/dnscommon.go

@@ -2,18 +2,20 @@ package dns
 
 import (
 	"encoding/binary"
+	"strings"
 	"time"
 
+	"golang.org/x/net/dns/dnsmessage"
+
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/errors"
 	"github.com/xtls/xray-core/common/net"
 	dns_feature "github.com/xtls/xray-core/features/dns"
-	"golang.org/x/net/dns/dnsmessage"
 )
 
 // Fqdn normalize domain make sure it ends with '.'
 func Fqdn(domain string) string {
-	if len(domain) > 0 && domain[len(domain)-1] == '.' {
+	if len(domain) > 0 && strings.HasSuffix(domain, ".") {
 		return domain
 	}
 	return domain + "."
@@ -112,7 +114,7 @@ func genEDNS0Options(clientIP net.IP) *dnsmessage.Resource {
 	return opt
 }
 
-func buildReqMsgs(domain string, option IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
+func buildReqMsgs(domain string, option dns_feature.IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
 	qA := dnsmessage.Question{
 		Name:  dnsmessage.MustNewName(domain),
 		Type:  dnsmessage.TypeA,

app/dns/dnscommon_test.go

@@ -7,9 +7,11 @@ import (
 
 	"github.com/google/go-cmp/cmp"
 	"github.com/miekg/dns"
+	"golang.org/x/net/dns/dnsmessage"
+
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/net"
-	"golang.org/x/net/dns/dnsmessage"
+	dns_feature "github.com/xtls/xray-core/features/dns"
 )
 
 func Test_parseResponse(t *testing.T) {
@@ -92,7 +94,7 @@ func Test_buildReqMsgs(t *testing.T) {
 	}
 	type args struct {
 		domain  string
-		option  IPOption
+		option  dns_feature.IPOption
 		reqOpts *dnsmessage.Resource
 	}
 	tests := []struct {
@@ -100,10 +102,26 @@ func Test_buildReqMsgs(t *testing.T) {
 		args args
 		want int
 	}{
-		{"dual stack", args{"test.com", IPOption{true, true}, nil}, 2},
+		{"dual stack", args{"test.com", dns_feature.IPOption{
-		{"ipv4 only", args{"test.com", IPOption{true, false}, nil}, 1},
+			IPv4Enable: true,
-		{"ipv6 only", args{"test.com", IPOption{false, true}, nil}, 1},
+			IPv6Enable: true,
-		{"none/error", args{"test.com", IPOption{false, false}, nil}, 0},
+			FakeEnable: false,
+		}, nil}, 2},
+		{"ipv4 only", args{"test.com", dns_feature.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: false,
+			FakeEnable: false,
+		}, nil}, 1},
+		{"ipv6 only", args{"test.com", dns_feature.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: true,
+			FakeEnable: false,
+		}, nil}, 1},
+		{"none/error", args{"test.com", dns_feature.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: false,
+			FakeEnable: false,
+		}, nil}, 0},
 	}
 	for _, tt := range tests {
 		t.Run(tt.name, func(t *testing.T) {

app/dns/dohdns.go

@@ -12,8 +12,12 @@ import (
 	"sync/atomic"
 	"time"
 
+	"golang.org/x/net/dns/dnsmessage"
+
 	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/log"
 	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/net/cnc"
 	"github.com/xtls/xray-core/common/protocol/dns"
 	"github.com/xtls/xray-core/common/session"
 	"github.com/xtls/xray-core/common/signal/pubsub"
@@ -21,13 +25,13 @@ import (
 	dns_feature "github.com/xtls/xray-core/features/dns"
 	"github.com/xtls/xray-core/features/routing"
 	"github.com/xtls/xray-core/transport/internet"
-	"golang.org/x/net/dns/dnsmessage"
 )
 
 // DoHNameServer implemented DNS over HTTPS (RFC8484) Wire Format,
 // which is compatible with traditional dns over udp(RFC1035),
 // thus most of the DOH implementation is copied from udpns.go
 type DoHNameServer struct {
+	dispatcher routing.Dispatcher
 	sync.RWMutex
 	ips        map[string]record
 	pub        *pubsub.Service
@@ -44,40 +48,59 @@ func NewDoHNameServer(url *url.URL, dispatcher routing.Dispatcher, clientIP net.
 	newError("DNS: created Remote DOH client for ", url.String()).AtInfo().WriteToLog()
 	s := baseDOHNameServer(url, "DOH", clientIP)
 
-	// Dispatched connection will be closed (interrupted) after each request
+	s.dispatcher = dispatcher
-	// This makes DOH inefficient without a keep-alived connection
-	// See: core/app/proxyman/outbound/handler.go:113
-	// Using mux (https request wrapped in a stream layer) improves the situation.
-	// Recommend to use NewDoHLocalNameServer (DOHL:) if xray instance is running on
-	//  a normal network eg. the server side of xray
 	tr := &http.Transport{
 		MaxIdleConns:        30,
 		IdleConnTimeout:     90 * time.Second,
 		TLSHandshakeTimeout: 30 * time.Second,
 		ForceAttemptHTTP2:   true,
 		DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
+			dispatcherCtx := context.Background()
+
 			dest, err := net.ParseDestination(network + ":" + addr)
 			if err != nil {
 				return nil, err
 			}
 
-			link, err := dispatcher.Dispatch(ctx, dest)
+			dispatcherCtx = session.ContextWithContent(dispatcherCtx, session.ContentFromContext(ctx))
+			dispatcherCtx = session.ContextWithInbound(dispatcherCtx, session.InboundFromContext(ctx))
+			dispatcherCtx = log.ContextWithAccessMessage(dispatcherCtx, &log.AccessMessage{
+				From:   "DoH",
+				To:     s.dohURL,
+				Status: log.AccessAccepted,
+				Reason: "",
+			})
+
+			link, err := s.dispatcher.Dispatch(dispatcherCtx, dest)
+			select {
+			case <-ctx.Done():
+				return nil, ctx.Err()
+			default:
+
+			}
 			if err != nil {
 				return nil, err
 			}
-			return net.NewConnection(
+
-				net.ConnectionInputMulti(link.Writer),
+			cc := common.ChainedClosable{}
-				net.ConnectionOutputMulti(link.Reader),
+			if cw, ok := link.Writer.(common.Closable); ok {
+				cc = append(cc, cw)
+			}
+			if cr, ok := link.Reader.(common.Closable); ok {
+				cc = append(cc, cr)
+			}
+			return cnc.NewConnection(
+				cnc.ConnectionInputMulti(link.Writer),
+				cnc.ConnectionOutputMulti(link.Reader),
+				cnc.ConnectionOnClose(cc),
 			), nil
 		},
 	}
-
+	s.httpClient = &http.Client{
-	dispatchedClient := &http.Client{
+		Timeout:   time.Second * 180,
 		Transport: tr,
-		Timeout:   60 * time.Second,
 	}
 
-	s.httpClient = dispatchedClient
 	return s, nil
 }
 
@@ -94,6 +117,12 @@ func NewDoHLocalNameServer(url *url.URL, clientIP net.IP) *DoHNameServer {
 				return nil, err
 			}
 			conn, err := internet.DialSystem(ctx, dest, nil)
+			log.Record(&log.AccessMessage{
+				From:   "DoH",
+				To:     s.dohURL,
+				Status: log.AccessAccepted,
+				Detour: "local",
+			})
 			if err != nil {
 				return nil, err
 			}
@@ -207,9 +236,14 @@ func (s *DoHNameServer) newReqID() uint16 {
 	return uint16(atomic.AddUint32(&s.reqID, 1))
 }
 
-func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPOption) {
+func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option dns_feature.IPOption) {
 	newError(s.name, " querying: ", domain).AtInfo().WriteToLog(session.ExportIDToError(ctx))
 
+	if s.name+"." == "DOH//"+domain {
+		newError(s.name, " tries to resolve itself! Use IP or set \"hosts\" instead.").AtError().WriteToLog(session.ExportIDToError(ctx))
+		return
+	}
+
 	reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
 
 	var deadline time.Time
@@ -232,11 +266,11 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPO
 
 			dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
 				Protocol: "https",
-				SkipRoutePick: true,
+				//SkipRoutePick: true,
 			})
 
 			// forced to use mux for DOH
-			dnsCtx = session.ContextWithMuxPrefered(dnsCtx, true)
+			// dnsCtx = session.ContextWithMuxPrefered(dnsCtx, true)
 
 			var cancel context.CancelFunc
 			dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
@@ -244,17 +278,17 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPO
 
 			b, err := dns.PackMessage(r.msg)
 			if err != nil {
-				newError("failed to pack dns query").Base(err).AtError().WriteToLog()
+				newError("failed to pack dns query for ", domain).Base(err).AtError().WriteToLog()
 				return
 			}
 			resp, err := s.dohHTTPSContext(dnsCtx, b.Bytes())
 			if err != nil {
-				newError("failed to retrieve response").Base(err).AtError().WriteToLog()
+				newError("failed to retrieve response for ", domain).Base(err).AtError().WriteToLog()
 				return
 			}
 			rec, err := parseResponse(resp)
 			if err != nil {
-				newError("failed to handle DOH response").Base(err).AtError().WriteToLog()
+				newError("failed to handle DOH response for ", domain).Base(err).AtError().WriteToLog()
 				return
 			}
 			s.updateIP(r, rec)
@@ -272,7 +306,9 @@ func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte,
 	req.Header.Add("Accept", "application/dns-message")
 	req.Header.Add("Content-Type", "application/dns-message")
 
-	resp, err := s.httpClient.Do(req.WithContext(ctx))
+	hc := s.httpClient
+
+	resp, err := hc.Do(req.WithContext(ctx))
 	if err != nil {
 		return nil, err
 	}
@@ -286,7 +322,7 @@ func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte,
 	return ioutil.ReadAll(resp.Body)
 }
 
-func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.IP, error) {
+func (s *DoHNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
 	s.RLock()
 	record, found := s.ips[domain]
 	s.RUnlock()
@@ -329,12 +365,13 @@ func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.
 }
 
 // QueryIP is called from dns.Server->queryIPTimeout
-func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
+func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, error) { // nolint: dupl
 	fqdn := Fqdn(domain)
 
 	ips, err := s.findIPsForDomain(fqdn, option)
 	if err != errRecordNotFound {
 		newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
+		log.Record(&log.DNSLog{s.name, domain, ips, log.DNSCacheHit, 0, err})
 		return ips, err
 	}
 
@@ -365,10 +402,12 @@ func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option IPOpt
 		close(done)
 	}()
 	s.sendQuery(ctx, fqdn, option)
+	start := time.Now()
 
 	for {
 		ips, err := s.findIPsForDomain(fqdn, option)
 		if err != errRecordNotFound {
+			log.Record(&log.DNSLog{s.name, domain, ips, log.DNSQueried, time.Since(start), err})
 			return ips, err
 		}
 

app/dns/fakedns/errors.generated.go

@@ -0,0 +1,9 @@
+package fakedns
+
+import "github.com/xtls/xray-core/common/errors"
+
+type errPathObjHolder struct{}
+
+func newError(values ...interface{}) *errors.Error {
+	return errors.New(values...).WithPathObj(errPathObjHolder{})
+}

app/dns/fakedns/fake.go

@@ -0,0 +1,134 @@
+package fakedns
+
+import (
+	"context"
+	"math"
+	"math/big"
+	gonet "net"
+	"time"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/cache"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+type Holder struct {
+	domainToIP cache.Lru
+	ipRange    *gonet.IPNet
+
+	config *FakeDnsPool
+}
+
+func (*Holder) Type() interface{} {
+	return (*dns.FakeDNSEngine)(nil)
+}
+
+func (fkdns *Holder) Start() error {
+	return fkdns.initializeFromConfig()
+}
+
+func (fkdns *Holder) Close() error {
+	fkdns.domainToIP = nil
+	fkdns.ipRange = nil
+	return nil
+}
+
+func NewFakeDNSHolder() (*Holder, error) {
+	var fkdns *Holder
+	var err error
+
+	if fkdns, err = NewFakeDNSHolderConfigOnly(nil); err != nil {
+		return nil, newError("Unable to create Fake Dns Engine").Base(err).AtError()
+	}
+	err = fkdns.initialize(dns.FakeIPPool, 65535)
+	if err != nil {
+		return nil, err
+	}
+	return fkdns, nil
+}
+
+func NewFakeDNSHolderConfigOnly(conf *FakeDnsPool) (*Holder, error) {
+	return &Holder{nil, nil, conf}, nil
+}
+
+func (fkdns *Holder) initializeFromConfig() error {
+	return fkdns.initialize(fkdns.config.IpPool, int(fkdns.config.LruSize))
+}
+
+func (fkdns *Holder) initialize(ipPoolCidr string, lruSize int) error {
+	var ipRange *gonet.IPNet
+	var err error
+
+	if _, ipRange, err = gonet.ParseCIDR(ipPoolCidr); err != nil {
+		return newError("Unable to parse CIDR for Fake DNS IP assignment").Base(err).AtError()
+	}
+
+	ones, bits := ipRange.Mask.Size()
+	rooms := bits - ones
+	if math.Log2(float64(lruSize)) >= float64(rooms) {
+		return newError("LRU size is bigger than subnet size").AtError()
+	}
+	fkdns.domainToIP = cache.NewLru(lruSize)
+	fkdns.ipRange = ipRange
+	return nil
+}
+
+// GetFakeIPForDomain check and generate a fake IP for a domain name
+func (fkdns *Holder) GetFakeIPForDomain(domain string) []net.Address {
+	if v, ok := fkdns.domainToIP.Get(domain); ok {
+		return []net.Address{v.(net.Address)}
+	}
+	var currentTimeMillis = uint64(time.Now().UnixNano() / 1e6)
+	ones, bits := fkdns.ipRange.Mask.Size()
+	rooms := bits - ones
+	if rooms < 64 {
+		currentTimeMillis %= (uint64(1) << rooms)
+	}
+	var bigIntIP = big.NewInt(0).SetBytes(fkdns.ipRange.IP)
+	bigIntIP = bigIntIP.Add(bigIntIP, new(big.Int).SetUint64(currentTimeMillis))
+	var ip net.Address
+	for {
+		ip = net.IPAddress(bigIntIP.Bytes())
+
+		// if we run for a long time, we may go back to beginning and start seeing the IP in use
+		if _, ok := fkdns.domainToIP.PeekKeyFromValue(ip); !ok {
+			break
+		}
+
+		bigIntIP = bigIntIP.Add(bigIntIP, big.NewInt(1))
+		if !fkdns.ipRange.Contains(bigIntIP.Bytes()) {
+			bigIntIP = big.NewInt(0).SetBytes(fkdns.ipRange.IP)
+		}
+	}
+	fkdns.domainToIP.Put(domain, ip)
+	return []net.Address{ip}
+}
+
+// GetDomainFromFakeDNS check if an IP is a fake IP and have corresponding domain name
+func (fkdns *Holder) GetDomainFromFakeDNS(ip net.Address) string {
+	if !ip.Family().IsIP() || !fkdns.ipRange.Contains(ip.IP()) {
+		return ""
+	}
+	if k, ok := fkdns.domainToIP.GetKeyFromValue(ip); ok {
+		return k.(string)
+	}
+	newError("A fake ip request to ", ip, ", however there is no matching domain name in fake DNS").AtInfo().WriteToLog()
+	return ""
+}
+
+// GetFakeIPRange return fake IP range from configuration
+func (fkdns *Holder) GetFakeIPRange() *gonet.IPNet {
+	return fkdns.ipRange
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*FakeDnsPool)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
+		var f *Holder
+		var err error
+		if f, err = NewFakeDNSHolderConfigOnly(config.(*FakeDnsPool)); err != nil {
+			return nil, err
+		}
+		return f, nil
+	}))
+}

app/dns/fakedns/fakedns.go

@@ -0,0 +1,3 @@
+package fakedns
+
+//go:generate go run github.com/xtls/xray-core/common/errors/errorgen

app/dns/fakedns/fakedns.pb.go

@@ -0,0 +1,158 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.27.1
+// 	protoc        v3.18.0
+// source: app/dns/fakedns/fakedns.proto
+
+package fakedns
+
+import (
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type FakeDnsPool struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	IpPool  string `protobuf:"bytes,1,opt,name=ip_pool,json=ipPool,proto3" json:"ip_pool,omitempty"` //CIDR of IP pool used as fake DNS IP
+	LruSize int64  `protobuf:"varint,2,opt,name=lruSize,proto3" json:"lruSize,omitempty"`            //Size of Pool for remembering relationship between domain name and IP address
+}
+
+func (x *FakeDnsPool) Reset() {
+	*x = FakeDnsPool{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *FakeDnsPool) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*FakeDnsPool) ProtoMessage() {}
+
+func (x *FakeDnsPool) ProtoReflect() protoreflect.Message {
+	mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use FakeDnsPool.ProtoReflect.Descriptor instead.
+func (*FakeDnsPool) Descriptor() ([]byte, []int) {
+	return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *FakeDnsPool) GetIpPool() string {
+	if x != nil {
+		return x.IpPool
+	}
+	return ""
+}
+
+func (x *FakeDnsPool) GetLruSize() int64 {
+	if x != nil {
+		return x.LruSize
+	}
+	return 0
+}
+
+var File_app_dns_fakedns_fakedns_proto protoreflect.FileDescriptor
+
+var file_app_dns_fakedns_fakedns_proto_rawDesc = []byte{
+	0x0a, 0x1d, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e,
+	0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12,
+	0x14, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61,
+	0x6b, 0x65, 0x64, 0x6e, 0x73, 0x22, 0x40, 0x0a, 0x0b, 0x46, 0x61, 0x6b, 0x65, 0x44, 0x6e, 0x73,
+	0x50, 0x6f, 0x6f, 0x6c, 0x12, 0x17, 0x0a, 0x07, 0x69, 0x70, 0x5f, 0x70, 0x6f, 0x6f, 0x6c, 0x18,
+	0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x69, 0x70, 0x50, 0x6f, 0x6f, 0x6c, 0x12, 0x18, 0x0a,
+	0x07, 0x6c, 0x72, 0x75, 0x53, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x07,
+	0x6c, 0x72, 0x75, 0x53, 0x69, 0x7a, 0x65, 0x42, 0x5e, 0x0a, 0x18, 0x63, 0x6f, 0x6d, 0x2e, 0x78,
+	0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61, 0x6b, 0x65,
+	0x64, 0x6e, 0x73, 0x50, 0x01, 0x5a, 0x29, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f,
+	0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65,
+	0x2f, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73,
+	0xaa, 0x02, 0x14, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x2e,
+	0x46, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
+}
+
+var (
+	file_app_dns_fakedns_fakedns_proto_rawDescOnce sync.Once
+	file_app_dns_fakedns_fakedns_proto_rawDescData = file_app_dns_fakedns_fakedns_proto_rawDesc
+)
+
+func file_app_dns_fakedns_fakedns_proto_rawDescGZIP() []byte {
+	file_app_dns_fakedns_fakedns_proto_rawDescOnce.Do(func() {
+		file_app_dns_fakedns_fakedns_proto_rawDescData = protoimpl.X.CompressGZIP(file_app_dns_fakedns_fakedns_proto_rawDescData)
+	})
+	return file_app_dns_fakedns_fakedns_proto_rawDescData
+}
+
+var file_app_dns_fakedns_fakedns_proto_msgTypes = make([]protoimpl.MessageInfo, 1)
+var file_app_dns_fakedns_fakedns_proto_goTypes = []interface{}{
+	(*FakeDnsPool)(nil), // 0: xray.app.dns.fakedns.FakeDnsPool
+}
+var file_app_dns_fakedns_fakedns_proto_depIdxs = []int32{
+	0, // [0:0] is the sub-list for method output_type
+	0, // [0:0] is the sub-list for method input_type
+	0, // [0:0] is the sub-list for extension type_name
+	0, // [0:0] is the sub-list for extension extendee
+	0, // [0:0] is the sub-list for field type_name
+}
+
+func init() { file_app_dns_fakedns_fakedns_proto_init() }
+func file_app_dns_fakedns_fakedns_proto_init() {
+	if File_app_dns_fakedns_fakedns_proto != nil {
+		return
+	}
+	if !protoimpl.UnsafeEnabled {
+		file_app_dns_fakedns_fakedns_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*FakeDnsPool); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: file_app_dns_fakedns_fakedns_proto_rawDesc,
+			NumEnums:      0,
+			NumMessages:   1,
+			NumExtensions: 0,
+			NumServices:   0,
+		},
+		GoTypes:           file_app_dns_fakedns_fakedns_proto_goTypes,
+		DependencyIndexes: file_app_dns_fakedns_fakedns_proto_depIdxs,
+		MessageInfos:      file_app_dns_fakedns_fakedns_proto_msgTypes,
+	}.Build()
+	File_app_dns_fakedns_fakedns_proto = out.File
+	file_app_dns_fakedns_fakedns_proto_rawDesc = nil
+	file_app_dns_fakedns_fakedns_proto_goTypes = nil
+	file_app_dns_fakedns_fakedns_proto_depIdxs = nil
+}

app/dns/fakedns/fakedns.proto

@@ -0,0 +1,12 @@
+syntax = "proto3";
+
+package xray.app.dns.fakedns;
+option csharp_namespace = "Xray.App.Dns.Fakedns";
+option go_package = "github.com/xtls/xray-core/app/dns/fakedns";
+option java_package = "com.xray.app.dns.fakedns";
+option java_multiple_files = true;
+
+message FakeDnsPool{
+  string ip_pool = 1; //CIDR of IP pool used as fake DNS IP
+  int64  lruSize = 2; //Size of Pool for remembering relationship between domain name and IP address
+}

app/dns/fakedns/fakedns_test.go

@@ -0,0 +1,105 @@
+package fakedns
+
+import (
+	"testing"
+
+	"github.com/stretchr/testify/assert"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/uuid"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+var (
+	ipPrefix = "198.18."
+)
+
+func TestNewFakeDnsHolder(_ *testing.T) {
+	_, err := NewFakeDNSHolder()
+	common.Must(err)
+}
+
+func TestFakeDnsHolderCreateMapping(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
+}
+
+func TestFakeDnsHolderCreateMappingMany(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
+
+	addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
+	assert.Equal(t, ipPrefix, addr2[0].IP().String()[0:len(ipPrefix)])
+	assert.NotEqual(t, addr[0].IP().String(), addr2[0].IP().String())
+}
+
+func TestFakeDnsHolderCreateMappingManyAndResolve(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
+
+	{
+		result := fkdns.GetDomainFromFakeDNS(addr[0])
+		assert.Equal(t, "fakednstest.example.com", result)
+	}
+
+	{
+		result := fkdns.GetDomainFromFakeDNS(addr2[0])
+		assert.Equal(t, "fakednstest2.example.com", result)
+	}
+}
+
+func TestFakeDnsHolderCreateMappingManySingleDomain(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	addr2 := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	assert.Equal(t, addr[0].IP().String(), addr2[0].IP().String())
+}
+
+func TestFakeDnsHolderCreateMappingAndRollOver(t *testing.T) {
+	fkdns, err := NewFakeDNSHolderConfigOnly(&FakeDnsPool{
+		IpPool:  dns.FakeIPPool,
+		LruSize: 256,
+	})
+	common.Must(err)
+
+	err = fkdns.Start()
+
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
+
+	for i := 0; i <= 8192; i++ {
+		{
+			result := fkdns.GetDomainFromFakeDNS(addr[0])
+			assert.Equal(t, "fakednstest.example.com", result)
+		}
+
+		{
+			result := fkdns.GetDomainFromFakeDNS(addr2[0])
+			assert.Equal(t, "fakednstest2.example.com", result)
+		}
+
+		{
+			uuid := uuid.New()
+			domain := uuid.String() + ".fakednstest.example.com"
+			tempAddr := fkdns.GetFakeIPForDomain(domain)
+			rsaddr := tempAddr[0].IP().String()
+
+			result := fkdns.GetDomainFromFakeDNS(net.ParseAddress(rsaddr))
+			assert.Equal(t, domain, result)
+		}
+	}
+}

app/dns/hosts.go

@@ -5,6 +5,7 @@ import (
 	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/common/strmatcher"
 	"github.com/xtls/xray-core/features"
+	"github.com/xtls/xray-core/features/dns"
 )
 
 // StaticHosts represents static domain-ip mapping in DNS server.
@@ -92,7 +93,7 @@ func NewStaticHosts(hosts []*Config_HostMapping, legacy map[string]*net.IPOrDoma
 	return sh, nil
 }
 
-func filterIP(ips []net.Address, option IPOption) []net.Address {
+func filterIP(ips []net.Address, option dns.IPOption) []net.Address {
 	filtered := make([]net.Address, 0, len(ips))
 	for _, ip := range ips {
 		if (ip.Family().IsIPv4() && option.IPv4Enable) || (ip.Family().IsIPv6() && option.IPv6Enable) {
@@ -106,7 +107,7 @@ func filterIP(ips []net.Address, option IPOption) []net.Address {
 }
 
 // LookupIP returns IP address for the given domain, if exists in this StaticHosts.
-func (h *StaticHosts) LookupIP(domain string, option IPOption) []net.Address {
+func (h *StaticHosts) LookupIP(domain string, option dns.IPOption) []net.Address {
 	indices := h.matchers.Match(domain)
 	if len(indices) == 0 {
 		return nil

app/dns/hosts_test.go

@@ -8,6 +8,7 @@ import (
 	. "github.com/xtls/xray-core/app/dns"
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/features/dns"
 )
 
 func TestStaticHosts(t *testing.T) {
@@ -39,7 +40,7 @@ func TestStaticHosts(t *testing.T) {
 	common.Must(err)
 
 	{
-		ips := hosts.LookupIP("example.com", IPOption{
+		ips := hosts.LookupIP("example.com", dns.IPOption{
 			IPv4Enable: true,
 			IPv6Enable: true,
 		})
@@ -52,7 +53,7 @@ func TestStaticHosts(t *testing.T) {
 	}
 
 	{
-		ips := hosts.LookupIP("www.example.cn", IPOption{
+		ips := hosts.LookupIP("www.example.cn", dns.IPOption{
 			IPv4Enable: true,
 			IPv6Enable: true,
 		})
@@ -65,7 +66,7 @@ func TestStaticHosts(t *testing.T) {
 	}
 
 	{
-		ips := hosts.LookupIP("baidu.com", IPOption{
+		ips := hosts.LookupIP("baidu.com", dns.IPOption{
 			IPv4Enable: false,
 			IPv6Enable: true,
 		})

app/dns/nameserver.go

@@ -4,39 +4,26 @@ import (
 	"context"
 
 	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/features/dns"
 	"github.com/xtls/xray-core/features/dns/localdns"
 )
 
-// IPOption is an object for IP query options.
-type IPOption struct {
-	IPv4Enable bool
-	IPv6Enable bool
-}
-
 // Client is the interface for DNS client.
 type Client interface {
 	// Name of the Client.
 	Name() string
 
 	// QueryIP sends IP queries to its configured server.
-	QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error)
+	QueryIP(ctx context.Context, domain string, option dns.IPOption) ([]net.IP, error)
 }
 
 type LocalNameServer struct {
 	client *localdns.Client
 }
 
-func (s *LocalNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
+func (s *LocalNameServer) QueryIP(_ context.Context, domain string, option dns.IPOption) ([]net.IP, error) {
-	if option.IPv4Enable && option.IPv6Enable {
+	if option.IPv4Enable || option.IPv6Enable {
-		return s.client.LookupIP(domain)
+		return s.client.LookupIP(domain, option)
-	}
-
-	if option.IPv4Enable {
-		return s.client.LookupIPv4(domain)
-	}
-
-	if option.IPv6Enable {
-		return s.client.LookupIPv6(domain)
 	}
 
 	return nil, newError("neither IPv4 nor IPv6 is enabled")

app/dns/nameserver_fakedns.go

@@ -0,0 +1,41 @@
+package dns
+
+import (
+	"context"
+
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+type FakeDNSServer struct {
+	fakeDNSEngine dns.FakeDNSEngine
+}
+
+func NewFakeDNSServer() *FakeDNSServer {
+	return &FakeDNSServer{}
+}
+
+func (FakeDNSServer) Name() string {
+	return "FakeDNS"
+}
+
+func (f *FakeDNSServer) QueryIP(ctx context.Context, domain string, _ dns.IPOption) ([]net.IP, error) {
+	if f.fakeDNSEngine == nil {
+		if err := core.RequireFeatures(ctx, func(fd dns.FakeDNSEngine) {
+			f.fakeDNSEngine = fd
+		}); err != nil {
+			return nil, newError("Unable to locate a fake DNS Engine").Base(err).AtError()
+		}
+	}
+	ips := f.fakeDNSEngine.GetFakeIPForDomain(domain)
+
+	netIP := toNetIP(ips)
+	if netIP == nil {
+		return nil, newError("Unable to convert IP to net ip").AtError()
+	}
+
+	newError(f.Name(), " got answer: ", domain, " -> ", ips).AtInfo().WriteToLog()
+
+	return netIP, nil
+}

app/dns/nameserver_test.go

@@ -7,14 +7,16 @@ import (
 
 	. "github.com/xtls/xray-core/app/dns"
 	"github.com/xtls/xray-core/common"
+	dns_feature "github.com/xtls/xray-core/features/dns"
 )
 
 func TestLocalNameServer(t *testing.T) {
 	s := NewLocalNameServer()
 	ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
-	ips, err := s.QueryIP(ctx, "google.com", IPOption{
+	ips, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
 		IPv4Enable: true,
 		IPv6Enable: true,
+		FakeEnable: false,
 	})
 	cancel()
 	common.Must(err)

app/dns/server.go

@@ -30,6 +30,7 @@ type Server struct {
 	hosts         *StaticHosts
 	clientIP      net.IP
 	clients       []Client // clientIdx -> Client
+	ctx           context.Context
 	ipIndexMap    []*MultiGeoIPMatcher // clientIdx -> *MultiGeoIPMatcher
 	domainRules   [][]string           // clientIdx -> domainRuleIdx -> DomainRule
 	domainMatcher strmatcher.IndexMatcher
@@ -74,6 +75,7 @@ func generateRandomTag() string {
 func New(ctx context.Context, config *Config) (*Server, error) {
 	server := &Server{
 		clients: make([]Client, 0, len(config.NameServers)+len(config.NameServer)),
+		ctx:     ctx,
 		tag:     config.Tag,
 	}
 	if server.tag == "" {
@@ -143,6 +145,9 @@ func New(ctx context.Context, config *Config) (*Server, error) {
 				server.clients[idx] = c
 			}))
 
+		case address.Family().IsDomain() && address.Domain() == "fakedns":
+			server.clients = append(server.clients, NewFakeDNSServer())
+
 		default:
 			// UDP classic DNS mode
 			dest := endpoint.AsDestination()
@@ -294,13 +299,14 @@ func (s *Server) Match(idx int, client Client, domain string, ips []net.IP) ([]n
 	return newIps, nil
 }
 
-func (s *Server) queryIPTimeout(idx int, client Client, domain string, option IPOption) ([]net.IP, error) {
+func (s *Server) queryIPTimeout(idx int, client Client, domain string, option dns.IPOption) ([]net.IP, error) {
-	ctx, cancel := context.WithTimeout(context.Background(), time.Second*4)
+	ctx, cancel := context.WithTimeout(s.ctx, time.Second*4)
 	if len(s.tag) > 0 {
 		ctx = session.ContextWithInbound(ctx, &session.Inbound{
 			Tag: s.tag,
 		})
 	}
+
 	ips, err := client.QueryIP(ctx, domain, option)
 	cancel()
 
@@ -312,31 +318,7 @@ func (s *Server) queryIPTimeout(idx int, client Client, domain string, option IP
 	return ips, err
 }
 
-// LookupIP implements dns.Client.
+func (s *Server) lookupStatic(domain string, option dns.IPOption, depth int32) []net.Address {
-func (s *Server) LookupIP(domain string) ([]net.IP, error) {
-	return s.lookupIPInternal(domain, IPOption{
-		IPv4Enable: true,
-		IPv6Enable: true,
-	})
-}
-
-// LookupIPv4 implements dns.IPv4Lookup.
-func (s *Server) LookupIPv4(domain string) ([]net.IP, error) {
-	return s.lookupIPInternal(domain, IPOption{
-		IPv4Enable: true,
-		IPv6Enable: false,
-	})
-}
-
-// LookupIPv6 implements dns.IPv6Lookup.
-func (s *Server) LookupIPv6(domain string) ([]net.IP, error) {
-	return s.lookupIPInternal(domain, IPOption{
-		IPv4Enable: false,
-		IPv6Enable: true,
-	})
-}
-
-func (s *Server) lookupStatic(domain string, option IPOption, depth int32) []net.Address {
 	ips := s.hosts.LookupIP(domain, option)
 	if ips == nil {
 		return nil
@@ -360,13 +342,14 @@ func toNetIP(ips []net.Address) []net.IP {
 	return netips
 }
 
-func (s *Server) lookupIPInternal(domain string, option IPOption) ([]net.IP, error) {
+// LookupIP implements dns.Client.
+func (s *Server) LookupIP(domain string, option dns.IPOption) ([]net.IP, error) {
 	if domain == "" {
 		return nil, newError("empty domain name")
 	}
 
 	// normalize the FQDN form query
-	if domain[len(domain)-1] == '.' {
+	if strings.HasSuffix(domain, ".") {
 		domain = domain[:len(domain)-1]
 	}
 
@@ -403,6 +386,10 @@ func (s *Server) lookupIPInternal(domain string, option IPOption) ([]net.IP, err
 		for _, idx := range indices {
 			clientIdx := int(s.matcherInfos[idx].clientIdx)
 			matchedClient = s.clients[clientIdx]
+			if !option.FakeEnable && strings.EqualFold(matchedClient.Name(), "FakeDNS") {
+				newError("skip DNS resolution for domain ", domain, " at server ", matchedClient.Name()).AtDebug().WriteToLog()
+				continue
+			}
 			ips, err := s.queryIPTimeout(clientIdx, matchedClient, domain, option)
 			if len(ips) > 0 {
 				return ips, nil
@@ -422,7 +409,10 @@ func (s *Server) lookupIPInternal(domain string, option IPOption) ([]net.IP, err
 			newError("domain ", domain, " at server ", client.Name(), " idx:", idx, " already lookup failed, just ignore").AtDebug().WriteToLog()
 			continue
 		}
-
+		if !option.FakeEnable && strings.EqualFold(client.Name(), "FakeDNS") {
+			newError("skip DNS resolution for domain ", domain, " at server ", client.Name()).AtDebug().WriteToLog()
+			continue
+		}
 		ips, err := s.queryIPTimeout(idx, client, domain, option)
 		if len(ips) > 0 {
 			return ips, nil

app/dns/server_test.go

@@ -154,7 +154,11 @@ func TestUDPServerSubnet(t *testing.T) {
 
 	client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
 
-	ips, err := client.LookupIP("google.com")
+	ips, err := client.LookupIP("google.com", feature_dns.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+		FakeEnable: false,
+	})
 	if err != nil {
 		t.Fatal("unexpected error: ", err)
 	}
@@ -209,7 +213,11 @@ func TestUDPServer(t *testing.T) {
 	client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
 
 	{
-		ips, err := client.LookupIP("google.com")
+		ips, err := client.LookupIP("google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -220,7 +228,11 @@ func TestUDPServer(t *testing.T) {
 	}
 
 	{
-		ips, err := client.LookupIP("facebook.com")
+		ips, err := client.LookupIP("facebook.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -231,7 +243,11 @@ func TestUDPServer(t *testing.T) {
 	}
 
 	{
-		_, err := client.LookupIP("notexist.google.com")
+		_, err := client.LookupIP("notexist.google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err == nil {
 			t.Fatal("nil error")
 		}
@@ -241,8 +257,11 @@ func TestUDPServer(t *testing.T) {
 	}
 
 	{
-		clientv6 := client.(feature_dns.IPv6Lookup)
+		ips, err := client.LookupIP("ipv4only.google.com", feature_dns.IPOption{
-		ips, err := clientv6.LookupIPv6("ipv4only.google.com")
+			IPv4Enable: false,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != feature_dns.ErrEmptyResponse {
 			t.Fatal("error: ", err)
 		}
@@ -254,7 +273,11 @@ func TestUDPServer(t *testing.T) {
 	dnsServer.Shutdown()
 
 	{
-		ips, err := client.LookupIP("google.com")
+		ips, err := client.LookupIP("google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -331,7 +354,11 @@ func TestPrioritizedDomain(t *testing.T) {
 	startTime := time.Now()
 
 	{
-		ips, err := client.LookupIP("google.com")
+		ips, err := client.LookupIP("google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -390,10 +417,12 @@ func TestUDPServerIPv6(t *testing.T) {
 	common.Must(err)
 
 	client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
-	client6 := client.(feature_dns.IPv6Lookup)
-
 	{
-		ips, err := client6.LookupIPv6("ipv6.google.com")
+		ips, err := client.LookupIP("ipv6.google.com", feature_dns.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -456,7 +485,11 @@ func TestStaticHostDomain(t *testing.T) {
 	client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
 
 	{
-		ips, err := client.LookupIP("example.com")
+		ips, err := client.LookupIP("example.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -563,7 +596,11 @@ func TestIPMatch(t *testing.T) {
 	startTime := time.Now()
 
 	{
-		ips, err := client.LookupIP("google.com")
+		ips, err := client.LookupIP("google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -682,7 +719,11 @@ func TestLocalDomain(t *testing.T) {
 	startTime := time.Now()
 
 	{ // Will match dotless:
-		ips, err := client.LookupIP("hostname")
+		ips, err := client.LookupIP("hostname", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -693,7 +734,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match domain:local
-		ips, err := client.LookupIP("hostname.local")
+		ips, err := client.LookupIP("hostname.local", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -704,7 +749,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match static ip
-		ips, err := client.LookupIP("hostnamestatic")
+		ips, err := client.LookupIP("hostnamestatic", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -715,7 +764,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match domain replacing
-		ips, err := client.LookupIP("hostnamealias")
+		ips, err := client.LookupIP("hostnamealias", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -726,7 +779,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match dotless:localhost, but not expectIPs: 127.0.0.2, 127.0.0.3, then matches at dotless:
-		ips, err := client.LookupIP("localhost")
+		ips, err := client.LookupIP("localhost", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -737,7 +794,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
-		ips, err := client.LookupIP("localhost-a")
+		ips, err := client.LookupIP("localhost-a", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -748,7 +809,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
-		ips, err := client.LookupIP("localhost-b")
+		ips, err := client.LookupIP("localhost-b", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -759,7 +824,11 @@ func TestLocalDomain(t *testing.T) {
 	}
 
 	{ // Will match dotless:
-		ips, err := client.LookupIP("Mijia Cloud")
+		ips, err := client.LookupIP("Mijia Cloud", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -921,7 +990,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
 	startTime := time.Now()
 
 	{ // Will match server 1,2 and server 1 returns expected ip
-		ips, err := client.LookupIP("google.com")
+		ips, err := client.LookupIP("google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -932,8 +1005,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
 	}
 
 	{ // Will match server 1,2 and server 1 returns unexpected ip, then server 2 returns expected one
-		clientv4 := client.(feature_dns.IPv4Lookup)
+		ips, err := client.LookupIP("ipv6.google.com", feature_dns.IPOption{
-		ips, err := clientv4.LookupIPv4("ipv6.google.com")
+			IPv4Enable: true,
+			IPv6Enable: false,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -944,7 +1020,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
 	}
 
 	{ // Will match server 3,1,2 and server 3 returns expected one
-		ips, err := client.LookupIP("api.google.com")
+		ips, err := client.LookupIP("api.google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}
@@ -955,7 +1035,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
 	}
 
 	{ // Will match server 4,3,1,2 and server 4 returns expected one
-		ips, err := client.LookupIP("v2.api.google.com")
+		ips, err := client.LookupIP("v2.api.google.com", feature_dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		})
 		if err != nil {
 			t.Fatal("unexpected error: ", err)
 		}

app/dns/udpns.go

@@ -7,7 +7,10 @@ import (
 	"sync/atomic"
 	"time"
 
+	"golang.org/x/net/dns/dnsmessage"
+
 	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/log"
 	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/common/protocol/dns"
 	udp_proto "github.com/xtls/xray-core/common/protocol/udp"
@@ -17,7 +20,6 @@ import (
 	dns_feature "github.com/xtls/xray-core/features/dns"
 	"github.com/xtls/xray-core/features/routing"
 	"github.com/xtls/xray-core/transport/internet/udp"
-	"golang.org/x/net/dns/dnsmessage"
 )
 
 type ClassicNameServer struct {
@@ -52,7 +54,7 @@ func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher
 		Execute:  s.Cleanup,
 	}
 	s.udpServer = udp.NewDispatcher(dispatcher, s.HandleResponse)
-	newError("DNS: created udp client inited for ", address.NetAddr()).AtInfo().WriteToLog()
+	newError("DNS: created UDP client initialized for ", address.NetAddr()).AtInfo().WriteToLog()
 	return s
 }
 
@@ -178,7 +180,7 @@ func (s *ClassicNameServer) addPendingRequest(req *dnsRequest) {
 	s.requests[id] = *req
 }
 
-func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option IPOption) {
+func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option dns_feature.IPOption) {
 	newError(s.name, " querying DNS for: ", domain).AtDebug().WriteToLog(session.ExportIDToError(ctx))
 
 	reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
@@ -190,14 +192,21 @@ func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option
 		if inbound := session.InboundFromContext(ctx); inbound != nil {
 			udpCtx = session.ContextWithInbound(udpCtx, inbound)
 		}
+
 		udpCtx = session.ContextWithContent(udpCtx, &session.Content{
 			Protocol: "dns",
 		})
+		udpCtx = log.ContextWithAccessMessage(udpCtx, &log.AccessMessage{
+			From:   "DNS",
+			To:     s.address,
+			Status: log.AccessAccepted,
+			Reason: "",
+		})
 		s.udpServer.Dispatch(udpCtx, s.address, b)
 	}
 }
 
-func (s *ClassicNameServer) findIPsForDomain(domain string, option IPOption) ([]net.IP, error) {
+func (s *ClassicNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
 	s.RLock()
 	record, found := s.ips[domain]
 	s.RUnlock()
@@ -235,12 +244,14 @@ func (s *ClassicNameServer) findIPsForDomain(domain string, option IPOption) ([]
 	return nil, dns_feature.ErrEmptyResponse
 }
 
-func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
+// QueryIP implements Server.
+func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, error) {
 	fqdn := Fqdn(domain)
 
 	ips, err := s.findIPsForDomain(fqdn, option)
 	if err != errRecordNotFound {
 		newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
+		log.Record(&log.DNSLog{s.name, domain, ips, log.DNSCacheHit, 0, err})
 		return ips, err
 	}
 
@@ -271,10 +282,12 @@ func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option I
 		close(done)
 	}()
 	s.sendQuery(ctx, fqdn, option)
+	start := time.Now()
 
 	for {
 		ips, err := s.findIPsForDomain(fqdn, option)
 		if err != errRecordNotFound {
+			log.Record(&log.DNSLog{s.name, domain, ips, log.DNSQueried, time.Since(start), err})
 			return ips, err
 		}
 

app/log/command/command.go

@@ -44,7 +44,7 @@ func (s *service) Register(server *grpc.Server) {
 	RegisterLoggerServiceServer(server, ls)
 
 	// For compatibility purposes
-	vCoreDesc := _LoggerService_serviceDesc
+	vCoreDesc := LoggerService_ServiceDesc
 	vCoreDesc.ServiceName = "v2ray.core.app.log.command.LoggerService"
 	server.RegisterService(&vCoreDesc, ls)
 }

app/log/command/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/log/command/config.proto
 
 package command
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type Config struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache

app/log/command/config_grpc.pb.go

@@ -11,6 +11,7 @@ import (
 
 // This is a compile-time assertion to ensure that this generated file
 // is compatible with the grpc package it is being compiled against.
+// Requires gRPC-Go v1.32.0 or later.
 const _ = grpc.SupportPackageIsVersion7
 
 // LoggerServiceClient is the client API for LoggerService service.
@@ -62,7 +63,7 @@ type UnsafeLoggerServiceServer interface {
 }
 
 func RegisterLoggerServiceServer(s grpc.ServiceRegistrar, srv LoggerServiceServer) {
-	s.RegisterService(&_LoggerService_serviceDesc, srv)
+	s.RegisterService(&LoggerService_ServiceDesc, srv)
 }
 
 func _LoggerService_RestartLogger_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
@@ -83,7 +84,10 @@ func _LoggerService_RestartLogger_Handler(srv interface{}, ctx context.Context,
 	return interceptor(ctx, in, info, handler)
 }
 
-var _LoggerService_serviceDesc = grpc.ServiceDesc{
+// LoggerService_ServiceDesc is the grpc.ServiceDesc for LoggerService service.
+// It's only intended for direct use with grpc.RegisterService,
+// and not to be introspected or modified (even as a copy)
+var LoggerService_ServiceDesc = grpc.ServiceDesc{
 	ServiceName: "xray.app.log.command.LoggerService",
 	HandlerType: (*LoggerServiceServer)(nil),
 	Methods: []grpc.MethodDesc{

app/log/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/log/config.proto
 
 package log
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	log "github.com/xtls/xray-core/common/log"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
@@ -22,10 +21,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type LogType int32
 
 const (
@@ -88,6 +83,7 @@ type Config struct {
 	ErrorLogPath  string       `protobuf:"bytes,3,opt,name=error_log_path,json=errorLogPath,proto3" json:"error_log_path,omitempty"`
 	AccessLogType LogType      `protobuf:"varint,4,opt,name=access_log_type,json=accessLogType,proto3,enum=xray.app.log.LogType" json:"access_log_type,omitempty"`
 	AccessLogPath string       `protobuf:"bytes,5,opt,name=access_log_path,json=accessLogPath,proto3" json:"access_log_path,omitempty"`
+	EnableDnsLog  bool         `protobuf:"varint,6,opt,name=enable_dns_log,json=enableDnsLog,proto3" json:"enable_dns_log,omitempty"`
 }
 
 func (x *Config) Reset() {
@@ -133,7 +129,7 @@ func (x *Config) GetErrorLogLevel() log.Severity {
 	if x != nil {
 		return x.ErrorLogLevel
 	}
-	return log.Severity_Unknown
+	return log.Severity(0)
 }
 
 func (x *Config) GetErrorLogPath() string {
@@ -157,13 +153,20 @@ func (x *Config) GetAccessLogPath() string {
 	return ""
 }
 
+func (x *Config) GetEnableDnsLog() bool {
+	if x != nil {
+		return x.EnableDnsLog
+	}
+	return false
+}
+
 var File_app_log_config_proto protoreflect.FileDescriptor
 
 var file_app_log_config_proto_rawDesc = []byte{
 	0x0a, 0x14, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0x2f, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x67,
 	0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x0c, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
 	0x2e, 0x6c, 0x6f, 0x67, 0x1a, 0x14, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2f, 0x6c, 0x6f, 0x67,
-	0x2f, 0x6c, 0x6f, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0x95, 0x02, 0x0a, 0x06, 0x43,
+	0x2f, 0x6c, 0x6f, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xbb, 0x02, 0x0a, 0x06, 0x43,
 	0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x3b, 0x0a, 0x0e, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x5f, 0x6c,
 	0x6f, 0x67, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x15, 0x2e,
 	0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x2e, 0x4c, 0x6f, 0x67,
@@ -181,15 +184,17 @@ var file_app_log_config_proto_rawDesc = []byte{
 	0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x26, 0x0a, 0x0f, 0x61, 0x63,
 	0x63, 0x65, 0x73, 0x73, 0x5f, 0x6c, 0x6f, 0x67, 0x5f, 0x70, 0x61, 0x74, 0x68, 0x18, 0x05, 0x20,
 	0x01, 0x28, 0x09, 0x52, 0x0d, 0x61, 0x63, 0x63, 0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x50, 0x61,
-	0x74, 0x68, 0x2a, 0x35, 0x0a, 0x07, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08, 0x0a,
+	0x74, 0x68, 0x12, 0x24, 0x0a, 0x0e, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x5f, 0x64, 0x6e, 0x73,
-	0x04, 0x4e, 0x6f, 0x6e, 0x65, 0x10, 0x00, 0x12, 0x0b, 0x0a, 0x07, 0x43, 0x6f, 0x6e, 0x73, 0x6f,
+	0x5f, 0x6c, 0x6f, 0x67, 0x18, 0x06, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x65, 0x6e, 0x61, 0x62,
-	0x6c, 0x65, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x69, 0x6c, 0x65, 0x10, 0x02, 0x12, 0x09,
+	0x6c, 0x65, 0x44, 0x6e, 0x73, 0x4c, 0x6f, 0x67, 0x2a, 0x35, 0x0a, 0x07, 0x4c, 0x6f, 0x67, 0x54,
-	0x0a, 0x05, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x10, 0x03, 0x42, 0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d,
+	0x79, 0x70, 0x65, 0x12, 0x08, 0x0a, 0x04, 0x4e, 0x6f, 0x6e, 0x65, 0x10, 0x00, 0x12, 0x0b, 0x0a,
-	0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x50, 0x01, 0x5a,
+	0x07, 0x43, 0x6f, 0x6e, 0x73, 0x6f, 0x6c, 0x65, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x69,
-	0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73,
+	0x6c, 0x65, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x10, 0x03, 0x42,
-	0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6c,
+	0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e,
-	0x6f, 0x67, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x4c, 0x6f,
+	0x6c, 0x6f, 0x67, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f,
-	0x67, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
+	0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65,
+	0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e,
+	0x41, 0x70, 0x70, 0x2e, 0x4c, 0x6f, 0x67, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
 }
 
 var (

app/log/config.proto

@@ -22,4 +22,5 @@ message Config {
 
   LogType access_log_type = 4;
   string access_log_path = 5;
+  bool enable_dns_log = 6;
 }

app/log/log.go

@@ -17,6 +17,7 @@ type Instance struct {
 	accessLogger log.Handler
 	errorLogger  log.Handler
 	active       bool
+	dns          bool
 }
 
 // New creates a new log.Instance based on the given config.
@@ -24,6 +25,7 @@ func New(ctx context.Context, config *Config) (*Instance, error) {
 	g := &Instance{
 		config: config,
 		active: false,
+		dns:    config.EnableDnsLog,
 	}
 	log.RegisterHandler(g)
 
@@ -103,6 +105,10 @@ func (g *Instance) Handle(msg log.Message) {
 		if g.accessLogger != nil {
 			g.accessLogger.Handle(msg)
 		}
+	case *log.DNSLog:
+		if g.dns && g.accessLogger != nil {
+			g.accessLogger.Handle(msg)
+		}
 	case *log.GeneralMessage:
 		if g.errorLogger != nil && msg.Severity <= g.config.ErrorLogLevel {
 			g.errorLogger.Handle(msg)

app/log/log_test.go

@@ -5,6 +5,7 @@ import (
 	"testing"
 
 	"github.com/golang/mock/gomock"
+
 	"github.com/xtls/xray-core/app/log"
 	"github.com/xtls/xray-core/common"
 	clog "github.com/xtls/xray-core/common/log"

app/policy/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/policy/config.proto
 
 package policy
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type Second struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache

app/proxyman/command/command.go

@@ -140,7 +140,7 @@ func (s *service) Register(server *grpc.Server) {
 	RegisterHandlerServiceServer(server, hs)
 
 	// For compatibility purposes
-	vCoreDesc := _HandlerService_serviceDesc
+	vCoreDesc := HandlerService_ServiceDesc
 	vCoreDesc.ServiceName = "v2ray.core.app.proxyman.command.HandlerService"
 	server.RegisterService(&vCoreDesc, hs)
 }

app/proxyman/command/command.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/proxyman/command/command.proto
 
 package command
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protocol "github.com/xtls/xray-core/common/protocol"
 	serial "github.com/xtls/xray-core/common/serial"
 	core "github.com/xtls/xray-core/core"
@@ -24,10 +23,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type AddUserOperation struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache

app/proxyman/command/command_grpc.pb.go

@@ -11,6 +11,7 @@ import (
 
 // This is a compile-time assertion to ensure that this generated file
 // is compatible with the grpc package it is being compiled against.
+// Requires gRPC-Go v1.32.0 or later.
 const _ = grpc.SupportPackageIsVersion7
 
 // HandlerServiceClient is the client API for HandlerService service.
@@ -132,7 +133,7 @@ type UnsafeHandlerServiceServer interface {
 }
 
 func RegisterHandlerServiceServer(s grpc.ServiceRegistrar, srv HandlerServiceServer) {
-	s.RegisterService(&_HandlerService_serviceDesc, srv)
+	s.RegisterService(&HandlerService_ServiceDesc, srv)
 }
 
 func _HandlerService_AddInbound_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
@@ -243,7 +244,10 @@ func _HandlerService_AlterOutbound_Handler(srv interface{}, ctx context.Context,
 	return interceptor(ctx, in, info, handler)
 }
 
-var _HandlerService_serviceDesc = grpc.ServiceDesc{
+// HandlerService_ServiceDesc is the grpc.ServiceDesc for HandlerService service.
+// It's only intended for direct use with grpc.RegisterService,
+// and not to be introspected or modified (even as a copy)
+var HandlerService_ServiceDesc = grpc.ServiceDesc{
 	ServiceName: "xray.app.proxyman.command.HandlerService",
 	HandlerType: (*HandlerServiceServer)(nil),
 	Methods: []grpc.MethodDesc{

app/proxyman/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/proxyman/config.proto
 
 package proxyman
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	net "github.com/xtls/xray-core/common/net"
 	serial "github.com/xtls/xray-core/common/serial"
 	internet "github.com/xtls/xray-core/transport/internet"
@@ -24,10 +23,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type KnownProtocols int32
 
 const (
@@ -239,8 +234,12 @@ type SniffingConfig struct {
 	// Whether or not to enable content sniffing on an inbound connection.
 	Enabled bool `protobuf:"varint,1,opt,name=enabled,proto3" json:"enabled,omitempty"`
 	// Override target destination if sniff'ed protocol is in the given list.
-	// Supported values are "http", "tls".
+	// Supported values are "http", "tls", "fakedns".
 	DestinationOverride []string `protobuf:"bytes,2,rep,name=destination_override,json=destinationOverride,proto3" json:"destination_override,omitempty"`
+	DomainsExcluded     []string `protobuf:"bytes,3,rep,name=domains_excluded,json=domainsExcluded,proto3" json:"domains_excluded,omitempty"`
+	// Whether should only try to sniff metadata without waiting for client input.
+	// Can be used to support SMTP like protocol where server send the first message.
+	MetadataOnly bool `protobuf:"varint,4,opt,name=metadata_only,json=metadataOnly,proto3" json:"metadata_only,omitempty"`
 }
 
 func (x *SniffingConfig) Reset() {
@@ -289,6 +288,20 @@ func (x *SniffingConfig) GetDestinationOverride() []string {
 	return nil
 }
 
+func (x *SniffingConfig) GetDomainsExcluded() []string {
+	if x != nil {
+		return x.DomainsExcluded
+	}
+	return nil
+}
+
+func (x *SniffingConfig) GetMetadataOnly() bool {
+	if x != nil {
+		return x.MetadataOnly
+	}
+	return false
+}
+
 type ReceiverConfig struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache
@@ -756,92 +769,97 @@ var file_app_proxyman_config_proto_rawDesc = []byte{
 	0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x22, 0x2c, 0x0a, 0x04, 0x54, 0x79, 0x70, 0x65, 0x12,
 	0x0a, 0x0a, 0x06, 0x41, 0x6c, 0x77, 0x61, 0x79, 0x73, 0x10, 0x00, 0x12, 0x0a, 0x0a, 0x06, 0x52,
 	0x61, 0x6e, 0x64, 0x6f, 0x6d, 0x10, 0x01, 0x12, 0x0c, 0x0a, 0x08, 0x45, 0x78, 0x74, 0x65, 0x72,
-	0x6e, 0x61, 0x6c, 0x10, 0x02, 0x22, 0x5d, 0x0a, 0x0e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e,
+	0x6e, 0x61, 0x6c, 0x10, 0x02, 0x22, 0xad, 0x01, 0x0a, 0x0e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69,
-	0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c,
+	0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62,
-	0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65,
+	0x6c, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c,
-	0x64, 0x12, 0x31, 0x0a, 0x14, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e,
+	0x65, 0x64, 0x12, 0x31, 0x0a, 0x14, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f,
-	0x5f, 0x6f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09, 0x52,
+	0x6e, 0x5f, 0x6f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09,
-	0x13, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x4f, 0x76, 0x65, 0x72,
+	0x52, 0x13, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x4f, 0x76, 0x65,
-	0x72, 0x69, 0x64, 0x65, 0x22, 0x90, 0x04, 0x0a, 0x0e, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65,
+	0x72, 0x72, 0x69, 0x64, 0x65, 0x12, 0x29, 0x0a, 0x10, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x73,
-	0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x39, 0x0a, 0x0a, 0x70, 0x6f, 0x72, 0x74, 0x5f,
+	0x5f, 0x65, 0x78, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x64, 0x18, 0x03, 0x20, 0x03, 0x28, 0x09, 0x52,
-	0x72, 0x61, 0x6e, 0x67, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x78, 0x72,
+	0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x73, 0x45, 0x78, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x64,
-	0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f,
+	0x12, 0x23, 0x0a, 0x0d, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x6f, 0x6e, 0x6c,
-	0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x52, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e,
+	0x79, 0x18, 0x04, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74,
-	0x67, 0x65, 0x12, 0x33, 0x0a, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x18, 0x02, 0x20, 0x01,
+	0x61, 0x4f, 0x6e, 0x6c, 0x79, 0x22, 0x90, 0x04, 0x0a, 0x0e, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76,
-	0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e,
+	0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x39, 0x0a, 0x0a, 0x70, 0x6f, 0x72, 0x74,
-	0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52,
+	0x5f, 0x72, 0x61, 0x6e, 0x67, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x78,
-	0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x12, 0x56, 0x0a, 0x13, 0x61, 0x6c, 0x6c, 0x6f, 0x63,
+	0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50,
-	0x61, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x03,
+	0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x52, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x52, 0x61,
-	0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e,
+	0x6e, 0x67, 0x65, 0x12, 0x33, 0x0a, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x18, 0x02, 0x20,
-	0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74,
+	0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f,
-	0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x12, 0x61, 0x6c, 0x6c,
+	0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
-	0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12,
+	0x52, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x12, 0x56, 0x0a, 0x13, 0x61, 0x6c, 0x6c, 0x6f,
-	0x4e, 0x0a, 0x0f, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e,
+	0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18,
-	0x67, 0x73, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
+	0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
-	0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e,
+	0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61,
-	0x65, 0x74, 0x2e, 0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52,
+	0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x12, 0x61, 0x6c,
-	0x0e, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12,
+	0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
-	0x40, 0x0a, 0x1c, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x5f, 0x6f, 0x72, 0x69, 0x67, 0x69,
+	0x12, 0x4e, 0x0a, 0x0f, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69,
-	0x6e, 0x61, 0x6c, 0x5f, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18,
+	0x6e, 0x67, 0x73, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79,
-	0x05, 0x20, 0x01, 0x28, 0x08, 0x52, 0x1a, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x4f, 0x72,
+	0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72,
-	0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x44, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f,
+	0x6e, 0x65, 0x74, 0x2e, 0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
-	0x6e, 0x12, 0x4e, 0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6f, 0x76, 0x65, 0x72,
+	0x52, 0x0e, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
-	0x72, 0x69, 0x64, 0x65, 0x18, 0x07, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61,
+	0x12, 0x40, 0x0a, 0x1c, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x5f, 0x6f, 0x72, 0x69, 0x67,
-	0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4b,
+	0x69, 0x6e, 0x61, 0x6c, 0x5f, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e,
-	0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x42, 0x02, 0x18,
+	0x18, 0x05, 0x20, 0x01, 0x28, 0x08, 0x52, 0x1a, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x4f,
-	0x01, 0x52, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64,
+	0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x44, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69,
-	0x65, 0x12, 0x4e, 0x0a, 0x11, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x5f, 0x73, 0x65,
+	0x6f, 0x6e, 0x12, 0x4e, 0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6f, 0x76, 0x65,
-	0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x21, 0x2e, 0x78,
+	0x72, 0x72, 0x69, 0x64, 0x65, 0x18, 0x07, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x21, 0x2e, 0x78, 0x72,
-	0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e,
+	0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e,
-	0x2e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52,
+	0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x42, 0x02,
-	0x10, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67,
+	0x18, 0x01, 0x52, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4f, 0x76, 0x65, 0x72, 0x72, 0x69,
-	0x73, 0x4a, 0x04, 0x08, 0x06, 0x10, 0x07, 0x22, 0xc0, 0x01, 0x0a, 0x14, 0x49, 0x6e, 0x62, 0x6f,
+	0x64, 0x65, 0x12, 0x4e, 0x0a, 0x11, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x5f, 0x73,
-	0x75, 0x6e, 0x64, 0x48, 0x61, 0x6e, 0x64, 0x6c, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
+	0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x21, 0x2e,
-	0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74,
+	0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61,
-	0x61, 0x67, 0x12, 0x4d, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x5f, 0x73,
+	0x6e, 0x2e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
-	0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e,
+	0x52, 0x10, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e,
-	0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69,
+	0x67, 0x73, 0x4a, 0x04, 0x08, 0x06, 0x10, 0x07, 0x22, 0xc0, 0x01, 0x0a, 0x14, 0x49, 0x6e, 0x62,
-	0x61, 0x6c, 0x2e, 0x54, 0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52,
+	0x6f, 0x75, 0x6e, 0x64, 0x48, 0x61, 0x6e, 0x64, 0x6c, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69,
-	0x10, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67,
+	0x67, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03,
-	0x73, 0x12, 0x47, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69,
+	0x74, 0x61, 0x67, 0x12, 0x4d, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x5f,
-	0x6e, 0x67, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79,
+	0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20,
-	0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e, 0x54,
+	0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72,
-	0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0d, 0x70, 0x72, 0x6f,
+	0x69, 0x61, 0x6c, 0x2e, 0x54, 0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65,
-	0x78, 0x79, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x10, 0x0a, 0x0e, 0x4f, 0x75,
+	0x52, 0x10, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e,
-	0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x22, 0xb0, 0x02, 0x0a,
+	0x67, 0x73, 0x12, 0x47, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74,
-	0x0c, 0x53, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x2d, 0x0a,
+	0x69, 0x6e, 0x67, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61,
-	0x03, 0x76, 0x69, 0x61, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61,
+	0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e,
-	0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f,
+	0x54, 0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0d, 0x70, 0x72,
-	0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x03, 0x76, 0x69, 0x61, 0x12, 0x4e, 0x0a, 0x0f,
+	0x6f, 0x78, 0x79, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x10, 0x0a, 0x0e, 0x4f,
-	0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18,
+	0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x22, 0xb0, 0x02,
-	0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61,
+	0x0a, 0x0c, 0x53, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x2d,
+	0x0a, 0x03, 0x76, 0x69, 0x61, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72,
+	0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50,
+	0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x03, 0x76, 0x69, 0x61, 0x12, 0x4e, 0x0a,
+	0x0f, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
+	0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72,
+	0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74,
+	0x2e, 0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73,
+	0x74, 0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x4b, 0x0a,
+	0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18,
+	0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x24, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61,
 	0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e,
-	0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74,
+	0x50, 0x72, 0x6f, 0x78, 0x79, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0d, 0x70, 0x72, 0x6f,
-	0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x4b, 0x0a, 0x0e,
+	0x78, 0x79, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x54, 0x0a, 0x12, 0x6d, 0x75,
-	0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x03,
+	0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
-	0x20, 0x01, 0x28, 0x0b, 0x32, 0x24, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e,
+	0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
-	0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x50,
+	0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4d, 0x75, 0x6c, 0x74, 0x69,
-	0x72, 0x6f, 0x78, 0x79, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78,
+	0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x11, 0x6d,
-	0x79, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x54, 0x0a, 0x12, 0x6d, 0x75, 0x6c,
+	0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
-	0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18,
+	0x22, 0x50, 0x0a, 0x12, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67,
-	0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
+	0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65,
-	0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70,
+	0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64,
-	0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x11, 0x6d, 0x75,
+	0x12, 0x20, 0x0a, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x18,
-	0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22,
+	0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e,
-	0x50, 0x0a, 0x12, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43,
+	0x63, 0x79, 0x2a, 0x23, 0x0a, 0x0e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f,
-	0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64,
+	0x63, 0x6f, 0x6c, 0x73, 0x12, 0x08, 0x0a, 0x04, 0x48, 0x54, 0x54, 0x50, 0x10, 0x00, 0x12, 0x07,
-	0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x12,
+	0x0a, 0x03, 0x54, 0x4c, 0x53, 0x10, 0x01, 0x42, 0x55, 0x0a, 0x15, 0x63, 0x6f, 0x6d, 0x2e, 0x78,
-	0x20, 0x0a, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x18, 0x02,
+	0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e,
-	0x20, 0x01, 0x28, 0x0d, 0x52, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63,
+	0x50, 0x01, 0x5a, 0x26, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78,
-	0x79, 0x2a, 0x23, 0x0a, 0x0e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63,
+	0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70,
-	0x6f, 0x6c, 0x73, 0x12, 0x08, 0x0a, 0x04, 0x48, 0x54, 0x54, 0x50, 0x10, 0x00, 0x12, 0x07, 0x0a,
+	0x70, 0x2f, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0xaa, 0x02, 0x11, 0x58, 0x72, 0x61,
-	0x03, 0x54, 0x4c, 0x53, 0x10, 0x01, 0x42, 0x55, 0x0a, 0x15, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72,
+	0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x62, 0x06,
-	0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x50,
+	0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
-	0x01, 0x5a, 0x26, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74,
-	0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70,
-	0x2f, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0xaa, 0x02, 0x11, 0x58, 0x72, 0x61, 0x79,
-	0x2e, 0x41, 0x70, 0x70, 0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x62, 0x06, 0x70,
-	0x72, 0x6f, 0x74, 0x6f, 0x33,
 }
 
 var (

app/proxyman/config.proto

@@ -54,8 +54,13 @@ message SniffingConfig {
   bool enabled = 1;
 
   // Override target destination if sniff'ed protocol is in the given list.
-  // Supported values are "http", "tls".
+  // Supported values are "http", "tls", "fakedns".
   repeated string destination_override = 2;
+  repeated string domains_excluded = 3;
+  
+  // Whether should only try to sniff metadata without waiting for client input.
+  // Can be used to support SMTP like protocol where server send the first message.
+  bool metadata_only = 4;
 }
 
 message ReceiverConfig {

app/proxyman/inbound/always.go

@@ -133,9 +133,11 @@ func NewAlwaysOnInboundHandler(ctx context.Context, tag string, receiverConfig *
 					address:         address,
 					port:            net.Port(port),
 					dispatcher:      h.mux,
+					sniffingConfig:  receiverConfig.GetEffectiveSniffingSettings(),
 					uplinkCounter:   uplinkCounter,
 					downlinkCounter: downlinkCounter,
 					stream:          mss,
+					ctx:             ctx,
 				}
 				h.workers = append(h.workers, worker)
 			}

app/proxyman/inbound/dynamic.go

@@ -153,9 +153,11 @@ func (h *DynamicInboundHandler) refresh() error {
 				address:         address,
 				port:            port,
 				dispatcher:      h.mux,
+				sniffingConfig:  h.receiverConfig.GetEffectiveSniffingSettings(),
 				uplinkCounter:   uplinkCounter,
 				downlinkCounter: downlinkCounter,
 				stream:          h.streamSettings,
+				ctx:             h.ctx,
 			}
 			if err := worker.Start(); err != nil {
 				newError("failed to create UDP worker").Base(err).AtWarning().WriteToLog()

app/proxyman/inbound/inbound.go

@@ -42,6 +42,9 @@ func (m *Manager) AddHandler(ctx context.Context, handler inbound.Handler) error
 
 	tag := handler.Tag()
 	if len(tag) > 0 {
+		if _, found := m.taggedHandlers[tag]; found {
+			return newError("existing tag found: " + tag)
+		}
 		m.taggedHandlers[tag] = handler
 	} else {
 		m.untaggedHandler = append(m.untaggedHandler, handler)

app/proxyman/inbound/worker.go

@@ -6,6 +6,8 @@ import (
 	"sync/atomic"
 	"time"
 
+	"github.com/xtls/xray-core/transport/internet/stat"
+
 	"github.com/xtls/xray-core/app/proxyman"
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/buf"
@@ -54,7 +56,7 @@ func getTProxyType(s *internet.MemoryStreamConfig) internet.SocketConfig_TProxyM
 	return s.SocketSettings.Tproxy
 }
 
-func (w *tcpWorker) callback(conn internet.Connection) {
+func (w *tcpWorker) callback(conn stat.Connection) {
 	ctx, cancel := context.WithCancel(w.ctx)
 	sid := session.NewID()
 	ctx = session.ContextWithID(ctx, sid)
@@ -80,7 +82,7 @@ func (w *tcpWorker) callback(conn internet.Connection) {
 	}
 
 	if w.uplinkCounter != nil || w.downlinkCounter != nil {
-		conn = &internet.StatCouterConnection{
+		conn = &stat.CounterConnection{
 			Connection:   conn,
 			ReadCounter:  w.uplinkCounter,
 			WriteCounter: w.downlinkCounter,
@@ -97,6 +99,8 @@ func (w *tcpWorker) callback(conn internet.Connection) {
 	if w.sniffingConfig != nil {
 		content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
 		content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
+		content.SniffingRequest.ExcludeForDomain = w.sniffingConfig.DomainsExcluded
+		content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
 	}
 	ctx = session.ContextWithContent(ctx, content)
 
@@ -115,7 +119,7 @@ func (w *tcpWorker) Proxy() proxy.Inbound {
 
 func (w *tcpWorker) Start() error {
 	ctx := context.Background()
-	hub, err := internet.ListenTCP(ctx, w.address, w.port, w.stream, func(conn internet.Connection) {
+	hub, err := internet.ListenTCP(ctx, w.address, w.port, w.stream, func(conn stat.Connection) {
 		go w.callback(conn)
 	})
 	if err != nil {
@@ -234,11 +238,15 @@ type udpWorker struct {
 	tag             string
 	stream          *internet.MemoryStreamConfig
 	dispatcher      routing.Dispatcher
+	sniffingConfig  *proxyman.SniffingConfig
 	uplinkCounter   stats.Counter
 	downlinkCounter stats.Counter
 
 	checker    *task.Periodic
 	activeConn map[connID]*udpConn
+
+	ctx  context.Context
+	cone bool
 }
 
 func (w *udpWorker) getConnection(id connID) (*udpConn, bool) {
@@ -279,8 +287,11 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
 		src: source,
 	}
 	if originalDest.IsValid() {
+		if !w.cone {
 			id.dest = originalDest
 		}
+		b.UDP = &originalDest
+	}
 	conn, existing := w.getConnection(id)
 
 	// payload will be discarded in pipe is full.
@@ -290,7 +301,7 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
 		common.Must(w.checker.Start())
 
 		go func() {
-			ctx := context.Background()
+			ctx := w.ctx
 			sid := session.NewID()
 			ctx = session.ContextWithID(ctx, sid)
 
@@ -304,6 +315,13 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
 				Gateway: net.UDPDestination(w.address, w.port),
 				Tag:     w.tag,
 			})
+			content := new(session.Content)
+			if w.sniffingConfig != nil {
+				content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
+				content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
+				content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
+			}
+			ctx = session.ContextWithContent(ctx, content)
 			if err := w.proxy.Process(ctx, net.Network_UDP, conn, w.dispatcher); err != nil {
 				newError("connection ends").Base(err).WriteToLog(session.ExportIDToError(ctx))
 			}
@@ -336,7 +354,7 @@ func (w *udpWorker) clean() error {
 	}
 
 	for addr, conn := range w.activeConn {
-		if nowSec-atomic.LoadInt64(&conn.lastActivityTime) > 8 { // TODO Timeout too small
+		if nowSec-atomic.LoadInt64(&conn.lastActivityTime) > 300 {
 			delete(w.activeConn, addr)
 			conn.Close()
 		}
@@ -357,8 +375,10 @@ func (w *udpWorker) Start() error {
 		return err
 	}
 
+	w.cone = w.ctx.Value("cone").(bool)
+
 	w.checker = &task.Periodic{
-		Interval: time.Second * 16,
+		Interval: time.Minute,
 		Execute:  w.clean,
 	}
 
@@ -418,13 +438,13 @@ type dsWorker struct {
 	ctx context.Context
 }
 
-func (w *dsWorker) callback(conn internet.Connection) {
+func (w *dsWorker) callback(conn stat.Connection) {
 	ctx, cancel := context.WithCancel(w.ctx)
 	sid := session.NewID()
 	ctx = session.ContextWithID(ctx, sid)
 
 	if w.uplinkCounter != nil || w.downlinkCounter != nil {
-		conn = &internet.StatCouterConnection{
+		conn = &stat.CounterConnection{
 			Connection:   conn,
 			ReadCounter:  w.uplinkCounter,
 			WriteCounter: w.downlinkCounter,
@@ -441,6 +461,8 @@ func (w *dsWorker) callback(conn internet.Connection) {
 	if w.sniffingConfig != nil {
 		content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
 		content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
+		content.SniffingRequest.ExcludeForDomain = w.sniffingConfig.DomainsExcluded
+		content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
 	}
 	ctx = session.ContextWithContent(ctx, content)
 
@@ -462,7 +484,7 @@ func (w *dsWorker) Port() net.Port {
 }
 func (w *dsWorker) Start() error {
 	ctx := context.Background()
-	hub, err := internet.ListenUnix(ctx, w.address, w.stream, func(conn internet.Connection) {
+	hub, err := internet.ListenUnix(ctx, w.address, w.stream, func(conn stat.Connection) {
 		go w.callback(conn)
 	})
 	if err != nil {

app/proxyman/outbound/handler.go

@@ -3,10 +3,13 @@ package outbound
 import (
 	"context"
 
+	"github.com/xtls/xray-core/transport/internet/stat"
+
 	"github.com/xtls/xray-core/app/proxyman"
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/mux"
 	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/net/cnc"
 	"github.com/xtls/xray-core/common/session"
 	"github.com/xtls/xray-core/core"
 	"github.com/xtls/xray-core/features/outbound"
@@ -157,7 +160,7 @@ func (h *Handler) Address() net.Address {
 }
 
 // Dial implements internet.Dialer.
-func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Connection, error) {
+func (h *Handler) Dial(ctx context.Context, dest net.Destination) (stat.Connection, error) {
 	if h.senderSettings != nil {
 		if h.senderSettings.ProxySettings.HasTag() {
 			tag := h.senderSettings.ProxySettings.Tag
@@ -173,7 +176,7 @@ func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Conn
 				downlinkReader, downlinkWriter := pipe.New(opts...)
 
 				go handler.Dispatch(ctx, &transport.Link{Reader: uplinkReader, Writer: downlinkWriter})
-				conn := net.NewConnection(net.ConnectionInputMulti(uplinkWriter), net.ConnectionOutputMulti(downlinkReader))
+				conn := cnc.NewConnection(cnc.ConnectionInputMulti(uplinkWriter), cnc.ConnectionOutputMulti(downlinkReader))
 
 				if config := tls.ConfigFromStreamSettings(h.streamSettings); config != nil {
 					tlsConfig := config.GetTLSConfig(tls.WithDestination(dest))
@@ -200,9 +203,9 @@ func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Conn
 	return h.getStatCouterConnection(conn), err
 }
 
-func (h *Handler) getStatCouterConnection(conn internet.Connection) internet.Connection {
+func (h *Handler) getStatCouterConnection(conn stat.Connection) stat.Connection {
 	if h.uplinkCounter != nil || h.downlinkCounter != nil {
-		return &internet.StatCouterConnection{
+		return &stat.CounterConnection{
 			Connection:   conn,
 			ReadCounter:  h.downlinkCounter,
 			WriteCounter: h.uplinkCounter,

app/proxyman/outbound/handler_test.go

@@ -4,6 +4,8 @@ import (
 	"context"
 	"testing"
 
+	"github.com/xtls/xray-core/transport/internet/stat"
+
 	"github.com/xtls/xray-core/app/policy"
 	. "github.com/xtls/xray-core/app/proxyman/outbound"
 	"github.com/xtls/xray-core/app/stats"
@@ -12,7 +14,6 @@ import (
 	core "github.com/xtls/xray-core/core"
 	"github.com/xtls/xray-core/features/outbound"
 	"github.com/xtls/xray-core/proxy/freedom"
-	"github.com/xtls/xray-core/transport/internet"
 )
 
 func TestInterfaces(t *testing.T) {
@@ -44,9 +45,9 @@ func TestOutboundWithoutStatCounter(t *testing.T) {
 		ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
 	})
 	conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
-	_, ok := conn.(*internet.StatCouterConnection)
+	_, ok := conn.(*stat.CounterConnection)
 	if ok {
-		t.Errorf("Expected conn to not be StatCouterConnection")
+		t.Errorf("Expected conn to not be CounterConnection")
 	}
 }
 
@@ -73,8 +74,8 @@ func TestOutboundWithStatCounter(t *testing.T) {
 		ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
 	})
 	conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
-	_, ok := conn.(*internet.StatCouterConnection)
+	_, ok := conn.(*stat.CounterConnection)
 	if !ok {
-		t.Errorf("Expected conn to be StatCouterConnection")
+		t.Errorf("Expected conn to be CounterConnection")
 	}
 }

app/proxyman/outbound/outbound.go

@@ -109,6 +109,9 @@ func (m *Manager) AddHandler(ctx context.Context, handler outbound.Handler) erro
 
 	tag := handler.Tag()
 	if len(tag) > 0 {
+		if _, found := m.taggedHandler[tag]; found {
+			return newError("existing tag found: " + tag)
+		}
 		m.taggedHandler[tag] = handler
 	} else {
 		m.untaggedHandlers = append(m.untaggedHandlers, handler)

app/reverse/bridge.go

@@ -5,6 +5,7 @@ import (
 	"time"
 
 	"github.com/golang/protobuf/proto"
+
 	"github.com/xtls/xray-core/common/mux"
 	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/common/session"

app/reverse/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/reverse/config.proto
 
 package reverse
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type Control_State int32
 
 const (

app/reverse/portal.go

@@ -6,6 +6,7 @@ import (
 	"time"
 
 	"github.com/golang/protobuf/proto"
+
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/buf"
 	"github.com/xtls/xray-core/common/mux"
@@ -157,6 +158,9 @@ func (p *StaticMuxPicker) PickAvailable() (*mux.ClientWorker, error) {
 		if w.draining {
 			continue
 		}
+		if w.client.Closed() {
+			continue
+		}
 		if w.client.ActiveConnections() < minConn {
 			minConn = w.client.ActiveConnections()
 			minIdx = i

app/router/command/command.go

@@ -85,7 +85,7 @@ func (s *service) Register(server *grpc.Server) {
 		RegisterRoutingServiceServer(server, rs)
 
 		// For compatibility purposes
-		vCoreDesc := _RoutingService_serviceDesc
+		vCoreDesc := RoutingService_ServiceDesc
 		vCoreDesc.ServiceName = "v2ray.core.app.router.command.RoutingService"
 		server.RegisterService(&vCoreDesc, rs)
 	}))

app/router/command/command.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/router/command/command.proto
 
 package command
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	net "github.com/xtls/xray-core/common/net"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
@@ -22,10 +21,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 // RoutingContext is the context with information relative to routing process.
 // It conforms to the structure of xray.features.routing.Context and
 // xray.features.routing.Route.
@@ -91,7 +86,7 @@ func (x *RoutingContext) GetNetwork() net.Network {
 	if x != nil {
 		return x.Network
 	}
-	return net.Network_Unknown
+	return net.Network(0)
 }
 
 func (x *RoutingContext) GetSourceIPs() [][]byte {

app/router/command/command_grpc.pb.go

@@ -11,6 +11,7 @@ import (
 
 // This is a compile-time assertion to ensure that this generated file
 // is compatible with the grpc package it is being compiled against.
+// Requires gRPC-Go v1.32.0 or later.
 const _ = grpc.SupportPackageIsVersion7
 
 // RoutingServiceClient is the client API for RoutingService service.
@@ -30,7 +31,7 @@ func NewRoutingServiceClient(cc grpc.ClientConnInterface) RoutingServiceClient {
 }
 
 func (c *routingServiceClient) SubscribeRoutingStats(ctx context.Context, in *SubscribeRoutingStatsRequest, opts ...grpc.CallOption) (RoutingService_SubscribeRoutingStatsClient, error) {
-	stream, err := c.cc.NewStream(ctx, &_RoutingService_serviceDesc.Streams[0], "/xray.app.router.command.RoutingService/SubscribeRoutingStats", opts...)
+	stream, err := c.cc.NewStream(ctx, &RoutingService_ServiceDesc.Streams[0], "/xray.app.router.command.RoutingService/SubscribeRoutingStats", opts...)
 	if err != nil {
 		return nil, err
 	}
@@ -99,7 +100,7 @@ type UnsafeRoutingServiceServer interface {
 }
 
 func RegisterRoutingServiceServer(s grpc.ServiceRegistrar, srv RoutingServiceServer) {
-	s.RegisterService(&_RoutingService_serviceDesc, srv)
+	s.RegisterService(&RoutingService_ServiceDesc, srv)
 }
 
 func _RoutingService_SubscribeRoutingStats_Handler(srv interface{}, stream grpc.ServerStream) error {
@@ -141,7 +142,10 @@ func _RoutingService_TestRoute_Handler(srv interface{}, ctx context.Context, dec
 	return interceptor(ctx, in, info, handler)
 }
 
-var _RoutingService_serviceDesc = grpc.ServiceDesc{
+// RoutingService_ServiceDesc is the grpc.ServiceDesc for RoutingService service.
+// It's only intended for direct use with grpc.RegisterService,
+// and not to be introspected or modified (even as a copy)
+var RoutingService_ServiceDesc = grpc.ServiceDesc{
 	ServiceName: "xray.app.router.command.RoutingService",
 	HandlerType: (*RoutingServiceServer)(nil),
 	Methods: []grpc.MethodDesc{

app/router/command/command_test.go

@@ -8,6 +8,9 @@ import (
 	"github.com/golang/mock/gomock"
 	"github.com/google/go-cmp/cmp"
 	"github.com/google/go-cmp/cmp/cmpopts"
+	"google.golang.org/grpc"
+	"google.golang.org/grpc/test/bufconn"
+
 	"github.com/xtls/xray-core/app/router"
 	. "github.com/xtls/xray-core/app/router/command"
 	"github.com/xtls/xray-core/app/stats"
@@ -15,8 +18,6 @@ import (
 	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/features/routing"
 	"github.com/xtls/xray-core/testing/mocks"
-	"google.golang.org/grpc"
-	"google.golang.org/grpc/test/bufconn"
 )
 
 func TestServiceSubscribeRoutingStats(t *testing.T) {

app/router/condition.go

@@ -66,6 +66,24 @@ type DomainMatcher struct {
 	matchers strmatcher.IndexMatcher
 }
 
+func NewMphMatcherGroup(domains []*Domain) (*DomainMatcher, error) {
+	g := strmatcher.NewMphMatcherGroup()
+	for _, d := range domains {
+		matcherType, f := matcherTypeMap[d.Type]
+		if !f {
+			return nil, newError("unsupported domain type", d.Type)
+		}
+		_, err := g.AddPattern(d.Value, matcherType)
+		if err != nil {
+			return nil, err
+		}
+	}
+	g.Build()
+	return &DomainMatcher{
+		matchers: g,
+	}, nil
+}
+
 func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
 	g := new(strmatcher.MatcherGroup)
 	for _, d := range domains {
@@ -82,7 +100,7 @@ func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
 }
 
 func (m *DomainMatcher) ApplyDomain(domain string) bool {
-	return len(m.matchers.Match(domain)) > 0
+	return len(m.matchers.Match(strings.ToLower(domain))) > 0
 }
 
 // Apply implements Condition.

app/router/condition_geoip_test.go

@@ -6,6 +6,7 @@ import (
 	"testing"
 
 	"github.com/golang/protobuf/proto"
+
 	"github.com/xtls/xray-core/app/router"
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/net"
@@ -18,10 +19,10 @@ func init() {
 	common.Must(err)
 
 	if _, err := os.Stat(platform.GetAssetLocation("geoip.dat")); err != nil && os.IsNotExist(err) {
-		common.Must(filesystem.CopyFile(platform.GetAssetLocation("geoip.dat"), filepath.Join(wd, "..", "..", "release", "config", "geoip.dat")))
+		common.Must(filesystem.CopyFile(platform.GetAssetLocation("geoip.dat"), filepath.Join(wd, "..", "..", "resources", "geoip.dat")))
 	}
 	if _, err := os.Stat(platform.GetAssetLocation("geosite.dat")); err != nil && os.IsNotExist(err) {
-		common.Must(filesystem.CopyFile(platform.GetAssetLocation("geosite.dat"), filepath.Join(wd, "..", "..", "release", "config", "geosite.dat")))
+		common.Must(filesystem.CopyFile(platform.GetAssetLocation("geosite.dat"), filepath.Join(wd, "..", "..", "resources", "geosite.dat")))
 	}
 }
 

app/router/condition_test.go

@@ -359,6 +359,9 @@ func TestChinaSites(t *testing.T) {
 	matcher, err := NewDomainMatcher(domains)
 	common.Must(err)
 
+	acMatcher, err := NewMphMatcherGroup(domains)
+	common.Must(err)
+
 	type TestCase struct {
 		Domain string
 		Output bool
@@ -387,9 +390,96 @@ func TestChinaSites(t *testing.T) {
 	}
 
 	for _, testCase := range testCases {
-		r := matcher.ApplyDomain(testCase.Domain)
+		r1 := matcher.ApplyDomain(testCase.Domain)
-		if r != testCase.Output {
+		r2 := acMatcher.ApplyDomain(testCase.Domain)
-			t.Error("expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r)
+		if r1 != testCase.Output {
+			t.Error("DomainMatcher expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r1)
+		} else if r2 != testCase.Output {
+			t.Error("ACDomainMatcher expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r2)
+		}
+	}
+}
+
+func BenchmarkMphDomainMatcher(b *testing.B) {
+	domains, err := loadGeoSite("CN")
+	common.Must(err)
+
+	matcher, err := NewMphMatcherGroup(domains)
+	common.Must(err)
+
+	type TestCase struct {
+		Domain string
+		Output bool
+	}
+	testCases := []TestCase{
+		{
+			Domain: "163.com",
+			Output: true,
+		},
+		{
+			Domain: "163.com",
+			Output: true,
+		},
+		{
+			Domain: "164.com",
+			Output: false,
+		},
+		{
+			Domain: "164.com",
+			Output: false,
+		},
+	}
+
+	for i := 0; i < 1024; i++ {
+		testCases = append(testCases, TestCase{Domain: strconv.Itoa(i) + ".not-exists.com", Output: false})
+	}
+
+	b.ResetTimer()
+	for i := 0; i < b.N; i++ {
+		for _, testCase := range testCases {
+			_ = matcher.ApplyDomain(testCase.Domain)
+		}
+	}
+}
+
+func BenchmarkDomainMatcher(b *testing.B) {
+	domains, err := loadGeoSite("CN")
+	common.Must(err)
+
+	matcher, err := NewDomainMatcher(domains)
+	common.Must(err)
+
+	type TestCase struct {
+		Domain string
+		Output bool
+	}
+	testCases := []TestCase{
+		{
+			Domain: "163.com",
+			Output: true,
+		},
+		{
+			Domain: "163.com",
+			Output: true,
+		},
+		{
+			Domain: "164.com",
+			Output: false,
+		},
+		{
+			Domain: "164.com",
+			Output: false,
+		},
+	}
+
+	for i := 0; i < 1024; i++ {
+		testCases = append(testCases, TestCase{Domain: strconv.Itoa(i) + ".not-exists.com", Output: false})
+	}
+
+	b.ResetTimer()
+	for i := 0; i < b.N; i++ {
+		for _, testCase := range testCases {
+			_ = matcher.ApplyDomain(testCase.Domain)
 		}
 	}
 }

app/router/config.go

@@ -67,11 +67,24 @@ func (rr *RoutingRule) BuildCondition() (Condition, error) {
 	conds := NewConditionChan()
 
 	if len(rr.Domain) > 0 {
+		switch rr.DomainMatcher {
+		case "linear":
 			matcher, err := NewDomainMatcher(rr.Domain)
 			if err != nil {
 				return nil, newError("failed to build domain condition").Base(err)
 			}
 			conds.Add(matcher)
+		case "mph", "hybrid":
+			fallthrough
+		default:
+			matcher, err := NewMphMatcherGroup(rr.Domain)
+			if err != nil {
+				return nil, newError("failed to build domain condition with MphDomainMatcher").Base(err)
+			}
+			newError("MphDomainMatcher is enabled for ", len(rr.Domain), " domain rule(s)").AtDebug().WriteToLog()
+			conds.Add(matcher)
+		}
+
 	}
 
 	if len(rr.UserEmail) > 0 {

app/router/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/router/config.proto
 
 package router
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	net "github.com/xtls/xray-core/common/net"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
@@ -22,10 +21,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 // Type of domain value.
 type Domain_Type int32
 
@@ -515,6 +510,7 @@ type RoutingRule struct {
 	InboundTag     []string      `protobuf:"bytes,8,rep,name=inbound_tag,json=inboundTag,proto3" json:"inbound_tag,omitempty"`
 	Protocol       []string      `protobuf:"bytes,9,rep,name=protocol,proto3" json:"protocol,omitempty"`
 	Attributes     string        `protobuf:"bytes,15,opt,name=attributes,proto3" json:"attributes,omitempty"`
+	DomainMatcher  string        `protobuf:"bytes,17,opt,name=domain_matcher,json=domainMatcher,proto3" json:"domain_matcher,omitempty"`
 }
 
 func (x *RoutingRule) Reset() {
@@ -672,6 +668,13 @@ func (x *RoutingRule) GetAttributes() string {
 	return ""
 }
 
+func (x *RoutingRule) GetDomainMatcher() string {
+	if x != nil {
+		return x.DomainMatcher
+	}
+	return ""
+}
+
 type isRoutingRule_TargetTag interface {
 	isRoutingRule_TargetTag()
 }
@@ -946,7 +949,7 @@ var file_app_router_config_proto_rawDesc = []byte{
 	0x74, 0x12, 0x2e, 0x0a, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b,
 	0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
 	0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x52, 0x05, 0x65, 0x6e, 0x74, 0x72,
-	0x79, 0x22, 0x8e, 0x06, 0x0a, 0x0b, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
+	0x79, 0x22, 0xb5, 0x06, 0x0a, 0x0b, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
 	0x65, 0x12, 0x12, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00,
 	0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x25, 0x0a, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69,
 	0x6e, 0x67, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x0c, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00, 0x52, 0x0c,
@@ -994,36 +997,38 @@ var file_app_router_config_proto_rawDesc = []byte{
 	0x6f, 0x63, 0x6f, 0x6c, 0x18, 0x09, 0x20, 0x03, 0x28, 0x09, 0x52, 0x08, 0x70, 0x72, 0x6f, 0x74,
 	0x6f, 0x63, 0x6f, 0x6c, 0x12, 0x1e, 0x0a, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62, 0x75, 0x74,
 	0x65, 0x73, 0x18, 0x0f, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62,
-	0x75, 0x74, 0x65, 0x73, 0x42, 0x0c, 0x0a, 0x0a, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74,
+	0x75, 0x74, 0x65, 0x73, 0x12, 0x25, 0x0a, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6d,
-	0x61, 0x67, 0x22, 0x4e, 0x0a, 0x0d, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52,
+	0x61, 0x74, 0x63, 0x68, 0x65, 0x72, 0x18, 0x11, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x64, 0x6f,
-	0x75, 0x6c, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09,
+	0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x65, 0x72, 0x42, 0x0c, 0x0a, 0x0a, 0x74,
-	0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x2b, 0x0a, 0x11, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e,
+	0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74, 0x61, 0x67, 0x22, 0x4e, 0x0a, 0x0d, 0x42, 0x61, 0x6c,
-	0x64, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09,
+	0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61,
-	0x52, 0x10, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74,
+	0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x2b, 0x0a, 0x11,
-	0x6f, 0x72, 0x22, 0x9b, 0x02, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x4f, 0x0a,
+	0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f,
-	0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
+	0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09, 0x52, 0x10, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e,
-	0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x26, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
+	0x64, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x22, 0x9b, 0x02, 0x0a, 0x06, 0x43, 0x6f,
-	0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e,
+	0x6e, 0x66, 0x69, 0x67, 0x12, 0x4f, 0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x73,
-	0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0e,
+	0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x26, 0x2e,
-	0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x30,
+	0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e,
-	0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78,
+	0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72,
-	0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x52,
+	0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72,
-	0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x04, 0x72, 0x75, 0x6c, 0x65,
+	0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x30, 0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x02, 0x20,
-	0x12, 0x45, 0x0a, 0x0e, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x5f, 0x72, 0x75,
+	0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72,
-	0x6c, 0x65, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1e, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
+	0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
-	0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e,
+	0x65, 0x52, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x12, 0x45, 0x0a, 0x0e, 0x62, 0x61, 0x6c, 0x61, 0x6e,
-	0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63,
+	0x63, 0x69, 0x6e, 0x67, 0x5f, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32,
-	0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x22, 0x47, 0x0a, 0x0e, 0x44, 0x6f, 0x6d, 0x61, 0x69,
+	0x1e, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65,
-	0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x08, 0x0a, 0x04, 0x41, 0x73, 0x49,
+	0x72, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52,
-	0x73, 0x10, 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55, 0x73, 0x65, 0x49, 0x70, 0x10, 0x01, 0x12, 0x10,
+	0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x22, 0x47,
-	0x0a, 0x0c, 0x49, 0x70, 0x49, 0x66, 0x4e, 0x6f, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x10, 0x02,
+	0x0a, 0x0e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
-	0x12, 0x0e, 0x0a, 0x0a, 0x49, 0x70, 0x4f, 0x6e, 0x44, 0x65, 0x6d, 0x61, 0x6e, 0x64, 0x10, 0x03,
+	0x12, 0x08, 0x0a, 0x04, 0x41, 0x73, 0x49, 0x73, 0x10, 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55, 0x73,
-	0x42, 0x4f, 0x0a, 0x13, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
+	0x65, 0x49, 0x70, 0x10, 0x01, 0x12, 0x10, 0x0a, 0x0c, 0x49, 0x70, 0x49, 0x66, 0x4e, 0x6f, 0x6e,
-	0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x50, 0x01, 0x5a, 0x24, 0x67, 0x69, 0x74, 0x68, 0x75,
+	0x4d, 0x61, 0x74, 0x63, 0x68, 0x10, 0x02, 0x12, 0x0e, 0x0a, 0x0a, 0x49, 0x70, 0x4f, 0x6e, 0x44,
-	0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d,
+	0x65, 0x6d, 0x61, 0x6e, 0x64, 0x10, 0x03, 0x42, 0x4f, 0x0a, 0x13, 0x63, 0x6f, 0x6d, 0x2e, 0x78,
-	0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0xaa,
+	0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x50, 0x01,
-	0x02, 0x0f, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x65,
+	0x5a, 0x24, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c,
-	0x72, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
+	0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f,
+	0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0xaa, 0x02, 0x0f, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70,
+	0x70, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
 }
 
 var (

app/router/config.proto

@@ -119,6 +119,8 @@ message RoutingRule {
   repeated string protocol = 9;
 
   string attributes = 15;
+
+  string domain_matcher = 17;
 }
 
 message BalancingRule {

app/router/router_test.go

@@ -5,10 +5,12 @@ import (
 	"testing"
 
 	"github.com/golang/mock/gomock"
+
 	. "github.com/xtls/xray-core/app/router"
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/features/dns"
 	"github.com/xtls/xray-core/features/outbound"
 	routing_session "github.com/xtls/xray-core/features/routing/session"
 	"github.com/xtls/xray-core/testing/mocks"
@@ -115,7 +117,11 @@ func TestIPOnDemand(t *testing.T) {
 	defer mockCtl.Finish()
 
 	mockDNS := mocks.NewDNSClient(mockCtl)
-	mockDNS.EXPECT().LookupIP(gomock.Eq("example.com")).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
+	mockDNS.EXPECT().LookupIP(gomock.Eq("example.com"), dns.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+		FakeEnable: false,
+	}).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
 
 	r := new(Router)
 	common.Must(r.Init(config, mockDNS, nil))
@@ -150,7 +156,11 @@ func TestIPIfNonMatchDomain(t *testing.T) {
 	defer mockCtl.Finish()
 
 	mockDNS := mocks.NewDNSClient(mockCtl)
-	mockDNS.EXPECT().LookupIP(gomock.Eq("example.com")).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
+	mockDNS.EXPECT().LookupIP(gomock.Eq("example.com"), dns.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+		FakeEnable: false,
+	}).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
 
 	r := new(Router)
 	common.Must(r.Init(config, mockDNS, nil))

app/stats/command/command.go

@@ -113,7 +113,7 @@ func (s *service) Register(server *grpc.Server) {
 	RegisterStatsServiceServer(server, ss)
 
 	// For compatibility purposes
-	vCoreDesc := _StatsService_serviceDesc
+	vCoreDesc := StatsService_ServiceDesc
 	vCoreDesc.ServiceName = "v2ray.core.app.stats.command.StatsService"
 	server.RegisterService(&vCoreDesc, ss)
 }

app/stats/command/command.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/stats/command/command.proto
 
 package command
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type GetStatsRequest struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache

app/stats/command/command_grpc.pb.go

@@ -11,6 +11,7 @@ import (
 
 // This is a compile-time assertion to ensure that this generated file
 // is compatible with the grpc package it is being compiled against.
+// Requires gRPC-Go v1.32.0 or later.
 const _ = grpc.SupportPackageIsVersion7
 
 // StatsServiceClient is the client API for StatsService service.
@@ -90,7 +91,7 @@ type UnsafeStatsServiceServer interface {
 }
 
 func RegisterStatsServiceServer(s grpc.ServiceRegistrar, srv StatsServiceServer) {
-	s.RegisterService(&_StatsService_serviceDesc, srv)
+	s.RegisterService(&StatsService_ServiceDesc, srv)
 }
 
 func _StatsService_GetStats_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
@@ -147,7 +148,10 @@ func _StatsService_GetSysStats_Handler(srv interface{}, ctx context.Context, dec
 	return interceptor(ctx, in, info, handler)
 }
 
-var _StatsService_serviceDesc = grpc.ServiceDesc{
+// StatsService_ServiceDesc is the grpc.ServiceDesc for StatsService service.
+// It's only intended for direct use with grpc.RegisterService,
+// and not to be introspected or modified (even as a copy)
+var StatsService_ServiceDesc = grpc.ServiceDesc{
 	ServiceName: "xray.app.stats.command.StatsService",
 	HandlerType: (*StatsServiceServer)(nil),
 	Methods: []grpc.MethodDesc{

app/stats/config.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: app/stats/config.proto
 
 package stats
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type Config struct {
 	state         protoimpl.MessageState
 	sizeCache     protoimpl.SizeCache

common/buf/buffer.go

@@ -4,6 +4,7 @@ import (
 	"io"
 
 	"github.com/xtls/xray-core/common/bytespool"
+	"github.com/xtls/xray-core/common/net"
 )
 
 const (
@@ -20,20 +21,51 @@ type Buffer struct {
 	v     []byte
 	start int32
 	end   int32
+	UDP   *net.Destination
 }
 
-// New creates a Buffer with 0 length and 2K capacity.
+// New creates a Buffer with 0 length and 8K capacity.
 func New() *Buffer {
+	buf := pool.Get().([]byte)
+	if cap(buf) >= Size {
+		buf = buf[:Size]
+	} else {
+		buf = make([]byte, Size)
+	}
+
 	return &Buffer{
-		v: pool.Get().([]byte),
+		v: buf,
+	}
+}
+
+func NewExisted(b []byte) *Buffer {
+	if cap(b) < Size {
+		panic("Invalid buffer")
+	}
+
+	oLen := len(b)
+	if oLen < Size {
+		b = b[:Size]
+	}
+
+	return &Buffer{
+		v:   b,
+		end: int32(oLen),
 	}
 }
 
 // StackNew creates a new Buffer object on stack.
 // This method is for buffers that is released in the same function.
 func StackNew() Buffer {
+	buf := pool.Get().([]byte)
+	if cap(buf) >= Size {
+		buf = buf[:Size]
+	} else {
+		buf = make([]byte, Size)
+	}
+
 	return Buffer{
-		v: pool.Get().([]byte),
+		v: buf,
 	}
 }
 
@@ -46,7 +78,11 @@ func (b *Buffer) Release() {
 	p := b.v
 	b.v = nil
 	b.Clear()
+
+	if cap(p) == Size {
 		pool.Put(p)
+	}
+	b.UDP = nil
 }
 
 // Clear clears the content of the buffer, results an empty buffer with
@@ -107,6 +143,9 @@ func (b *Buffer) BytesTo(to int32) []byte {
 	if to < 0 {
 		to += b.Len()
 	}
+	if to < 0 {
+		to = 0
+	}
 	return b.v[b.start : b.start+to]
 }
 

common/buf/buffer_test.go

@@ -6,6 +6,7 @@ import (
 	"testing"
 
 	"github.com/google/go-cmp/cmp"
+
 	"github.com/xtls/xray-core/common"
 	. "github.com/xtls/xray-core/common/buf"
 )

common/buf/io.go

@@ -6,6 +6,9 @@ import (
 	"os"
 	"syscall"
 	"time"
+
+	"github.com/xtls/xray-core/features/stats"
+	"github.com/xtls/xray-core/transport/internet/stat"
 )
 
 // Reader extends io.Reader with MultiBuffer.
@@ -29,9 +32,17 @@ type Writer interface {
 }
 
 // WriteAllBytes ensures all bytes are written into the given writer.
-func WriteAllBytes(writer io.Writer, payload []byte) error {
+func WriteAllBytes(writer io.Writer, payload []byte, c stats.Counter) error {
+	wc := 0
+	defer func() {
+		if c != nil {
+			c.Add(int64(wc))
+		}
+	}()
+
 	for len(payload) > 0 {
 		n, err := writer.Write(payload)
+		wc += n
 		if err != nil {
 			return err
 		}
@@ -65,7 +76,13 @@ func NewReader(reader io.Reader) Reader {
 			if err != nil {
 				newError("failed to get sysconn").Base(err).WriteToLog()
 			} else {
-				return NewReadVReader(reader, rawConn)
+				var counter stats.Counter
+
+				if statConn, ok := reader.(*stat.CounterConnection); ok {
+					reader = statConn.Connection
+					counter = statConn.ReadCounter
+				}
+				return NewReadVReader(reader, rawConn, counter)
 			}
 		}
 	}
@@ -104,13 +121,24 @@ func NewWriter(writer io.Writer) Writer {
 		return mw
 	}
 
-	if isPacketWriter(writer) {
+	var iConn = writer
+	if statConn, ok := writer.(*stat.CounterConnection); ok {
+		iConn = statConn.Connection
+	}
+
+	if isPacketWriter(iConn) {
 		return &SequentialWriter{
 			Writer: writer,
 		}
 	}
 
+	var counter stats.Counter
+
+	if statConn, ok := writer.(*stat.CounterConnection); ok {
+		counter = statConn.WriteCounter
+	}
 	return &BufferToBytesWriter{
-		Writer: writer,
+		Writer:  iConn,
+		counter: counter,
 	}
 }

common/buf/multi_buffer_test.go

@@ -9,6 +9,7 @@ import (
 	"testing"
 
 	"github.com/google/go-cmp/cmp"
+
 	"github.com/xtls/xray-core/common"
 	. "github.com/xtls/xray-core/common/buf"
 )

common/buf/readv_posix.go

@@ -1,6 +1,5 @@
-// +build !windows
+//go:build !windows && !wasm && !illumos
-// +build !wasm
+// +build !windows,!wasm,!illumos
-// +build !illumos
 
 package buf
 

common/buf/readv_reader.go

@@ -1,12 +1,14 @@
+//go:build !wasm
 // +build !wasm
 
 package buf
 
 import (
 	"io"
-	"runtime"
 	"syscall"
 
+	"github.com/xtls/xray-core/features/stats"
+
 	"github.com/xtls/xray-core/common/platform"
 )
 
@@ -54,10 +56,11 @@ type ReadVReader struct {
 	rawConn syscall.RawConn
 	mr      multiReader
 	alloc   allocStrategy
+	counter stats.Counter
 }
 
 // NewReadVReader creates a new ReadVReader.
-func NewReadVReader(reader io.Reader, rawConn syscall.RawConn) *ReadVReader {
+func NewReadVReader(reader io.Reader, rawConn syscall.RawConn, counter stats.Counter) *ReadVReader {
 	return &ReadVReader{
 		Reader:  reader,
 		rawConn: rawConn,
@@ -65,6 +68,7 @@ func NewReadVReader(reader io.Reader, rawConn syscall.RawConn) *ReadVReader {
 			current: 1,
 		},
 		mr:      newMultiReader(),
+		counter: counter,
 	}
 }
 
@@ -123,10 +127,16 @@ func (r *ReadVReader) ReadMultiBuffer() (MultiBuffer, error) {
 		if b.IsFull() {
 			r.alloc.Adjust(1)
 		}
+		if r.counter != nil && b != nil {
+			r.counter.Add(int64(b.Len()))
+		}
 		return MultiBuffer{b}, err
 	}
 
 	mb, err := r.readMulti()
+	if r.counter != nil && mb != nil {
+		r.counter.Add(int64(mb.Len()))
+	}
 	if err != nil {
 		return nil, err
 	}
@@ -134,17 +144,13 @@ func (r *ReadVReader) ReadMultiBuffer() (MultiBuffer, error) {
 	return mb, nil
 }
 
-var useReadv = true
+var useReadv bool
 
 func init() {
 	const defaultFlagValue = "NOT_DEFINED_AT_ALL"
 	value := platform.NewEnvFlag("xray.buf.readv").GetValue(func() string { return defaultFlagValue })
 	switch value {
-	case defaultFlagValue, "auto":
+	case defaultFlagValue, "auto", "enable":
-		if (runtime.GOARCH == "386" || runtime.GOARCH == "amd64" || runtime.GOARCH == "s390x") && (runtime.GOOS == "linux" || runtime.GOOS == "darwin" || runtime.GOOS == "windows") {
-			useReadv = true
-		}
-	case "enable":
 		useReadv = true
 	}
 }

common/buf/readv_reader_wasm.go

@@ -1,3 +1,4 @@
+//go:build wasm
 // +build wasm
 
 package buf

common/buf/readv_test.go

@@ -1,3 +1,4 @@
+//go:build !wasm
 // +build !wasm
 
 package buf_test
@@ -9,10 +10,11 @@ import (
 
 	"github.com/google/go-cmp/cmp"
 
+	"golang.org/x/sync/errgroup"
+
 	"github.com/xtls/xray-core/common"
 	. "github.com/xtls/xray-core/common/buf"
 	"github.com/xtls/xray-core/testing/servers/tcp"
-	"golang.org/x/sync/errgroup"
 )
 
 func TestReadvReader(t *testing.T) {
@@ -50,7 +52,7 @@ func TestReadvReader(t *testing.T) {
 	rawConn, err := conn.(*net.TCPConn).SyscallConn()
 	common.Must(err)
 
-	reader := NewReadVReader(conn, rawConn)
+	reader := NewReadVReader(conn, rawConn, nil)
 	var rmb MultiBuffer
 	for {
 		mb, err := reader.ReadMultiBuffer()

common/buf/readv_unix.go

@@ -1,3 +1,4 @@
+//go:build illumos
 // +build illumos
 
 package buf

common/buf/writer.go

@@ -5,6 +5,8 @@ import (
 	"net"
 	"sync"
 
+	"github.com/xtls/xray-core/features/stats"
+
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/errors"
 )
@@ -13,6 +15,7 @@ import (
 type BufferToBytesWriter struct {
 	io.Writer
 
+	counter stats.Counter
 	cache   [][]byte
 }
 
@@ -26,7 +29,7 @@ func (w *BufferToBytesWriter) WriteMultiBuffer(mb MultiBuffer) error {
 	}
 
 	if len(mb) == 1 {
-		return WriteAllBytes(w.Writer, mb[0].Bytes())
+		return WriteAllBytes(w.Writer, mb[0].Bytes(), w.counter)
 	}
 
 	if cap(w.cache) < len(mb) {
@@ -45,9 +48,15 @@ func (w *BufferToBytesWriter) WriteMultiBuffer(mb MultiBuffer) error {
 	}()
 
 	nb := net.Buffers(bs)
-
+	wc := int64(0)
+	defer func() {
+		if w.counter != nil {
+			w.counter.Add(wc)
+		}
+	}()
 	for size > 0 {
 		n, err := nb.WriteTo(w.Writer)
+		wc += n
 		if err != nil {
 			return err
 		}
@@ -173,7 +182,7 @@ func (w *BufferedWriter) flushInternal() error {
 	w.buffer = nil
 
 	if writer, ok := w.writer.(io.Writer); ok {
-		err := WriteAllBytes(writer, b.Bytes())
+		err := WriteAllBytes(writer, b.Bytes(), nil)
 		b.Release()
 		return err
 	}

common/cache/lru.go

@@ -0,0 +1,85 @@
+package cache
+
+import (
+	"container/list"
+	sync "sync"
+)
+
+// Lru simple, fast lru cache implementation
+type Lru interface {
+	Get(key interface{}) (value interface{}, ok bool)
+	GetKeyFromValue(value interface{}) (key interface{}, ok bool)
+	PeekKeyFromValue(value interface{}) (key interface{}, ok bool) // Peek means check but NOT bring to top
+	Put(key, value interface{})
+}
+
+type lru struct {
+	capacity         int
+	doubleLinkedlist *list.List
+	keyToElement     *sync.Map
+	valueToElement   *sync.Map
+	mu               *sync.Mutex
+}
+
+type lruElement struct {
+	key   interface{}
+	value interface{}
+}
+
+// NewLru init a lru cache
+func NewLru(cap int) Lru {
+	return lru{
+		capacity:         cap,
+		doubleLinkedlist: list.New(),
+		keyToElement:     new(sync.Map),
+		valueToElement:   new(sync.Map),
+		mu:               new(sync.Mutex),
+	}
+}
+
+func (l lru) Get(key interface{}) (value interface{}, ok bool) {
+	if v, ok := l.keyToElement.Load(key); ok {
+		element := v.(*list.Element)
+		l.doubleLinkedlist.MoveBefore(element, l.doubleLinkedlist.Front())
+		return element.Value.(lruElement).value, true
+	}
+	return nil, false
+}
+
+func (l lru) GetKeyFromValue(value interface{}) (key interface{}, ok bool) {
+	if k, ok := l.valueToElement.Load(value); ok {
+		element := k.(*list.Element)
+		l.doubleLinkedlist.MoveBefore(element, l.doubleLinkedlist.Front())
+		return element.Value.(lruElement).key, true
+	}
+	return nil, false
+}
+
+func (l lru) PeekKeyFromValue(value interface{}) (key interface{}, ok bool) {
+	if k, ok := l.valueToElement.Load(value); ok {
+		element := k.(*list.Element)
+		return element.Value.(lruElement).key, true
+	}
+	return nil, false
+}
+
+func (l lru) Put(key, value interface{}) {
+	e := lruElement{key, value}
+	if v, ok := l.keyToElement.Load(key); ok {
+		element := v.(*list.Element)
+		element.Value = e
+		l.doubleLinkedlist.MoveBefore(element, l.doubleLinkedlist.Front())
+	} else {
+		l.mu.Lock()
+		element := l.doubleLinkedlist.PushFront(e)
+		l.keyToElement.Store(key, element)
+		l.valueToElement.Store(value, element)
+		if l.doubleLinkedlist.Len() > l.capacity {
+			toBeRemove := l.doubleLinkedlist.Back()
+			l.doubleLinkedlist.Remove(toBeRemove)
+			l.keyToElement.Delete(toBeRemove.Value.(lruElement).key)
+			l.valueToElement.Delete(toBeRemove.Value.(lruElement).value)
+		}
+		l.mu.Unlock()
+	}
+}

common/cache/lru_test.go

@@ -0,0 +1,86 @@
+package cache_test
+
+import (
+	"testing"
+
+	. "github.com/xtls/xray-core/common/cache"
+)
+
+func TestLruReplaceValue(t *testing.T) {
+	lru := NewLru(2)
+	lru.Put(2, 6)
+	lru.Put(1, 5)
+	lru.Put(1, 2)
+	v, _ := lru.Get(1)
+	if v != 2 {
+		t.Error("should get 2", v)
+	}
+	v, _ = lru.Get(2)
+	if v != 6 {
+		t.Error("should get 6", v)
+	}
+}
+
+func TestLruRemoveOld(t *testing.T) {
+	lru := NewLru(2)
+	v, ok := lru.Get(2)
+	if ok {
+		t.Error("should get nil", v)
+	}
+	lru.Put(1, 1)
+	lru.Put(2, 2)
+	v, _ = lru.Get(1)
+	if v != 1 {
+		t.Error("should get 1", v)
+	}
+	lru.Put(3, 3)
+	v, ok = lru.Get(2)
+	if ok {
+		t.Error("should get nil", v)
+	}
+	lru.Put(4, 4)
+	v, ok = lru.Get(1)
+	if ok {
+		t.Error("should get nil", v)
+	}
+	v, _ = lru.Get(3)
+	if v != 3 {
+		t.Error("should get 3", v)
+	}
+	v, _ = lru.Get(4)
+	if v != 4 {
+		t.Error("should get 4", v)
+	}
+}
+
+func TestGetKeyFromValue(t *testing.T) {
+	lru := NewLru(2)
+	lru.Put(3, 3)
+	lru.Put(2, 2)
+	lru.GetKeyFromValue(3)
+	lru.Put(1, 1)
+	v, ok := lru.GetKeyFromValue(2)
+	if ok {
+		t.Error("should get nil", v)
+	}
+	v, _ = lru.GetKeyFromValue(3)
+	if v != 3 {
+		t.Error("should get 3", v)
+	}
+}
+
+func TestPeekKeyFromValue(t *testing.T) {
+	lru := NewLru(2)
+	lru.Put(3, 3)
+	lru.Put(2, 2)
+	lru.PeekKeyFromValue(3)
+	lru.Put(1, 1)
+	v, ok := lru.PeekKeyFromValue(3)
+	if ok {
+		t.Error("should get nil", v)
+	}
+	v, _ = lru.PeekKeyFromValue(2)
+	if v != 2 {
+		t.Error("should get 2", v)
+	}
+}

common/crypto/internal/chacha_core_gen.go

@@ -1,3 +1,4 @@
+//go:build generate
 // +build generate
 
 package main

common/crypto/io.go

@@ -50,7 +50,7 @@ func NewCryptionWriter(stream cipher.Stream, writer io.Writer) *CryptionWriter {
 func (w *CryptionWriter) Write(data []byte) (int, error) {
 	w.stream.XORKeyStream(data, data)
 
-	if err := buf.WriteAllBytes(w.writer, data); err != nil {
+	if err := buf.WriteAllBytes(w.writer, data, nil); err != nil {
 		return 0, err
 	}
 	return len(data), nil

common/errors/errorgen/main.go

@@ -2,11 +2,8 @@ package main
 
 import (
 	"fmt"
-	"log"
 	"os"
 	"path/filepath"
-
-	"github.com/xtls/xray-core/common"
 )
 
 func main() {
@@ -20,26 +17,21 @@ func main() {
 		pkg = "core"
 	}
 
-	moduleName, gmnErr := common.GetModuleName(pwd)
-	if gmnErr != nil {
-		fmt.Println("can not get module path", gmnErr)
-		os.Exit(1)
-	}
-
 	file, err := os.OpenFile("errors.generated.go", os.O_WRONLY|os.O_TRUNC|os.O_CREATE, 0644)
 	if err != nil {
-		log.Fatalf("Failed to generate errors.generated.go: %v", err)
+		fmt.Printf("Failed to generate errors.generated.go: %v", err)
 		os.Exit(1)
 	}
 	defer file.Close()
 
-	fmt.Fprintln(file, "package", pkg)
+	fmt.Fprintf(file, `package %s
-	fmt.Fprintln(file, "")
+
-	fmt.Fprintln(file, "import \""+moduleName+"/common/errors\"")
+import "github.com/xtls/xray-core/common/errors"
-	fmt.Fprintln(file, "")
+
-	fmt.Fprintln(file, "type errPathObjHolder struct{}")
+type errPathObjHolder struct{}
-	fmt.Fprintln(file, "")
+
-	fmt.Fprintln(file, "func newError(values ...interface{}) *errors.Error {")
+func newError(values ...interface{}) *errors.Error {
-	fmt.Fprintln(file, "	return errors.New(values...).WithPathObj(errPathObjHolder{})")
+	return errors.New(values...).WithPathObj(errPathObjHolder{})
-	fmt.Fprintln(file, "}")
+}
+`, pkg)
 }

common/errors/errors.go

@@ -40,11 +40,9 @@ func (err *Error) pkgPath() string {
 		return ""
 	}
 	path := reflect.TypeOf(err.pathObj).PkgPath()
-	for i := 0; i < len(path); i++ {
+	if len(path) >= trim {
-		if path[i] == '/' {
 		return path[trim:]
 	}
-	}
 	return path
 }
 

common/log/access.go

@@ -36,19 +36,23 @@ func (m *AccessMessage) String() string {
 	builder.WriteString(string(m.Status))
 	builder.WriteByte(' ')
 	builder.WriteString(serial.ToString(m.To))
-	builder.WriteByte(' ')
+
 	if len(m.Detour) > 0 {
-		builder.WriteByte('[')
+		builder.WriteString(" [")
 		builder.WriteString(m.Detour)
-		builder.WriteString("] ")
+		builder.WriteByte(']')
+	}
+
+	if reason := serial.ToString(m.Reason); len(reason) > 0 {
+		builder.WriteString(" ")
+		builder.WriteString(reason)
 	}
-	builder.WriteString(serial.ToString(m.Reason))
 
 	if len(m.Email) > 0 {
-		builder.WriteString("email:")
+		builder.WriteString(" email: ")
 		builder.WriteString(m.Email)
-		builder.WriteByte(' ')
 	}
+
 	return builder.String()
 }
 

common/log/dns.go

@@ -0,0 +1,59 @@
+package log
+
+import (
+	"net"
+	"strings"
+	"time"
+)
+
+type DNSLog struct {
+	Server  string
+	Domain  string
+	Result  []net.IP
+	Status  dnsStatus
+	Elapsed time.Duration
+	Error   error
+}
+
+func (l *DNSLog) String() string {
+	builder := &strings.Builder{}
+
+	// Server got answer: domain -> [ip1, ip2] 23ms
+	builder.WriteString(l.Server)
+	builder.WriteString(" ")
+	builder.WriteString(string(l.Status))
+	builder.WriteString(" ")
+	builder.WriteString(l.Domain)
+	builder.WriteString(" -> [")
+	builder.WriteString(joinNetIP(l.Result))
+	builder.WriteString("]")
+
+	if l.Elapsed > 0 {
+		builder.WriteString(" ")
+		builder.WriteString(l.Elapsed.String())
+	}
+	if l.Error != nil {
+		builder.WriteString(" <")
+		builder.WriteString(l.Error.Error())
+		builder.WriteString(">")
+	}
+	return builder.String()
+}
+
+type dnsStatus string
+
+var (
+	DNSQueried  = dnsStatus("got answer:")
+	DNSCacheHit = dnsStatus("cache HIT:")
+)
+
+func joinNetIP(ips []net.IP) string {
+	if len(ips) == 0 {
+		return ""
+	}
+	sips := make([]string, 0, len(ips))
+	for _, ip := range ips {
+		sips = append(sips, ip.String())
+	}
+	return strings.Join(sips, ", ")
+}

common/log/log.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: common/log/log.proto
 
 package log
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type Severity int32
 
 const (

common/mux/client.go

@@ -330,7 +330,7 @@ func (m *ClientWorker) handleStatusKeep(meta *FrameMetadata, reader *buf.Buffere
 		return buf.Copy(NewStreamReader(reader), buf.Discard)
 	}
 
-	rr := s.NewReader(reader)
+	rr := s.NewReader(reader, &meta.Target)
 	err := buf.Copy(rr, s.output)
 	if err != nil && buf.IsWriteError(err) {
 		newError("failed to write to downstream. closing session ", s.ID).Base(err).WriteToLog()

common/mux/client_test.go

@@ -6,6 +6,7 @@ import (
 	"time"
 
 	"github.com/golang/mock/gomock"
+
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/errors"
 	"github.com/xtls/xray-core/common/mux"

common/mux/frame.go

@@ -81,6 +81,9 @@ func (f FrameMetadata) WriteTo(b *buf.Buffer) error {
 		if err := addrParser.WriteAddressPort(b, f.Target.Address, f.Target.Port); err != nil {
 			return err
 		}
+	} else if b.UDP != nil {
+		b.WriteByte(byte(TargetNetworkUDP))
+		addrParser.WriteAddressPort(b, b.UDP.Address, b.UDP.Port)
 	}
 
 	len1 := b.Len()
@@ -119,7 +122,7 @@ func (f *FrameMetadata) UnmarshalFromBuffer(b *buf.Buffer) error {
 	f.Option = bitmask.Byte(b.Byte(3))
 	f.Target.Network = net.Network_Unknown
 
-	if f.SessionStatus == SessionStatusNew {
+	if f.SessionStatus == SessionStatusNew || (f.SessionStatus == SessionStatusKeep && b.Len() != 4) {
 		if b.Len() < 8 {
 			return newError("insufficient buffer: ", b.Len())
 		}

common/mux/reader.go

@@ -5,6 +5,7 @@ import (
 
 	"github.com/xtls/xray-core/common/buf"
 	"github.com/xtls/xray-core/common/crypto"
+	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/common/serial"
 )
 
@@ -12,13 +13,15 @@ import (
 type PacketReader struct {
 	reader io.Reader
 	eof    bool
+	dest   *net.Destination
 }
 
 // NewPacketReader creates a new PacketReader.
-func NewPacketReader(reader io.Reader) *PacketReader {
+func NewPacketReader(reader io.Reader, dest *net.Destination) *PacketReader {
 	return &PacketReader{
 		reader: reader,
 		eof:    false,
+		dest:   dest,
 	}
 }
 
@@ -43,6 +46,9 @@ func (r *PacketReader) ReadMultiBuffer() (buf.MultiBuffer, error) {
 		return nil, err
 	}
 	r.eof = true
+	if r.dest != nil && r.dest.Network == net.Network_UDP {
+		b.UDP = r.dest
+	}
 	return buf.MultiBuffer{b}, nil
 }
 

common/mux/server.go

@@ -145,7 +145,7 @@ func (w *ServerWorker) handleStatusNew(ctx context.Context, meta *FrameMetadata,
 		return nil
 	}
 
-	rr := s.NewReader(reader)
+	rr := s.NewReader(reader, &meta.Target)
 	if err := buf.Copy(rr, s.output); err != nil {
 		buf.Copy(rr, buf.Discard)
 		common.Interrupt(s.input)
@@ -168,7 +168,7 @@ func (w *ServerWorker) handleStatusKeep(meta *FrameMetadata, reader *buf.Buffere
 		return buf.Copy(NewStreamReader(reader), buf.Discard)
 	}
 
-	rr := s.NewReader(reader)
+	rr := s.NewReader(reader, &meta.Target)
 	err := buf.Copy(rr, s.output)
 
 	if err != nil && buf.IsWriteError(err) {

common/mux/session.go

@@ -5,6 +5,7 @@ import (
 
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/buf"
+	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/common/protocol"
 )
 
@@ -152,9 +153,9 @@ func (s *Session) Close() error {
 }
 
 // NewReader creates a buf.Reader based on the transfer type of this Session.
-func (s *Session) NewReader(reader *buf.BufferedReader) buf.Reader {
+func (s *Session) NewReader(reader *buf.BufferedReader, dest *net.Destination) buf.Reader {
 	if s.transferType == protocol.TransferTypeStream {
 		return NewStreamReader(reader)
 	}
-	return NewPacketReader(reader)
+	return NewPacketReader(reader, dest)
 }

common/mux/writer.go

@@ -63,6 +63,9 @@ func (w *Writer) writeMetaOnly() error {
 
 func writeMetaWithFrame(writer buf.Writer, meta FrameMetadata, data buf.MultiBuffer) error {
 	frame := buf.New()
+	if len(data) == 1 {
+		frame.UDP = data[0].UDP
+	}
 	if err := meta.WriteTo(frame); err != nil {
 		return err
 	}

common/net/address.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: common/net/address.proto
 
 package net
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 // Address of a network host. It may be either an IP address or a domain
 // address.
 type IPOrDomain struct {

common/net/cnc/connection.go

@@ -1,12 +1,12 @@
-package net
+package cnc
 
 import (
 	"io"
-	"net"
 	"time"
 
 	"github.com/xtls/xray-core/common"
 	"github.com/xtls/xray-core/common/buf"
+	"github.com/xtls/xray-core/common/net"
 	"github.com/xtls/xray-core/common/signal/done"
 )
 
@@ -88,8 +88,8 @@ type connection struct {
 	writer  buf.Writer
 	done    *done.Instance
 	onClose io.Closer
-	local   Addr
+	local   net.Addr
-	remote  Addr
+	remote  net.Addr
 }
 
 func (c *connection) Read(b []byte) (int, error) {

common/net/destination.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: common/net/destination.proto
 
 package net
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 // Endpoint of a network connection.
 type Endpoint struct {
 	state         protoimpl.MessageState

common/net/network.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: common/net/network.proto
 
 package net
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 type Network int32
 
 const (

common/net/port.pb.go

@@ -1,13 +1,12 @@
 // Code generated by protoc-gen-go. DO NOT EDIT.
 // versions:
-// 	protoc-gen-go v1.25.0
+// 	protoc-gen-go v1.27.1
-// 	protoc        v3.14.0
+// 	protoc        v3.18.0
 // source: common/net/port.proto
 
 package net
 
 import (
-	proto "github.com/golang/protobuf/proto"
 	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
 	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
 	reflect "reflect"
@@ -21,10 +20,6 @@ const (
 	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
 )
 
-// This is a compile-time assertion that a sufficiently up-to-date version
-// of the legacy proto package is being used.
-const _ = proto.ProtoPackageIsVersion4
-
 // PortRange represents a range of ports.
 type PortRange struct {
 	state         protoimpl.MessageState

common/ocsp/errors.generated.go

@@ -1,4 +1,4 @@
-package jsonem
+package ocsp
 
 import "github.com/xtls/xray-core/common/errors"